- Name
- Nonane
- InChI
- InChI=1S/C9H20/c1-3-5-7-9-8-6-4-2/h3-9H2,1-2H3
- InChI Key
- BKIMMITUMNQMOS-UHFFFAOYSA-N
- Formula
- C9H20
- SMILES
- CCCCCCCCC
- Mol. Weight (g/mol)
- 128.26
- CAS
- 111-84-2
- Name
- 4,7-Methano-1H-indene, octahydro-
- InChI
- InChI=1S/C10H16/c1-2-9-7-4-5-8(6-7)10(9)3-1/h7-10H,1-6H2
- InChI Key
- LPSXSORODABQKT-UHFFFAOYSA-N
- Formula
- C10H16
- SMILES
- C1CC2C3CCC(C3)C2C1
- Mol. Weight (g/mol)
- 136.23
- CAS
- 6004-38-2
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- γ - Surface tension liquid-gas, N/m (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Nonane (1) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0031 |
| 293.15 | 0.1089 | 0.0025 |
| 293.15 | 0.2212 | 0.0020 |
| 293.15 | 0.3244 | 0.0017 |
| 293.15 | 0.4159 | 0.0015 |
| 293.15 | 0.5099 | 0.0013 |
| 293.15 | 0.6161 | 0.0011 |
| 293.15 | 0.7128 | 0.0010 |
| 293.15 | 0.8078 | 0.0009 |
| 293.15 | 0.9133 | 0.0008 |
| 293.15 | 1.0000 | 0.0007 |
| 298.15 | 0.0000 | 0.0028 |
| 298.15 | 0.1089 | 0.0022 |
| 298.15 | 0.2212 | 0.0018 |
| 298.15 | 0.3244 | 0.0015 |
| 298.15 | 0.4159 | 0.0013 |
| 298.15 | 0.5099 | 0.0012 |
| 298.15 | 0.6161 | 0.0010 |
| 298.15 | 0.7128 | 0.0009 |
| 298.15 | 0.8078 | 0.0008 |
| 298.15 | 0.9133 | 0.0007 |
| 298.15 | 1.0000 | 0.0007 |
| 303.15 | 0.0000 | 0.0025 |
| 303.15 | 0.1089 | 0.0020 |
| 303.15 | 0.2212 | 0.0017 |
| 303.15 | 0.3244 | 0.0014 |
| 303.15 | 0.4159 | 0.0012 |
| 303.15 | 0.5099 | 0.0011 |
| 303.15 | 0.6161 | 0.0010 |
| 303.15 | 0.7128 | 0.0009 |
| 303.15 | 0.8078 | 0.0008 |
| 303.15 | 0.9133 | 0.0007 |
| 303.15 | 1.0000 | 0.0006 |
| 313.15 | 0.0000 | 0.0021 |
| 313.15 | 0.1089 | 0.0017 |
| 313.15 | 0.2212 | 0.0014 |
| 313.15 | 0.3244 | 0.0012 |
| 313.15 | 0.4159 | 0.0011 |
| 313.15 | 0.5099 | 0.0010 |
| 313.15 | 0.6161 | 0.0008 |
| 313.15 | 0.7128 | 0.0008 |
| 313.15 | 0.8078 | 0.0007 |
| 313.15 | 0.9133 | 0.0006 |
| 313.15 | 1.0000 | 0.0006 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Nonane (1) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0031 |
| 293.15 | 0.1089 | 0.0025 |
| 293.15 | 0.2212 | 0.0020 |
| 293.15 | 0.3244 | 0.0017 |
| 293.15 | 0.4159 | 0.0015 |
| 293.15 | 0.5099 | 0.0013 |
| 293.15 | 0.6161 | 0.0011 |
| 293.15 | 0.7128 | 0.0010 |
| 293.15 | 0.8078 | 0.0009 |
| 293.15 | 0.9133 | 0.0008 |
| 293.15 | 1.0000 | 0.0007 |
| 298.15 | 0.0000 | 0.0028 |
| 298.15 | 0.1089 | 0.0022 |
| 298.15 | 0.2212 | 0.0018 |
| 298.15 | 0.3244 | 0.0015 |
| 298.15 | 0.4159 | 0.0013 |
| 298.15 | 0.5099 | 0.0012 |
| 298.15 | 0.6161 | 0.0010 |
| 298.15 | 0.7128 | 0.0009 |
| 298.15 | 0.8078 | 0.0008 |
| 298.15 | 0.9133 | 0.0007 |
| 298.15 | 1.0000 | 0.0007 |
| 303.15 | 0.0000 | 0.0025 |
| 303.15 | 0.1089 | 0.0020 |
| 303.15 | 0.2212 | 0.0017 |
| 303.15 | 0.3244 | 0.0014 |
| 303.15 | 0.4159 | 0.0012 |
| 303.15 | 0.5099 | 0.0011 |
| 303.15 | 0.6161 | 0.0010 |
| 303.15 | 0.7128 | 0.0009 |
| 303.15 | 0.8078 | 0.0008 |
| 303.15 | 0.9133 | 0.0007 |
| 303.15 | 1.0000 | 0.0006 |
