- Name
- 2-Butanone
- InChI
- InChI=1S/C4H8O/c1-3-4(2)5/h3H2,1-2H3
- InChI Key
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N
- Formula
- C4H8O
- SMILES
- CCC(C)=O
- Mol. Weight (g/mol)
- 72.11
- CAS
- 78-93-3
- Name
- 3-Pentanol
- InChI
- InChI=1S/C5H12O/c1-3-5(6)4-2/h5-6H,3-4H2,1-2H3
- InChI Key
- AQIXEPGDORPWBJ-UHFFFAOYSA-N
- Formula
- C5H12O
- SMILES
- CCC(O)CC
- Mol. Weight (g/mol)
- 88.15
- CAS
- 584-02-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Butanone (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0046 |
| 298.15 | 0.0843 | 0.0028 |
| 298.15 | 0.1622 | 0.0020 |
| 298.15 | 0.2428 | 0.0015 |
| 298.15 | 0.3505 | 0.0011 |
| 298.15 | 0.4415 | 0.0009 |
| 298.15 | 0.5584 | 0.0007 |
| 298.15 | 0.6526 | 0.0006 |
| 298.15 | 0.7399 | 0.0005 |
| 298.15 | 0.8540 | 0.0004 |
| 298.15 | 0.9383 | 0.0004 |
| 298.15 | 1.0000 | 0.0004 |
| 308.15 | 0.0000 | 0.0029 |
| 308.15 | 0.0843 | 0.0020 |
| 308.15 | 0.1622 | 0.0015 |
| 308.15 | 0.2428 | 0.0012 |
| 308.15 | 0.3505 | 0.0009 |
| 308.15 | 0.4415 | 0.0007 |
| 308.15 | 0.5584 | 0.0006 |
| 308.15 | 0.6526 | 0.0005 |
| 308.15 | 0.7399 | 0.0004 |
| 308.15 | 0.8540 | 0.0004 |
| 308.15 | 0.9383 | 0.0004 |
| 308.15 | 1.0000 | 0.0004 |
| 318.15 | 0.0000 | 0.0019 |
| 318.15 | 0.0843 | 0.0014 |
| 318.15 | 0.1622 | 0.0010 |
| 318.15 | 0.2428 | 0.0007 |
| 318.15 | 0.3505 | 0.0005 |
| 318.15 | 0.4415 | 0.0004 |
| 318.15 | 0.5584 | 0.0003 |
| 318.15 | 0.6526 | 0.0003 |
| 318.15 | 0.7399 | 0.0003 |
| 318.15 | 0.8540 | 0.0003 |
| 318.15 | 0.9383 | 0.0003 |
| 318.15 | 1.0000 | 0.0003 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Butanone (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0046 |
| 298.15 | 0.0843 | 0.0028 |
| 298.15 | 0.1622 | 0.0020 |
| 298.15 | 0.2428 | 0.0015 |
| 298.15 | 0.3505 | 0.0011 |
| 298.15 | 0.4415 | 0.0009 |
| 298.15 | 0.5584 | 0.0007 |
| 298.15 | 0.6526 | 0.0006 |
| 298.15 | 0.7399 | 0.0005 |
| 298.15 | 0.8540 | 0.0004 |
| 298.15 | 0.9383 | 0.0004 |
| 298.15 | 1.0000 | 0.0004 |
| 308.15 | 0.0000 | 0.0029 |
| 308.15 | 0.0843 | 0.0020 |
| 308.15 | 0.1622 | 0.0015 |
| 308.15 | 0.2428 | 0.0012 |
| 308.15 | 0.3505 | 0.0009 |
| 308.15 | 0.4415 | 0.0007 |
| 308.15 | 0.5584 | 0.0006 |
| 308.15 | 0.6526 | 0.0005 |
| 308.15 | 0.7399 | 0.0004 |
| 308.15 | 0.8540 | 0.0004 |
| 308.15 | 0.9383 | 0.0004 |
| 308.15 | 1.0000 | 0.0004 |
| 318.15 | 0.0000 | 0.0019 |
| 318.15 | 0.0843 | 0.0014 |
