- Name
- Potassium nitrate
- InChI
- InChI=1S/K.NO3/c;2-1(3)4/q+1;-1
- InChI Key
- FGIUAXJPYTZDNR-UHFFFAOYSA-N
- Formula
- KNO3
- SMILES
- O=[N+]([O-])O[K]
- Mol. Weight (g/mol)
- 101.10
- Name
- D-Valine
- InChI
- InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t4-/m0/s1
- InChI Key
- KZSNJWFQEVHDMF-BYPYZUCNSA-N
- Formula
- C5H11NO2
- SMILES
- CC(C)C(N)C(=O)O
- Mol. Weight (g/mol)
- 117.15
- CAS
- 640-68-6
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Osmotic coefficient (2)
- Molality, mol/kg (2)
- η - Viscosity, Pa*s (2)
- ρl - Mass density, kg/m3 (4)
- csound,fluid - Speed of Sound, m/s (4)
Osmotic coefficient [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Molality, mol/kg of D-Valine (2) - Liquid | Molality, mol/kg of Potassium nitrate (1) - Liquid | Osmotic coefficient - Liquid |
| 0.0000 | 1.0000 | 0.7440 |
| 0.0500 | 1.0000 | 0.7480 |
| 0.0980 | 1.0000 | 0.7560 |
| 0.1520 | 1.0000 | 0.7640 |
| 0.2030 | 1.0000 | 0.7670 |
| 0.2500 | 1.0000 | 0.7740 |
| 0.3000 | 1.0000 | 0.7810 |
| 0.3480 | 1.0000 | 0.7860 |
| 0.4040 | 1.0000 | 0.7930 |
| 0.4550 | 1.0000 | 0.7940 |
| 0.4980 | 1.0000 | 0.8000 |
| 0.0000 | 3.0 | 0.5990 |
| 0.0520 | 3.0 | 0.6100 |
| 0.1020 | 3.0 | 0.6270 |
| 0.1550 | 3.0 | 0.6360 |
| 0.2020 | 3.0 | 0.6440 |
| 0.2510 | 3.0 | 0.6490 |
| 0.2990 | 3.0 | 0.6520 |
| 0.3520 | 3.0 | 0.6620 |
| 0.4010 | 3.0 | 0.6690 |
Osmotic coefficient [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Molality, mol/kg of D-Valine (2) - Liquid | Molality, mol/kg of Potassium nitrate (1) - Liquid | Osmotic coefficient - Liquid |
| 0.0000 | 1.0000 | 0.7440 |
| 0.0500 | 1.0000 | 0.7480 |
| 0.0980 | 1.0000 | 0.7560 |
| 0.1520 | 1.0000 | 0.7640 |
| 0.2030 | 1.0000 | 0.7670 |
| 0.2500 | 1.0000 | 0.7740 |
| 0.3000 | 1.0000 | 0.7810 |
| 0.3480 | 1.0000 | 0.7860 |
| 0.4040 | 1.0000 | 0.7930 |
| 0.4550 | 1.0000 | 0.7940 |
| 0.4980 | 1.0000 | 0.8000 |
| 0.0000 | 3.0 | 0.5990 |
| 0.0520 | 3.0 | 0.6100 |
| 0.1020 | 3.0 | 0.6270 |
| 0.1550 | 3.0 | 0.6360 |
| 0.2020 | 3.0 | 0.6440 |
| 0.2510 | 3.0 | 0.6490 |
| 0.2990 | 3.0 | 0.6520 |
| 0.3520 | 3.0 | 0.6620 |
| 0.4010 | 3.0 | 0.6690 |
Molality, mol/kg of D-Valine (2) [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Molality, mol/kg of Potassium nitrate (1) - Liquid | Molality, mol/kg of D-Valine (2) - Liquid |
|---|---|
| 0.9900 | 0.5200 |
| 3.0 | 0.4500 |
Molality, mol/kg of D-Valine (2) [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Molality, mol/kg of Potassium nitrate (1) - Liquid | Molality, mol/kg of D-Valine (2) - Liquid |
|---|---|
| 0.9900 | 0.5200 |
| 3.0 | 0.4500 |
