- Name
- 2-Pentanone
- InChI
- InChI=1S/C5H10O/c1-3-4-5(2)6/h3-4H2,1-2H3
- InChI Key
- XNLICIUVMPYHGG-UHFFFAOYSA-N
- Formula
- C5H10O
- SMILES
- CCCC(C)=O
- Mol. Weight (g/mol)
- 86.13
- CAS
- 107-87-9
- Name
- Thiophene, tetrahydro-, 1,1-dioxide
- InChI
- InChI=1S/C4H8O2S/c5-7(6)3-1-2-4-7/h1-4H2
- InChI Key
- HXJUTPCZVOIRIF-UHFFFAOYSA-N
- Formula
- C4H8O2S
- SMILES
- O=S1(=O)CCCC1
- Mol. Weight (g/mol)
- 120.17
- CAS
- 126-33-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 796.6 |
| 303.15 | 0.0261 | 808.2 |
| 303.15 | 0.1620 | 869.2 |
| 303.15 | 0.2945 | 929.2 |
| 303.15 | 0.4450 | 998.5 |
| 303.15 | 0.5296 | 1038.2 |
| 303.15 | 0.6319 | 1086.6 |
| 303.15 | 0.7498 | 1143.2 |
| 303.15 | 0.8677 | 1200.2 |
| 303.15 | 0.9799 | 1253.2 |
| 303.15 | 1.0000 | 1261.8 |
| 308.15 | 0.0000 | 792.7 |
| 308.15 | 0.0261 | 804.2 |
| 308.15 | 0.1620 | 864.6 |
| 308.15 | 0.2945 | 924.8 |
| 308.15 | 0.4450 | 994.6 |
| 308.15 | 0.5296 | 1034.5 |
| 308.15 | 0.6319 | 1082.8 |
| 308.15 | 0.7498 | 1139.2 |
| 308.15 | 0.8677 | 1195.8 |
| 308.15 | 0.9799 | 1248.5 |
| 308.15 | 1.0000 | 1257.0 |
| 313.15 | 0.0000 | 785.5 |
| 313.15 | 0.0261 | 797.8 |
| 313.15 | 0.1620 | 858.8 |
| 313.15 | 0.2945 | 919.1 |
| 313.15 | 0.4450 | 989.1 |
| 313.15 | 0.5296 | 1029.1 |
| 313.15 | 0.6319 | 1078.0 |
| 313.15 | 0.7498 | 1134.7 |
| 313.15 | 0.8677 | 1191.6 |
| 313.15 | 0.9799 | 1243.6 |
| 313.15 | 1.0000 | 1251.6 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 796.6 |
| 303.15 | 0.0261 | 808.2 |
| 303.15 | 0.1620 | 869.2 |
| 303.15 | 0.2945 | 929.2 |
| 303.15 | 0.4450 | 998.5 |
| 303.15 | 0.5296 | 1038.2 |
| 303.15 | 0.6319 | 1086.6 |
| 303.15 | 0.7498 | 1143.2 |
| 303.15 | 0.8677 | 1200.2 |
| 303.15 | 0.9799 | 1253.2 |
| 303.15 | 1.0000 | 1261.8 |
| 308.15 | 0.0000 | 792.7 |
| 308.15 | 0.0261 | 804.2 |
| 308.15 | 0.1620 | 864.6 |
| 308.15 | 0.2945 | 924.8 |
| 308.15 | 0.4450 | 994.6 |
| 308.15 | 0.5296 | 1034.5 |
| 308.15 | 0.6319 | 1082.8 |
| 308.15 | 0.7498 | 1139.2 |
| 308.15 | 0.8677 | 1195.8 |
| 308.15 | 0.9799 | 1248.5 |
| 308.15 | 1.0000 | 1257.0 |
| 313.15 | 0.0000 | 785.5 |
| 313.15 | 0.0261 | 797.8 |
| 313.15 | 0.1620 | 858.8 |
| 313.15 | 0.2945 | 919.1 |
