- Name
- Benzenamine, N-ethyl-
- InChI
- InChI=1S/C8H11N/c1-2-9-8-6-4-3-5-7-8/h3-7,9H,2H2,1H3
- InChI Key
- OJGMBLNIHDZDGS-UHFFFAOYSA-N
- Formula
- C8H11N
- SMILES
- CCNc1ccccc1
- Mol. Weight (g/mol)
- 121.18
- CAS
- 103-69-5
- Name
- Diisopropyl ether
- InChI
- InChI=1S/C6H14O/c1-5(2)7-6(3)4/h5-6H,1-4H3
- InChI Key
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N
- Formula
- C6H14O
- SMILES
- CC(C)OC(C)C
- Mol. Weight (g/mol)
- 102.17
- CAS
- 108-20-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 952.6 |
| 303.15 | 0.0735 | 936.7 |
| 303.15 | 0.1577 | 917.9 |
| 303.15 | 0.2410 | 899.3 |
| 303.15 | 0.3228 | 880.9 |
| 303.15 | 0.4216 | 858.5 |
| 303.15 | 0.5267 | 833.9 |
| 303.15 | 0.6288 | 809.0 |
| 303.15 | 0.7478 | 778.7 |
| 303.15 | 0.8697 | 746.7 |
| 303.15 | 1.0000 | 713.3 |
| 313.15 | 0.0000 | 944.2 |
| 313.15 | 0.0735 | 929.0 |
| 313.15 | 0.1577 | 910.9 |
| 313.15 | 0.2410 | 892.5 |
| 313.15 | 0.3228 | 874.1 |
| 313.15 | 0.4216 | 851.5 |
| 313.15 | 0.5267 | 826.7 |
| 313.15 | 0.6288 | 801.7 |
| 313.15 | 0.7478 | 771.3 |
| 313.15 | 0.8697 | 738.7 |
| 313.15 | 1.0000 | 702.9 |
| 323.15 | 0.0000 | 935.9 |
| 323.15 | 0.0735 | 921.2 |
| 323.15 | 0.1577 | 903.7 |
| 323.15 | 0.2410 | 885.7 |
| 323.15 | 0.3228 | 867.4 |
| 323.15 | 0.4216 | 844.6 |
| 323.15 | 0.5267 | 819.5 |
| 323.15 | 0.6288 | 794.4 |
| 323.15 | 0.7478 | 763.9 |
| 323.15 | 0.8697 | 730.8 |
| 323.15 | 1.0000 | 692.3 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 952.6 |
| 303.15 | 0.0735 | 936.7 |
| 303.15 | 0.1577 | 917.9 |
| 303.15 | 0.2410 | 899.3 |
| 303.15 | 0.3228 | 880.9 |
| 303.15 | 0.4216 | 858.5 |
| 303.15 | 0.5267 | 833.9 |
| 303.15 | 0.6288 | 809.0 |
| 303.15 | 0.7478 | 778.7 |
| 303.15 | 0.8697 | 746.7 |
| 303.15 | 1.0000 | 713.3 |
| 313.15 | 0.0000 | 944.2 |
| 313.15 | 0.0735 | 929.0 |
| 313.15 | 0.1577 | 910.9 |
| 313.15 | 0.2410 | 892.5 |
| 313.15 | 0.3228 | 874.1 |
| 313.15 | 0.4216 | 851.5 |
| 313.15 | 0.5267 | 826.7 |
| 313.15 | 0.6288 | 801.7 |
| 313.15 | 0.7478 | 771.3 |
| 313.15 | 0.8697 | 738.7 |
| 313.15 | 1.0000 | 702.9 |
| 323.15 | 0.0000 | 935.9 |
| 323.15 | 0.0735 | 921.2 |
| 323.15 | 0.1577 | 903.7 |
| 323.15 | 0.2410 | 885.7 |
| 323.15 | 0.3228 | 867.4 |
| 323.15 | 0.4216 | 844.6 |
