- Name
- Methyl acetoacetate
- InChI
- InChI=1S/C5H8O3/c1-4(6)3-5(7)8-2/h3H2,1-2H3
- InChI Key
- WRQNANDWMGAFTP-UHFFFAOYSA-N
- Formula
- C5H8O3
- SMILES
- COC(=O)CC(C)=O
- Mol. Weight (g/mol)
- 116.12
- CAS
- 105-45-3
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- ρl - Mass density, kg/m3 (4)
- csound,fluid - Speed of Sound, m/s (4)
- γ - Surface tension liquid-gas, N/m (2)
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Methyl acetoacetate (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0809 | 1000.362 |
| 288.15 | 0.1654 | 1001.65 |
| 288.15 | 0.2850 | 1003.438 |
| 288.15 | 0.3860 | 1004.9 |
| 288.15 | 0.4607 | 1005.978 |
| 288.15 | 0.5604 | 1007.367 |
| 288.15 | 0.6367 | 1008.404 |
| 288.15 | 0.7871 | 1010.4 |
| 288.15 | 0.8429 | 1011.132 |
| 293.15 | 0.0809 | 999.43 |
| 293.15 | 0.1654 | 1000.66 |
| 293.15 | 0.2850 | 1002.36 |
| 293.15 | 0.3860 | 1003.749 |
| 293.15 | 0.4607 | 1004.75 |
| 293.15 | 0.5604 | 1006.06 |
| 293.15 | 0.6367 | 1007.01 |
| 293.15 | 0.7871 | 1008.9 |
| 293.15 | 0.8429 | 1009.58 |
| 298.15 | 0.0809 | 998.205 |
| 298.15 | 0.1654 | 999.37 |
| 298.15 | 0.2850 | 1001.0 |
| 298.15 | 0.3860 | 1002.33 |
| 298.15 | 0.4607 | 1003.3 |
| 298.15 | 0.5604 | 1004.56 |
| 298.15 | 0.6367 | 1005.532 |
| 298.15 | 0.7871 | 1007.35 |
| 298.15 | 0.8429 | 1008.0 |
| 303.15 | 0.0809 | 996.78 |
| 303.15 | 0.1654 | 997.9 |
| 303.15 | 0.2850 | 999.454 |
| 303.15 | 0.3860 | 1000.73 |
| 303.15 | 0.4607 | 1001.65 |
| 303.15 | 0.5604 | 1002.85 |
| 303.15 | 0.6367 | 1003.74 |
| 303.15 | 0.7871 | 1005.47 |
| 303.15 | 0.8429 | 1006.11 |
| 308.15 | 0.0809 | 995.12 |
| 308.15 | 0.1654 | 996.2 |
| 308.15 | 0.2850 | 997.68 |
| 308.15 | 0.3860 | 998.91 |
| 308.15 | 0.4607 | 999.79 |
| 308.15 | 0.5604 | 1000.938 |
| 308.15 | 0.6367 | 1001.795 |
| 308.15 | 0.7871 | 1003.453 |
| 308.15 | 0.8429 | 1004.037 |
| 288.15 | 0.0000 | 999.113 |
| 293.15 | 0.0000 | 998.227 |
| 298.15 | 0.0000 | 997.072 |
| 303.15 | 0.0000 | 995.677 |
| 308.15 | 0.0000 | 994.062 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Methyl acetoacetate (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0809 | 1000.362 |
| 288.15 | 0.1654 | 1001.65 |
| 288.15 | 0.2850 | 1003.438 |
| 288.15 | 0.3860 | 1004.9 |
| 288.15 | 0.4607 | 1005.978 |
| 288.15 | 0.5604 | 1007.367 |
| 288.15 | 0.6367 | 1008.404 |
| 288.15 | 0.7871 | 1010.4 |
