- Name
- Aniline, N-methyl-
- InChI
- InChI=1S/C7H9N/c1-8-7-5-3-2-4-6-7/h2-6,8H,1H3
- InChI Key
- AFBPFSWMIHJQDM-UHFFFAOYSA-N
- Formula
- C7H9N
- SMILES
- CNc1ccccc1
- Mol. Weight (g/mol)
- 107.15
- CAS
- 100-61-8
- Name
- Diisopropyl ether
- InChI
- InChI=1S/C6H14O/c1-5(2)7-6(3)4/h5-6H,1-4H3
- InChI Key
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N
- Formula
- C6H14O
- SMILES
- CC(C)OC(C)C
- Mol. Weight (g/mol)
- 102.17
- CAS
- 108-20-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 978.2 |
| 303.15 | 0.0742 | 958.3 |
| 303.15 | 0.1544 | 936.8 |
| 303.15 | 0.2393 | 914.0 |
| 303.15 | 0.3269 | 890.6 |
| 303.15 | 0.4266 | 864.1 |
| 303.15 | 0.5274 | 837.3 |
| 303.15 | 0.6283 | 810.5 |
| 303.15 | 0.7442 | 779.8 |
| 303.15 | 0.8661 | 747.7 |
| 303.15 | 1.0000 | 713.3 |
| 313.15 | 0.0000 | 969.8 |
| 313.15 | 0.0742 | 951.4 |
| 313.15 | 0.1544 | 930.5 |
| 313.15 | 0.2393 | 907.9 |
| 313.15 | 0.3269 | 884.5 |
| 313.15 | 0.4266 | 857.8 |
| 313.15 | 0.5274 | 831.0 |
| 313.15 | 0.6283 | 804.2 |
| 313.15 | 0.7442 | 773.2 |
| 313.15 | 0.8661 | 740.1 |
| 313.15 | 1.0000 | 702.9 |
| 323.15 | 0.0000 | 961.5 |
| 323.15 | 0.0742 | 944.6 |
| 323.15 | 0.1544 | 924.4 |
| 323.15 | 0.2393 | 901.9 |
| 323.15 | 0.3269 | 878.3 |
| 323.15 | 0.4266 | 851.4 |
| 323.15 | 0.5274 | 824.5 |
| 323.15 | 0.6283 | 797.7 |
| 323.15 | 0.7442 | 766.6 |
| 323.15 | 0.8661 | 732.5 |
| 323.15 | 1.0000 | 692.3 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 978.2 |
| 303.15 | 0.0742 | 958.3 |
| 303.15 | 0.1544 | 936.8 |
| 303.15 | 0.2393 | 914.0 |
| 303.15 | 0.3269 | 890.6 |
| 303.15 | 0.4266 | 864.1 |
| 303.15 | 0.5274 | 837.3 |
| 303.15 | 0.6283 | 810.5 |
| 303.15 | 0.7442 | 779.8 |
| 303.15 | 0.8661 | 747.7 |
| 303.15 | 1.0000 | 713.3 |
| 313.15 | 0.0000 | 969.8 |
| 313.15 | 0.0742 | 951.4 |
| 313.15 | 0.1544 | 930.5 |
| 313.15 | 0.2393 | 907.9 |
| 313.15 | 0.3269 | 884.5 |
| 313.15 | 0.4266 | 857.8 |
| 313.15 | 0.5274 | 831.0 |
| 313.15 | 0.6283 | 804.2 |
| 313.15 | 0.7442 | 773.2 |
| 313.15 | 0.8661 | 740.1 |
| 313.15 | 1.0000 | 702.9 |
| 323.15 | 0.0000 | 961.5 |
| 323.15 | 0.0742 | 944.6 |
| 323.15 | 0.1544 | 924.4 |
| 323.15 | 0.2393 | 901.9 |
| 323.15 | 0.3269 | 878.3 |
| 323.15 | 0.4266 | 851.4 |
