- Name
- Ethyl Acetate
- InChI
- InChI=1S/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3
- InChI Key
- XEKOWRVHYACXOJ-UHFFFAOYSA-N
- Formula
- C4H8O2
- SMILES
- CCOC(C)=O
- Mol. Weight (g/mol)
- 88.11
- CAS
- 141-78-6
- Name
- Thiophene, tetrahydro-, 1,1-dioxide
- InChI
- InChI=1S/C4H8O2S/c5-7(6)3-1-2-4-7/h1-4H2
- InChI Key
- HXJUTPCZVOIRIF-UHFFFAOYSA-N
- Formula
- C4H8O2S
- SMILES
- O=S1(=O)CCCC1
- Mol. Weight (g/mol)
- 120.17
- CAS
- 126-33-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Viscosity, Pa*s - Liquid |
| 303.15 | 0.0000 | 0.0004 |
| 303.15 | 0.0218 | 0.0004 |
| 303.15 | 0.1511 | 0.0006 |
| 303.15 | 0.2748 | 0.0008 |
| 303.15 | 0.4012 | 0.0011 |
| 303.15 | 0.5068 | 0.0015 |
| 303.15 | 0.5980 | 0.0021 |
| 303.15 | 0.7331 | 0.0032 |
| 303.15 | 0.8548 | 0.0053 |
| 303.15 | 0.9799 | 0.0092 |
| 303.15 | 1.0000 | 0.0100 |
| 308.15 | 0.0000 | 0.0004 |
| 308.15 | 0.0218 | 0.0004 |
| 308.15 | 0.1511 | 0.0005 |
| 308.15 | 0.2748 | 0.0007 |
| 308.15 | 0.4012 | 0.0010 |
| 308.15 | 0.5068 | 0.0014 |
| 308.15 | 0.5980 | 0.0019 |
| 308.15 | 0.7331 | 0.0029 |
| 308.15 | 0.8548 | 0.0048 |
| 308.15 | 0.9799 | 0.0081 |
| 308.15 | 1.0000 | 0.0088 |
| 313.15 | 0.0000 | 0.0003 |
| 313.15 | 0.0218 | 0.0004 |
| 313.15 | 0.1511 | 0.0005 |
| 313.15 | 0.2748 | 0.0007 |
| 313.15 | 0.4012 | 0.0010 |
| 313.15 | 0.5068 | 0.0013 |
| 313.15 | 0.5980 | 0.0018 |
| 313.15 | 0.7331 | 0.0027 |
| 313.15 | 0.8548 | 0.0043 |
| 313.15 | 0.9799 | 0.0071 |
| 313.15 | 1.0000 | 0.0078 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Viscosity, Pa*s - Liquid |
| 303.15 | 0.0000 | 0.0004 |
| 303.15 | 0.0218 | 0.0004 |
| 303.15 | 0.1511 | 0.0006 |
| 303.15 | 0.2748 | 0.0008 |
| 303.15 | 0.4012 | 0.0011 |
| 303.15 | 0.5068 | 0.0015 |
| 303.15 | 0.5980 | 0.0021 |
| 303.15 | 0.7331 | 0.0032 |
| 303.15 | 0.8548 | 0.0053 |
| 303.15 | 0.9799 | 0.0092 |
| 303.15 | 1.0000 | 0.0100 |
| 308.15 | 0.0000 | 0.0004 |
| 308.15 | 0.0218 | 0.0004 |
| 308.15 | 0.1511 | 0.0005 |
| 308.15 | 0.2748 | 0.0007 |
| 308.15 | 0.4012 | 0.0010 |
| 308.15 | 0.5068 | 0.0014 |
| 308.15 | 0.5980 | 0.0019 |
| 308.15 | 0.7331 | 0.0029 |
| 308.15 | 0.8548 | 0.0048 |
| 308.15 | 0.9799 | 0.0081 |
| 308.15 | 1.0000 | 0.0088 |
| 313.15 | 0.0000 | 0.0003 |