| 288.15 | 0.8429 | 1011.132 |
| 293.15 | 0.0809 | 999.43 |
| 293.15 | 0.1654 | 1000.66 |
| 293.15 | 0.2850 | 1002.36 |
| 293.15 | 0.3860 | 1003.749 |
| 293.15 | 0.4607 | 1004.75 |
| 293.15 | 0.5604 | 1006.06 |
| 293.15 | 0.6367 | 1007.01 |
| 293.15 | 0.7871 | 1008.9 |
| 293.15 | 0.8429 | 1009.58 |
| 298.15 | 0.0809 | 998.205 |
| 298.15 | 0.1654 | 999.37 |
| 298.15 | 0.2850 | 1001.0 |
| 298.15 | 0.3860 | 1002.33 |
| 298.15 | 0.4607 | 1003.3 |
| 298.15 | 0.5604 | 1004.56 |
| 298.15 | 0.6367 | 1005.532 |
| 298.15 | 0.7871 | 1007.35 |
| 298.15 | 0.8429 | 1008.0 |
| 303.15 | 0.0809 | 996.78 |
| 303.15 | 0.1654 | 997.9 |
| 303.15 | 0.2850 | 999.454 |
| 303.15 | 0.3860 | 1000.73 |
| 303.15 | 0.4607 | 1001.65 |
| 303.15 | 0.5604 | 1002.85 |
| 303.15 | 0.6367 | 1003.74 |
| 303.15 | 0.7871 | 1005.47 |
| 303.15 | 0.8429 | 1006.11 |
| 308.15 | 0.0809 | 995.12 |
| 308.15 | 0.1654 | 996.2 |
| 308.15 | 0.2850 | 997.68 |
| 308.15 | 0.3860 | 998.91 |
| 308.15 | 0.4607 | 999.79 |
| 308.15 | 0.5604 | 1000.938 |
| 308.15 | 0.6367 | 1001.795 |
| 308.15 | 0.7871 | 1003.453 |
| 308.15 | 0.8429 | 1004.037 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Methyl acetoacetate (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0809 | 1000.362 |
| 288.15 | 0.1654 | 1001.65 |
| 288.15 | 0.2850 | 1003.438 |
| 288.15 | 0.3860 | 1004.9 |
| 288.15 | 0.4607 | 1005.978 |
| 288.15 | 0.5604 | 1007.367 |
| 288.15 | 0.6367 | 1008.404 |
| 288.15 | 0.7871 | 1010.4 |
| 288.15 | 0.8429 | 1011.132 |
| 293.15 | 0.0809 | 999.43 |
| 293.15 | 0.1654 | 1000.66 |
| 293.15 | 0.2850 | 1002.36 |
| 293.15 | 0.3860 | 1003.749 |
| 293.15 | 0.4607 | 1004.75 |
| 293.15 | 0.5604 | 1006.06 |
| 293.15 | 0.6367 | 1007.01 |
| 293.15 | 0.7871 | 1008.9 |
| 293.15 | 0.8429 | 1009.58 |
| 298.15 | 0.0809 | 998.205 |
| 298.15 | 0.1654 | 999.37 |
| 298.15 | 0.2850 | 1001.0 |
| 298.15 | 0.3860 | 1002.33 |
| 298.15 | 0.4607 | 1003.3 |
| 298.15 | 0.5604 | 1004.56 |
| 298.15 | 0.6367 | 1005.532 |
| 298.15 | 0.7871 | 1007.35 |
| 298.15 | 0.8429 | 1008.0 |
| 303.15 | 0.0809 | 996.78 |
| 303.15 | 0.1654 | 997.9 |
| 303.15 | 0.2850 | 999.454 |
| 303.15 | 0.3860 | 1000.73 |
| 303.15 | 0.4607 | 1001.65 |
| 303.15 | 0.5604 | 1002.85 |
| 303.15 | 0.6367 | 1003.74 |
| 303.15 | 0.7871 | 1005.47 |
| 303.15 | 0.8429 | 1006.11 |
| 308.15 | 0.0809 | 995.12 |