Viscosity, Pa*s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Amount concentration (molarity), mol/dm3 = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-Valine (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0009 |
| 298.15 | 0.0178 | 0.0009 |
| 298.15 | 0.0357 | 0.0009 |
| 298.15 | 0.0537 | 0.0010 |
| 298.15 | 0.0898 | 0.0010 |
| 298.15 | 0.1264 | 0.0010 |
| 298.15 | 0.1814 | 0.0010 |
| 303.15 | 0.0000 | 0.0008 |
| 303.15 | 0.0178 | 0.0009 |
| 303.15 | 0.0357 | 0.0009 |
| 303.15 | 0.0537 | 0.0009 |
| 303.15 | 0.0898 | 0.0009 |
| 303.15 | 0.1264 | 0.0009 |
| 303.15 | 0.1630 | 0.0009 |
| 303.15 | 0.1814 | 0.0009 |
| 308.15 | 0.0000 | 0.0008 |
| 308.15 | 0.0178 | 0.0008 |
| 308.15 | 0.0357 | 0.0008 |
| 308.15 | 0.0537 | 0.0008 |
| 308.15 | 0.0898 | 0.0008 |
| 308.15 | 0.1264 | 0.0008 |
| 308.15 | 0.1630 | 0.0008 |
| 308.15 | 0.1814 | 0.0009 |
| 313.15 | 0.0000 | 0.0007 |
| 313.15 | 0.0178 | 0.0007 |
| 313.15 | 0.0357 | 0.0007 |
| 313.15 | 0.0537 | 0.0007 |
| 313.15 | 0.0898 | 0.0008 |
| 313.15 | 0.1264 | 0.0008 |
| 313.15 | 0.1630 | 0.0008 |
| 313.15 | 0.1814 | 0.0008 |
| 318.15 | 0.0000 | 0.0006 |
| 318.15 | 0.0178 | 0.0006 |
| 318.15 | 0.0357 | 0.0007 |
| 318.15 | 0.0537 | 0.0007 |
| 318.15 | 0.0898 | 0.0007 |
| 318.15 | 0.1264 | 0.0007 |
| 318.15 | 0.1630 | 0.0007 |
| 318.15 | 0.1814 | 0.0007 |
| 323.15 | 0.0000 | 0.0006 |
| 323.15 | 0.0178 | 0.0006 |
| 323.15 | 0.0357 | 0.0006 |
| 323.15 | 0.0537 | 0.0006 |
| 323.15 | 0.0898 | 0.0006 |
| 323.15 | 0.1264 | 0.0006 |
| 323.15 | 0.1630 | 0.0006 |
| 323.15 | 0.1814 | 0.0006 |
Viscosity, Pa*s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Amount concentration (molarity), mol/dm3 = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-Valine (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0009 |
| 298.15 | 0.0178 | 0.0009 |
| 298.15 | 0.0357 | 0.0009 |
| 298.15 | 0.0537 | 0.0010 |
| 298.15 | 0.0898 | 0.0010 |
| 298.15 | 0.1264 | 0.0010 |
| 298.15 | 0.1814 | 0.0010 |
| 303.15 | 0.0000 | 0.0008 |
| 303.15 | 0.0178 | 0.0009 |
| 303.15 | 0.0357 | 0.0009 |
| 303.15 | 0.0537 | 0.0009 |
| 303.15 | 0.0898 | 0.0009 |
| 303.15 | 0.1264 | 0.0009 |
| 303.15 | 0.1630 | 0.0009 |
| 303.15 | 0.1814 | 0.0009 |
| 308.15 | 0.0000 | 0.0008 |
| 308.15 | 0.0178 | 0.0008 |
| 308.15 | 0.0357 | 0.0008 |
| 308.15 | 0.0537 | 0.0008 |
| 308.15 | 0.0898 | 0.0008 |
| 308.15 | 0.1264 | 0.0008 |
| 308.15 | 0.1630 | 0.0008 |
| 308.15 | 0.1814 | 0.0009 |
| 313.15 | 0.0000 | 0.0007 |
| 313.15 | 0.0178 | 0.0007 |
| 313.15 | 0.0357 | 0.0007 |
| 313.15 | 0.0537 | 0.0007 |
| 313.15 | 0.0898 | 0.0008 |
| 313.15 | 0.1264 | 0.0008 |
| 313.15 | 0.1630 | 0.0008 |
| 313.15 | 0.1814 | 0.0008 |
| 318.15 | 0.0000 | 0.0006 |
| 318.15 | 0.0178 | 0.0006 |
| 318.15 | 0.0357 | 0.0007 |
| 318.15 | 0.0537 | 0.0007 |
| 318.15 | 0.0898 | 0.0007 |