| 313.15 | 0.0218 | 0.0004 |
| 313.15 | 0.1511 | 0.0005 |
| 313.15 | 0.2748 | 0.0007 |
| 313.15 | 0.4012 | 0.0010 |
| 313.15 | 0.5068 | 0.0013 |
| 313.15 | 0.5980 | 0.0018 |
| 313.15 | 0.7331 | 0.0027 |
| 313.15 | 0.8548 | 0.0043 |
| 313.15 | 0.9799 | 0.0071 |
| 313.15 | 1.0000 | 0.0078 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 895.1 |
| 298.15 | 1.0000 | 1263.9 |
| 303.15 | 0.0000 | 889.4 |
| 303.15 | 0.0218 | 897.8 |
| 303.15 | 0.1511 | 950.7 |
| 303.15 | 0.2748 | 1001.1 |
| 303.15 | 0.4012 | 1052.3 |
| 303.15 | 0.5068 | 1094.0 |
| 303.15 | 0.5980 | 1127.6 |
| 303.15 | 0.7331 | 1175.4 |
| 303.15 | 0.8548 | 1215.5 |
| 303.15 | 0.9799 | 1255.5 |
| 303.15 | 1.0000 | 1261.8 |
| 308.15 | 0.0000 | 883.9 |
| 308.15 | 0.0218 | 893.2 |
| 308.15 | 0.1511 | 947.1 |
| 308.15 | 0.2748 | 997.7 |
| 308.15 | 0.4012 | 1048.8 |
| 308.15 | 0.5068 | 1090.3 |
| 308.15 | 0.5980 | 1123.9 |
| 308.15 | 0.7331 | 1171.5 |
| 308.15 | 0.8548 | 1211.6 |
| 308.15 | 0.9799 | 1251.9 |
| 308.15 | 1.0000 | 1257.0 |
| 313.15 | 0.0000 | 875.8 |
| 313.15 | 0.0218 | 885.1 |
| 313.15 | 0.1511 | 939.5 |
| 313.15 | 0.2748 | 989.9 |
| 313.15 | 0.4012 | 1040.5 |
| 313.15 | 0.5068 | 1082.1 |
| 313.15 | 0.5980 | 1116.7 |
| 313.15 | 0.7331 | 1164.7 |
| 313.15 | 0.8548 | 1205.5 |
| 313.15 | 0.9799 | 1245.8 |
| 313.15 | 1.0000 | 1251.6 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 895.1 |
| 298.15 | 1.0000 | 1263.9 |
| 303.15 | 0.0000 | 889.4 |
| 303.15 | 0.0218 | 897.8 |
| 303.15 | 0.1511 | 950.7 |
| 303.15 | 0.2748 | 1001.1 |
| 303.15 | 0.4012 | 1052.3 |
| 303.15 | 0.5068 | 1094.0 |
| 303.15 | 0.5980 | 1127.6 |
| 303.15 | 0.7331 | 1175.4 |
| 303.15 | 0.8548 | 1215.5 |
| 303.15 | 0.9799 | 1255.5 |
| 303.15 | 1.0000 | 1261.8 |
| 308.15 | 0.0000 | 883.9 |
| 308.15 | 0.0218 | 893.2 |
| 308.15 | 0.1511 | 947.1 |
| 308.15 | 0.2748 | 997.7 |
| 308.15 | 0.4012 | 1048.8 |
| 308.15 | 0.5068 | 1090.3 |
| 308.15 | 0.5980 | 1123.9 |
| 308.15 | 0.7331 | 1171.5 |
| 308.15 | 0.8548 | 1211.6 |
| 308.15 | 0.9799 | 1251.9 |
| 308.15 | 1.0000 | 1257.0 |
| 313.15 | 0.0000 | 875.8 |
| 313.15 | 0.0218 | 885.1 |
| 313.15 | 0.1511 | 939.5 |
| 313.15 | 0.2748 | 989.9 |
| 313.15 | 0.4012 | 1040.5 |
| 313.15 | 0.5068 | 1082.1 |