| 308.15 | 0.1654 | 996.2 |
| 308.15 | 0.2850 | 997.68 |
| 308.15 | 0.3860 | 998.91 |
| 308.15 | 0.4607 | 999.79 |
| 308.15 | 0.5604 | 1000.938 |
| 308.15 | 0.6367 | 1001.795 |
| 308.15 | 0.7871 | 1003.453 |
| 308.15 | 0.8429 | 1004.037 |
| 288.15 | 0.0000 | 999.113 |
| 293.15 | 0.0000 | 998.227 |
| 298.15 | 0.0000 | 997.072 |
| 303.15 | 0.0000 | 995.677 |
| 308.15 | 0.0000 | 994.062 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Methyl acetoacetate (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0809 | 1000.362 |
| 288.15 | 0.1654 | 1001.65 |
| 288.15 | 0.2850 | 1003.438 |
| 288.15 | 0.3860 | 1004.9 |
| 288.15 | 0.4607 | 1005.978 |
| 288.15 | 0.5604 | 1007.367 |
| 288.15 | 0.6367 | 1008.404 |
| 288.15 | 0.7871 | 1010.4 |
| 288.15 | 0.8429 | 1011.132 |
| 293.15 | 0.0809 | 999.43 |
| 293.15 | 0.1654 | 1000.66 |
| 293.15 | 0.2850 | 1002.36 |
| 293.15 | 0.3860 | 1003.749 |
| 293.15 | 0.4607 | 1004.75 |
| 293.15 | 0.5604 | 1006.06 |
| 293.15 | 0.6367 | 1007.01 |
| 293.15 | 0.7871 | 1008.9 |
| 293.15 | 0.8429 | 1009.58 |
| 298.15 | 0.0809 | 998.205 |
| 298.15 | 0.1654 | 999.37 |
| 298.15 | 0.2850 | 1001.0 |
| 298.15 | 0.3860 | 1002.33 |
| 298.15 | 0.4607 | 1003.3 |
| 298.15 | 0.5604 | 1004.56 |
| 298.15 | 0.6367 | 1005.532 |
| 298.15 | 0.7871 | 1007.35 |
| 298.15 | 0.8429 | 1008.0 |
| 303.15 | 0.0809 | 996.78 |
| 303.15 | 0.1654 | 997.9 |
| 303.15 | 0.2850 | 999.454 |
| 303.15 | 0.3860 | 1000.73 |
| 303.15 | 0.4607 | 1001.65 |
| 303.15 | 0.5604 | 1002.85 |
| 303.15 | 0.6367 | 1003.74 |
| 303.15 | 0.7871 | 1005.47 |
| 303.15 | 0.8429 | 1006.11 |
| 308.15 | 0.0809 | 995.12 |
| 308.15 | 0.1654 | 996.2 |
| 308.15 | 0.2850 | 997.68 |
| 308.15 | 0.3860 | 998.91 |
| 308.15 | 0.4607 | 999.79 |
| 308.15 | 0.5604 | 1000.938 |
| 308.15 | 0.6367 | 1001.795 |
| 308.15 | 0.7871 | 1003.453 |
| 308.15 | 0.8429 | 1004.037 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Methyl acetoacetate (1) - Liquid | Speed of sound, m/s - Liquid |
| 288.15 | 0.0809 | 1472.46 |
| 288.15 | 0.1654 | 1477.31 |
| 288.15 | 0.2850 | 1484.66 |
| 288.15 | 0.3860 | 1490.14 |
| 288.15 | 0.4607 | 1494.18 |
| 288.15 | 0.5604 | 1499.61 |
| 288.15 | 0.6367 | 1502.99 |
| 288.15 | 0.7871 | 1509.83 |
| 288.15 | 0.8429 | 1512.22 |
| 293.15 | 0.0809 | 1487.68 |
| 293.15 | 0.1654 | 1491.86 |
| 293.15 | 0.2850 | 1498.34 |
| 293.15 | 0.3860 | 1503.11 |