| 318.15 | 0.1264 | 0.0007 |
| 318.15 | 0.1630 | 0.0007 |
| 318.15 | 0.1814 | 0.0007 |
| 323.15 | 0.0000 | 0.0006 |
| 323.15 | 0.0178 | 0.0006 |
| 323.15 | 0.0357 | 0.0006 |
| 323.15 | 0.0537 | 0.0006 |
| 323.15 | 0.0898 | 0.0006 |
| 323.15 | 0.1264 | 0.0006 |
| 323.15 | 0.1630 | 0.0006 |
| 323.15 | 0.1814 | 0.0006 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Amount concentration (molarity), mol/dm3 = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-Valine (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1122.9 |
| 298.15 | 0.0178 | 1123.2 |
| 298.15 | 0.0357 | 1123.5 |
| 298.15 | 0.0537 | 1123.8 |
| 298.15 | 0.0898 | 1124.6 |
| 298.15 | 0.1264 | 1124.8 |
| 298.15 | 0.1630 | 1125.1 |
| 298.15 | 0.1814 | 1126.0 |
| 303.15 | 0.0000 | 1120.6 |
| 303.15 | 0.0178 | 1120.9 |
| 303.15 | 0.0357 | 1121.2 |
| 303.15 | 0.0537 | 1121.5 |
| 303.15 | 0.0898 | 1121.9 |
| 303.15 | 0.1264 | 1122.5 |
| 303.15 | 0.1630 | 1123.1 |
| 303.15 | 0.1814 | 1123.4 |
| 308.15 | 0.0000 | 1118.0 |
| 308.15 | 0.0178 | 1118.2 |
| 308.15 | 0.0357 | 1118.6 |
| 308.15 | 0.0537 | 1118.8 |
| 308.15 | 0.0898 | 1119.1 |
| 308.15 | 0.1264 | 1120.3 |
| 308.15 | 0.1630 | 1120.6 |
| 308.15 | 0.1814 | 1120.9 |
| 313.15 | 0.0000 | 1115.0 |
| 313.15 | 0.0178 | 1115.3 |
| 313.15 | 0.0357 | 1115.7 |
| 313.15 | 0.0537 | 1115.9 |
| 313.15 | 0.0898 | 1116.3 |
| 313.15 | 0.1264 | 1117.6 |
| 313.15 | 0.1630 | 1117.8 |
| 313.15 | 0.1814 | 1118.0 |
| 318.15 | 0.0000 | 1111.8 |
| 318.15 | 0.0178 | 1112.1 |
| 318.15 | 0.0357 | 1112.4 |
| 318.15 | 0.0537 | 1112.7 |
| 318.15 | 0.0898 | 1113.3 |
| 318.15 | 0.1264 | 1114.4 |
| 318.15 | 0.1630 | 1114.6 |
| 318.15 | 0.1814 | 1114.9 |
| 323.15 | 0.0000 | 1108.2 |
| 323.15 | 0.0178 | 1108.6 |
| 323.15 | 0.0357 | 1108.9 |
| 323.15 | 0.0537 | 1109.2 |
| 323.15 | 0.0898 | 1110.2 |
| 323.15 | 0.1264 | 1110.7 |
| 323.15 | 0.1630 | 1111.0 |
| 323.15 | 0.1814 | 1111.5 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Amount concentration (molarity), mol/dm3 = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-Valine (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1122.9 |
| 298.15 | 0.0178 | 1123.2 |
| 298.15 | 0.0357 | 1123.5 |
| 298.15 | 0.0537 | 1123.8 |
| 298.15 | 0.0898 | 1124.6 |
| 298.15 | 0.1264 | 1124.8 |
| 298.15 | 0.1630 | 1125.1 |
| 298.15 | 0.1814 | 1126.0 |
| 303.15 | 0.0000 | 1120.6 |
| 303.15 | 0.0178 | 1120.9 |
| 303.15 | 0.0357 | 1121.2 |
| 303.15 | 0.0537 | 1121.5 |
| 303.15 | 0.0898 | 1121.9 |
| 303.15 | 0.1264 | 1122.5 |
| 303.15 | 0.1630 | 1123.1 |
| 303.15 | 0.1814 | 1123.4 |
| 308.15 | 0.0000 | 1118.0 |
| 308.15 | 0.0178 | 1118.2 |
| 308.15 | 0.0357 | 1118.6 |
| 308.15 | 0.0537 | 1118.8 |
| 308.15 | 0.0898 | 1119.1 |
