- Name
- 1-Butanol
- InChI
- InChI=1S/C4H10O/c1-2-3-4-5/h5H,2-4H2,1H3
- InChI Key
- LRHPLDYGYMQRHN-UHFFFAOYSA-N
- Formula
- C4H10O
- SMILES
- CCCCO
- Mol. Weight (g/mol)
- 74.12
- CAS
- 71-36-3
- Name
- 1-Naphthalenamine
- InChI
- InChI=1S/C10H9N/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,11H2
- InChI Key
- RUFPHBVGCFYCNW-UHFFFAOYSA-N
- Formula
- C10H9N
- SMILES
- Nc1cccc2ccccc12
- Mol. Weight (g/mol)
- 143.19
- CAS
- 134-32-7
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of 1-Naphthalenamine (2) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0029 |
| 293.15 | 0.4997 | 0.0031 |
| 293.15 | 0.9982 | 0.0032 |
| 293.15 | 1.997 | 0.0035 |
| 293.15 | 2.9964 | 0.0039 |
| 293.15 | 3.9953 | 0.0043 |
| 293.15 | 4.9944 | 0.0047 |
| 293.15 | 5.9926 | 0.0052 |
| 303.15 | 0.0000 | 0.0023 |
| 303.15 | 0.4997 | 0.0024 |
| 303.15 | 0.9982 | 0.0024 |
| 303.15 | 1.997 | 0.0026 |
| 303.15 | 2.9964 | 0.0029 |
| 303.15 | 3.9953 | 0.0031 |
| 303.15 | 4.9944 | 0.0034 |
| 303.15 | 5.9926 | 0.0037 |
| 313.15 | 0.0000 | 0.0018 |
| 313.15 | 0.4997 | 0.0018 |
| 313.15 | 0.9982 | 0.0019 |
| 313.15 | 1.997 | 0.0020 |
| 313.15 | 2.9964 | 0.0022 |
| 313.15 | 3.9953 | 0.0024 |
| 313.15 | 4.9944 | 0.0025 |
| 313.15 | 5.9926 | 0.0027 |
| 323.15 | 0.0000 | 0.0014 |
| 323.15 | 0.4997 | 0.0015 |
| 323.15 | 0.9982 | 0.0015 |
| 323.15 | 1.997 | 0.0016 |
| 323.15 | 2.9964 | 0.0017 |
| 323.15 | 3.9953 | 0.0018 |
| 323.15 | 4.9944 | 0.0020 |
| 323.15 | 5.9926 | 0.0021 |
| 333.15 | 0.0000 | 0.0011 |
| 333.15 | 0.4997 | 0.0012 |
| 333.15 | 0.9982 | 0.0012 |
| 333.15 | 1.997 | 0.0013 |
| 333.15 | 2.9964 | 0.0014 |
| 333.15 | 3.9953 | 0.0015 |
| 333.15 | 4.9944 | 0.0016 |
| 333.15 | 5.9926 | 0.0017 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of 1-Naphthalenamine (2) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0029 |
| 293.15 | 0.4997 | 0.0031 |
| 293.15 | 0.9982 | 0.0032 |
| 293.15 | 1.997 | 0.0035 |
| 293.15 | 2.9964 | 0.0039 |
| 293.15 | 3.9953 | 0.0043 |
| 293.15 | 4.9944 | 0.0047 |
| 293.15 | 5.9926 | 0.0052 |
| 303.15 | 0.0000 | 0.0023 |
| 303.15 | 0.4997 | 0.0024 |
| 303.15 | 0.9982 | 0.0024 |
| 303.15 | 1.997 | 0.0026 |
| 303.15 | 2.9964 | 0.0029 |
| 303.15 | 3.9953 | 0.0031 |
| 303.15 | 4.9944 | 0.0034 |
| 303.15 | 5.9926 | 0.0037 |
| 313.15 | 0.0000 | 0.0018 |
| 313.15 | 0.4997 | 0.0018 |
| 313.15 | 0.9982 | 0.0019 |
| 313.15 | 1.997 | 0.0020 |
| 313.15 | 2.9964 | 0.0022 |
| 313.15 | 3.9953 | 0.0024 |
| 313.15 | 4.9944 | 0.0025 |
| 313.15 | 5.9926 | 0.0027 |
| 323.15 | 0.0000 | 0.0014 |
| 323.15 | 0.4997 | 0.0015 |
| 323.15 | 0.9982 | 0.0015 |
| 323.15 | 1.997 | 0.0016 |
| 323.15 | 2.9964 | 0.0017 |
| 323.15 | 3.9953 | 0.0018 |
| 323.15 | 4.9944 | 0.0020 |
| 323.15 | 5.9926 | 0.0021 |
