- Name
- Methyl Isobutyl Ketone
- InChI
- InChI=1S/C6H12O/c1-5(2)4-6(3)7/h5H,4H2,1-3H3
- InChI Key
- NTIZESTWPVYFNL-UHFFFAOYSA-N
- Formula
- C6H12O
- SMILES
- CC(=O)CC(C)C
- Mol. Weight (g/mol)
- 100.16
- CAS
- 108-10-1
- Name
- Thiophene, tetrahydro-, 1,1-dioxide
- InChI
- InChI=1S/C4H8O2S/c5-7(6)3-1-2-4-7/h1-4H2
- InChI Key
- HXJUTPCZVOIRIF-UHFFFAOYSA-N
- Formula
- C4H8O2S
- SMILES
- O=S1(=O)CCCC1
- Mol. Weight (g/mol)
- 120.17
- CAS
- 126-33-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 791.7 |
| 303.15 | 0.0287 | 803.4 |
| 303.15 | 0.1852 | 866.6 |
| 303.15 | 0.3272 | 927.3 |
| 303.15 | 0.4634 | 989.2 |
| 303.15 | 0.5671 | 1038.9 |
| 303.15 | 0.6671 | 1088.8 |
| 303.15 | 0.7777 | 1145.1 |
| 303.15 | 0.8809 | 1198.5 |
| 303.15 | 0.9829 | 1252.3 |
| 303.15 | 1.0000 | 1261.8 |
| 308.15 | 0.0000 | 787.7 |
| 308.15 | 0.0287 | 799.3 |
| 308.15 | 0.1852 | 862.5 |
| 308.15 | 0.3272 | 923.3 |
| 308.15 | 0.4634 | 985.1 |
| 308.15 | 0.5671 | 1034.6 |
| 308.15 | 0.6671 | 1083.9 |
| 308.15 | 0.7777 | 1140.7 |
| 308.15 | 0.8809 | 1195.1 |
| 308.15 | 0.9829 | 1249.2 |
| 308.15 | 1.0000 | 1257.0 |
| 313.15 | 0.0000 | 782.6 |
| 313.15 | 0.0287 | 793.9 |
| 313.15 | 0.1852 | 856.8 |
| 313.15 | 0.3272 | 917.6 |
| 313.15 | 0.4634 | 979.7 |
| 313.15 | 0.5671 | 1029.3 |
| 313.15 | 0.6671 | 1078.5 |
| 313.15 | 0.7777 | 1134.1 |
| 313.15 | 0.8809 | 1187.8 |
| 313.15 | 0.9829 | 1242.3 |
| 313.15 | 1.0000 | 1251.6 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.0000 | 791.7 |
| 303.15 | 0.0287 | 803.4 |
| 303.15 | 0.1852 | 866.6 |
| 303.15 | 0.3272 | 927.3 |
| 303.15 | 0.4634 | 989.2 |
| 303.15 | 0.5671 | 1038.9 |
| 303.15 | 0.6671 | 1088.8 |
| 303.15 | 0.7777 | 1145.1 |
| 303.15 | 0.8809 | 1198.5 |
| 303.15 | 0.9829 | 1252.3 |
| 303.15 | 1.0000 | 1261.8 |
| 308.15 | 0.0000 | 787.7 |
| 308.15 | 0.0287 | 799.3 |
| 308.15 | 0.1852 | 862.5 |
| 308.15 | 0.3272 | 923.3 |
| 308.15 | 0.4634 | 985.1 |
| 308.15 | 0.5671 | 1034.6 |
| 308.15 | 0.6671 | 1083.9 |
| 308.15 | 0.7777 | 1140.7 |
| 308.15 | 0.8809 | 1195.1 |
| 308.15 | 0.9829 | 1249.2 |
| 308.15 | 1.0000 | 1257.0 |
| 313.15 | 0.0000 | 782.6 |
| 313.15 | 0.0287 | 793.9 |
| 313.15 | 0.1852 | 856.8 |
| 313.15 | 0.3272 | 917.6 |
| 313.15 | 0.4634 | 979.7 |
