- Name
- 2-Propanol, 2-methyl-
- InChI
- InChI=1S/C4H10O/c1-4(2,3)5/h5H,1-3H3
- InChI Key
- DKGAVHZHDRPRBM-UHFFFAOYSA-N
- Formula
- C4H10O
- SMILES
- CC(C)(C)O
- Mol. Weight (g/mol)
- 74.12
- CAS
- 75-65-0
- Name
- n-Propyl acetate
- InChI
- InChI=1S/C5H10O2/c1-3-4-7-5(2)6/h3-4H2,1-2H3
- InChI Key
- YKYONYBAUNKHLG-UHFFFAOYSA-N
- Formula
- C5H10O2
- SMILES
- CCCOC(C)=O
- Mol. Weight (g/mol)
- 102.13
- CAS
- 109-60-4
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (2)
- Excess molar enthalpy (molar enthalpy (2)
- Tboil - Boiling temperature at pressure P, K (2)
- Excess molar volume, m3/mol (2)
Mole fraction of n-Propyl acetate (2) [ref]
Operational condition: Pressure, kPa = 101.32 (Liquid)
| Mole fraction of n-Propyl acetate (2) - Liquid | Mole fraction of n-Propyl acetate (2) - Gas |
|---|---|
| 0.0601 | 0.0492 |
| 0.0859 | 0.0695 |
| 0.1183 | 0.0944 |
| 0.1557 | 0.1203 |
| 0.2030 | 0.1529 |
| 0.2424 | 0.1791 |
| 0.2796 | 0.2024 |
| 0.3053 | 0.2189 |
| 0.3494 | 0.2476 |
| 0.3858 | 0.2723 |
| 0.4255 | 0.2997 |
| 0.4488 | 0.3153 |
| 0.4797 | 0.3389 |
| 0.5078 | 0.3602 |
| 0.5474 | 0.3903 |
| 0.5753 | 0.4147 |
| 0.6172 | 0.4524 |
| 0.6493 | 0.4825 |
| 0.6970 | 0.5319 |
| 0.7302 | 0.5687 |
| 0.7591 | 0.6033 |
| 0.7938 | 0.6485 |
| 0.8127 | 0.6741 |
| 0.8153 | 0.6770 |
| 0.8265 | 0.6927 |
| 0.8721 | 0.7625 |
| 0.8971 | 0.8032 |
| 0.9127 | 0.8307 |
| 0.9375 | 0.8748 |
| 0.9623 | 0.9222 |
| 0.9806 | 0.9592 |
Mole fraction of n-Propyl acetate (2) [ref]
Operational condition: Pressure, kPa = 101.32 (Liquid)
| Mole fraction of n-Propyl acetate (2) - Liquid | Mole fraction of n-Propyl acetate (2) - Gas |
|---|---|
| 0.0601 | 0.0492 |
| 0.0859 | 0.0695 |
| 0.1183 | 0.0944 |
| 0.1557 | 0.1203 |
| 0.2030 | 0.1529 |
| 0.2424 | 0.1791 |
| 0.2796 | 0.2024 |
| 0.3053 | 0.2189 |
| 0.3494 | 0.2476 |
| 0.3858 | 0.2723 |
| 0.4255 | 0.2997 |
| 0.4488 | 0.3153 |
| 0.4797 | 0.3389 |
| 0.5078 | 0.3602 |
| 0.5474 | 0.3903 |
| 0.5753 | 0.4147 |
| 0.6172 | 0.4524 |
| 0.6493 | 0.4825 |
| 0.6970 | 0.5319 |
| 0.7302 | 0.5687 |
| 0.7591 | 0.6033 |
| 0.7938 | 0.6485 |
| 0.8127 | 0.6741 |
| 0.8153 | 0.6770 |
| 0.8265 | 0.6927 |
| 0.8721 | 0.7625 |
| 0.8971 | 0.8032 |
| 0.9127 | 0.8307 |
| 0.9375 | 0.8748 |
| 0.9623 | 0.9222 |
| 0.9806 | 0.9592 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of n-Propyl acetate (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 299.15 | 0.0506 | 0.3334 |
| 299.15 | 0.1059 | 0.6663 |
| 299.15 | 0.1612 | 0.9933 |
| 299.15 | 0.2204 | 1.2566 |
| 299.15 | 0.2796 | 1.4752 |
| 299.15 | 0.3339 | 1.6229 |
| 299.15 | 0.3870 | 1.7272 |
| 299.15 | 0.4295 | 1.8037 |
| 299.15 | 0.4677 | 1.8253 |
| 299.15 | 0.5217 | 1.8354 |
| 299.15 | 0.5786 | 1.8038 |
| 299.15 | 0.6401 | 1.7137 |
| 299.15 | 0.7062 | 1.5555 |
| 299.15 | 0.7783 | 1.307 |
| 299.15 | 0.8559 | 0.9458 |
| 299.15 | 0.9283 | 0.5393 |
| 318.15 | 0.0437 | 0.2532 |
| 318.15 | 0.0939 | 0.5206 |
| 318.15 | 0.1490 | 0.8039 |