| 313.15 | 0.5980 | 1116.7 |
| 313.15 | 0.7331 | 1164.7 |
| 313.15 | 0.8548 | 1205.5 |
| 313.15 | 0.9799 | 1245.8 |
| 313.15 | 1.0000 | 1251.6 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1142.0 |
| 298.15 | 1.0000 | 1601.0 |
| 303.15 | 0.0000 | 1122.0 |
| 303.15 | 0.0218 | 1134.0 |
| 303.15 | 0.1511 | 1196.0 |
| 303.15 | 0.2748 | 1251.0 |
| 303.15 | 0.4012 | 1313.0 |
| 303.15 | 0.5068 | 1366.0 |
| 303.15 | 0.5980 | 1408.0 |
| 303.15 | 0.7331 | 1472.0 |
| 303.15 | 0.8548 | 1524.0 |
| 303.15 | 0.9799 | 1579.0 |
| 303.15 | 1.0000 | 1588.0 |
| 308.15 | 0.0000 | 1101.0 |
| 308.15 | 0.0218 | 1121.0 |
| 308.15 | 0.1511 | 1185.0 |
| 308.15 | 0.2748 | 1241.0 |
| 308.15 | 0.4012 | 1301.0 |
| 308.15 | 0.5068 | 1355.0 |
| 308.15 | 0.5980 | 1398.0 |
| 308.15 | 0.7331 | 1465.0 |
| 308.15 | 0.8548 | 1515.0 |
| 308.15 | 0.9799 | 1569.0 |
| 308.15 | 1.0000 | 1576.0 |
| 313.15 | 0.0000 | 1082.0 |
| 313.15 | 0.0218 | 1092.0 |
| 313.15 | 0.1511 | 1154.0 |
| 313.15 | 0.2748 | 1216.0 |
| 313.15 | 0.4012 | 1283.0 |
| 313.15 | 0.5068 | 1346.0 |
| 313.15 | 0.5980 | 1397.0 |
| 313.15 | 0.7331 | 1464.0 |
| 313.15 | 0.8548 | 1513.0 |
| 313.15 | 0.9799 | 1555.0 |
| 313.15 | 1.0000 | 1558.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1142.0 |
| 298.15 | 1.0000 | 1601.0 |
| 303.15 | 0.0000 | 1122.0 |
| 303.15 | 0.0218 | 1134.0 |
| 303.15 | 0.1511 | 1196.0 |
| 303.15 | 0.2748 | 1251.0 |
| 303.15 | 0.4012 | 1313.0 |
| 303.15 | 0.5068 | 1366.0 |
| 303.15 | 0.5980 | 1408.0 |
| 303.15 | 0.7331 | 1472.0 |
| 303.15 | 0.8548 | 1524.0 |
| 303.15 | 0.9799 | 1579.0 |
| 303.15 | 1.0000 | 1588.0 |
| 308.15 | 0.0000 | 1101.0 |
| 308.15 | 0.0218 | 1121.0 |
| 308.15 | 0.1511 | 1185.0 |
| 308.15 | 0.2748 | 1241.0 |
| 308.15 | 0.4012 | 1301.0 |
| 308.15 | 0.5068 | 1355.0 |
| 308.15 | 0.5980 | 1398.0 |
| 308.15 | 0.7331 | 1465.0 |
| 308.15 | 0.8548 | 1515.0 |
| 308.15 | 0.9799 | 1569.0 |
| 308.15 | 1.0000 | 1576.0 |
| 313.15 | 0.0000 | 1082.0 |
| 313.15 | 0.0218 | 1092.0 |
| 313.15 | 0.1511 | 1154.0 |
| 313.15 | 0.2748 | 1216.0 |
| 313.15 | 0.4012 | 1283.0 |
| 313.15 | 0.5068 | 1346.0 |
| 313.15 | 0.5980 | 1397.0 |
| 313.15 | 0.7331 | 1464.0 |
| 313.15 | 0.8548 | 1513.0 |
| 313.15 | 0.9799 | 1555.0 |
| 313.15 | 1.0000 | 1558.0 |