| 323.15 | 0.5267 | 819.5 |
| 323.15 | 0.6288 | 794.4 |
| 323.15 | 0.7478 | 763.9 |
| 323.15 | 0.8697 | 730.8 |
| 323.15 | 1.0000 | 692.3 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (2) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1497.0 |
| 303.15 | 0.0735 | 1459.0 |
| 303.15 | 0.1577 | 1417.0 |
| 303.15 | 0.2410 | 1372.0 |
| 303.15 | 0.3228 | 1329.0 |
| 303.15 | 0.4216 | 1275.0 |
| 303.15 | 0.5267 | 1219.0 |
| 303.15 | 0.6288 | 1167.0 |
| 303.15 | 0.7478 | 1105.0 |
| 303.15 | 0.8697 | 1043.0 |
| 303.15 | 1.0000 | 975.0 |
| 313.15 | 0.0000 | 1462.0 |
| 313.15 | 0.0735 | 1425.0 |
| 313.15 | 0.1577 | 1382.0 |
| 313.15 | 0.2410 | 1340.0 |
| 313.15 | 0.3228 | 1296.0 |
| 313.15 | 0.4216 | 1243.0 |
| 313.15 | 0.5267 | 1187.0 |
| 313.15 | 0.6288 | 1132.0 |
| 313.15 | 0.7478 | 1068.0 |
| 313.15 | 0.8697 | 1004.0 |
| 313.15 | 1.0000 | 934.0 |
| 323.15 | 0.0000 | 1431.0 |
| 323.15 | 0.0735 | 1391.0 |
| 323.15 | 0.1577 | 1346.0 |
| 323.15 | 0.2410 | 1301.0 |
| 323.15 | 0.3228 | 1258.0 |
| 323.15 | 0.4216 | 1205.0 |
| 323.15 | 0.5267 | 1149.0 |
| 323.15 | 0.6288 | 1094.0 |
| 323.15 | 0.7478 | 1030.0 |
| 323.15 | 0.8697 | 963.0 |
| 323.15 | 1.0000 | 892.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (2) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1497.0 |
| 303.15 | 0.0735 | 1459.0 |
| 303.15 | 0.1577 | 1417.0 |
| 303.15 | 0.2410 | 1372.0 |
| 303.15 | 0.3228 | 1329.0 |
| 303.15 | 0.4216 | 1275.0 |
| 303.15 | 0.5267 | 1219.0 |
| 303.15 | 0.6288 | 1167.0 |
| 303.15 | 0.7478 | 1105.0 |
| 303.15 | 0.8697 | 1043.0 |
| 303.15 | 1.0000 | 975.0 |
| 313.15 | 0.0000 | 1462.0 |
| 313.15 | 0.0735 | 1425.0 |
| 313.15 | 0.1577 | 1382.0 |
| 313.15 | 0.2410 | 1340.0 |
| 313.15 | 0.3228 | 1296.0 |
| 313.15 | 0.4216 | 1243.0 |
| 313.15 | 0.5267 | 1187.0 |
| 313.15 | 0.6288 | 1132.0 |
| 313.15 | 0.7478 | 1068.0 |
| 313.15 | 0.8697 | 1004.0 |
| 313.15 | 1.0000 | 934.0 |
| 323.15 | 0.0000 | 1431.0 |
| 323.15 | 0.0735 | 1391.0 |
| 323.15 | 0.1577 | 1346.0 |
| 323.15 | 0.2410 | 1301.0 |
| 323.15 | 0.3228 | 1258.0 |
| 323.15 | 0.4216 | 1205.0 |
| 323.15 | 0.5267 | 1149.0 |
| 323.15 | 0.6288 | 1094.0 |
| 323.15 | 0.7478 | 1030.0 |
| 323.15 | 0.8697 | 963.0 |
| 323.15 | 1.0000 | 892.0 |