| 318.15 | 0.2040 | 1.0573 |
| 318.15 | 0.2592 | 1.2791 |
| 318.15 | 0.3141 | 1.4896 |
| 318.15 | 0.3611 | 1.6179 |
| 318.15 | 0.3804 | 1.6703 |
| 318.15 | 0.4115 | 1.7373 |
| 318.15 | 0.4179 | 1.7478 |
| 318.15 | 0.4562 | 1.7898 |
| 318.15 | 0.4638 | 1.7941 |
| 318.15 | 0.4957 | 1.8156 |
| 318.15 | 0.5115 | 1.822 |
| 318.15 | 0.5704 | 1.7984 |
| 318.15 | 0.6343 | 1.7147 |
| 318.15 | 0.7055 | 1.5485 |
| 318.15 | 0.7756 | 1.3037 |
| 318.15 | 0.8554 | 0.9372 |
| 318.15 | 0.9304 | 0.5056 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of n-Propyl acetate (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 299.15 | 0.0506 | 0.3334 |
| 299.15 | 0.1059 | 0.6663 |
| 299.15 | 0.1612 | 0.9933 |
| 299.15 | 0.2204 | 1.2566 |
| 299.15 | 0.2796 | 1.4752 |
| 299.15 | 0.3339 | 1.6229 |
| 299.15 | 0.3870 | 1.7272 |
| 299.15 | 0.4295 | 1.8037 |
| 299.15 | 0.4677 | 1.8253 |
| 299.15 | 0.5217 | 1.8354 |
| 299.15 | 0.5786 | 1.8038 |
| 299.15 | 0.6401 | 1.7137 |
| 299.15 | 0.7062 | 1.5555 |
| 299.15 | 0.7783 | 1.307 |
| 299.15 | 0.8559 | 0.9458 |
| 299.15 | 0.9283 | 0.5393 |
| 318.15 | 0.0437 | 0.2532 |
| 318.15 | 0.0939 | 0.5206 |
| 318.15 | 0.1490 | 0.8039 |
| 318.15 | 0.2040 | 1.0573 |
| 318.15 | 0.2592 | 1.2791 |
| 318.15 | 0.3141 | 1.4896 |
| 318.15 | 0.3611 | 1.6179 |
| 318.15 | 0.3804 | 1.6703 |
| 318.15 | 0.4115 | 1.7373 |
| 318.15 | 0.4179 | 1.7478 |
| 318.15 | 0.4562 | 1.7898 |
| 318.15 | 0.4638 | 1.7941 |
| 318.15 | 0.4957 | 1.8156 |
| 318.15 | 0.5115 | 1.822 |
| 318.15 | 0.5704 | 1.7984 |
| 318.15 | 0.6343 | 1.7147 |
| 318.15 | 0.7055 | 1.5485 |
| 318.15 | 0.7756 | 1.3037 |
| 318.15 | 0.8554 | 0.9372 |
| 318.15 | 0.9304 | 0.5056 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.32 (Liquid)
| Mole fraction of n-Propyl acetate (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0601 | 355.88 |
| 0.0859 | 356.02 |
| 0.1183 | 356.21 |
| 0.1557 | 356.47 |
| 0.2030 | 356.87 |
| 0.2424 | 357.18 |
| 0.2796 | 357.53 |
| 0.3053 | 357.85 |
| 0.3494 | 358.32 |
| 0.3858 | 358.77 |
| 0.4255 | 359.25 |
| 0.4488 | 359.58 |
| 0.4797 | 360.01 |
| 0.5078 | 360.49 |
| 0.5474 | 361.12 |
| 0.5753 | 361.63 |
| 0.6172 | 362.40 |
| 0.6493 | 363.05 |
| 0.6970 | 364.15 |
| 0.7302 | 364.95 |
| 0.7591 | 365.68 |
| 0.7938 | 366.67 |
| 0.8127 | 367.24 |
| 0.8153 | 367.33 |
| 0.8265 | 367.67 |
| 0.8721 | 369.12 |
| 0.8971 | 369.97 |
| 0.9127 | 370.56 |
| 0.9375 | 371.51 |
| 0.9623 | 372.47 |
| 0.9806 | 373.23 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 101.32 (Liquid)
| Mole fraction of n-Propyl acetate (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0601 | 355.88 |
| 0.0859 | 356.02 |
| 0.1183 | 356.21 |
| 0.1557 | 356.47 |
| 0.2030 | 356.87 |
| 0.2424 | 357.18 |
| 0.2796 | 357.53 |
| 0.3053 | 357.85 |
| 0.3494 | 358.32 |
| 0.3858 | 358.77 |
| 0.4255 | 359.25 |
| 0.4488 | 359.58 |
| 0.4797 | 360.01 |
| 0.5078 | 360.49 |
| 0.5474 | 361.12 |
| 0.5753 | 361.63 |
