- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
- Name
- Triethanolamine
- InChI
- InChI=1S/C6H15NO3/c8-4-1-7(2-5-9)3-6-10/h8-10H,1-6H2
- InChI Key
- GSEJCLTVZPLZKY-UHFFFAOYSA-N
- Formula
- C6H15NO3
- SMILES
- OCCN(CCO)CCO
- Mol. Weight (g/mol)
- 149.19
- CAS
- 102-71-6
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Carbon dioxide (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa of Carbon dioxide (1) - Liquid | Mole fraction of Carbon dioxide (1) - Liquid |
| 313.20 | 6.78 | 0.0078 |
| 313.20 | 12.40 | 0.0088 |
| 313.20 | 17.90 | 0.0112 |
| 313.20 | 25.30 | 0.0128 |
| 313.20 | 39.20 | 0.0151 |
| 313.20 | 48.10 | 0.0164 |
| 313.20 | 69.90 | 0.0195 |
| 313.20 | 92.30 | 0.0227 |
| 313.20 | 94.30 | 0.0227 |
| 313.20 | 109.00 | 0.0241 |
| 333.20 | 1.70 | 0.0020 |
| 333.20 | 4.71 | 0.0026 |
| 333.20 | 15.70 | 0.0047 |
| 333.20 | 34.30 | 0.0067 |
| 333.20 | 55.70 | 0.0090 |
| 333.20 | 64.50 | 0.0104 |
| 333.20 | 102.00 | 0.0136 |
| 353.20 | 7.22 | 0.0037 |
| 353.20 | 14.00 | 0.0043 |
| 353.20 | 34.60 | 0.0053 |
| 353.20 | 68.70 | 0.0063 |
| 353.20 | 88.30 | 0.0076 |
| 353.20 | 99.50 | 0.0090 |
| 373.20 | 3.36 | 0.0021 |
| 373.20 | 8.53 | 0.0026 |
| 373.20 | 18.30 | 0.0028 |
| 373.20 | 28.30 | 0.0030 |
| 373.20 | 53.40 | 0.0042 |
| 373.20 | 82.00 | 0.0046 |
| 373.20 | 105.00 | 0.0056 |
Mass fraction of Carbon dioxide (1) [ref]
Operational condition: Solvent: Molality, mol/kg = 2.7 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa of Carbon dioxide (1) - Gas | Temperature, K - Liquid | Mass fraction of Carbon dioxide (1) - Liquid |
| 8.10 | 298.15 | 0.0215 |
| 8.10 | 303.15 | 0.0193 |
| 8.10 | 308.15 | 0.0173 |
| 8.10 | 313.15 | 0.0153 |
| 15.00 | 298.15 | 0.0277 |
| 15.00 | 303.15 | 0.0248 |
| 15.00 | 308.15 | 0.0204 |
| 15.00 | 313.15 | 0.0173 |
| 20.30 | 298.15 | 0.0312 |
| 20.30 | 303.15 | 0.0271 |
| 20.30 | 308.15 | 0.0240 |
| 20.30 | 313.15 | 0.0205 |
| 30.40 | 298.15 | 0.0336 |
| 30.40 | 303.15 | 0.0309 |
| 30.40 | 308.15 | 0.0283 |
| 30.40 | 313.15 | 0.0240 |
| 60.80 | 298.15 | 0.0441 |
| 60.80 | 303.15 | 0.0408 |
| 60.80 | 308.15 | 0.0354 |
| 60.80 | 313.15 | 0.0325 |
Mass ratio of solute to solvent of Carbon dioxide (1) [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Solvent: Mass fraction of Triethanolamine (2) - Liquid | Temperature, K - Liquid | Pressure, kPa - Liquid | Mass ratio of solute to solvent of Carbon dioxide (1) - Liquid |
| 0.3000 | 303.15 | 1500.00 | 0.1290 |
Mole fraction of Carbon dioxide (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa of Carbon dioxide (1) - Liquid | Mole fraction of Carbon dioxide (1) - Liquid |
| 313.20 | 6.78 | 0.0078 |
| 313.20 | 12.40 | 0.0088 |
| 313.20 | 17.90 | 0.0112 |
| 313.20 | 25.30 | 0.0128 |
| 313.20 | 39.20 | 0.0151 |
| 313.20 | 48.10 | 0.0164 |
| 313.20 | 69.90 | 0.0195 |
| 313.20 | 92.30 | 0.0227 |
| 313.20 | 94.30 | 0.0227 |
| 313.20 | 109.00 | 0.0241 |
| 333.20 | 1.70 | 0.0020 |
| 333.20 | 4.71 | 0.0026 |
| 333.20 | 15.70 | 0.0047 |
| 333.20 | 34.30 | 0.0067 |
| 333.20 | 55.70 | 0.0090 |
| 333.20 | 64.50 | 0.0104 |
| 333.20 | 102.00 | 0.0136 |
| 353.20 | 7.22 | 0.0037 |
| 353.20 | 14.00 | 0.0043 |
| 353.20 | 34.60 | 0.0053 |
| 353.20 | 68.70 | 0.0063 |
| 353.20 | 88.30 | 0.0076 |
| 353.20 | 99.50 | 0.0090 |
| 373.20 | 3.36 | 0.0021 |
| 373.20 | 8.53 | 0.0026 |
| 373.20 | 18.30 | 0.0028 |
| 373.20 | 28.30 | 0.0030 |
| 373.20 | 53.40 | 0.0042 |
| 373.20 | 82.00 | 0.0046 |
| 373.20 | 105.00 | 0.0056 |
Mass fraction of Carbon dioxide (1) [ref]
Operational condition: Solvent: Molality, mol/kg = 2.7 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa of Carbon dioxide (1) - Gas | Temperature, K - Liquid | Mass fraction of Carbon dioxide (1) - Liquid |
| 8.10 | 298.15 | 0.0215 |
| 8.10 | 303.15 | 0.0193 |
| 8.10 | 308.15 | 0.0173 |
| 8.10 | 313.15 | 0.0153 |
| 15.00 | 298.15 | 0.0277 |
| 15.00 | 303.15 | 0.0248 |
| 15.00 | 308.15 | 0.0204 |
| 15.00 | 313.15 | 0.0173 |
| 20.30 | 298.15 | 0.0312 |
| 20.30 | 303.15 | 0.0271 |
| 20.30 | 308.15 | 0.0240 |
| 20.30 | 313.15 | 0.0205 |
| 30.40 | 298.15 | 0.0336 |
| 30.40 | 303.15 | 0.0309 |
| 30.40 | 308.15 | 0.0283 |
| 30.40 | 313.15 | 0.0240 |
| 60.80 | 298.15 | 0.0441 |
| 60.80 | 303.15 | 0.0408 |
| 60.80 | 308.15 | 0.0354 |
| 60.80 | 313.15 | 0.0325 |
Mass ratio of solute to solvent of Carbon dioxide (1) [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Solvent: Mass fraction of Triethanolamine (2) - Liquid | Temperature, K - Liquid | Pressure, kPa - Liquid | Mass ratio of solute to solvent of Carbon dioxide (1) - Liquid |
| 0.3000 | 303.15 | 1500.00 | 0.1290 |
Sources
- Solubility of CO2 in the solvent system (water + monoethanolamine + triethanolamine)
- CO2 absorption with aqueous tertiary amine solutions: Equilibrium solubility and thermodynamic modeling
- Density, Viscosity, and Performances of Carbon Dioxide Capture in 16 Absorbents of Amine + Ionic Liquid + H2O, Ionic Liquid + H2O, and Amine + H2O Systems