- Name
- n-Hexane
- InChI
- InChI=1S/C6H14/c1-3-5-6-4-2/h3-6H2,1-2H3
- InChI Key
- VLKZOEOYAKHREP-UHFFFAOYSA-N
- Formula
- C6H14
- SMILES
- CCCCCC
- Mol. Weight (g/mol)
- 86.18
- CAS
- 110-54-3
- Name
- Benzoic acid, methyl ester
- InChI
- InChI=1S/C8H8O2/c1-10-8(9)7-5-3-2-4-6-7/h2-6H,1H3
- InChI Key
- QPJVMBTYPHYUOC-UHFFFAOYSA-N
- Formula
- C8H8O2
- SMILES
- COC(=O)c1ccccc1
- Mol. Weight (g/mol)
- 136.15
- CAS
- 93-58-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- Pvap - Vapor or sublimation pressure, kPa (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzoic acid, methyl ester (2) - Liquid | Viscosity, Pa*s - Liquid |
| 303.15 | 0.0000 | 0.0003 |
| 303.15 | 0.1027 | 0.0003 |
| 303.15 | 0.2076 | 0.0004 |
| 303.15 | 0.3084 | 0.0004 |
| 303.15 | 0.4087 | 0.0005 |
| 303.15 | 0.5114 | 0.0006 |
| 303.15 | 0.6115 | 0.0008 |
| 303.15 | 0.7092 | 0.0009 |
| 303.15 | 0.8069 | 0.0011 |
| 303.15 | 0.9024 | 0.0014 |
| 303.15 | 1.0000 | 0.0017 |
| 308.15 | 0.0000 | 0.0003 |
| 308.15 | 0.1027 | 0.0003 |
| 308.15 | 0.2076 | 0.0004 |
| 308.15 | 0.3084 | 0.0004 |
| 308.15 | 0.4087 | 0.0005 |
| 308.15 | 0.5114 | 0.0006 |
| 308.15 | 0.6115 | 0.0007 |
| 308.15 | 0.7092 | 0.0008 |
| 308.15 | 0.8069 | 0.0010 |
| 308.15 | 0.9024 | 0.0012 |
| 308.15 | 1.0000 | 0.0015 |
| 313.15 | 0.0000 | 0.0003 |
| 313.15 | 0.1027 | 0.0003 |
| 313.15 | 0.2076 | 0.0003 |
| 313.15 | 0.3084 | 0.0004 |
| 313.15 | 0.4087 | 0.0005 |
| 313.15 | 0.5114 | 0.0005 |
| 313.15 | 0.6115 | 0.0006 |
| 313.15 | 0.7092 | 0.0008 |
| 313.15 | 0.8069 | 0.0009 |
| 313.15 | 0.9024 | 0.0011 |
| 313.15 | 1.0000 | 0.0014 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzoic acid, methyl ester (2) - Liquid | Viscosity, Pa*s - Liquid |
| 303.15 | 0.0000 | 0.0003 |
| 303.15 | 0.1027 | 0.0003 |
| 303.15 | 0.2076 | 0.0004 |
| 303.15 | 0.3084 | 0.0004 |
| 303.15 | 0.4087 | 0.0005 |
| 303.15 | 0.5114 | 0.0006 |
| 303.15 | 0.6115 | 0.0008 |
| 303.15 | 0.7092 | 0.0009 |
| 303.15 | 0.8069 | 0.0011 |
| 303.15 | 0.9024 | 0.0014 |
| 303.15 | 1.0000 | 0.0017 |
| 308.15 | 0.0000 | 0.0003 |
| 308.15 | 0.1027 | 0.0003 |
| 308.15 | 0.2076 | 0.0004 |
| 308.15 | 0.3084 | 0.0004 |
| 308.15 | 0.4087 | 0.0005 |
| 308.15 | 0.5114 | 0.0006 |
| 308.15 | 0.6115 | 0.0007 |
| 308.15 | 0.7092 | 0.0008 |
| 308.15 | 0.8069 | 0.0010 |
| 308.15 | 0.9024 | 0.0012 |
| 308.15 | 1.0000 | 0.0015 |
| 313.15 | 0.0000 | 0.0003 |
| 313.15 | 0.1027 | 0.0003 |
| 313.15 | 0.2076 | 0.0003 |
| 313.15 | 0.3084 | 0.0004 |
| 313.15 | 0.4087 | 0.0005 |
| 313.15 | 0.5114 | 0.0005 |
| 313.15 | 0.6115 | 0.0006 |
| 313.15 | 0.7092 | 0.0008 |
| 313.15 | 0.8069 | 0.0009 |
| 313.15 | 0.9024 | 0.0011 |
| 313.15 | 1.0000 | 0.0014 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of n-Hexane (1) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 393.15 | 0.0884 | 92.00 |
| 393.15 | 0.1621 | 136.00 |
| 393.15 | 0.3089 | 204.00 |
| 393.15 | 0.4736 | 260.00 |
| 393.15 | 0.6648 | 320.00 |
| 393.15 | 0.8611 | 365.00 |
| 393.15 | 1.0000 | 410.00 |
| 413.15 | 0.0962 | 139.00 |
| 413.15 | 0.1720 | 203.00 |