| 313.15 | 0.4450 | 989.1 |
| 313.15 | 0.5296 | 1029.1 |
| 313.15 | 0.6319 | 1078.0 |
| 313.15 | 0.7498 | 1134.7 |
| 313.15 | 0.8677 | 1191.6 |
| 313.15 | 0.9799 | 1243.6 |
| 313.15 | 1.0000 | 1251.6 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1192.0 |
| 303.15 | 0.0261 | 1203.0 |
| 303.15 | 0.1620 | 1246.0 |
| 303.15 | 0.2945 | 1290.0 |
| 303.15 | 0.4450 | 1352.0 |
| 303.15 | 0.5296 | 1384.0 |
| 303.15 | 0.6319 | 1429.0 |
| 303.15 | 0.7498 | 1484.0 |
| 303.15 | 0.8677 | 1536.0 |
| 303.15 | 0.9799 | 1580.0 |
| 303.15 | 1.0000 | 1588.0 |
| 308.15 | 0.0000 | 1176.0 |
| 308.15 | 0.0261 | 1183.0 |
| 308.15 | 0.1620 | 1225.0 |
| 308.15 | 0.2945 | 1271.0 |
| 308.15 | 0.4450 | 1340.0 |
| 308.15 | 0.5296 | 1373.0 |
| 308.15 | 0.6319 | 1418.0 |
| 308.15 | 0.7498 | 1469.0 |
| 308.15 | 0.8677 | 1520.0 |
| 308.15 | 0.9799 | 1562.0 |
| 308.15 | 1.0000 | 1576.0 |
| 313.15 | 0.0000 | 1151.0 |
| 313.15 | 0.0261 | 1161.0 |
| 313.15 | 0.1620 | 1203.0 |
| 313.15 | 0.2945 | 1251.0 |
| 313.15 | 0.4450 | 1318.0 |
| 313.15 | 0.5296 | 1353.0 |
| 313.15 | 0.6319 | 1401.0 |
| 313.15 | 0.7498 | 1450.0 |
| 313.15 | 0.8677 | 1503.0 |
| 313.15 | 0.9799 | 1549.0 |
| 313.15 | 1.0000 | 1558.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1192.0 |
| 303.15 | 0.0261 | 1203.0 |
| 303.15 | 0.1620 | 1246.0 |
| 303.15 | 0.2945 | 1290.0 |
| 303.15 | 0.4450 | 1352.0 |
| 303.15 | 0.5296 | 1384.0 |
| 303.15 | 0.6319 | 1429.0 |
| 303.15 | 0.7498 | 1484.0 |
| 303.15 | 0.8677 | 1536.0 |
| 303.15 | 0.9799 | 1580.0 |
| 303.15 | 1.0000 | 1588.0 |
| 308.15 | 0.0000 | 1176.0 |
| 308.15 | 0.0261 | 1183.0 |
| 308.15 | 0.1620 | 1225.0 |
| 308.15 | 0.2945 | 1271.0 |
| 308.15 | 0.4450 | 1340.0 |
| 308.15 | 0.5296 | 1373.0 |
| 308.15 | 0.6319 | 1418.0 |
| 308.15 | 0.7498 | 1469.0 |
| 308.15 | 0.8677 | 1520.0 |
| 308.15 | 0.9799 | 1562.0 |
| 308.15 | 1.0000 | 1576.0 |
| 313.15 | 0.0000 | 1151.0 |
| 313.15 | 0.0261 | 1161.0 |
| 313.15 | 0.1620 | 1203.0 |
| 313.15 | 0.2945 | 1251.0 |
| 313.15 | 0.4450 | 1318.0 |
| 313.15 | 0.5296 | 1353.0 |
| 313.15 | 0.6319 | 1401.0 |
| 313.15 | 0.7498 | 1450.0 |
| 313.15 | 0.8677 | 1503.0 |
| 313.15 | 0.9799 | 1549.0 |
| 313.15 | 1.0000 | 1558.0 |