- Name
- Ethanol
- InChI
- InChI=1S/C2H6O/c1-2-3/h3H,2H2,1H3
- InChI Key
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N
- Formula
- C2H6O
- SMILES
- CCO
- Mol. Weight (g/mol)
- 46.07
- CAS
- 64-17-5
- Name
- 1-Naphthalenamine
- InChI
- InChI=1S/C10H9N/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,11H2
- InChI Key
- RUFPHBVGCFYCNW-UHFFFAOYSA-N
- Formula
- C10H9N
- SMILES
- Nc1cccc2ccccc12
- Mol. Weight (g/mol)
- 143.19
- CAS
- 134-32-7
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of 1-Naphthalenamine (2) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0012 |
| 293.15 | 0.4996 | 0.0013 |
| 293.15 | 0.9988 | 0.0015 |
| 293.15 | 1.9975 | 0.0017 |
| 293.15 | 2.9966 | 0.0020 |
| 293.15 | 3.9949 | 0.0023 |
| 293.15 | 4.9929 | 0.0027 |
| 293.15 | 5.9924 | 0.0030 |
| 303.15 | 0.0000 | 0.0010 |
| 303.15 | 0.4996 | 0.0011 |
| 303.15 | 0.9988 | 0.0012 |
| 303.15 | 1.9975 | 0.0014 |
| 303.15 | 2.9966 | 0.0016 |
| 303.15 | 3.9949 | 0.0018 |
| 303.15 | 4.9929 | 0.0020 |
| 303.15 | 5.9924 | 0.0023 |
| 313.15 | 0.0000 | 0.0008 |
| 313.15 | 0.4996 | 0.0009 |
| 313.15 | 0.9988 | 0.0010 |
| 313.15 | 1.9975 | 0.0011 |
| 313.15 | 2.9966 | 0.0013 |
| 313.15 | 3.9949 | 0.0014 |
| 313.15 | 4.9929 | 0.0016 |
| 313.15 | 5.9924 | 0.0018 |
| 323.15 | 0.0000 | 0.0007 |
| 323.15 | 0.4996 | 0.0007 |
| 323.15 | 0.9988 | 0.0008 |
| 323.15 | 1.9975 | 0.0009 |
| 323.15 | 2.9966 | 0.0010 |
| 323.15 | 3.9949 | 0.0011 |
| 323.15 | 4.9929 | 0.0013 |
| 323.15 | 5.9924 | 0.0014 |
| 333.15 | 0.0000 | 0.0006 |
| 333.15 | 0.4996 | 0.0006 |
| 333.15 | 0.9988 | 0.0007 |
| 333.15 | 1.9975 | 0.0007 |
| 333.15 | 2.9966 | 0.0008 |
| 333.15 | 3.9949 | 0.0009 |
| 333.15 | 4.9929 | 0.0010 |
| 333.15 | 5.9924 | 0.0011 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of 1-Naphthalenamine (2) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0012 |
| 293.15 | 0.4996 | 0.0013 |
| 293.15 | 0.9988 | 0.0015 |
| 293.15 | 1.9975 | 0.0017 |
| 293.15 | 2.9966 | 0.0020 |
| 293.15 | 3.9949 | 0.0023 |
| 293.15 | 4.9929 | 0.0027 |
| 293.15 | 5.9924 | 0.0030 |
| 303.15 | 0.0000 | 0.0010 |
| 303.15 | 0.4996 | 0.0011 |
| 303.15 | 0.9988 | 0.0012 |
| 303.15 | 1.9975 | 0.0014 |
| 303.15 | 2.9966 | 0.0016 |
| 303.15 | 3.9949 | 0.0018 |
| 303.15 | 4.9929 | 0.0020 |
| 303.15 | 5.9924 | 0.0023 |
| 313.15 | 0.0000 | 0.0008 |
| 313.15 | 0.4996 | 0.0009 |
| 313.15 | 0.9988 | 0.0010 |
| 313.15 | 1.9975 | 0.0011 |
| 313.15 | 2.9966 | 0.0013 |
| 313.15 | 3.9949 | 0.0014 |
| 313.15 | 4.9929 | 0.0016 |
| 313.15 | 5.9924 | 0.0018 |
| 323.15 | 0.0000 | 0.0007 |
| 323.15 | 0.4996 | 0.0007 |
| 323.15 | 0.9988 | 0.0008 |
| 323.15 | 1.9975 | 0.0009 |
| 323.15 | 2.9966 | 0.0010 |
| 323.15 | 3.9949 | 0.0011 |
| 323.15 | 4.9929 | 0.0013 |
| 323.15 | 5.9924 | 0.0014 |
