- Name
- 2-Butanone
- InChI
- InChI=1S/C4H8O/c1-3-4(2)5/h3H2,1-2H3
- InChI Key
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N
- Formula
- C4H8O
- SMILES
- CCC(C)=O
- Mol. Weight (g/mol)
- 72.11
- CAS
- 78-93-3
- Name
- Thiophene, tetrahydro-, 1,1-dioxide
- InChI
- InChI=1S/C4H8O2S/c5-7(6)3-1-2-4-7/h1-4H2
- InChI Key
- HXJUTPCZVOIRIF-UHFFFAOYSA-N
- Formula
- C4H8O2S
- SMILES
- O=S1(=O)CCCC1
- Mol. Weight (g/mol)
- 120.17
- CAS
- 126-33-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 794.6 |
| 303.15 | 0.0293 | 810.6 |
| 303.15 | 0.1391 | 869.7 |
| 303.15 | 0.2575 | 931.6 |
| 303.15 | 0.3803 | 993.5 |
| 303.15 | 0.4834 | 1043.1 |
| 303.15 | 0.5854 | 1089.7 |
| 303.15 | 0.7119 | 1145.2 |
| 303.15 | 0.8428 | 1200.5 |
| 303.15 | 0.9756 | 1252.7 |
| 303.15 | 1.0000 | 1261.8 |
| 308.15 | 0.0000 | 790.4 |
| 308.15 | 0.0293 | 806.2 |
| 308.15 | 0.1391 | 865.6 |
| 308.15 | 0.2575 | 927.5 |
| 308.15 | 0.3803 | 989.6 |
| 308.15 | 0.4834 | 1039.9 |
| 308.15 | 0.5854 | 1086.6 |
| 308.15 | 0.7119 | 1142.0 |
| 308.15 | 0.8428 | 1196.8 |
| 308.15 | 0.9756 | 1249.0 |
| 308.15 | 1.0000 | 1257.0 |
| 313.15 | 0.0000 | 783.1 |
| 313.15 | 0.0293 | 799.2 |
| 313.15 | 0.1391 | 858.7 |
| 313.15 | 0.2575 | 920.9 |
| 313.15 | 0.3803 | 983.5 |
| 313.15 | 0.4834 | 1034.4 |
| 313.15 | 0.5854 | 1081.8 |
| 313.15 | 0.7119 | 1137.2 |
| 313.15 | 0.8428 | 1191.8 |
| 313.15 | 0.9756 | 1243.7 |
| 313.15 | 1.0000 | 1251.6 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 794.6 |
| 303.15 | 0.0293 | 810.6 |
| 303.15 | 0.1391 | 869.7 |
| 303.15 | 0.2575 | 931.6 |
| 303.15 | 0.3803 | 993.5 |
| 303.15 | 0.4834 | 1043.1 |
| 303.15 | 0.5854 | 1089.7 |
| 303.15 | 0.7119 | 1145.2 |
| 303.15 | 0.8428 | 1200.5 |
| 303.15 | 0.9756 | 1252.7 |
| 303.15 | 1.0000 | 1261.8 |
| 308.15 | 0.0000 | 790.4 |
| 308.15 | 0.0293 | 806.2 |
| 308.15 | 0.1391 | 865.6 |
| 308.15 | 0.2575 | 927.5 |
| 308.15 | 0.3803 | 989.6 |
| 308.15 | 0.4834 | 1039.9 |
| 308.15 | 0.5854 | 1086.6 |
| 308.15 | 0.7119 | 1142.0 |
| 308.15 | 0.8428 | 1196.8 |
| 308.15 | 0.9756 | 1249.0 |
| 308.15 | 1.0000 | 1257.0 |
| 313.15 | 0.0000 | 783.1 |
| 313.15 | 0.0293 | 799.2 |
| 313.15 | 0.1391 | 858.7 |
| 313.15 | 0.2575 | 920.9 |
