- Name
- Ethyl cyanoacetate
- InChI
- InChI=1S/C5H7NO2/c1-2-8-5(7)3-4-6/h2-3H2,1H3
- InChI Key
- ZIUSEGSNTOUIPT-UHFFFAOYSA-N
- Formula
- C5H7NO2
- SMILES
- CCOC(=O)CC#N
- Mol. Weight (g/mol)
- 113.11
- CAS
- 105-56-6
- Name
- Acetamide, N-methyl-
- InChI
- InChI=1S/C3H7NO/c1-3(5)4-2/h1-2H3,(H,4,5)
- InChI Key
- OHLUUHNLEMFGTQ-UHFFFAOYSA-N
- Formula
- C3H7NO
- SMILES
- CNC(C)=O
- Mol. Weight (g/mol)
- 73.09
- CAS
- 79-16-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Volume fraction of Acetamide, N-methyl- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 1051.4 |
| 303.15 | 0.0529 | 1048.11 |
| 303.15 | 0.1860 | 1036.06 |
| 303.15 | 0.2745 | 1027.82 |
| 303.15 | 0.3672 | 1018.95 |
| 303.15 | 0.4502 | 1010.93 |
| 303.15 | 0.5435 | 1001.23 |
| 303.15 | 0.5664 | 998.75 |
| 303.15 | 0.7307 | 980.97 |
| 303.15 | 0.8795 | 964.97 |
| 303.15 | 1.0000 | 951.3 |
| 308.15 | 0.0000 | 1046.5 |
| 308.15 | 0.0529 | 1041.91 |
| 308.15 | 0.1862 | 1029.63 |
| 308.15 | 0.2747 | 1021.42 |
| 308.15 | 0.3675 | 1012.63 |
| 308.15 | 0.4504 | 1004.44 |
| 308.15 | 0.5438 | 994.68 |
| 308.15 | 0.5666 | 992.26 |
| 308.15 | 0.7309 | 974.66 |
| 308.15 | 0.8796 | 958.76 |
| 308.15 | 1.0000 | 945.9 |
| 313.15 | 0.0000 | 1040.8 |
| 313.15 | 0.0528 | 1036.3 |
| 313.15 | 0.1857 | 1024.28 |
| 313.15 | 0.2741 | 1015.97 |
| 313.15 | 0.3667 | 1007.36 |
| 313.15 | 0.4497 | 999.41 |
| 313.15 | 0.5430 | 990.26 |
| 313.15 | 0.5659 | 987.92 |
| 313.15 | 0.7303 | 971.38 |
| 313.15 | 0.8793 | 956.39 |
| 313.15 | 1.0000 | 943.6 |
| 318.15 | 0.0000 | 1034.7 |
| 318.15 | 0.0527 | 1030.52 |
| 318.15 | 0.1854 | 1018.59 |
| 318.15 | 0.2737 | 1010.48 |
| 318.15 | 0.3663 | 1001.85 |
| 318.15 | 0.4492 | 994.13 |
| 318.15 | 0.5425 | 985.18 |
| 318.15 | 0.5654 | 982.97 |
| 318.15 | 0.7299 | 966.83 |
| 318.15 | 0.8791 | 952.07 |
| 318.15 | 1.0000 | 939.9 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Volume fraction of Acetamide, N-methyl- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 1051.4 |
| 303.15 | 0.0529 | 1048.11 |
| 303.15 | 0.1860 | 1036.06 |
| 303.15 | 0.2745 | 1027.82 |
| 303.15 | 0.3672 | 1018.95 |
| 303.15 | 0.4502 | 1010.93 |
| 303.15 | 0.5435 | 1001.23 |
| 303.15 | 0.5664 | 998.75 |
| 303.15 | 0.7307 | 980.97 |
| 303.15 | 0.8795 | 964.97 |
| 303.15 | 1.0000 | 951.3 |
| 308.15 | 0.0000 | 1046.5 |
| 308.15 | 0.0529 | 1041.91 |
| 308.15 | 0.1862 | 1029.63 |
| 308.15 | 0.2747 | 1021.42 |
| 308.15 | 0.3675 | 1012.63 |
| 308.15 | 0.4504 | 1004.44 |
| 308.15 | 0.5438 | 994.68 |
| 308.15 | 0.5666 | 992.26 |
| 308.15 | 0.7309 | 974.66 |
| 308.15 | 0.8796 | 958.76 |
| 308.15 | 1.0000 | 945.9 |
| 313.15 | 0.0000 | 1040.8 |
| 313.15 | 0.0528 | 1036.3 |
| 313.15 | 0.1857 | 1024.28 |
| 313.15 | 0.2741 | 1015.97 |
| 313.15 | 0.3667 | 1007.36 |
| 313.15 | 0.4497 | 999.41 |
| 313.15 | 0.5430 | 990.26 |
| 313.15 | 0.5659 | 987.92 |
| 313.15 | 0.7303 | 971.38 |
| 313.15 | 0.8793 | 956.39 |
| 313.15 | 1.0000 | 943.6 |
| 318.15 | 0.0000 | 1034.7 |
| 318.15 | 0.0527 | 1030.52 |
| 318.15 | 0.1854 | 1018.59 |
