- Name
- 1-Propanol
- InChI
- InChI=1S/C3H8O/c1-2-3-4/h4H,2-3H2,1H3
- InChI Key
- BDERNNFJNOPAEC-UHFFFAOYSA-N
- Formula
- C3H8O
- SMILES
- CCCO
- Mol. Weight (g/mol)
- 60.09
- CAS
- 71-23-8
- Name
- 1-Naphthalenamine
- InChI
- InChI=1S/C10H9N/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,11H2
- InChI Key
- RUFPHBVGCFYCNW-UHFFFAOYSA-N
- Formula
- C10H9N
- SMILES
- Nc1cccc2ccccc12
- Mol. Weight (g/mol)
- 143.19
- CAS
- 134-32-7
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of 1-Naphthalenamine (2) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0022 |
| 293.15 | 0.4994 | 0.0024 |
| 293.15 | 0.9984 | 0.0025 |
| 293.15 | 1.9972 | 0.0028 |
| 293.15 | 2.9954 | 0.0032 |
| 293.15 | 3.9951 | 0.0036 |
| 293.15 | 4.9939 | 0.0041 |
| 293.15 | 5.9939 | 0.0045 |
| 303.15 | 0.0000 | 0.0017 |
| 303.15 | 0.4994 | 0.0018 |
| 303.15 | 0.9984 | 0.0019 |
| 303.15 | 1.9972 | 0.0022 |
| 303.15 | 2.9954 | 0.0024 |
| 303.15 | 3.9951 | 0.0027 |
| 303.15 | 4.9939 | 0.0029 |
| 303.15 | 5.9939 | 0.0032 |
| 313.15 | 0.0000 | 0.0014 |
| 313.15 | 0.4994 | 0.0014 |
| 313.15 | 0.9984 | 0.0015 |
| 313.15 | 1.9972 | 0.0017 |
| 313.15 | 2.9954 | 0.0018 |
| 313.15 | 3.9951 | 0.0020 |
| 313.15 | 4.9939 | 0.0022 |
| 313.15 | 5.9939 | 0.0024 |
| 323.15 | 0.0000 | 0.0011 |
| 323.15 | 0.4994 | 0.0012 |
| 323.15 | 0.9984 | 0.0012 |
| 323.15 | 1.9972 | 0.0013 |
| 323.15 | 2.9954 | 0.0014 |
| 323.15 | 3.9951 | 0.0016 |
| 323.15 | 4.9939 | 0.0017 |
| 323.15 | 5.9939 | 0.0018 |
| 333.15 | 0.0000 | 0.0009 |
| 333.15 | 0.4994 | 0.0009 |
| 333.15 | 0.9984 | 0.0010 |
| 333.15 | 1.9972 | 0.0011 |
| 333.15 | 2.9954 | 0.0012 |
| 333.15 | 3.9951 | 0.0013 |
| 333.15 | 4.9939 | 0.0014 |
| 333.15 | 5.9939 | 0.0015 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of 1-Naphthalenamine (2) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0022 |
| 293.15 | 0.4994 | 0.0024 |
| 293.15 | 0.9984 | 0.0025 |
| 293.15 | 1.9972 | 0.0028 |
| 293.15 | 2.9954 | 0.0032 |
| 293.15 | 3.9951 | 0.0036 |
| 293.15 | 4.9939 | 0.0041 |
| 293.15 | 5.9939 | 0.0045 |
| 303.15 | 0.0000 | 0.0017 |
| 303.15 | 0.4994 | 0.0018 |
| 303.15 | 0.9984 | 0.0019 |
| 303.15 | 1.9972 | 0.0022 |
| 303.15 | 2.9954 | 0.0024 |
| 303.15 | 3.9951 | 0.0027 |
| 303.15 | 4.9939 | 0.0029 |
| 303.15 | 5.9939 | 0.0032 |
| 313.15 | 0.0000 | 0.0014 |
| 313.15 | 0.4994 | 0.0014 |
| 313.15 | 0.9984 | 0.0015 |
| 313.15 | 1.9972 | 0.0017 |
| 313.15 | 2.9954 | 0.0018 |
| 313.15 | 3.9951 | 0.0020 |
| 313.15 | 4.9939 | 0.0022 |
| 313.15 | 5.9939 | 0.0024 |
| 323.15 | 0.0000 | 0.0011 |
| 323.15 | 0.4994 | 0.0012 |
| 323.15 | 0.9984 | 0.0012 |
| 323.15 | 1.9972 | 0.0013 |
| 323.15 | 2.9954 | 0.0014 |
| 323.15 | 3.9951 | 0.0016 |
| 323.15 | 4.9939 | 0.0017 |
| 323.15 | 5.9939 | 0.0018 |
