- Name
- n-Propyl acetate
- InChI
- InChI=1S/C5H10O2/c1-3-4-7-5(2)6/h3-4H2,1-2H3
- InChI Key
- YKYONYBAUNKHLG-UHFFFAOYSA-N
- Formula
- C5H10O2
- SMILES
- CCCOC(C)=O
- Mol. Weight (g/mol)
- 102.13
- CAS
- 109-60-4
- Name
- o-Xylene
- InChI
- InChI=1S/C8H10/c1-7-5-3-4-6-8(7)2/h3-6H,1-2H3
- InChI Key
- CTQNGGLPUBDAKN-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1ccccc1C
- Mol. Weight (g/mol)
- 106.17
- CAS
- 95-47-6
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of n-Propyl acetate (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 875.05 |
| 298.15 | 0.0998 | 876.04 |
| 298.15 | 0.1995 | 876.96 |
| 298.15 | 0.2996 | 877.83 |
| 298.15 | 0.4002 | 878.67 |
| 298.15 | 0.5001 | 879.45 |
| 298.15 | 0.6004 | 880.18 |
| 298.15 | 0.7002 | 880.85 |
| 298.15 | 0.7999 | 881.46 |
| 298.15 | 0.9000 | 882.03 |
| 298.15 | 1.0000 | 882.54 |
| 303.15 | 0.0000 | 870.83 |
| 303.15 | 0.1000 | 871.68 |
| 303.15 | 0.1997 | 872.48 |
| 303.15 | 0.2992 | 873.22 |
| 303.15 | 0.3998 | 873.93 |
| 303.15 | 0.4993 | 874.57 |
| 303.15 | 0.6002 | 875.17 |
| 303.15 | 0.6994 | 875.7 |
| 303.15 | 0.8002 | 876.19 |
| 303.15 | 0.9020 | 876.63 |
| 303.15 | 1.0000 | 876.99 |
| 308.15 | 0.0000 | 866.62 |
| 308.15 | 0.0999 | 867.33 |
| 308.15 | 0.1999 | 867.99 |
| 308.15 | 0.3001 | 868.59 |
| 308.15 | 0.3989 | 869.15 |
| 308.15 | 0.5002 | 869.66 |
| 308.15 | 0.6008 | 870.11 |
| 308.15 | 0.6998 | 870.5 |
| 308.15 | 0.8007 | 870.84 |
| 308.15 | 0.9000 | 871.12 |
| 308.15 | 1.0000 | 871.35 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of n-Propyl acetate (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 875.05 |
| 298.15 | 0.0998 | 876.04 |
| 298.15 | 0.1995 | 876.96 |
| 298.15 | 0.2996 | 877.83 |
| 298.15 | 0.4002 | 878.67 |
| 298.15 | 0.5001 | 879.45 |
| 298.15 | 0.6004 | 880.18 |
| 298.15 | 0.7002 | 880.85 |
| 298.15 | 0.7999 | 881.46 |
| 298.15 | 0.9000 | 882.03 |
| 298.15 | 1.0000 | 882.54 |
| 303.15 | 0.0000 | 870.83 |
| 303.15 | 0.1000 | 871.68 |
| 303.15 | 0.1997 | 872.48 |
| 303.15 | 0.2992 | 873.22 |
| 303.15 | 0.3998 | 873.93 |
| 303.15 | 0.4993 | 874.57 |
| 303.15 | 0.6002 | 875.17 |
| 303.15 | 0.6994 | 875.7 |
| 303.15 | 0.8002 | 876.19 |
| 303.15 | 0.9020 | 876.63 |
| 303.15 | 1.0000 | 876.99 |
| 308.15 | 0.0000 | 866.62 |
| 308.15 | 0.0999 | 867.33 |
| 308.15 | 0.1999 | 867.99 |
| 308.15 | 0.3001 | 868.59 |