| 323.15 | 0.5274 | 824.5 |
| 323.15 | 0.6283 | 797.7 |
| 323.15 | 0.7442 | 766.6 |
| 323.15 | 0.8661 | 732.5 |
| 323.15 | 1.0000 | 692.3 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (2) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1548.0 |
| 303.15 | 0.0742 | 1501.0 |
| 303.15 | 0.1544 | 1449.0 |
| 303.15 | 0.2393 | 1395.0 |
| 303.15 | 0.3269 | 1342.0 |
| 303.15 | 0.4266 | 1282.0 |
| 303.15 | 0.5274 | 1224.0 |
| 303.15 | 0.6283 | 1169.0 |
| 303.15 | 0.7442 | 1107.0 |
| 303.15 | 0.8661 | 1041.0 |
| 303.15 | 1.0000 | 975.0 |
| 313.15 | 0.0000 | 1512.0 |
| 313.15 | 0.0742 | 1465.0 |
| 313.15 | 0.1544 | 1414.0 |
| 313.15 | 0.2393 | 1360.0 |
| 313.15 | 0.3269 | 1307.0 |
| 313.15 | 0.4266 | 1248.0 |
| 313.15 | 0.5274 | 1190.0 |
| 313.15 | 0.6283 | 1134.0 |
| 313.15 | 0.7442 | 1072.0 |
| 313.15 | 0.8661 | 1007.0 |
| 313.15 | 1.0000 | 934.0 |
| 323.15 | 0.0000 | 1477.0 |
| 323.15 | 0.0742 | 1430.0 |
| 323.15 | 0.1544 | 1379.0 |
| 323.15 | 0.2393 | 1326.0 |
| 323.15 | 0.3269 | 1273.0 |
| 323.15 | 0.4266 | 1214.0 |
| 323.15 | 0.5274 | 1156.0 |
| 323.15 | 0.6283 | 1099.0 |
| 323.15 | 0.7442 | 1035.0 |
| 323.15 | 0.8661 | 966.0 |
| 323.15 | 1.0000 | 892.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (2) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1548.0 |
| 303.15 | 0.0742 | 1501.0 |
| 303.15 | 0.1544 | 1449.0 |
| 303.15 | 0.2393 | 1395.0 |
| 303.15 | 0.3269 | 1342.0 |
| 303.15 | 0.4266 | 1282.0 |
| 303.15 | 0.5274 | 1224.0 |
| 303.15 | 0.6283 | 1169.0 |
| 303.15 | 0.7442 | 1107.0 |
| 303.15 | 0.8661 | 1041.0 |
| 303.15 | 1.0000 | 975.0 |
| 313.15 | 0.0000 | 1512.0 |
| 313.15 | 0.0742 | 1465.0 |
| 313.15 | 0.1544 | 1414.0 |
| 313.15 | 0.2393 | 1360.0 |
| 313.15 | 0.3269 | 1307.0 |
| 313.15 | 0.4266 | 1248.0 |
| 313.15 | 0.5274 | 1190.0 |
| 313.15 | 0.6283 | 1134.0 |
| 313.15 | 0.7442 | 1072.0 |
| 313.15 | 0.8661 | 1007.0 |
| 313.15 | 1.0000 | 934.0 |
| 323.15 | 0.0000 | 1477.0 |
| 323.15 | 0.0742 | 1430.0 |
| 323.15 | 0.1544 | 1379.0 |
| 323.15 | 0.2393 | 1326.0 |
| 323.15 | 0.3269 | 1273.0 |
| 323.15 | 0.4266 | 1214.0 |
| 323.15 | 0.5274 | 1156.0 |
| 323.15 | 0.6283 | 1099.0 |
| 323.15 | 0.7442 | 1035.0 |
| 323.15 | 0.8661 | 966.0 |
| 323.15 | 1.0000 | 892.0 |