| 308.15 | 0.1264 | 1120.3 |
| 308.15 | 0.1630 | 1120.6 |
| 308.15 | 0.1814 | 1120.9 |
| 313.15 | 0.0000 | 1115.0 |
| 313.15 | 0.0178 | 1115.3 |
| 313.15 | 0.0357 | 1115.7 |
| 313.15 | 0.0537 | 1115.9 |
| 313.15 | 0.0898 | 1116.3 |
| 313.15 | 0.1264 | 1117.6 |
| 313.15 | 0.1630 | 1117.8 |
| 313.15 | 0.1814 | 1118.0 |
| 318.15 | 0.0000 | 1111.8 |
| 318.15 | 0.0178 | 1112.1 |
| 318.15 | 0.0357 | 1112.4 |
| 318.15 | 0.0537 | 1112.7 |
| 318.15 | 0.0898 | 1113.3 |
| 318.15 | 0.1264 | 1114.4 |
| 318.15 | 0.1630 | 1114.6 |
| 318.15 | 0.1814 | 1114.9 |
| 323.15 | 0.0000 | 1108.2 |
| 323.15 | 0.0178 | 1108.6 |
| 323.15 | 0.0357 | 1108.9 |
| 323.15 | 0.0537 | 1109.2 |
| 323.15 | 0.0898 | 1110.2 |
| 323.15 | 0.1264 | 1110.7 |
| 323.15 | 0.1630 | 1111.0 |
| 323.15 | 0.1814 | 1111.5 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Amount concentration (molarity), mol/dm3 = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-Valine (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1122.9 |
| 298.15 | 0.0178 | 1123.2 |
| 298.15 | 0.0357 | 1123.5 |
| 298.15 | 0.0537 | 1123.8 |
| 298.15 | 0.0898 | 1124.6 |
| 298.15 | 0.1264 | 1124.8 |
| 298.15 | 0.1630 | 1125.1 |
| 298.15 | 0.1814 | 1126.0 |
| 303.15 | 0.0000 | 1120.6 |
| 303.15 | 0.0178 | 1120.9 |
| 303.15 | 0.0357 | 1121.2 |
| 303.15 | 0.0537 | 1121.5 |
| 303.15 | 0.0898 | 1121.9 |
| 303.15 | 0.1264 | 1122.5 |
| 303.15 | 0.1630 | 1123.1 |
| 303.15 | 0.1814 | 1123.4 |
| 308.15 | 0.0000 | 1118.0 |
| 308.15 | 0.0178 | 1118.2 |
| 308.15 | 0.0357 | 1118.6 |
| 308.15 | 0.0537 | 1118.8 |
| 308.15 | 0.0898 | 1119.1 |
| 308.15 | 0.1264 | 1120.3 |
| 308.15 | 0.1630 | 1120.6 |
| 308.15 | 0.1814 | 1120.9 |
| 313.15 | 0.0000 | 1115.0 |
| 313.15 | 0.0178 | 1115.3 |
| 313.15 | 0.0357 | 1115.7 |
| 313.15 | 0.0537 | 1115.9 |
| 313.15 | 0.0898 | 1116.3 |
| 313.15 | 0.1264 | 1117.6 |
| 313.15 | 0.1630 | 1117.8 |
| 313.15 | 0.1814 | 1118.0 |
| 318.15 | 0.0000 | 1111.8 |
| 318.15 | 0.0178 | 1112.1 |
| 318.15 | 0.0357 | 1112.4 |
| 318.15 | 0.0537 | 1112.7 |
| 318.15 | 0.0898 | 1113.3 |
| 318.15 | 0.1264 | 1114.4 |
| 318.15 | 0.1630 | 1114.6 |
| 318.15 | 0.1814 | 1114.9 |
| 323.15 | 0.0000 | 1108.2 |
| 323.15 | 0.0178 | 1108.6 |
| 323.15 | 0.0357 | 1108.9 |
| 323.15 | 0.0537 | 1109.2 |
| 323.15 | 0.0898 | 1110.2 |
| 323.15 | 0.1264 | 1110.7 |
| 323.15 | 0.1630 | 1111.0 |
| 323.15 | 0.1814 | 1111.5 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Amount concentration (molarity), mol/dm3 = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-Valine (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1122.9 |
| 298.15 | 0.0178 | 1123.2 |
| 298.15 | 0.0357 | 1123.5 |
| 298.15 | 0.0537 | 1123.8 |
| 298.15 | 0.0898 | 1124.6 |