| 293.15 | 0.4607 | 1506.62 |
| 293.15 | 0.5604 | 1511.38 |
| 293.15 | 0.6367 | 1514.25 |
| 293.15 | 0.7871 | 1520.15 |
| 293.15 | 0.8429 | 1522.2 |
| 298.15 | 0.0809 | 1501.27 |
| 298.15 | 0.1654 | 1504.84 |
| 298.15 | 0.2850 | 1510.5 |
| 298.15 | 0.3860 | 1514.57 |
| 298.15 | 0.4607 | 1517.59 |
| 298.15 | 0.5604 | 1521.72 |
| 298.15 | 0.6367 | 1524.12 |
| 298.15 | 0.7871 | 1529.11 |
| 298.15 | 0.8429 | 1530.86 |
| 303.15 | 0.0809 | 1513.1 |
| 303.15 | 0.1654 | 1516.09 |
| 303.15 | 0.2850 | 1520.98 |
| 303.15 | 0.3860 | 1524.42 |
| 303.15 | 0.4607 | 1526.98 |
| 303.15 | 0.5604 | 1530.54 |
| 303.15 | 0.6367 | 1532.5 |
| 303.15 | 0.7871 | 1536.68 |
| 303.15 | 0.8429 | 1538.12 |
| 308.15 | 0.0809 | 1523.24 |
| 308.15 | 0.1654 | 1525.69 |
| 308.15 | 0.2850 | 1529.88 |
| 308.15 | 0.3860 | 1532.74 |
| 308.15 | 0.4607 | 1534.88 |
| 308.15 | 0.5604 | 1537.9 |
| 308.15 | 0.6367 | 1539.46 |
| 308.15 | 0.7871 | 1542.89 |
| 308.15 | 0.8429 | 1544.04 |
| 288.15 | 0.0000 | 1466.69 |
| 293.15 | 0.0000 | 1482.47 |
| 298.15 | 0.0000 | 1496.62 |
| 303.15 | 0.0000 | 1508.98 |
| 308.15 | 0.0000 | 1519.62 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Methyl acetoacetate (1) - Liquid | Speed of sound, m/s - Liquid |
| 288.15 | 0.0809 | 1472.46 |
| 288.15 | 0.1654 | 1477.31 |
| 288.15 | 0.2850 | 1484.66 |
| 288.15 | 0.3860 | 1490.14 |
| 288.15 | 0.4607 | 1494.18 |
| 288.15 | 0.5604 | 1499.61 |
| 288.15 | 0.6367 | 1502.99 |
| 288.15 | 0.7871 | 1509.83 |
| 288.15 | 0.8429 | 1512.22 |
| 293.15 | 0.0809 | 1487.68 |
| 293.15 | 0.1654 | 1491.86 |
| 293.15 | 0.2850 | 1498.34 |
| 293.15 | 0.3860 | 1503.11 |
| 293.15 | 0.4607 | 1506.62 |
| 293.15 | 0.5604 | 1511.38 |
| 293.15 | 0.6367 | 1514.25 |
| 293.15 | 0.7871 | 1520.15 |
| 293.15 | 0.8429 | 1522.2 |
| 298.15 | 0.0809 | 1501.27 |
| 298.15 | 0.1654 | 1504.84 |
| 298.15 | 0.2850 | 1510.5 |
| 298.15 | 0.3860 | 1514.57 |
| 298.15 | 0.4607 | 1517.59 |
| 298.15 | 0.5604 | 1521.72 |
| 298.15 | 0.6367 | 1524.12 |
| 298.15 | 0.7871 | 1529.11 |
| 298.15 | 0.8429 | 1530.86 |
| 303.15 | 0.0809 | 1513.1 |
| 303.15 | 0.1654 | 1516.09 |
| 303.15 | 0.2850 | 1520.98 |
| 303.15 | 0.3860 | 1524.42 |
| 303.15 | 0.4607 | 1526.98 |
| 303.15 | 0.5604 | 1530.54 |
| 303.15 | 0.6367 | 1532.5 |
| 303.15 | 0.7871 | 1536.68 |
| 303.15 | 0.8429 | 1538.12 |
| 308.15 | 0.0809 | 1523.24 |