| 413.15 | 0.3274 | 324.00 |
| 413.15 | 0.4980 | 392.00 |
| 413.15 | 0.6842 | 484.00 |
| 413.15 | 0.8669 | 569.00 |
| 413.15 | 1.0000 | 633.00 |
| 433.15 | 0.1061 | 209.00 |
| 433.15 | 0.1771 | 293.00 |
| 433.15 | 0.3306 | 427.00 |
| 433.15 | 0.4973 | 551.00 |
| 433.15 | 0.6800 | 685.00 |
| 433.15 | 0.8661 | 830.00 |
| 433.15 | 1.0000 | 918.00 |
| 453.15 | 0.1150 | 314.00 |
| 453.15 | 0.1841 | 406.00 |
| 453.15 | 0.3314 | 594.00 |
| 453.15 | 0.4967 | 761.00 |
| 453.15 | 0.6781 | 971.00 |
| 453.15 | 0.8651 | 1149.00 |
| 453.15 | 1.0000 | 1301.00 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of n-Hexane (1) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 393.15 | 0.0884 | 92.00 |
| 393.15 | 0.1621 | 136.00 |
| 393.15 | 0.3089 | 204.00 |
| 393.15 | 0.4736 | 260.00 |
| 393.15 | 0.6648 | 320.00 |
| 393.15 | 0.8611 | 365.00 |
| 393.15 | 1.0000 | 410.00 |
| 413.15 | 0.0962 | 139.00 |
| 413.15 | 0.1720 | 203.00 |
| 413.15 | 0.3274 | 324.00 |
| 413.15 | 0.4980 | 392.00 |
| 413.15 | 0.6842 | 484.00 |
| 413.15 | 0.8669 | 569.00 |
| 413.15 | 1.0000 | 633.00 |
| 433.15 | 0.1061 | 209.00 |
| 433.15 | 0.1771 | 293.00 |
| 433.15 | 0.3306 | 427.00 |
| 433.15 | 0.4973 | 551.00 |
| 433.15 | 0.6800 | 685.00 |
| 433.15 | 0.8661 | 830.00 |
| 433.15 | 1.0000 | 918.00 |
| 453.15 | 0.1150 | 314.00 |
| 453.15 | 0.1841 | 406.00 |
| 453.15 | 0.3314 | 594.00 |
| 453.15 | 0.4967 | 761.00 |
| 453.15 | 0.6781 | 971.00 |
| 453.15 | 0.8651 | 1149.00 |
| 453.15 | 1.0000 | 1301.00 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzoic acid, methyl ester (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 649.8 |
| 303.15 | 0.1027 | 692.7 |
| 303.15 | 0.2076 | 738.0 |
| 303.15 | 0.3084 | 781.4 |
| 303.15 | 0.4087 | 825.2 |
| 303.15 | 0.5114 | 869.6 |
| 303.15 | 0.6115 | 913.1 |
| 303.15 | 0.7092 | 955.5 |
| 303.15 | 0.8069 | 997.7 |
| 303.15 | 0.9024 | 1036.9 |
| 303.15 | 1.0000 | 1078.3 |
| 308.15 | 0.0000 | 645.9 |
| 308.15 | 0.1027 | 689.0 |
| 308.15 | 0.2076 | 734.2 |
| 308.15 | 0.3084 | 777.6 |
| 308.15 | 0.4087 | 821.3 |
| 308.15 | 0.5114 | 865.6 |
| 308.15 | 0.6115 | 909.2 |
| 308.15 | 0.7092 | 951.5 |
| 308.15 | 0.8069 | 993.7 |
| 308.15 | 0.9024 | 1033.0 |
| 308.15 | 1.0000 | 1074.4 |
| 313.15 | 0.0000 | 642.2 |
| 313.15 | 0.1027 | 685.1 |
| 313.15 | 0.2076 | 730.3 |
| 313.15 | 0.3084 | 773.7 |
| 313.15 | 0.4087 | 817.3 |
| 313.15 | 0.5114 | 861.7 |
| 313.15 | 0.6115 | 905.3 |
| 313.15 | 0.7092 | 947.3 |
| 313.15 | 0.8069 | 989.7 |
| 313.15 | 0.9024 | 1029.1 |
| 313.15 | 1.0000 | 1070.3 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzoic acid, methyl ester (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 649.8 |
| 303.15 | 0.1027 | 692.7 |
| 303.15 | 0.2076 | 738.0 |
| 303.15 | 0.3084 | 781.4 |
| 303.15 | 0.4087 | 825.2 |
| 303.15 | 0.5114 | 869.6 |
| 303.15 | 0.6115 | 913.1 |
| 303.15 | 0.7092 | 955.5 |
| 303.15 | 0.8069 | 997.7 |
| 303.15 | 0.9024 | 1036.9 |
| 303.15 | 1.0000 | 1078.3 |
| 308.15 | 0.0000 | 645.9 |
| 308.15 | 0.1027 | 689.0 |
| 308.15 | 0.2076 | 734.2 |