| 333.15 | 0.0000 | 0.0006 |
| 333.15 | 0.4996 | 0.0006 |
| 333.15 | 0.9988 | 0.0007 |
| 333.15 | 1.9975 | 0.0007 |
| 333.15 | 2.9966 | 0.0008 |
| 333.15 | 3.9949 | 0.0009 |
| 333.15 | 4.9929 | 0.0010 |
| 333.15 | 5.9924 | 0.0011 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of 1-Naphthalenamine (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 790.08 |
| 293.15 | 0.4996 | 809.42 |
| 293.15 | 0.9988 | 826.91 |
| 293.15 | 1.9975 | 856.99 |
| 293.15 | 2.9966 | 882.03 |
| 293.15 | 3.9949 | 903.36 |
| 293.15 | 4.9929 | 922.23 |
| 293.15 | 5.9924 | 938.63 |
| 303.15 | 0.0000 | 781.0 |
| 303.15 | 0.4996 | 800.39 |
| 303.15 | 0.9988 | 817.97 |
| 303.15 | 1.9975 | 848.0 |
| 303.15 | 2.9966 | 873.42 |
| 303.15 | 3.9949 | 894.68 |
| 303.15 | 4.9929 | 913.66 |
| 303.15 | 5.9924 | 929.72 |
| 313.15 | 0.0000 | 772.31 |
| 313.15 | 0.4996 | 791.75 |
| 313.15 | 0.9988 | 809.41 |
| 313.15 | 1.9975 | 839.69 |
| 313.15 | 2.9966 | 864.64 |
| 313.15 | 3.9949 | 885.71 |
| 313.15 | 4.9929 | 904.69 |
| 313.15 | 5.9924 | 921.15 |
| 323.15 | 0.0000 | 763.35 |
| 323.15 | 0.4996 | 782.89 |
| 323.15 | 0.9988 | 800.36 |
| 323.15 | 1.9975 | 830.87 |
| 323.15 | 2.9966 | 855.75 |
| 323.15 | 3.9949 | 876.99 |
| 323.15 | 4.9929 | 895.99 |
| 323.15 | 5.9924 | 912.41 |
| 333.15 | 0.0000 | 754.2 |
| 333.15 | 0.4996 | 773.73 |
| 333.15 | 0.9988 | 791.31 |
| 333.15 | 1.9975 | 821.59 |
| 333.15 | 2.9966 | 846.64 |
| 333.15 | 3.9949 | 867.66 |
| 333.15 | 4.9929 | 886.79 |
| 333.15 | 5.9924 | 903.3 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of 1-Naphthalenamine (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 790.08 |
| 293.15 | 0.4996 | 809.42 |
| 293.15 | 0.9988 | 826.91 |
| 293.15 | 1.9975 | 856.99 |
| 293.15 | 2.9966 | 882.03 |
| 293.15 | 3.9949 | 903.36 |
| 293.15 | 4.9929 | 922.23 |
| 293.15 | 5.9924 | 938.63 |
| 303.15 | 0.0000 | 781.0 |
| 303.15 | 0.4996 | 800.39 |
| 303.15 | 0.9988 | 817.97 |
| 303.15 | 1.9975 | 848.0 |
| 303.15 | 2.9966 | 873.42 |
| 303.15 | 3.9949 | 894.68 |
| 303.15 | 4.9929 | 913.66 |
| 303.15 | 5.9924 | 929.72 |
| 313.15 | 0.0000 | 772.31 |
| 313.15 | 0.4996 | 791.75 |
| 313.15 | 0.9988 | 809.41 |
| 313.15 | 1.9975 | 839.69 |
| 313.15 | 2.9966 | 864.64 |
| 313.15 | 3.9949 | 885.71 |
| 313.15 | 4.9929 | 904.69 |
| 313.15 | 5.9924 | 921.15 |
| 323.15 | 0.0000 | 763.35 |
| 323.15 | 0.4996 | 782.89 |
| 323.15 | 0.9988 | 800.36 |
| 323.15 | 1.9975 | 830.87 |
| 323.15 | 2.9966 | 855.75 |
| 323.15 | 3.9949 | 876.99 |
| 323.15 | 4.9929 | 895.99 |
| 323.15 | 5.9924 | 912.41 |
| 333.15 | 0.0000 | 754.2 |
| 333.15 | 0.4996 | 773.73 |
| 333.15 | 0.9988 | 791.31 |
| 333.15 | 1.9975 | 821.59 |
| 333.15 | 2.9966 | 846.64 |
| 333.15 | 3.9949 | 867.66 |
| 333.15 | 4.9929 | 886.79 |
| 333.15 | 5.9924 | 903.3 |