| 308.15 | 0.3989 | 869.15 |
| 308.15 | 0.5002 | 869.66 |
| 308.15 | 0.6008 | 870.11 |
| 308.15 | 0.6998 | 870.5 |
| 308.15 | 0.8007 | 870.84 |
| 308.15 | 0.9000 | 871.12 |
| 308.15 | 1.0000 | 871.35 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of n-Propyl acetate (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 298.15 | 0.0000 | 0.0299 |
| 298.15 | 0.0998 | 0.0289 |
| 298.15 | 0.1995 | 0.0281 |
| 298.15 | 0.2996 | 0.0275 |
| 298.15 | 0.4002 | 0.0268 |
| 298.15 | 0.5001 | 0.0263 |
| 298.15 | 0.6004 | 0.0257 |
| 298.15 | 0.7002 | 0.0252 |
| 298.15 | 0.7999 | 0.0247 |
| 298.15 | 0.9000 | 0.0243 |
| 298.15 | 1.0000 | 0.0239 |
| 303.15 | 0.0000 | 0.0292 |
| 303.15 | 0.0999 | 0.0284 |
| 303.15 | 0.1997 | 0.0276 |
| 303.15 | 0.2992 | 0.0269 |
| 303.15 | 0.3998 | 0.0263 |
| 303.15 | 0.4993 | 0.0257 |
| 303.15 | 0.6002 | 0.0252 |
| 303.15 | 0.6994 | 0.0247 |
| 303.15 | 0.8002 | 0.0242 |
| 303.15 | 0.9020 | 0.0238 |
| 303.15 | 1.0000 | 0.0235 |
| 308.15 | 0.0000 | 0.0286 |
| 308.15 | 0.0999 | 0.0278 |
| 308.15 | 0.1999 | 0.0271 |
| 308.15 | 0.3001 | 0.0263 |
| 308.15 | 0.3989 | 0.0257 |
| 308.15 | 0.5002 | 0.0251 |
| 308.15 | 0.6008 | 0.0246 |
| 308.15 | 0.6998 | 0.0241 |
| 308.15 | 0.8007 | 0.0236 |
| 308.15 | 0.9000 | 0.0232 |
| 308.15 | 1.0000 | 0.0228 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of n-Propyl acetate (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 298.15 | 0.0000 | 0.0299 |
| 298.15 | 0.0998 | 0.0289 |
| 298.15 | 0.1995 | 0.0281 |
| 298.15 | 0.2996 | 0.0275 |
| 298.15 | 0.4002 | 0.0268 |
| 298.15 | 0.5001 | 0.0263 |
| 298.15 | 0.6004 | 0.0257 |
| 298.15 | 0.7002 | 0.0252 |
| 298.15 | 0.7999 | 0.0247 |
| 298.15 | 0.9000 | 0.0243 |
| 298.15 | 1.0000 | 0.0239 |
| 303.15 | 0.0000 | 0.0292 |
| 303.15 | 0.0999 | 0.0284 |
| 303.15 | 0.1997 | 0.0276 |
| 303.15 | 0.2992 | 0.0269 |
| 303.15 | 0.3998 | 0.0263 |
| 303.15 | 0.4993 | 0.0257 |
| 303.15 | 0.6002 | 0.0252 |
| 303.15 | 0.6994 | 0.0247 |
| 303.15 | 0.8002 | 0.0242 |
| 303.15 | 0.9020 | 0.0238 |
| 303.15 | 1.0000 | 0.0235 |
| 308.15 | 0.0000 | 0.0286 |
| 308.15 | 0.0999 | 0.0278 |
| 308.15 | 0.1999 | 0.0271 |
| 308.15 | 0.3001 | 0.0263 |
| 308.15 | 0.3989 | 0.0257 |
| 308.15 | 0.5002 | 0.0251 |
| 308.15 | 0.6008 | 0.0246 |
| 308.15 | 0.6998 | 0.0241 |
| 308.15 | 0.8007 | 0.0236 |
| 308.15 | 0.9000 | 0.0232 |
| 308.15 | 1.0000 | 0.0228 |