- Name
- Aniline, N-methyl-
- InChI
- InChI=1S/C7H9N/c1-8-7-5-3-2-4-6-7/h2-6,8H,1H3
- InChI Key
- AFBPFSWMIHJQDM-UHFFFAOYSA-N
- Formula
- C7H9N
- SMILES
- CNc1ccccc1
- Mol. Weight (g/mol)
- 107.15
- CAS
- 100-61-8
- Name
- 2-Butanone
- InChI
- InChI=1S/C4H8O/c1-3-4(2)5/h3H2,1-2H3
- InChI Key
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N
- Formula
- C4H8O
- SMILES
- CCC(C)=O
- Mol. Weight (g/mol)
- 72.11
- CAS
- 78-93-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Excess molar enthalpy (molar enthalpy (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of 2-Butanone (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.1361 | -0.3560 |
| 0.2283 | -0.5400 |
| 0.3187 | -0.6760 |
| 0.4093 | -0.7810 |
| 0.5090 | -0.8160 |
| 0.6091 | -0.7790 |
| 0.7055 | -0.6720 |
| 0.8028 | -0.5060 |
| 0.9030 | -0.2800 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of 2-Butanone (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.1361 | -0.3560 |
| 0.2283 | -0.5400 |
| 0.3187 | -0.6760 |
| 0.4093 | -0.7810 |
| 0.5090 | -0.8160 |
| 0.6091 | -0.7790 |
| 0.7055 | -0.6720 |
| 0.8028 | -0.5060 |
| 0.9030 | -0.2800 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Butanone (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0627 | 977.942 |
| 293.15 | 0.1133 | 970.977 |
| 293.15 | 0.1564 | 964.888 |
| 293.15 | 0.2058 | 957.75 |
| 293.15 | 0.2538 | 950.572 |
| 293.15 | 0.3018 | 943.182 |
| 293.15 | 0.3464 | 936.057 |
| 293.15 | 0.3938 | 928.444 |
| 293.15 | 0.4435 | 920.205 |
| 293.15 | 0.4907 | 912.022 |
| 293.15 | 0.5508 | 901.21 |
| 293.15 | 0.5959 | 892.779 |
| 293.15 | 0.6529 | 881.753 |
| 293.15 | 0.7489 | 862.241 |
| 293.15 | 0.7938 | 852.894 |
| 293.15 | 0.8492 | 840.63 |
| 293.15 | 0.8981 | 829.68 |
| 293.15 | 0.9525 | 816.716 |
| 298.15 | 0.0760 | 972.066 |
| 298.15 | 0.1115 | 967.149 |
| 298.15 | 0.1566 | 960.718 |
| 298.15 | 0.2076 | 953.334 |
| 298.15 | 0.2589 | 945.633 |
| 298.15 | 0.2967 | 939.765 |
| 298.15 | 0.3471 | 931.809 |
| 298.15 | 0.3973 | 923.563 |
| 298.15 | 0.4477 | 915.055 |
| 298.15 | 0.4950 | 906.694 |
| 298.15 | 0.5471 | 897.284 |
| 298.15 | 0.5992 | 887.579 |
| 298.15 | 0.6921 | 869.471 |
| 298.15 | 0.7463 | 858.202 |
| 298.15 | 0.8007 | 846.555 |
| 298.15 | 0.8470 | 836.277 |
| 298.15 | 0.8993 | 824.346 |
| 298.15 | 0.9472 | 813.0 |
| 303.15 | 0.0641 | 969.669 |
| 303.15 | 0.1123 | 962.964 |
| 303.15 | 0.1581 | 956.434 |
| 303.15 | 0.2036 | 949.789 |
| 303.15 | 0.2591 | 941.381 |
| 303.15 | 0.3061 | 934.049 |
| 303.15 | 0.3513 | 926.789 |
| 303.15 | 0.4022 | 918.424 |
| 303.15 | 0.4472 | 910.653 |
| 303.15 | 0.5025 | 900.926 |
| 303.15 | 0.5536 | 891.605 |
| 303.15 | 0.5984 | 883.203 |
| 303.15 | 0.6489 | 873.485 |
| 303.15 | 0.6969 | 863.705 |
| 303.15 | 0.7543 | 851.719 |
| 303.15 | 0.8047 | 840.797 |
| 303.15 | 0.8497 | 830.818 |