| 333.15 | 0.0000 | 0.0011 |
| 333.15 | 0.4997 | 0.0012 |
| 333.15 | 0.9982 | 0.0012 |
| 333.15 | 1.997 | 0.0013 |
| 333.15 | 2.9964 | 0.0014 |
| 333.15 | 3.9953 | 0.0015 |
| 333.15 | 4.9944 | 0.0016 |
| 333.15 | 5.9926 | 0.0017 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of 1-Naphthalenamine (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 809.66 |
| 293.15 | 0.4997 | 827.04 |
| 293.15 | 0.9982 | 842.59 |
| 293.15 | 1.997 | 869.21 |
| 293.15 | 2.9964 | 891.09 |
| 293.15 | 3.9953 | 909.35 |
| 293.15 | 4.9944 | 924.85 |
| 293.15 | 5.9926 | 938.21 |
| 303.15 | 0.0000 | 802.03 |
| 303.15 | 0.4997 | 819.38 |
| 303.15 | 0.9982 | 834.83 |
| 303.15 | 1.997 | 861.4 |
| 303.15 | 2.9964 | 883.19 |
| 303.15 | 3.9953 | 901.39 |
| 303.15 | 4.9944 | 916.91 |
| 303.15 | 5.9926 | 930.26 |
| 313.15 | 0.0000 | 794.26 |
| 313.15 | 0.4997 | 811.58 |
| 313.15 | 0.9982 | 826.94 |
| 313.15 | 1.997 | 853.34 |
| 313.15 | 2.9964 | 875.17 |
| 313.15 | 3.9953 | 893.26 |
| 313.15 | 4.9944 | 908.96 |
| 313.15 | 5.9926 | 922.49 |
| 323.15 | 0.0000 | 786.31 |
| 323.15 | 0.4997 | 803.57 |
| 323.15 | 0.9982 | 818.85 |
| 323.15 | 1.997 | 845.17 |
| 323.15 | 2.9964 | 866.81 |
| 323.15 | 3.9953 | 885.12 |
| 323.15 | 4.9944 | 900.78 |
| 323.15 | 5.9926 | 914.28 |
| 333.15 | 0.0000 | 778.16 |
| 333.15 | 0.4997 | 795.39 |
| 333.15 | 0.9982 | 810.62 |
| 333.15 | 1.997 | 836.91 |
| 333.15 | 2.9964 | 858.57 |
| 333.15 | 3.9953 | 876.84 |
| 333.15 | 4.9944 | 892.36 |
| 333.15 | 5.9926 | 906.01 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of 1-Naphthalenamine (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 809.66 |
| 293.15 | 0.4997 | 827.04 |
| 293.15 | 0.9982 | 842.59 |
| 293.15 | 1.997 | 869.21 |
| 293.15 | 2.9964 | 891.09 |
| 293.15 | 3.9953 | 909.35 |
| 293.15 | 4.9944 | 924.85 |
| 293.15 | 5.9926 | 938.21 |
| 303.15 | 0.0000 | 802.03 |
| 303.15 | 0.4997 | 819.38 |
| 303.15 | 0.9982 | 834.83 |
| 303.15 | 1.997 | 861.4 |
| 303.15 | 2.9964 | 883.19 |
| 303.15 | 3.9953 | 901.39 |
| 303.15 | 4.9944 | 916.91 |
| 303.15 | 5.9926 | 930.26 |
| 313.15 | 0.0000 | 794.26 |
| 313.15 | 0.4997 | 811.58 |
| 313.15 | 0.9982 | 826.94 |
| 313.15 | 1.997 | 853.34 |
| 313.15 | 2.9964 | 875.17 |
| 313.15 | 3.9953 | 893.26 |
| 313.15 | 4.9944 | 908.96 |
| 313.15 | 5.9926 | 922.49 |
| 323.15 | 0.0000 | 786.31 |
| 323.15 | 0.4997 | 803.57 |
| 323.15 | 0.9982 | 818.85 |
| 323.15 | 1.997 | 845.17 |
| 323.15 | 2.9964 | 866.81 |
| 323.15 | 3.9953 | 885.12 |
| 323.15 | 4.9944 | 900.78 |
| 323.15 | 5.9926 | 914.28 |
| 333.15 | 0.0000 | 778.16 |
| 333.15 | 0.4997 | 795.39 |
| 333.15 | 0.9982 | 810.62 |
| 333.15 | 1.997 | 836.91 |
| 333.15 | 2.9964 | 858.57 |
| 333.15 | 3.9953 | 876.84 |
| 333.15 | 4.9944 | 892.36 |
| 333.15 | 5.9926 | 906.01 |