| 313.15 | 0.0000 | 0.0021 |
| 313.15 | 0.1089 | 0.0017 |
| 313.15 | 0.2212 | 0.0014 |
| 313.15 | 0.3244 | 0.0012 |
| 313.15 | 0.4159 | 0.0011 |
| 313.15 | 0.5099 | 0.0010 |
| 313.15 | 0.6161 | 0.0008 |
| 313.15 | 0.7128 | 0.0008 |
| 313.15 | 0.8078 | 0.0007 |
| 313.15 | 0.9133 | 0.0006 |
| 313.15 | 1.0000 | 0.0006 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Nonane (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.0000 | 1.4877 |
| 293.15 | 0.1089 | 1.4777 |
| 293.15 | 0.2212 | 1.4667 |
| 293.15 | 0.3244 | 1.457 |
| 293.15 | 0.4159 | 1.45 |
| 293.15 | 0.5099 | 1.4422 |
| 293.15 | 0.6161 | 1.4332 |
| 293.15 | 0.7128 | 1.426 |
| 293.15 | 0.8078 | 1.4192 |
| 293.15 | 0.9133 | 1.4114 |
| 293.15 | 1.0000 | 1.4048 |
| 303.15 | 0.0000 | 1.4832 |
| 303.15 | 0.1089 | 1.4728 |
| 303.15 | 0.2212 | 1.4627 |
| 303.15 | 0.3244 | 1.4517 |
| 303.15 | 0.4159 | 1.445 |
| 303.15 | 0.5099 | 1.4377 |
| 303.15 | 0.6161 | 1.4282 |
| 303.15 | 0.7128 | 1.421 |
| 303.15 | 0.8078 | 1.4139 |
| 303.15 | 0.9133 | 1.4062 |
| 303.15 | 1.0000 | 1.4001 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Nonane (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.0000 | 1.4877 |
| 293.15 | 0.1089 | 1.4777 |
| 293.15 | 0.2212 | 1.4667 |
| 293.15 | 0.3244 | 1.457 |
| 293.15 | 0.4159 | 1.45 |
| 293.15 | 0.5099 | 1.4422 |
| 293.15 | 0.6161 | 1.4332 |
| 293.15 | 0.7128 | 1.426 |
| 293.15 | 0.8078 | 1.4192 |
| 293.15 | 0.9133 | 1.4114 |
| 293.15 | 1.0000 | 1.4048 |
| 303.15 | 0.0000 | 1.4832 |
| 303.15 | 0.1089 | 1.4728 |
| 303.15 | 0.2212 | 1.4627 |
| 303.15 | 0.3244 | 1.4517 |
| 303.15 | 0.4159 | 1.445 |
| 303.15 | 0.5099 | 1.4377 |
| 303.15 | 0.6161 | 1.4282 |
| 303.15 | 0.7128 | 1.421 |
| 303.15 | 0.8078 | 1.4139 |
| 303.15 | 0.9133 | 1.4062 |
| 303.15 | 1.0000 | 1.4001 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Nonane (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 935.3 |
| 293.15 | 0.1089 | 907.6 |
| 293.15 | 0.2212 | 880.1 |
| 293.15 | 0.3244 | 855.8 |
| 293.15 | 0.4159 | 835.1 |
| 293.15 | 0.5099 | 814.5 |
| 293.15 | 0.6161 | 792.0 |
| 293.15 | 0.7128 | 772.3 |
| 293.15 | 0.8078 | 753.7 |
| 293.15 | 0.9133 | 733.7 |
| 293.15 | 1.0000 | 717.8 |
| 298.15 | 0.0000 | 931.4 |
| 298.15 | 0.1089 | 903.7 |
| 298.15 | 0.2212 | 876.2 |
| 298.15 | 0.3244 | 851.9 |
| 298.15 | 0.4159 | 831.2 |
| 298.15 | 0.5099 | 810.6 |
| 298.15 | 0.6161 | 788.1 |
| 298.15 | 0.7128 | 768.4 |
| 298.15 | 0.8078 | 749.8 |
| 298.15 | 0.9133 | 729.8 |
| 298.15 | 1.0000 | 713.9 |
| 303.15 | 0.0000 | 927.5 |
| 303.15 | 0.1089 | 899.8 |
| 303.15 | 0.2212 | 872.3 |
| 303.15 | 0.3244 | 848.0 |
| 303.15 | 0.4159 | 827.2 |
| 303.15 | 0.5099 | 806.6 |
| 303.15 | 0.6161 | 784.2 |
| 303.15 | 0.7128 | 764.5 |
| 303.15 | 0.8078 | 745.9 |
| 303.15 | 0.9133 | 725.9 |
| 303.15 | 1.0000 | 710.0 |
| 313.15 | 0.0000 | 919.6 |
| 313.15 | 0.1089 | 891.9 |
| 313.15 | 0.2212 | 864.4 |
| 313.15 | 0.3244 | 840.1 |
| 313.15 | 0.4159 | 819.4 |
| 313.15 | 0.5099 | 798.8 |