| 318.15 | 0.1622 | 0.0010 |
| 318.15 | 0.2428 | 0.0007 |
| 318.15 | 0.3505 | 0.0005 |
| 318.15 | 0.4415 | 0.0004 |
| 318.15 | 0.5584 | 0.0003 |
| 318.15 | 0.6526 | 0.0003 |
| 318.15 | 0.7399 | 0.0003 |
| 318.15 | 0.8540 | 0.0003 |
| 318.15 | 0.9383 | 0.0003 |
| 318.15 | 1.0000 | 0.0003 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Butanone (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4047 |
| 298.15 | 0.0843 | 1.4032 |
| 298.15 | 0.1622 | 1.4016 |
| 298.15 | 0.2428 | 1.3999 |
| 298.15 | 0.3505 | 1.3971 |
| 298.15 | 0.4415 | 1.3945 |
| 298.15 | 0.5584 | 1.3908 |
| 298.15 | 0.6526 | 1.3876 |
| 298.15 | 0.7399 | 1.3846 |
| 298.15 | 0.8540 | 1.3803 |
| 298.15 | 0.9383 | 1.3773 |
| 298.15 | 1.0000 | 1.375 |
| 308.15 | 0.0000 | 1.4029 |
| 308.15 | 0.0843 | 1.4012 |
| 308.15 | 0.1622 | 1.3995 |
| 308.15 | 0.2428 | 1.3975 |
| 308.15 | 0.3505 | 1.3944 |
| 308.15 | 0.4415 | 1.3916 |
| 308.15 | 0.5584 | 1.3876 |
| 308.15 | 0.6526 | 1.3841 |
| 308.15 | 0.7399 | 1.3806 |
| 308.15 | 0.8540 | 1.376 |
| 308.15 | 0.9383 | 1.3725 |
| 308.15 | 1.0000 | 1.37 |
| 318.15 | 0.0000 | 1.3981 |
| 318.15 | 0.0843 | 1.3965 |
| 318.15 | 0.1622 | 1.3949 |
| 318.15 | 0.2428 | 1.3929 |
| 318.15 | 0.3505 | 1.3901 |
| 318.15 | 0.4415 | 1.3873 |
| 318.15 | 0.5584 | 1.3835 |
| 318.15 | 0.6526 | 1.38 |
| 318.15 | 0.7399 | 1.3767 |
| 318.15 | 0.8540 | 1.372 |
| 318.15 | 0.9383 | 1.3684 |
| 318.15 | 1.0000 | 1.3657 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Butanone (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4047 |
| 298.15 | 0.0843 | 1.4032 |
| 298.15 | 0.1622 | 1.4016 |
| 298.15 | 0.2428 | 1.3999 |
| 298.15 | 0.3505 | 1.3971 |
| 298.15 | 0.4415 | 1.3945 |
| 298.15 | 0.5584 | 1.3908 |
| 298.15 | 0.6526 | 1.3876 |
| 298.15 | 0.7399 | 1.3846 |
| 298.15 | 0.8540 | 1.3803 |
| 298.15 | 0.9383 | 1.3773 |
| 298.15 | 1.0000 | 1.375 |
| 308.15 | 0.0000 | 1.4029 |
| 308.15 | 0.0843 | 1.4012 |
| 308.15 | 0.1622 | 1.3995 |
| 308.15 | 0.2428 | 1.3975 |
| 308.15 | 0.3505 | 1.3944 |
| 308.15 | 0.4415 | 1.3916 |
| 308.15 | 0.5584 | 1.3876 |
| 308.15 | 0.6526 | 1.3841 |
| 308.15 | 0.7399 | 1.3806 |
| 308.15 | 0.8540 | 1.376 |
| 308.15 | 0.9383 | 1.3725 |
| 308.15 | 1.0000 | 1.37 |
| 318.15 | 0.0000 | 1.3981 |
| 318.15 | 0.0843 | 1.3965 |
| 318.15 | 0.1622 | 1.3949 |
| 318.15 | 0.2428 | 1.3929 |
| 318.15 | 0.3505 | 1.3901 |
| 318.15 | 0.4415 | 1.3873 |
| 318.15 | 0.5584 | 1.3835 |
| 318.15 | 0.6526 | 1.38 |