| 318.15 | 0.2737 | 1010.48 |
| 318.15 | 0.3663 | 1001.85 |
| 318.15 | 0.4492 | 994.13 |
| 318.15 | 0.5425 | 985.18 |
| 318.15 | 0.5654 | 982.97 |
| 318.15 | 0.7299 | 966.83 |
| 318.15 | 0.8791 | 952.07 |
| 318.15 | 1.0000 | 939.9 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Volume fraction of Acetamide, N-methyl- (2) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1397.0 |
| 303.15 | 0.0529 | 1396.0 |
| 303.15 | 0.1860 | 1391.0 |
| 303.15 | 0.2745 | 1389.0 |
| 303.15 | 0.3672 | 1386.0 |
| 303.15 | 0.4502 | 1384.0 |
| 303.15 | 0.5435 | 1380.0 |
| 303.15 | 0.5664 | 1379.0 |
| 303.15 | 0.7307 | 1375.0 |
| 303.15 | 0.8795 | 1370.0 |
| 303.15 | 1.0000 | 1367.0 |
| 308.15 | 0.0000 | 1385.0 |
| 308.15 | 0.0529 | 1384.0 |
| 308.15 | 0.1862 | 1380.0 |
| 308.15 | 0.2747 | 1378.0 |
| 308.15 | 0.3675 | 1375.0 |
| 308.15 | 0.4504 | 1373.0 |
| 308.15 | 0.5438 | 1371.0 |
| 308.15 | 0.5666 | 1370.0 |
| 308.15 | 0.7309 | 1367.0 |
| 308.15 | 0.8796 | 1365.0 |
| 308.15 | 1.0000 | 1362.0 |
| 313.15 | 0.0000 | 1368.0 |
| 313.15 | 0.0528 | 1366.0 |
| 313.15 | 0.1857 | 1362.0 |
| 313.15 | 0.2741 | 1359.0 |
| 313.15 | 0.3667 | 1356.0 |
| 313.15 | 0.4497 | 1353.0 |
| 313.15 | 0.5430 | 1349.0 |
| 313.15 | 0.5659 | 1348.0 |
| 313.15 | 0.7303 | 1343.0 |
| 313.15 | 0.8793 | 1337.0 |
| 313.15 | 1.0000 | 1334.0 |
| 318.15 | 0.0000 | 1359.0 |
| 318.15 | 0.0527 | 1358.0 |
| 318.15 | 0.1854 | 1356.0 |
| 318.15 | 0.2737 | 1352.0 |
| 318.15 | 0.3663 | 1348.0 |
| 318.15 | 0.4492 | 1345.0 |
| 318.15 | 0.5425 | 1341.0 |
| 318.15 | 0.5654 | 1340.0 |
| 318.15 | 0.7299 | 1332.0 |
| 318.15 | 0.8791 | 1324.0 |
| 318.15 | 1.0000 | 1319.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Volume fraction of Acetamide, N-methyl- (2) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1397.0 |
| 303.15 | 0.0529 | 1396.0 |
| 303.15 | 0.1860 | 1391.0 |
| 303.15 | 0.2745 | 1389.0 |
| 303.15 | 0.3672 | 1386.0 |
| 303.15 | 0.4502 | 1384.0 |
| 303.15 | 0.5435 | 1380.0 |
| 303.15 | 0.5664 | 1379.0 |
| 303.15 | 0.7307 | 1375.0 |
| 303.15 | 0.8795 | 1370.0 |
| 303.15 | 1.0000 | 1367.0 |
| 308.15 | 0.0000 | 1385.0 |
| 308.15 | 0.0529 | 1384.0 |
| 308.15 | 0.1862 | 1380.0 |
| 308.15 | 0.2747 | 1378.0 |
| 308.15 | 0.3675 | 1375.0 |
| 308.15 | 0.4504 | 1373.0 |
| 308.15 | 0.5438 | 1371.0 |
| 308.15 | 0.5666 | 1370.0 |
| 308.15 | 0.7309 | 1367.0 |
| 308.15 | 0.8796 | 1365.0 |
| 308.15 | 1.0000 | 1362.0 |
| 313.15 | 0.0000 | 1368.0 |
| 313.15 | 0.0528 | 1366.0 |
| 313.15 | 0.1857 | 1362.0 |
| 313.15 | 0.2741 | 1359.0 |
| 313.15 | 0.3667 | 1356.0 |
| 313.15 | 0.4497 | 1353.0 |
| 313.15 | 0.5430 | 1349.0 |
| 313.15 | 0.5659 | 1348.0 |
| 313.15 | 0.7303 | 1343.0 |
| 313.15 | 0.8793 | 1337.0 |
| 313.15 | 1.0000 | 1334.0 |
| 318.15 | 0.0000 | 1359.0 |
| 318.15 | 0.0527 | 1358.0 |
| 318.15 | 0.1854 | 1356.0 |
| 318.15 | 0.2737 | 1352.0 |
| 318.15 | 0.3663 | 1348.0 |
| 318.15 | 0.4492 | 1345.0 |
| 318.15 | 0.5425 | 1341.0 |
| 318.15 | 0.5654 | 1340.0 |
| 318.15 | 0.7299 | 1332.0 |
| 318.15 | 0.8791 | 1324.0 |
| 318.15 | 1.0000 | 1319.0 |