| 308.15 | 0.1654 | 1525.69 |
| 308.15 | 0.2850 | 1529.88 |
| 308.15 | 0.3860 | 1532.74 |
| 308.15 | 0.4607 | 1534.88 |
| 308.15 | 0.5604 | 1537.9 |
| 308.15 | 0.6367 | 1539.46 |
| 308.15 | 0.7871 | 1542.89 |
| 308.15 | 0.8429 | 1544.04 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Methyl acetoacetate (1) - Liquid | Speed of sound, m/s - Liquid |
| 288.15 | 0.0809 | 1472.46 |
| 288.15 | 0.1654 | 1477.31 |
| 288.15 | 0.2850 | 1484.66 |
| 288.15 | 0.3860 | 1490.14 |
| 288.15 | 0.4607 | 1494.18 |
| 288.15 | 0.5604 | 1499.61 |
| 288.15 | 0.6367 | 1502.99 |
| 288.15 | 0.7871 | 1509.83 |
| 288.15 | 0.8429 | 1512.22 |
| 293.15 | 0.0809 | 1487.68 |
| 293.15 | 0.1654 | 1491.86 |
| 293.15 | 0.2850 | 1498.34 |
| 293.15 | 0.3860 | 1503.11 |
| 293.15 | 0.4607 | 1506.62 |
| 293.15 | 0.5604 | 1511.38 |
| 293.15 | 0.6367 | 1514.25 |
| 293.15 | 0.7871 | 1520.15 |
| 293.15 | 0.8429 | 1522.2 |
| 298.15 | 0.0809 | 1501.27 |
| 298.15 | 0.1654 | 1504.84 |
| 298.15 | 0.2850 | 1510.5 |
| 298.15 | 0.3860 | 1514.57 |
| 298.15 | 0.4607 | 1517.59 |
| 298.15 | 0.5604 | 1521.72 |
| 298.15 | 0.6367 | 1524.12 |
| 298.15 | 0.7871 | 1529.11 |
| 298.15 | 0.8429 | 1530.86 |
| 303.15 | 0.0809 | 1513.1 |
| 303.15 | 0.1654 | 1516.09 |
| 303.15 | 0.2850 | 1520.98 |
| 303.15 | 0.3860 | 1524.42 |
| 303.15 | 0.4607 | 1526.98 |
| 303.15 | 0.5604 | 1530.54 |
| 303.15 | 0.6367 | 1532.5 |
| 303.15 | 0.7871 | 1536.68 |
| 303.15 | 0.8429 | 1538.12 |
| 308.15 | 0.0809 | 1523.24 |
| 308.15 | 0.1654 | 1525.69 |
| 308.15 | 0.2850 | 1529.88 |
| 308.15 | 0.3860 | 1532.74 |
| 308.15 | 0.4607 | 1534.88 |
| 308.15 | 0.5604 | 1537.9 |
| 308.15 | 0.6367 | 1539.46 |
| 308.15 | 0.7871 | 1542.89 |
| 308.15 | 0.8429 | 1544.04 |
| 288.15 | 0.0000 | 1466.69 |
| 293.15 | 0.0000 | 1482.47 |
| 298.15 | 0.0000 | 1496.62 |
| 303.15 | 0.0000 | 1508.98 |
| 308.15 | 0.0000 | 1519.62 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Methyl acetoacetate (1) - Liquid | Speed of sound, m/s - Liquid |
| 288.15 | 0.0809 | 1472.46 |
| 288.15 | 0.1654 | 1477.31 |
| 288.15 | 0.2850 | 1484.66 |
| 288.15 | 0.3860 | 1490.14 |
| 288.15 | 0.4607 | 1494.18 |
| 288.15 | 0.5604 | 1499.61 |
| 288.15 | 0.6367 | 1502.99 |
| 288.15 | 0.7871 | 1509.83 |
| 288.15 | 0.8429 | 1512.22 |
| 293.15 | 0.0809 | 1487.68 |
| 293.15 | 0.1654 | 1491.86 |
| 293.15 | 0.2850 | 1498.34 |