| 313.15 | 0.6161 | 776.3 |
| 313.15 | 0.7128 | 756.7 |
| 313.15 | 0.8078 | 738.0 |
| 313.15 | 0.9133 | 718.1 |
| 313.15 | 1.0000 | 702.1 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Nonane (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 935.3 |
| 293.15 | 0.1089 | 907.6 |
| 293.15 | 0.2212 | 880.1 |
| 293.15 | 0.3244 | 855.8 |
| 293.15 | 0.4159 | 835.1 |
| 293.15 | 0.5099 | 814.5 |
| 293.15 | 0.6161 | 792.0 |
| 293.15 | 0.7128 | 772.3 |
| 293.15 | 0.8078 | 753.7 |
| 293.15 | 0.9133 | 733.7 |
| 293.15 | 1.0000 | 717.8 |
| 298.15 | 0.0000 | 931.4 |
| 298.15 | 0.1089 | 903.7 |
| 298.15 | 0.2212 | 876.2 |
| 298.15 | 0.3244 | 851.9 |
| 298.15 | 0.4159 | 831.2 |
| 298.15 | 0.5099 | 810.6 |
| 298.15 | 0.6161 | 788.1 |
| 298.15 | 0.7128 | 768.4 |
| 298.15 | 0.8078 | 749.8 |
| 298.15 | 0.9133 | 729.8 |
| 298.15 | 1.0000 | 713.9 |
| 303.15 | 0.0000 | 927.5 |
| 303.15 | 0.1089 | 899.8 |
| 303.15 | 0.2212 | 872.3 |
| 303.15 | 0.3244 | 848.0 |
| 303.15 | 0.4159 | 827.2 |
| 303.15 | 0.5099 | 806.6 |
| 303.15 | 0.6161 | 784.2 |
| 303.15 | 0.7128 | 764.5 |
| 303.15 | 0.8078 | 745.9 |
| 303.15 | 0.9133 | 725.9 |
| 303.15 | 1.0000 | 710.0 |
| 313.15 | 0.0000 | 919.6 |
| 313.15 | 0.1089 | 891.9 |
| 313.15 | 0.2212 | 864.4 |
| 313.15 | 0.3244 | 840.1 |
| 313.15 | 0.4159 | 819.4 |
| 313.15 | 0.5099 | 798.8 |
| 313.15 | 0.6161 | 776.3 |
| 313.15 | 0.7128 | 756.7 |
| 313.15 | 0.8078 | 738.0 |
| 313.15 | 0.9133 | 718.1 |
| 313.15 | 1.0000 | 702.1 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Nonane (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 293.15 | 0.0000 | 0.0319 |
| 293.15 | 0.1089 | 0.0302 |
| 293.15 | 0.2212 | 0.0279 |
| 293.15 | 0.3244 | 0.0271 |
| 293.15 | 0.4159 | 0.0263 |
| 293.15 | 0.5099 | 0.0256 |
| 293.15 | 0.6161 | 0.0244 |
| 293.15 | 0.7128 | 0.0238 |
| 293.15 | 0.8078 | 0.0231 |
| 293.15 | 0.9133 | 0.0226 |
| 293.15 | 1.0000 | 0.0222 |
| 303.15 | 0.0000 | 0.0311 |
| 303.15 | 0.1089 | 0.0290 |
| 303.15 | 0.2212 | 0.0274 |
| 303.15 | 0.3244 | 0.0266 |
| 303.15 | 0.4159 | 0.0257 |
| 303.15 | 0.5099 | 0.0249 |
| 303.15 | 0.6161 | 0.0234 |
| 303.15 | 0.7128 | 0.0229 |
| 303.15 | 0.8078 | 0.0224 |
| 303.15 | 0.9133 | 0.0218 |
| 303.15 | 1.0000 | 0.0214 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Nonane (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 293.15 | 0.0000 | 0.0319 |
| 293.15 | 0.1089 | 0.0302 |
| 293.15 | 0.2212 | 0.0279 |
| 293.15 | 0.3244 | 0.0271 |
| 293.15 | 0.4159 | 0.0263 |
| 293.15 | 0.5099 | 0.0256 |
| 293.15 | 0.6161 | 0.0244 |
| 293.15 | 0.7128 | 0.0238 |
| 293.15 | 0.8078 | 0.0231 |
| 293.15 | 0.9133 | 0.0226 |
| 293.15 | 1.0000 | 0.0222 |
| 303.15 | 0.0000 | 0.0311 |
| 303.15 | 0.1089 | 0.0290 |
| 303.15 | 0.2212 | 0.0274 |
| 303.15 | 0.3244 | 0.0266 |
| 303.15 | 0.4159 | 0.0257 |
| 303.15 | 0.5099 | 0.0249 |
| 303.15 | 0.6161 | 0.0234 |
| 303.15 | 0.7128 | 0.0229 |
| 303.15 | 0.8078 | 0.0224 |
| 303.15 | 0.9133 | 0.0218 |
| 303.15 | 1.0000 | 0.0214 |