| 313.15 | 0.3803 | 983.5 |
| 313.15 | 0.4834 | 1034.4 |
| 313.15 | 0.5854 | 1081.8 |
| 313.15 | 0.7119 | 1137.2 |
| 313.15 | 0.8428 | 1191.8 |
| 313.15 | 0.9756 | 1243.7 |
| 313.15 | 1.0000 | 1251.6 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1178.0 |
| 303.15 | 0.0293 | 1191.0 |
| 303.15 | 0.1391 | 1234.0 |
| 303.15 | 0.2575 | 1288.0 |
| 303.15 | 0.3803 | 1341.0 |
| 303.15 | 0.4834 | 1386.0 |
| 303.15 | 0.5854 | 1431.0 |
| 303.15 | 0.7119 | 1481.0 |
| 303.15 | 0.8428 | 1533.0 |
| 303.15 | 0.9756 | 1581.0 |
| 303.15 | 1.0000 | 1588.0 |
| 308.15 | 0.0000 | 1158.0 |
| 308.15 | 0.0293 | 1170.0 |
| 308.15 | 0.1391 | 1215.0 |
| 308.15 | 0.2575 | 1266.0 |
| 308.15 | 0.3803 | 1319.0 |
| 308.15 | 0.4834 | 1366.0 |
| 308.15 | 0.5854 | 1413.0 |
| 308.15 | 0.7119 | 1465.0 |
| 308.15 | 0.8428 | 1517.0 |
| 308.15 | 0.9756 | 1568.0 |
| 308.15 | 1.0000 | 1576.0 |
| 313.15 | 0.0000 | 1136.0 |
| 313.15 | 0.0293 | 1149.0 |
| 313.15 | 0.1391 | 1195.0 |
| 313.15 | 0.2575 | 1247.0 |
| 313.15 | 0.3803 | 1300.0 |
| 313.15 | 0.4834 | 1346.0 |
| 313.15 | 0.5854 | 1395.0 |
| 313.15 | 0.7119 | 1450.0 |
| 313.15 | 0.8428 | 1502.0 |
| 313.15 | 0.9756 | 1552.0 |
| 313.15 | 1.0000 | 1558.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1178.0 |
| 303.15 | 0.0293 | 1191.0 |
| 303.15 | 0.1391 | 1234.0 |
| 303.15 | 0.2575 | 1288.0 |
| 303.15 | 0.3803 | 1341.0 |
| 303.15 | 0.4834 | 1386.0 |
| 303.15 | 0.5854 | 1431.0 |
| 303.15 | 0.7119 | 1481.0 |
| 303.15 | 0.8428 | 1533.0 |
| 303.15 | 0.9756 | 1581.0 |
| 303.15 | 1.0000 | 1588.0 |
| 308.15 | 0.0000 | 1158.0 |
| 308.15 | 0.0293 | 1170.0 |
| 308.15 | 0.1391 | 1215.0 |
| 308.15 | 0.2575 | 1266.0 |
| 308.15 | 0.3803 | 1319.0 |
| 308.15 | 0.4834 | 1366.0 |
| 308.15 | 0.5854 | 1413.0 |
| 308.15 | 0.7119 | 1465.0 |
| 308.15 | 0.8428 | 1517.0 |
| 308.15 | 0.9756 | 1568.0 |
| 308.15 | 1.0000 | 1576.0 |
| 313.15 | 0.0000 | 1136.0 |
| 313.15 | 0.0293 | 1149.0 |
| 313.15 | 0.1391 | 1195.0 |
| 313.15 | 0.2575 | 1247.0 |
| 313.15 | 0.3803 | 1300.0 |
| 313.15 | 0.4834 | 1346.0 |
| 313.15 | 0.5854 | 1395.0 |
| 313.15 | 0.7119 | 1450.0 |
| 313.15 | 0.8428 | 1502.0 |
| 313.15 | 0.9756 | 1552.0 |
| 313.15 | 1.0000 | 1558.0 |