- Name
- Butanedioic acid
- InChI
- InChI=1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8)
- InChI Key
- KDYFGRWQOYBRFD-UHFFFAOYSA-N
- Formula
- C4H6O4
- SMILES
- O=C(O)CCC(=O)O
- Mol. Weight (g/mol)
- 118.09
- CAS
- 110-15-6
- Name
- Acetone
- InChI
- InChI=1S/C3H6O/c1-3(2)4/h1-2H3
- InChI Key
- CSCPPACGZOOCGX-UHFFFAOYSA-N
- Formula
- C3H6O
- SMILES
- CC(C)=O
- Mol. Weight (g/mol)
- 58.08
- CAS
- 67-64-1
Datasets
Mole fraction of Butanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mole fraction of Butanedioic acid (1) - Liquid |
|---|---|
| 288.15 | 0.0113 |
| 293.15 | 0.0136 |
| 298.15 | 0.0163 |
| 303.15 | 0.0192 |
| 308.15 | 0.0226 |
| 315.15 | 0.0267 |
| 318.15 | 0.0314 |
| 323.15 | 0.0368 |
Mole fraction of Butanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Butanedioic acid (1) - Liquid |
|---|---|
| 277.85 | 0.0098 |
| 279.95 | 0.0109 |
| 283.75 | 0.0117 |
| 287.55 | 0.0129 |
| 290.25 | 0.0140 |
| 292.95 | 0.0149 |
| 296.55 | 0.0162 |
| 299.45 | 0.0172 |
| 302.55 | 0.0185 |
| 306.15 | 0.0199 |
| 308.75 | 0.0214 |
| 311.95 | 0.0230 |
| 315.85 | 0.0248 |
| 319.35 | 0.0280 |
| 323.35 | 0.0322 |
| 327.65 | 0.0378 |
Mole fraction of Butanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Butanedioic acid (1) - Liquid |
|---|---|
| 287.55 | 0.0129 |
| 290.25 | 0.0140 |
| 292.95 | 0.0149 |
| 296.55 | 0.0162 |
| 299.45 | 0.0172 |
| 302.55 | 0.0185 |
| 306.15 | 0.0199 |
| 308.75 | 0.0214 |
| 311.95 | 0.0230 |
| 315.85 | 0.0248 |
Mole fraction of Butanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Butanedioic acid (1) - Liquid |
|---|---|
| 282.85 | 0.0123 |
| 289.15 | 0.0143 |
| 294.15 | 0.0162 |
| 298.05 | 0.0180 |
| 302.95 | 0.0209 |
| 313.15 | 0.0263 |
| 317.75 | 0.0296 |
Mole fraction of Butanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mole fraction of Butanedioic acid (1) - Liquid |
|---|---|
| 288.15 | 0.0113 |
| 293.15 | 0.0136 |
| 298.15 | 0.0163 |
| 303.15 | 0.0192 |
| 308.15 | 0.0226 |
| 315.15 | 0.0267 |
| 318.15 | 0.0314 |
| 323.15 | 0.0368 |
Mole fraction of Butanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Butanedioic acid (1) - Liquid |
|---|---|
| 277.85 | 0.0098 |
| 279.95 | 0.0109 |
| 283.75 | 0.0117 |
| 287.55 | 0.0129 |
| 290.25 | 0.0140 |
| 292.95 | 0.0149 |
| 296.55 | 0.0162 |
| 299.45 | 0.0172 |
| 302.55 | 0.0185 |
| 306.15 | 0.0199 |
| 308.75 | 0.0214 |
| 311.95 | 0.0230 |
| 315.85 | 0.0248 |
| 319.35 | 0.0280 |
| 323.35 | 0.0322 |
| 327.65 | 0.0378 |
Mole fraction of Butanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Butanedioic acid (1) - Liquid |
|---|---|
| 287.55 | 0.0129 |
| 290.25 | 0.0140 |
| 292.95 | 0.0149 |
| 296.55 | 0.0162 |
| 299.45 | 0.0172 |
| 302.55 | 0.0185 |
| 306.15 | 0.0199 |
| 308.75 | 0.0214 |
| 311.95 | 0.0230 |
| 315.85 | 0.0248 |
Mole fraction of Butanedioic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Butanedioic acid (1) - Liquid |
|---|---|
| 282.85 | 0.0123 |
| 289.15 | 0.0143 |
| 294.15 | 0.0162 |
| 298.05 | 0.0180 |
| 302.95 | 0.0209 |
| 313.15 | 0.0263 |
| 317.75 | 0.0296 |
Sources
- An odd-even effect on solubility of dicarboxylic acids in organic solvents
- Determination and Correlation of Solubilities for Succinic Acid in the Adipic Acid + Glutaric Acid + Acetone Mixture and Adipic Acid in the Succinic Acid + Glutaric Acid + Acetone Mixture
- Solubilities of Adipic Acid and Succinic Acid in Glutaric Acid + Acetone or n-butanol Mixture
- Solubility of Butanedioic Acid in Different Solvents at Temperatures between 283 K and 333 K