| 303.15 | 0.8965 | 819.999 |
| 303.15 | 0.9524 | 806.615 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Butanone (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0627 | 977.942 |
| 293.15 | 0.1133 | 970.977 |
| 293.15 | 0.1564 | 964.888 |
| 293.15 | 0.2058 | 957.75 |
| 293.15 | 0.2538 | 950.572 |
| 293.15 | 0.3018 | 943.182 |
| 293.15 | 0.3464 | 936.057 |
| 293.15 | 0.3938 | 928.444 |
| 293.15 | 0.4435 | 920.205 |
| 293.15 | 0.4907 | 912.022 |
| 293.15 | 0.5508 | 901.21 |
| 293.15 | 0.5959 | 892.779 |
| 293.15 | 0.6529 | 881.753 |
| 293.15 | 0.7489 | 862.241 |
| 293.15 | 0.7938 | 852.894 |
| 293.15 | 0.8492 | 840.63 |
| 293.15 | 0.8981 | 829.68 |
| 293.15 | 0.9525 | 816.716 |
| 298.15 | 0.0760 | 972.066 |
| 298.15 | 0.1115 | 967.149 |
| 298.15 | 0.1566 | 960.718 |
| 298.15 | 0.2076 | 953.334 |
| 298.15 | 0.2589 | 945.633 |
| 298.15 | 0.2967 | 939.765 |
| 298.15 | 0.3471 | 931.809 |
| 298.15 | 0.3973 | 923.563 |
| 298.15 | 0.4477 | 915.055 |
| 298.15 | 0.4950 | 906.694 |
| 298.15 | 0.5471 | 897.284 |
| 298.15 | 0.5992 | 887.579 |
| 298.15 | 0.6921 | 869.471 |
| 298.15 | 0.7463 | 858.202 |
| 298.15 | 0.8007 | 846.555 |
| 298.15 | 0.8470 | 836.277 |
| 298.15 | 0.8993 | 824.346 |
| 298.15 | 0.9472 | 813.0 |
| 303.15 | 0.0641 | 969.669 |
| 303.15 | 0.1123 | 962.964 |
| 303.15 | 0.1581 | 956.434 |
| 303.15 | 0.2036 | 949.789 |
| 303.15 | 0.2591 | 941.381 |
| 303.15 | 0.3061 | 934.049 |
| 303.15 | 0.3513 | 926.789 |
| 303.15 | 0.4022 | 918.424 |
| 303.15 | 0.4472 | 910.653 |
| 303.15 | 0.5025 | 900.926 |
| 303.15 | 0.5536 | 891.605 |
| 303.15 | 0.5984 | 883.203 |
| 303.15 | 0.6489 | 873.485 |
| 303.15 | 0.6969 | 863.705 |
| 303.15 | 0.7543 | 851.719 |
| 303.15 | 0.8047 | 840.797 |
| 303.15 | 0.8497 | 830.818 |
| 303.15 | 0.8965 | 819.999 |
| 303.15 | 0.9524 | 806.615 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Butanone (2) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0627 | 1562.93 |
| 293.15 | 0.1133 | 1546.9 |
| 293.15 | 0.1564 | 1532.86 |
| 293.15 | 0.2058 | 1516.97 |
| 293.15 | 0.2538 | 1501.02 |
| 293.15 | 0.3018 | 1484.81 |
| 293.15 | 0.3464 | 1469.41 |
| 293.15 | 0.3938 | 1453.01 |
| 293.15 | 0.4435 | 1435.57 |
| 293.15 | 0.4907 | 1418.46 |
| 293.15 | 0.5508 | 1396.18 |
| 293.15 | 0.5959 | 1378.86 |
| 293.15 | 0.6529 | 1356.64 |
| 293.15 | 0.7489 | 1318.2 |
| 293.15 | 0.7938 | 1300.01 |
| 293.15 | 0.8492 | 1276.95 |
| 293.15 | 0.8981 | 1256.68 |
| 293.15 | 0.9525 | 1232.87 |
| 298.15 | 0.0760 | 1540.12 |
| 298.15 | 0.1115 | 1528.78 |
| 298.15 | 0.1566 | 1514.16 |
| 298.15 | 0.2076 | 1497.6 |
| 298.15 | 0.2589 | 1480.59 |
| 298.15 | 0.2967 | 1467.74 |
| 298.15 | 0.3471 | 1450.49 |
| 298.15 | 0.3973 | 1432.77 |
| 298.15 | 0.4477 | 1414.78 |
| 298.15 | 0.4950 | 1397.25 |
| 298.15 | 0.5471 | 1377.77 |
| 298.15 | 0.5992 | 1357.93 |
