- Name
- Cyclooctane
- InChI
- InChI=1S/C8H16/c1-2-4-6-8-7-5-3-1/h1-8H2
- InChI Key
- WJTCGQSWYFHTAC-UHFFFAOYSA-N
- Formula
- C8H16
- SMILES
- C1CCCCCCC1
- Mol. Weight (g/mol)
- 112.21
- CAS
- 292-64-8
- Name
- o-Xylene
- InChI
- InChI=1S/C8H10/c1-7-5-3-4-6-8(7)2/h3-6H,1-2H3
- InChI Key
- CTQNGGLPUBDAKN-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1ccccc1C
- Mol. Weight (g/mol)
- 106.17
- CAS
- 95-47-6
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclooctane (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.5026 |
| 298.15 | 0.0513 | 1.4989 |
| 298.15 | 0.1015 | 1.4959 |
| 298.15 | 0.2000 | 1.4904 |
| 298.15 | 0.3067 | 1.4847 |
| 298.15 | 0.4026 | 1.4799 |
| 298.15 | 0.5037 | 1.4751 |
| 298.15 | 0.6262 | 1.4696 |
| 298.15 | 0.7007 | 1.4665 |
| 298.15 | 0.8028 | 1.4626 |
| 298.15 | 0.8953 | 1.4593 |
| 298.15 | 0.9498 | 1.4575 |
| 298.15 | 1.0000 | 1.456 |
| 313.15 | 0.0000 | 1.4947 |
| 313.15 | 0.0508 | 1.4918 |
| 313.15 | 0.0905 | 1.4893 |
| 313.15 | 0.1697 | 1.485 |
| 313.15 | 0.2967 | 1.4782 |
| 313.15 | 0.3824 | 1.4739 |
| 313.15 | 0.4839 | 1.4691 |
| 313.15 | 0.5878 | 1.4644 |
| 313.15 | 0.6869 | 1.4602 |
| 313.15 | 0.7892 | 1.4562 |
| 313.15 | 0.8891 | 1.4524 |
| 313.15 | 0.9368 | 1.4507 |
| 313.15 | 1.0000 | 1.4488 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclooctane (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.5026 |
| 298.15 | 0.0513 | 1.4989 |
| 298.15 | 0.1015 | 1.4959 |
| 298.15 | 0.2000 | 1.4904 |
| 298.15 | 0.3067 | 1.4847 |
| 298.15 | 0.4026 | 1.4799 |
| 298.15 | 0.5037 | 1.4751 |
| 298.15 | 0.6262 | 1.4696 |
| 298.15 | 0.7007 | 1.4665 |
| 298.15 | 0.8028 | 1.4626 |
| 298.15 | 0.8953 | 1.4593 |
| 298.15 | 0.9498 | 1.4575 |
| 298.15 | 1.0000 | 1.456 |
| 313.15 | 0.0000 | 1.4947 |
| 313.15 | 0.0508 | 1.4918 |
| 313.15 | 0.0905 | 1.4893 |
| 313.15 | 0.1697 | 1.485 |
| 313.15 | 0.2967 | 1.4782 |
| 313.15 | 0.3824 | 1.4739 |
| 313.15 | 0.4839 | 1.4691 |
| 313.15 | 0.5878 | 1.4644 |
| 313.15 | 0.6869 | 1.4602 |
| 313.15 | 0.7892 | 1.4562 |
| 313.15 | 0.8891 | 1.4524 |
| 313.15 | 0.9368 | 1.4507 |
| 313.15 | 1.0000 | 1.4488 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclooctane (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 875.4 |
| 298.15 | 0.0513 | 871.8 |
| 298.15 | 0.1015 | 868.4 |
| 298.15 | 0.2000 | 862.5 |
| 298.15 | 0.3067 | 856.9 |
| 298.15 | 0.4026 | 852.2 |
| 298.15 | 0.5037 | 847.6 |
| 298.15 | 0.6262 | 842.6 |
| 298.15 | 0.7007 | 839.9 |
| 298.15 | 0.8028 | 836.5 |
| 298.15 | 0.8953 | 833.9 |
| 298.15 | 0.9498 | 832.5 |
| 298.15 | 1.0000 | 831.5 |
| 313.15 | 0.0000 | 862.9 |
| 313.15 | 0.0508 | 859.7 |
| 313.15 | 0.0905 | 857.3 |
| 313.15 | 0.1697 | 852.7 |
| 313.15 | 0.2967 | 845.9 |
| 313.15 | 0.3824 | 841.6 |
