- Name
- Carbamic acid, phenyl-, methyl ester
- InChI
- InChI=1S/C8H9NO2/c1-11-8(10)9-7-5-3-2-4-6-7/h2-6H,1H3,(H,9,10)
- InChI Key
- IAGUPODHENSJEZ-UHFFFAOYSA-N
- Formula
- C8H9NO2
- SMILES
- COC(=O)Nc1ccccc1
- Mol. Weight (g/mol)
- 151.16
- CAS
- 2603-10-3
- Name
- Carbamic acid, methyl ester
- InChI
- InChI=1S/C2H5NO2/c1-5-2(3)4/h1H3,(H2,3,4)
- InChI Key
- GTCAXTIRRLKXRU-UHFFFAOYSA-N
- Formula
- C2H5NO2
- SMILES
- COC(N)=O
- Mol. Weight (g/mol)
- 75.07
- CAS
- 598-55-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Boiling temperature at pressure P, K [ref]
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Mole fraction of Carbamic acid, methyl ester (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
| 1.00 | 0.9037 | 340.45 |
| 1.00 | 0.8143 | 341.13 |
| 1.00 | 0.6908 | 342.60 |
| 1.00 | 0.6301 | 345.65 |
| 1.00 | 0.5580 | 346.90 |
| 1.00 | 0.4615 | 349.70 |
| 1.00 | 0.3849 | 354.45 |
| 1.00 | 0.3085 | 355.15 |
| 1.00 | 0.1830 | 356.95 |
| 1.00 | 0.0852 | 368.00 |
| 2.00 | 0.8933 | 351.56 |
| 2.00 | 0.8110 | 351.67 |
| 2.00 | 0.7017 | 354.65 |
| 2.00 | 0.6146 | 355.05 |
| 2.00 | 0.5641 | 357.43 |
| 2.00 | 0.4630 | 358.50 |
| 2.00 | 0.3710 | 362.04 |
| 2.00 | 0.3176 | 363.56 |
| 2.00 | 0.1830 | 369.35 |
| 2.00 | 0.0852 | 380.50 |
| 4.00 | 0.9030 | 366.83 |
| 4.00 | 0.8221 | 367.55 |
| 4.00 | 0.7013 | 368.85 |
| 4.00 | 0.6090 | 369.90 |
| 4.00 | 0.5312 | 371.15 |
| 4.00 | 0.4663 | 372.30 |
| 4.00 | 0.3656 | 376.23 |
| 4.00 | 0.3120 | 378.60 |
| 4.00 | 0.1830 | 381.75 |
| 4.00 | 0.0852 | 391.60 |
| 6.00 | 0.9254 | 375.96 |
| 6.00 | 0.8062 | 375.53 |
| 6.00 | 0.6920 | 378.75 |
| 6.00 | 0.6046 | 379.17 |
| 6.00 | 0.5518 | 380.70 |
| 6.00 | 0.4651 | 381.90 |
| 6.00 | 0.3625 | 385.45 |
| 6.00 | 0.3093 | 387.82 |
| 6.00 | 0.1830 | 392.05 |
| 8.00 | 0.9162 | 382.18 |
| 8.00 | 0.8071 | 382.35 |
| 8.00 | 0.6936 | 384.49 |
| 8.00 | 0.6107 | 385.85 |
| 8.00 | 0.5488 | 386.90 |
| 8.00 | 0.4511 | 388.46 |
| 8.00 | 0.3643 | 391.95 |
Boiling temperature at pressure P, K [ref]
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Mole fraction of Carbamic acid, methyl ester (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
| 1.00 | 0.9037 | 340.45 |
| 1.00 | 0.8143 | 341.13 |
| 1.00 | 0.6908 | 342.60 |
| 1.00 | 0.6301 | 345.65 |
| 1.00 | 0.5580 | 346.90 |
| 1.00 | 0.4615 | 349.70 |
| 1.00 | 0.3849 | 354.45 |
| 1.00 | 0.3085 | 355.15 |
| 1.00 | 0.1830 | 356.95 |
| 1.00 | 0.0852 | 368.00 |
| 2.00 | 0.8933 | 351.56 |
| 2.00 | 0.8110 | 351.67 |
| 2.00 | 0.7017 | 354.65 |
| 2.00 | 0.6146 | 355.05 |
| 2.00 | 0.5641 | 357.43 |
| 2.00 | 0.4630 | 358.50 |
| 2.00 | 0.3710 | 362.04 |
| 2.00 | 0.3176 | 363.56 |
| 2.00 | 0.1830 | 369.35 |
| 2.00 | 0.0852 | 380.50 |
| 4.00 | 0.9030 | 366.83 |
| 4.00 | 0.8221 | 367.55 |
| 4.00 | 0.7013 | 368.85 |
| 4.00 | 0.6090 | 369.90 |
| 4.00 | 0.5312 | 371.15 |
| 4.00 | 0.4663 | 372.30 |
| 4.00 | 0.3656 | 376.23 |
| 4.00 | 0.3120 | 378.60 |
| 4.00 | 0.1830 | 381.75 |
| 4.00 | 0.0852 | 391.60 |
| 6.00 | 0.9254 | 375.96 |
| 6.00 | 0.8062 | 375.53 |
| 6.00 | 0.6920 | 378.75 |
| 6.00 | 0.6046 | 379.17 |
| 6.00 | 0.5518 | 380.70 |
| 6.00 | 0.4651 | 381.90 |
| 6.00 | 0.3625 | 385.45 |
| 6.00 | 0.3093 | 387.82 |
| 6.00 | 0.1830 | 392.05 |
| 8.00 | 0.9162 | 382.18 |
| 8.00 | 0.8071 | 382.35 |
| 8.00 | 0.6936 | 384.49 |
| 8.00 | 0.6107 | 385.85 |
| 8.00 | 0.5488 | 386.90 |
| 8.00 | 0.4511 | 388.46 |
| 8.00 | 0.3643 | 391.95 |