| 293.15 | 0.3860 | 1503.11 |
| 293.15 | 0.4607 | 1506.62 |
| 293.15 | 0.5604 | 1511.38 |
| 293.15 | 0.6367 | 1514.25 |
| 293.15 | 0.7871 | 1520.15 |
| 293.15 | 0.8429 | 1522.2 |
| 298.15 | 0.0809 | 1501.27 |
| 298.15 | 0.1654 | 1504.84 |
| 298.15 | 0.2850 | 1510.5 |
| 298.15 | 0.3860 | 1514.57 |
| 298.15 | 0.4607 | 1517.59 |
| 298.15 | 0.5604 | 1521.72 |
| 298.15 | 0.6367 | 1524.12 |
| 298.15 | 0.7871 | 1529.11 |
| 298.15 | 0.8429 | 1530.86 |
| 303.15 | 0.0809 | 1513.1 |
| 303.15 | 0.1654 | 1516.09 |
| 303.15 | 0.2850 | 1520.98 |
| 303.15 | 0.3860 | 1524.42 |
| 303.15 | 0.4607 | 1526.98 |
| 303.15 | 0.5604 | 1530.54 |
| 303.15 | 0.6367 | 1532.5 |
| 303.15 | 0.7871 | 1536.68 |
| 303.15 | 0.8429 | 1538.12 |
| 308.15 | 0.0809 | 1523.24 |
| 308.15 | 0.1654 | 1525.69 |
| 308.15 | 0.2850 | 1529.88 |
| 308.15 | 0.3860 | 1532.74 |
| 308.15 | 0.4607 | 1534.88 |
| 308.15 | 0.5604 | 1537.9 |
| 308.15 | 0.6367 | 1539.46 |
| 308.15 | 0.7871 | 1542.89 |
| 308.15 | 0.8429 | 1544.04 |
Surface tension liquid-gas, N/m [ref]
Operational condition: Temperature, K = 298.15 (Liquid)
| Mole fraction of Methyl acetoacetate (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
|---|---|
| 0.0002 | 0.0711 |
| 0.0004 | 0.0704 |
| 0.0006 | 0.0699 |
| 0.0008 | 0.0693 |
| 0.0010 | 0.0686 |
| 0.0018 | 0.0666 |
| 0.0040 | 0.0624 |
| 0.0058 | 0.0602 |
| 0.0081 | 0.0578 |
| 0.0100 | 0.0561 |
| 0.0121 | 0.0545 |
| 0.0140 | 0.0532 |
Surface tension liquid-gas, N/m [ref]
Operational condition: Temperature, K = 298.15 (Liquid)
| Mole fraction of Methyl acetoacetate (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
|---|---|
| 0.0002 | 0.0711 |
| 0.0004 | 0.0704 |
| 0.0006 | 0.0699 |
| 0.0008 | 0.0693 |
| 0.0010 | 0.0686 |
| 0.0018 | 0.0666 |
| 0.0040 | 0.0624 |
| 0.0058 | 0.0602 |
| 0.0081 | 0.0578 |
| 0.0100 | 0.0561 |
| 0.0121 | 0.0545 |
| 0.0140 | 0.0532 |
Sources
- Solute-Solvent Interactions of Alkyl Acetoacetates in Aqueous {1-Butyl-3-Methylimidazolium Bromide [bmim][Br]}Ionic Liquid Solutions in the Temperature Interval (288.15 - 308.15 ) K
- Concentration Dependence of Surface Tension for Very Dilute Aqueous Solutions of Organic Non-Electrolytes
- Solute Solvent Interactions of Alkyl Acetoacetates in Aqueous {1-Butyl-3-methylimidazolium Chloride [bmim][Cl]} Ionic Liquid Solutions in the Temperature Interval (288.15 308.15) K