| 318.15 | 0.7399 | 1.3767 |
| 318.15 | 0.8540 | 1.372 |
| 318.15 | 0.9383 | 1.3684 |
| 318.15 | 1.0000 | 1.3657 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Butanone (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 815.79 |
| 298.15 | 0.0843 | 813.43 |
| 298.15 | 0.1622 | 811.5 |
| 298.15 | 0.2428 | 809.72 |
| 298.15 | 0.3505 | 807.45 |
| 298.15 | 0.4415 | 805.82 |
| 298.15 | 0.5584 | 803.92 |
| 298.15 | 0.6526 | 802.64 |
| 298.15 | 0.7399 | 801.72 |
| 298.15 | 0.8540 | 800.8 |
| 298.15 | 0.9383 | 800.16 |
| 298.15 | 1.0000 | 799.76 |
| 308.15 | 0.0000 | 806.91 |
| 308.15 | 0.0843 | 804.58 |
| 308.15 | 0.1622 | 802.6 |
| 308.15 | 0.2428 | 800.57 |
| 308.15 | 0.3505 | 798.07 |
| 308.15 | 0.4415 | 796.23 |
| 308.15 | 0.5584 | 794.1 |
| 308.15 | 0.6526 | 792.64 |
| 308.15 | 0.7399 | 791.55 |
| 308.15 | 0.8540 | 790.31 |
| 308.15 | 0.9383 | 789.7 |
| 308.15 | 1.0000 | 789.21 |
| 318.15 | 0.0000 | 797.66 |
| 318.15 | 0.0843 | 795.034 |
| 318.15 | 0.1622 | 792.888 |
| 318.15 | 0.2428 | 790.723 |
| 318.15 | 0.3505 | 788.175 |
| 318.15 | 0.4415 | 786.285 |
| 318.15 | 0.5584 | 784.161 |
| 318.15 | 0.6526 | 782.699 |
| 318.15 | 0.7399 | 781.619 |
| 318.15 | 0.8540 | 780.165 |
| 318.15 | 0.9383 | 779.212 |
| 318.15 | 1.0000 | 778.52 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Butanone (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 815.79 |
| 298.15 | 0.0843 | 813.43 |
| 298.15 | 0.1622 | 811.5 |
| 298.15 | 0.2428 | 809.72 |
| 298.15 | 0.3505 | 807.45 |
| 298.15 | 0.4415 | 805.82 |
| 298.15 | 0.5584 | 803.92 |
| 298.15 | 0.6526 | 802.64 |
| 298.15 | 0.7399 | 801.72 |
| 298.15 | 0.8540 | 800.8 |
| 298.15 | 0.9383 | 800.16 |
| 298.15 | 1.0000 | 799.76 |
| 308.15 | 0.0000 | 806.91 |
| 308.15 | 0.0843 | 804.58 |
| 308.15 | 0.1622 | 802.6 |
| 308.15 | 0.2428 | 800.57 |
| 308.15 | 0.3505 | 798.07 |
| 308.15 | 0.4415 | 796.23 |
| 308.15 | 0.5584 | 794.1 |
| 308.15 | 0.6526 | 792.64 |
| 308.15 | 0.7399 | 791.55 |
| 308.15 | 0.8540 | 790.31 |
| 308.15 | 0.9383 | 789.7 |
| 308.15 | 1.0000 | 789.21 |
| 318.15 | 0.0000 | 797.66 |
| 318.15 | 0.0843 | 795.034 |
| 318.15 | 0.1622 | 792.888 |
| 318.15 | 0.2428 | 790.723 |
| 318.15 | 0.3505 | 788.175 |
| 318.15 | 0.4415 | 786.285 |
| 318.15 | 0.5584 | 784.161 |
| 318.15 | 0.6526 | 782.699 |
| 318.15 | 0.7399 | 781.619 |
| 318.15 | 0.8540 | 780.165 |
| 318.15 | 0.9383 | 779.212 |
| 318.15 | 1.0000 | 778.52 |