| 0.6172 | 362.40 |
| 0.6493 | 363.05 |
| 0.6970 | 364.15 |
| 0.7302 | 364.95 |
| 0.7591 | 365.68 |
| 0.7938 | 366.67 |
| 0.8127 | 367.24 |
| 0.8153 | 367.33 |
| 0.8265 | 367.67 |
| 0.8721 | 369.12 |
| 0.8971 | 369.97 |
| 0.9127 | 370.56 |
| 0.9375 | 371.51 |
| 0.9623 | 372.47 |
| 0.9806 | 373.23 |
Excess molar volume, m3/mol [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of n-Propyl acetate (2) - Liquid | Excess molar volume, m3/mol - Liquid |
| 303.15 | 0.0592 | 1.7400e-07 |
| 303.15 | 0.0987 | 2.7700e-07 |
| 303.15 | 0.1549 | 4.0200e-07 |
| 303.15 | 0.1964 | 4.8400e-07 |
| 303.15 | 0.2539 | 5.7500e-07 |
| 303.15 | 0.3093 | 6.4300e-07 |
| 303.15 | 0.3593 | 6.8700e-07 |
| 303.15 | 0.4083 | 7.1500e-07 |
| 303.15 | 0.4512 | 7.2600e-07 |
| 303.15 | 0.5076 | 7.2300e-07 |
| 303.15 | 0.5677 | 7.0200e-07 |
| 303.15 | 0.6144 | 6.7200e-07 |
| 303.15 | 0.6505 | 6.4100e-07 |
| 303.15 | 0.7060 | 5.8300e-07 |
| 303.15 | 0.7481 | 5.2500e-07 |
| 303.15 | 0.8180 | 4.1200e-07 |
| 303.15 | 0.8690 | 3.1200e-07 |
| 303.15 | 0.9167 | 2.0700e-07 |
| 303.15 | 0.9469 | 1.3500e-07 |
| 318.15 | 0.0724 | 2.1700e-07 |
| 318.15 | 0.1084 | 3.1600e-07 |
| 318.15 | 0.1406 | 3.8200e-07 |
| 318.15 | 0.1989 | 4.9500e-07 |
| 318.15 | 0.2600 | 5.7600e-07 |
| 318.15 | 0.3076 | 6.2700e-07 |
| 318.15 | 0.3580 | 6.7900e-07 |
| 318.15 | 0.4059 | 7.1200e-07 |
| 318.15 | 0.4689 | 7.2700e-07 |
| 318.15 | 0.5226 | 7.2300e-07 |
| 318.15 | 0.5801 | 6.9900e-07 |
| 318.15 | 0.6377 | 6.5700e-07 |
| 318.15 | 0.7098 | 5.9700e-07 |
| 318.15 | 0.7775 | 5.1300e-07 |
| 318.15 | 0.8290 | 4.1900e-07 |
| 318.15 | 0.9060 | 2.5700e-07 |
Excess molar volume, m3/mol [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of n-Propyl acetate (2) - Liquid | Excess molar volume, m3/mol - Liquid |
| 303.15 | 0.0592 | 1.7400e-07 |
| 303.15 | 0.0987 | 2.7700e-07 |
| 303.15 | 0.1549 | 4.0200e-07 |
| 303.15 | 0.1964 | 4.8400e-07 |
| 303.15 | 0.2539 | 5.7500e-07 |
| 303.15 | 0.3093 | 6.4300e-07 |
| 303.15 | 0.3593 | 6.8700e-07 |
| 303.15 | 0.4083 | 7.1500e-07 |
| 303.15 | 0.4512 | 7.2600e-07 |
| 303.15 | 0.5076 | 7.2300e-07 |
| 303.15 | 0.5677 | 7.0200e-07 |
| 303.15 | 0.6144 | 6.7200e-07 |
| 303.15 | 0.6505 | 6.4100e-07 |
| 303.15 | 0.7060 | 5.8300e-07 |
| 303.15 | 0.7481 | 5.2500e-07 |
| 303.15 | 0.8180 | 4.1200e-07 |
| 303.15 | 0.8690 | 3.1200e-07 |
| 303.15 | 0.9167 | 2.0700e-07 |
| 303.15 | 0.9469 | 1.3500e-07 |
| 318.15 | 0.0724 | 2.1700e-07 |
| 318.15 | 0.1084 | 3.1600e-07 |
| 318.15 | 0.1406 | 3.8200e-07 |
| 318.15 | 0.1989 | 4.9500e-07 |
| 318.15 | 0.2600 | 5.7600e-07 |
| 318.15 | 0.3076 | 6.2700e-07 |
| 318.15 | 0.3580 | 6.7900e-07 |
| 318.15 | 0.4059 | 7.1200e-07 |
| 318.15 | 0.4689 | 7.2700e-07 |
| 318.15 | 0.5226 | 7.2300e-07 |
| 318.15 | 0.5801 | 6.9900e-07 |
| 318.15 | 0.6377 | 6.5700e-07 |
| 318.15 | 0.7098 | 5.9700e-07 |
| 318.15 | 0.7775 | 5.1300e-07 |
| 318.15 | 0.8290 | 4.1900e-07 |
| 318.15 | 0.9060 | 2.5700e-07 |