| 298.15 | 0.6921 | 1321.67 |
| 298.15 | 0.7463 | 1299.55 |
| 298.15 | 0.8007 | 1276.99 |
| 298.15 | 0.8470 | 1257.46 |
| 298.15 | 0.8993 | 1235.12 |
| 298.15 | 0.9472 | 1214.45 |
| 303.15 | 0.0641 | 1525.99 |
| 303.15 | 0.1123 | 1510.65 |
| 303.15 | 0.1581 | 1495.93 |
| 303.15 | 0.2036 | 1481.08 |
| 303.15 | 0.2591 | 1462.5 |
| 303.15 | 0.3061 | 1446.49 |
| 303.15 | 0.3513 | 1430.76 |
| 303.15 | 0.4022 | 1412.9 |
| 303.15 | 0.4472 | 1396.45 |
| 303.15 | 0.5025 | 1376.1 |
| 303.15 | 0.5536 | 1356.87 |
| 303.15 | 0.5984 | 1339.7 |
| 303.15 | 0.6489 | 1320.14 |
| 303.15 | 0.6969 | 1300.71 |
| 303.15 | 0.7543 | 1277.07 |
| 303.15 | 0.8047 | 1256.0 |
| 303.15 | 0.8497 | 1237.07 |
| 303.15 | 0.8965 | 1216.77 |
| 303.15 | 0.9524 | 1192.15 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Butanone (2) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0627 | 1562.93 |
| 293.15 | 0.1133 | 1546.9 |
| 293.15 | 0.1564 | 1532.86 |
| 293.15 | 0.2058 | 1516.97 |
| 293.15 | 0.2538 | 1501.02 |
| 293.15 | 0.3018 | 1484.81 |
| 293.15 | 0.3464 | 1469.41 |
| 293.15 | 0.3938 | 1453.01 |
| 293.15 | 0.4435 | 1435.57 |
| 293.15 | 0.4907 | 1418.46 |
| 293.15 | 0.5508 | 1396.18 |
| 293.15 | 0.5959 | 1378.86 |
| 293.15 | 0.6529 | 1356.64 |
| 293.15 | 0.7489 | 1318.2 |
| 293.15 | 0.7938 | 1300.01 |
| 293.15 | 0.8492 | 1276.95 |
| 293.15 | 0.8981 | 1256.68 |
| 293.15 | 0.9525 | 1232.87 |
| 298.15 | 0.0760 | 1540.12 |
| 298.15 | 0.1115 | 1528.78 |
| 298.15 | 0.1566 | 1514.16 |
| 298.15 | 0.2076 | 1497.6 |
| 298.15 | 0.2589 | 1480.59 |
| 298.15 | 0.2967 | 1467.74 |
| 298.15 | 0.3471 | 1450.49 |
| 298.15 | 0.3973 | 1432.77 |
| 298.15 | 0.4477 | 1414.78 |
| 298.15 | 0.4950 | 1397.25 |
| 298.15 | 0.5471 | 1377.77 |
| 298.15 | 0.5992 | 1357.93 |
| 298.15 | 0.6921 | 1321.67 |
| 298.15 | 0.7463 | 1299.55 |
| 298.15 | 0.8007 | 1276.99 |
| 298.15 | 0.8470 | 1257.46 |
| 298.15 | 0.8993 | 1235.12 |
| 298.15 | 0.9472 | 1214.45 |
| 303.15 | 0.0641 | 1525.99 |
| 303.15 | 0.1123 | 1510.65 |
| 303.15 | 0.1581 | 1495.93 |
| 303.15 | 0.2036 | 1481.08 |
| 303.15 | 0.2591 | 1462.5 |
| 303.15 | 0.3061 | 1446.49 |
| 303.15 | 0.3513 | 1430.76 |
| 303.15 | 0.4022 | 1412.9 |
| 303.15 | 0.4472 | 1396.45 |
| 303.15 | 0.5025 | 1376.1 |
| 303.15 | 0.5536 | 1356.87 |
| 303.15 | 0.5984 | 1339.7 |
| 303.15 | 0.6489 | 1320.14 |
| 303.15 | 0.6969 | 1300.71 |
| 303.15 | 0.7543 | 1277.07 |
| 303.15 | 0.8047 | 1256.0 |
| 303.15 | 0.8497 | 1237.07 |
| 303.15 | 0.8965 | 1216.77 |
| 303.15 | 0.9524 | 1192.15 |
Sources
- Thermodynamics of Ketone + Amine Mixtures. Part III. Volumetric and Speed of Sound Data at (293.15, 298.15, and 303.15) K for 2-Butanone + Aniline, + N-Methylaniline, or + Pyridine Systems
- Thermodynamics of Ketone + Amine Mixtures. Part VIII. Molar Excess Enthalpies at 298.15 K for n-Alkanone + Aniline or + N-Methylaniline Systems