| 313.15 | 0.4839 | 836.9 |
| 313.15 | 0.5878 | 832.4 |
| 313.15 | 0.6869 | 828.6 |
| 313.15 | 0.7892 | 825.1 |
| 313.15 | 0.8891 | 822.0 |
| 313.15 | 0.9368 | 820.7 |
| 313.15 | 1.0000 | 819.2 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclooctane (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 875.4 |
| 298.15 | 0.0513 | 871.8 |
| 298.15 | 0.1015 | 868.4 |
| 298.15 | 0.2000 | 862.5 |
| 298.15 | 0.3067 | 856.9 |
| 298.15 | 0.4026 | 852.2 |
| 298.15 | 0.5037 | 847.6 |
| 298.15 | 0.6262 | 842.6 |
| 298.15 | 0.7007 | 839.9 |
| 298.15 | 0.8028 | 836.5 |
| 298.15 | 0.8953 | 833.9 |
| 298.15 | 0.9498 | 832.5 |
| 298.15 | 1.0000 | 831.5 |
| 313.15 | 0.0000 | 862.9 |
| 313.15 | 0.0508 | 859.7 |
| 313.15 | 0.0905 | 857.3 |
| 313.15 | 0.1697 | 852.7 |
| 313.15 | 0.2967 | 845.9 |
| 313.15 | 0.3824 | 841.6 |
| 313.15 | 0.4839 | 836.9 |
| 313.15 | 0.5878 | 832.4 |
| 313.15 | 0.6869 | 828.6 |
| 313.15 | 0.7892 | 825.1 |
| 313.15 | 0.8891 | 822.0 |
| 313.15 | 0.9368 | 820.7 |
| 313.15 | 1.0000 | 819.2 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclooctane (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1350.0 |
| 298.15 | 0.0513 | 1347.0 |
| 298.15 | 0.1015 | 1348.0 |
| 298.15 | 0.2000 | 1349.0 |
| 298.15 | 0.3067 | 1351.0 |
| 298.15 | 0.4026 | 1354.0 |
| 298.15 | 0.5037 | 1358.0 |
| 298.15 | 0.6262 | 1364.0 |
| 298.15 | 0.7007 | 1368.0 |
| 298.15 | 0.8028 | 1375.0 |
| 298.15 | 0.8953 | 1381.0 |
| 298.15 | 0.9498 | 1386.0 |
| 298.15 | 1.0000 | 1391.0 |
| 313.15 | 0.0000 | 1289.0 |
| 313.15 | 0.0508 | 1289.0 |
| 313.15 | 0.0905 | 1289.0 |
| 313.15 | 0.1697 | 1289.0 |
| 313.15 | 0.2967 | 1291.0 |
| 313.15 | 0.3824 | 1293.0 |
| 313.15 | 0.4839 | 1296.0 |
| 313.15 | 0.5878 | 1300.0 |
| 313.15 | 0.6869 | 1305.0 |
| 313.15 | 0.7892 | 1310.0 |
| 313.15 | 0.8891 | 1317.0 |
| 313.15 | 0.9368 | 1321.0 |
| 313.15 | 1.0000 | 1326.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Cyclooctane (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1350.0 |
| 298.15 | 0.0513 | 1347.0 |
| 298.15 | 0.1015 | 1348.0 |
| 298.15 | 0.2000 | 1349.0 |
| 298.15 | 0.3067 | 1351.0 |
| 298.15 | 0.4026 | 1354.0 |
| 298.15 | 0.5037 | 1358.0 |
| 298.15 | 0.6262 | 1364.0 |
| 298.15 | 0.7007 | 1368.0 |
| 298.15 | 0.8028 | 1375.0 |
| 298.15 | 0.8953 | 1381.0 |
| 298.15 | 0.9498 | 1386.0 |
| 298.15 | 1.0000 | 1391.0 |
| 313.15 | 0.0000 | 1289.0 |
| 313.15 | 0.0508 | 1289.0 |
| 313.15 | 0.0905 | 1289.0 |
| 313.15 | 0.1697 | 1289.0 |
| 313.15 | 0.2967 | 1291.0 |
| 313.15 | 0.3824 | 1293.0 |
| 313.15 | 0.4839 | 1296.0 |
| 313.15 | 0.5878 | 1300.0 |
| 313.15 | 0.6869 | 1305.0 |
| 313.15 | 0.7892 | 1310.0 |
| 313.15 | 0.8891 | 1317.0 |
| 313.15 | 0.9368 | 1321.0 |
| 313.15 | 1.0000 | 1326.0 |