| 313.15 | 0.5671 | 1029.3 |
| 313.15 | 0.6671 | 1078.5 |
| 313.15 | 0.7777 | 1134.1 |
| 313.15 | 0.8809 | 1187.8 |
| 313.15 | 0.9829 | 1242.3 |
| 313.15 | 1.0000 | 1251.6 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1175.0 |
| 303.15 | 0.0287 | 1185.0 |
| 303.15 | 0.1852 | 1233.0 |
| 303.15 | 0.3272 | 1281.0 |
| 303.15 | 0.4634 | 1335.0 |
| 303.15 | 0.5671 | 1381.0 |
| 303.15 | 0.6671 | 1426.0 |
| 303.15 | 0.7777 | 1479.0 |
| 303.15 | 0.8809 | 1530.0 |
| 303.15 | 0.9829 | 1578.0 |
| 303.15 | 1.0000 | 1588.0 |
| 308.15 | 0.0000 | 1156.0 |
| 308.15 | 0.0287 | 1166.0 |
| 308.15 | 0.1852 | 1215.0 |
| 308.15 | 0.3272 | 1263.0 |
| 308.15 | 0.4634 | 1316.0 |
| 308.15 | 0.5671 | 1361.0 |
| 308.15 | 0.6671 | 1407.0 |
| 308.15 | 0.7777 | 1463.0 |
| 308.15 | 0.8809 | 1513.0 |
| 308.15 | 0.9829 | 1564.0 |
| 308.15 | 1.0000 | 1576.0 |
| 313.15 | 0.0000 | 1138.0 |
| 313.15 | 0.0287 | 1147.0 |
| 313.15 | 0.1852 | 1198.0 |
| 313.15 | 0.3272 | 1247.0 |
| 313.15 | 0.4634 | 1300.0 |
| 313.15 | 0.5671 | 1345.0 |
| 313.15 | 0.6671 | 1391.0 |
| 313.15 | 0.7777 | 1447.0 |
| 313.15 | 0.8809 | 1496.0 |
| 313.15 | 0.9829 | 1550.0 |
| 313.15 | 1.0000 | 1558.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Thiophene, tetrahydro-, 1,1-dioxide (2) - Liquid | Speed of sound, m/s - Liquid |
| 303.15 | 0.0000 | 1175.0 |
| 303.15 | 0.0287 | 1185.0 |
| 303.15 | 0.1852 | 1233.0 |
| 303.15 | 0.3272 | 1281.0 |
| 303.15 | 0.4634 | 1335.0 |
| 303.15 | 0.5671 | 1381.0 |
| 303.15 | 0.6671 | 1426.0 |
| 303.15 | 0.7777 | 1479.0 |
| 303.15 | 0.8809 | 1530.0 |
| 303.15 | 0.9829 | 1578.0 |
| 303.15 | 1.0000 | 1588.0 |
| 308.15 | 0.0000 | 1156.0 |
| 308.15 | 0.0287 | 1166.0 |
| 308.15 | 0.1852 | 1215.0 |
| 308.15 | 0.3272 | 1263.0 |
| 308.15 | 0.4634 | 1316.0 |
| 308.15 | 0.5671 | 1361.0 |
| 308.15 | 0.6671 | 1407.0 |
| 308.15 | 0.7777 | 1463.0 |
| 308.15 | 0.8809 | 1513.0 |
| 308.15 | 0.9829 | 1564.0 |
| 308.15 | 1.0000 | 1576.0 |
| 313.15 | 0.0000 | 1138.0 |
| 313.15 | 0.0287 | 1147.0 |
| 313.15 | 0.1852 | 1198.0 |
| 313.15 | 0.3272 | 1247.0 |
| 313.15 | 0.4634 | 1300.0 |
| 313.15 | 0.5671 | 1345.0 |
| 313.15 | 0.6671 | 1391.0 |
| 313.15 | 0.7777 | 1447.0 |
| 313.15 | 0.8809 | 1496.0 |
| 313.15 | 0.9829 | 1550.0 |
| 313.15 | 1.0000 | 1558.0 |