| 308.15 | 0.3084 | 777.6 |
| 308.15 | 0.4087 | 821.3 |
| 308.15 | 0.5114 | 865.6 |
| 308.15 | 0.6115 | 909.2 |
| 308.15 | 0.7092 | 951.5 |
| 308.15 | 0.8069 | 993.7 |
| 308.15 | 0.9024 | 1033.0 |
| 308.15 | 1.0000 | 1074.4 |
| 313.15 | 0.0000 | 642.2 |
| 313.15 | 0.1027 | 685.1 |
| 313.15 | 0.2076 | 730.3 |
| 313.15 | 0.3084 | 773.7 |
| 313.15 | 0.4087 | 817.3 |
| 313.15 | 0.5114 | 861.7 |
| 313.15 | 0.6115 | 905.3 |
| 313.15 | 0.7092 | 947.3 |
| 313.15 | 0.8069 | 989.7 |
| 313.15 | 0.9024 | 1029.1 |
| 313.15 | 1.0000 | 1070.3 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzoic acid, methyl ester (2) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1048.0 |
| 303.15 | 0.1027 | 1072.0 |
| 303.15 | 0.2076 | 1100.0 |
| 303.15 | 0.3084 | 1128.0 |
| 303.15 | 0.4087 | 1160.0 |
| 303.15 | 0.5114 | 1196.0 |
| 303.15 | 0.6115 | 1232.0 |
| 303.15 | 0.7092 | 1272.0 |
| 303.15 | 0.8069 | 1312.0 |
| 303.15 | 0.9024 | 1344.0 |
| 303.15 | 1.0000 | 1380.0 |
| 308.15 | 0.0000 | 1028.0 |
| 308.15 | 0.1027 | 1052.0 |
| 308.15 | 0.2076 | 1080.0 |
| 308.15 | 0.3084 | 1108.0 |
| 308.15 | 0.4087 | 1140.0 |
| 308.15 | 0.5114 | 1180.0 |
| 308.15 | 0.6115 | 1220.0 |
| 308.15 | 0.7092 | 1256.0 |
| 308.15 | 0.8069 | 1292.0 |
| 308.15 | 0.9024 | 1328.0 |
| 308.15 | 1.0000 | 1364.0 |
| 313.15 | 0.0000 | 1008.0 |
| 313.15 | 0.1027 | 1036.0 |
| 313.15 | 0.2076 | 1064.0 |
| 313.15 | 0.3084 | 1096.0 |
| 313.15 | 0.4087 | 1128.0 |
| 313.15 | 0.5114 | 1164.0 |
| 313.15 | 0.6115 | 1200.0 |
| 313.15 | 0.7092 | 1240.0 |
| 313.15 | 0.8069 | 1280.0 |
| 313.15 | 0.9024 | 1316.0 |
| 313.15 | 1.0000 | 1348.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzoic acid, methyl ester (2) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1048.0 |
| 303.15 | 0.1027 | 1072.0 |
| 303.15 | 0.2076 | 1100.0 |
| 303.15 | 0.3084 | 1128.0 |
| 303.15 | 0.4087 | 1160.0 |
| 303.15 | 0.5114 | 1196.0 |
| 303.15 | 0.6115 | 1232.0 |
| 303.15 | 0.7092 | 1272.0 |
| 303.15 | 0.8069 | 1312.0 |
| 303.15 | 0.9024 | 1344.0 |
| 303.15 | 1.0000 | 1380.0 |
| 308.15 | 0.0000 | 1028.0 |
| 308.15 | 0.1027 | 1052.0 |
| 308.15 | 0.2076 | 1080.0 |
| 308.15 | 0.3084 | 1108.0 |
| 308.15 | 0.4087 | 1140.0 |
| 308.15 | 0.5114 | 1180.0 |
| 308.15 | 0.6115 | 1220.0 |
| 308.15 | 0.7092 | 1256.0 |
| 308.15 | 0.8069 | 1292.0 |
| 308.15 | 0.9024 | 1328.0 |
| 308.15 | 1.0000 | 1364.0 |
| 313.15 | 0.0000 | 1008.0 |
| 313.15 | 0.1027 | 1036.0 |
| 313.15 | 0.2076 | 1064.0 |
| 313.15 | 0.3084 | 1096.0 |
| 313.15 | 0.4087 | 1128.0 |
| 313.15 | 0.5114 | 1164.0 |
| 313.15 | 0.6115 | 1200.0 |
| 313.15 | 0.7092 | 1240.0 |
| 313.15 | 0.8069 | 1280.0 |
| 313.15 | 0.9024 | 1316.0 |
| 313.15 | 1.0000 | 1348.0 |
Sources
- In Situ Determination of Phase Equilibria of Methyl Benzoate + Alkane Mixtures Using an Infrared Absorption Method. Comparison with Polar GC-SAFT Predictions
- Density, Viscosity, and Speed of Sound of (Methyl Benzoate + Cyclohexane), (Methyl Benzoate + n-Hexane), (Methyl Benzoate + Heptane), and (Methyl Benzoate + Octane) at Temperatures of (303.15, 308.15, and 313.15) K