- Name
- 1-Propene, 2-methyl-
- InChI
- InChI=1S/C4H8/c1-4(2)3/h1H2,2-3H3
- InChI Key
- VQTUBCCKSQIDNK-UHFFFAOYSA-N
- Formula
- C4H8
- SMILES
- C=C(C)C
- Mol. Weight (g/mol)
- 56.11
- CAS
- 115-11-7
- Name
- Thiophene
- InChI
- InChI=1S/C4H4S/c1-2-4-5-3-1/h1-4H
- InChI Key
- YTPLMLYBLZKORZ-UHFFFAOYSA-N
- Formula
- C4H4S
- SMILES
- c1ccsc1
- Mol. Weight (g/mol)
- 84.14
- CAS
- 110-02-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1-Propene, 2-methyl- (1) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 308.11 | 0.0359 | 42.80 |
| 308.11 | 0.5965 | 281.40 |
| 308.11 | 0.6468 | 295.50 |
| 308.11 | 0.8467 | 356.60 |
| 308.11 | 0.8971 | 374.10 |
| 308.12 | 0.0000 | 16.70 |
| 308.12 | 0.0161 | 28.90 |
| 308.12 | 0.0536 | 54.80 |
| 308.12 | 0.0973 | 81.80 |
| 308.12 | 0.1462 | 108.90 |
| 308.12 | 0.1946 | 133.20 |
| 308.12 | 0.2443 | 155.80 |
| 308.12 | 0.2944 | 176.90 |
| 308.12 | 0.3442 | 196.50 |
| 308.12 | 0.3950 | 215.70 |
| 308.12 | 0.4465 | 234.80 |
| 308.12 | 0.4968 | 254.20 |
| 308.12 | 0.4972 | 255.40 |
| 308.12 | 0.5476 | 268.30 |
| 308.12 | 0.6972 | 310.10 |
| 308.12 | 0.7966 | 340.30 |
| 308.12 | 0.9491 | 393.30 |
| 308.12 | 0.9693 | 401.00 |
| 308.12 | 0.9912 | 409.40 |
| 308.13 | 0.7467 | 325.10 |
| 308.13 | 1.0000 | 413.70 |
| 336.83 | 0.0000 | 51.20 |
| 336.83 | 0.2938 | 352.20 |
| 336.84 | 0.0058 | 59.20 |
| 336.84 | 0.0283 | 88.70 |
| 336.84 | 0.0468 | 111.80 |
| 336.84 | 0.0940 | 166.70 |
| 336.84 | 0.1422 | 217.50 |
| 336.84 | 0.1915 | 264.90 |
| 336.84 | 0.2416 | 309.30 |
| 336.84 | 0.3461 | 392.50 |
| 336.84 | 0.3958 | 428.90 |
| 336.84 | 0.4472 | 465.50 |
| 336.84 | 0.4975 | 500.60 |
| 336.84 | 0.6444 | 594.50 |
| 336.84 | 0.6934 | 625.90 |
| 336.84 | 0.7433 | 658.70 |
| 336.84 | 0.9685 | 827.50 |
| 336.84 | 0.9900 | 846.00 |
| 336.84 | 1.0000 | 855.50 |
| 336.85 | 0.4955 | 501.00 |
| 336.85 | 0.5446 | 531.80 |
| 336.85 | 0.5931 | 562.00 |
| 336.85 | 0.7949 | 694.10 |
| 336.85 | 0.8458 | 730.60 |
| 336.85 | 0.8967 | 768.90 |
| 336.85 | 0.9479 | 809.90 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1-Propene, 2-methyl- (1) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 308.11 | 0.0359 | 42.80 |
| 308.11 | 0.5965 | 281.40 |
| 308.11 | 0.6468 | 295.50 |
| 308.11 | 0.8467 | 356.60 |
| 308.11 | 0.8971 | 374.10 |
| 308.12 | 0.0000 | 16.70 |
| 308.12 | 0.0161 | 28.90 |
| 308.12 | 0.0536 | 54.80 |
| 308.12 | 0.0973 | 81.80 |
| 308.12 | 0.1462 | 108.90 |
| 308.12 | 0.1946 | 133.20 |
| 308.12 | 0.2443 | 155.80 |
| 308.12 | 0.2944 | 176.90 |
| 308.12 | 0.3442 | 196.50 |
| 308.12 | 0.3950 | 215.70 |
| 308.12 | 0.4465 | 234.80 |
| 308.12 | 0.4968 | 254.20 |
| 308.12 | 0.4972 | 255.40 |
| 308.12 | 0.5476 | 268.30 |
| 308.12 | 0.6972 | 310.10 |
| 308.12 | 0.7966 | 340.30 |
| 308.12 | 0.9491 | 393.30 |
| 308.12 | 0.9693 | 401.00 |
| 308.12 | 0.9912 | 409.40 |
| 308.13 | 0.7467 | 325.10 |
| 308.13 | 1.0000 | 413.70 |
| 336.83 | 0.0000 | 51.20 |
| 336.83 | 0.2938 | 352.20 |
| 336.84 | 0.0058 | 59.20 |
| 336.84 | 0.0283 | 88.70 |
| 336.84 | 0.0468 | 111.80 |
| 336.84 | 0.0940 | 166.70 |
| 336.84 | 0.1422 | 217.50 |
| 336.84 | 0.1915 | 264.90 |
| 336.84 | 0.2416 | 309.30 |
| 336.84 | 0.3461 | 392.50 |
| 336.84 | 0.3958 | 428.90 |
| 336.84 | 0.4472 | 465.50 |
| 336.84 | 0.4975 | 500.60 |
| 336.84 | 0.6444 | 594.50 |
| 336.84 | 0.6934 | 625.90 |
| 336.84 | 0.7433 | 658.70 |
| 336.84 | 0.9685 | 827.50 |
| 336.84 | 0.9900 | 846.00 |
| 336.84 | 1.0000 | 855.50 |
| 336.85 | 0.4955 | 501.00 |
| 336.85 | 0.5446 | 531.80 |
| 336.85 | 0.5931 | 562.00 |
| 336.85 | 0.7949 | 694.10 |
| 336.85 | 0.8458 | 730.60 |
| 336.85 | 0.8967 | 768.90 |
| 336.85 | 0.9479 | 809.90 |