| 333.15 | 0.0000 | 0.0009 |
| 333.15 | 0.4994 | 0.0009 |
| 333.15 | 0.9984 | 0.0010 |
| 333.15 | 1.9972 | 0.0011 |
| 333.15 | 2.9954 | 0.0012 |
| 333.15 | 3.9951 | 0.0013 |
| 333.15 | 4.9939 | 0.0014 |
| 333.15 | 5.9939 | 0.0015 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of 1-Naphthalenamine (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 803.76 |
| 293.15 | 0.4994 | 822.0 |
| 293.15 | 0.9984 | 838.0 |
| 293.15 | 1.9972 | 865.83 |
| 293.15 | 2.9954 | 888.9 |
| 293.15 | 3.9951 | 908.53 |
| 293.15 | 4.9939 | 925.53 |
| 293.15 | 5.9939 | 940.2 |
| 303.15 | 0.0000 | 795.74 |
| 303.15 | 0.4994 | 813.59 |
| 303.15 | 0.9984 | 829.67 |
| 303.15 | 1.9972 | 857.43 |
| 303.15 | 2.9954 | 880.64 |
| 303.15 | 3.9951 | 900.29 |
| 303.15 | 4.9939 | 917.34 |
| 303.15 | 5.9939 | 932.1 |
| 313.15 | 0.0000 | 787.46 |
| 313.15 | 0.4994 | 805.32 |
| 313.15 | 0.9984 | 821.45 |
| 313.15 | 1.9972 | 849.22 |
| 313.15 | 2.9954 | 872.27 |
| 313.15 | 3.9951 | 891.86 |
| 313.15 | 4.9939 | 908.95 |
| 313.15 | 5.9939 | 923.4 |
| 323.15 | 0.0000 | 779.02 |
| 323.15 | 0.4994 | 796.95 |
| 323.15 | 0.9984 | 812.9 |
| 323.15 | 1.9972 | 840.6 |
| 323.15 | 2.9954 | 863.65 |
| 323.15 | 3.9951 | 883.35 |
| 323.15 | 4.9939 | 899.99 |
| 323.15 | 5.9939 | 914.74 |
| 333.15 | 0.0000 | 770.45 |
| 333.15 | 0.4994 | 788.31 |
| 333.15 | 0.9984 | 804.25 |
| 333.15 | 1.9972 | 831.91 |
| 333.15 | 2.9954 | 854.94 |
| 333.15 | 3.9951 | 874.63 |
| 333.15 | 4.9939 | 891.39 |
| 333.15 | 5.9939 | 906.03 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of 1-Naphthalenamine (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 803.76 |
| 293.15 | 0.4994 | 822.0 |
| 293.15 | 0.9984 | 838.0 |
| 293.15 | 1.9972 | 865.83 |
| 293.15 | 2.9954 | 888.9 |
| 293.15 | 3.9951 | 908.53 |
| 293.15 | 4.9939 | 925.53 |
| 293.15 | 5.9939 | 940.2 |
| 303.15 | 0.0000 | 795.74 |
| 303.15 | 0.4994 | 813.59 |
| 303.15 | 0.9984 | 829.67 |
| 303.15 | 1.9972 | 857.43 |
| 303.15 | 2.9954 | 880.64 |
| 303.15 | 3.9951 | 900.29 |
| 303.15 | 4.9939 | 917.34 |
| 303.15 | 5.9939 | 932.1 |
| 313.15 | 0.0000 | 787.46 |
| 313.15 | 0.4994 | 805.32 |
| 313.15 | 0.9984 | 821.45 |
| 313.15 | 1.9972 | 849.22 |
| 313.15 | 2.9954 | 872.27 |
| 313.15 | 3.9951 | 891.86 |
| 313.15 | 4.9939 | 908.95 |
| 313.15 | 5.9939 | 923.4 |
| 323.15 | 0.0000 | 779.02 |
| 323.15 | 0.4994 | 796.95 |
| 323.15 | 0.9984 | 812.9 |
| 323.15 | 1.9972 | 840.6 |
| 323.15 | 2.9954 | 863.65 |
| 323.15 | 3.9951 | 883.35 |
| 323.15 | 4.9939 | 899.99 |
| 323.15 | 5.9939 | 914.74 |
| 333.15 | 0.0000 | 770.45 |
| 333.15 | 0.4994 | 788.31 |
| 333.15 | 0.9984 | 804.25 |
| 333.15 | 1.9972 | 831.91 |
| 333.15 | 2.9954 | 854.94 |
| 333.15 | 3.9951 | 874.63 |
| 333.15 | 4.9939 | 891.39 |
| 333.15 | 5.9939 | 906.03 |