| 298.15 | 0.1264 | 1124.8 |
| 298.15 | 0.1630 | 1125.1 |
| 298.15 | 0.1814 | 1126.0 |
| 303.15 | 0.0000 | 1120.6 |
| 303.15 | 0.0178 | 1120.9 |
| 303.15 | 0.0357 | 1121.2 |
| 303.15 | 0.0537 | 1121.5 |
| 303.15 | 0.0898 | 1121.9 |
| 303.15 | 0.1264 | 1122.5 |
| 303.15 | 0.1630 | 1123.1 |
| 303.15 | 0.1814 | 1123.4 |
| 308.15 | 0.0000 | 1118.0 |
| 308.15 | 0.0178 | 1118.2 |
| 308.15 | 0.0357 | 1118.6 |
| 308.15 | 0.0537 | 1118.8 |
| 308.15 | 0.0898 | 1119.1 |
| 308.15 | 0.1264 | 1120.3 |
| 308.15 | 0.1630 | 1120.6 |
| 308.15 | 0.1814 | 1120.9 |
| 313.15 | 0.0000 | 1115.0 |
| 313.15 | 0.0178 | 1115.3 |
| 313.15 | 0.0357 | 1115.7 |
| 313.15 | 0.0537 | 1115.9 |
| 313.15 | 0.0898 | 1116.3 |
| 313.15 | 0.1264 | 1117.6 |
| 313.15 | 0.1630 | 1117.8 |
| 313.15 | 0.1814 | 1118.0 |
| 318.15 | 0.0000 | 1111.8 |
| 318.15 | 0.0178 | 1112.1 |
| 318.15 | 0.0357 | 1112.4 |
| 318.15 | 0.0537 | 1112.7 |
| 318.15 | 0.0898 | 1113.3 |
| 318.15 | 0.1264 | 1114.4 |
| 318.15 | 0.1630 | 1114.6 |
| 318.15 | 0.1814 | 1114.9 |
| 323.15 | 0.0000 | 1108.2 |
| 323.15 | 0.0178 | 1108.6 |
| 323.15 | 0.0357 | 1108.9 |
| 323.15 | 0.0537 | 1109.2 |
| 323.15 | 0.0898 | 1110.2 |
| 323.15 | 0.1264 | 1110.7 |
| 323.15 | 0.1630 | 1111.0 |
| 323.15 | 0.1814 | 1111.5 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Amount concentration (molarity), mol/dm3 = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-Valine (2) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1562.0 |
| 298.15 | 0.0178 | 1565.0 |
| 298.15 | 0.0357 | 1568.0 |
| 298.15 | 0.0537 | 1571.2 |
| 298.15 | 0.0898 | 1574.4 |
| 298.15 | 0.1264 | 1577.4 |
| 298.15 | 0.1630 | 1580.6 |
| 298.15 | 0.1814 | 1583.4 |
| 303.15 | 0.0000 | 1569.4 |
| 303.15 | 0.0178 | 1572.6 |
| 303.15 | 0.0357 | 1575.8 |
| 303.15 | 0.0537 | 1578.8 |
| 303.15 | 0.0898 | 1582.0 |
| 303.15 | 0.1264 | 1585.0 |
| 303.15 | 0.1630 | 1588.2 |
| 303.15 | 0.1814 | 1591.4 |
| 308.15 | 0.0000 | 1575.0 |
| 308.15 | 0.0178 | 1578.0 |
| 308.15 | 0.0357 | 1581.2 |
| 308.15 | 0.0537 | 1584.2 |
| 308.15 | 0.0898 | 1587.2 |
| 308.15 | 0.1264 | 1590.4 |
| 308.15 | 0.1630 | 1593.6 |
| 308.15 | 0.1814 | 1596.6 |
| 313.15 | 0.0000 | 1580.0 |
| 313.15 | 0.0178 | 1583.0 |
| 313.15 | 0.0357 | 1586.2 |
| 313.15 | 0.0537 | 1589.4 |
| 313.15 | 0.0898 | 1592.6 |
| 313.15 | 0.1264 | 1595.8 |
| 313.15 | 0.1630 | 1599.0 |
| 313.15 | 0.1814 | 1602.0 |
| 318.15 | 0.0000 | 1584.5 |
| 318.15 | 0.0178 | 1587.5 |
| 318.15 | 0.0357 | 1590.5 |
| 318.15 | 0.0537 | 1593.8 |
| 318.15 | 0.0898 | 1597.0 |
| 318.15 | 0.1264 | 1600.0 |
| 318.15 | 0.1630 | 1603.2 |
| 318.15 | 0.1814 | 1606.4 |
| 323.15 | 0.0000 | 1588.8 |
| 323.15 | 0.0178 | 1592.0 |
| 323.15 | 0.0357 | 1595.0 |
| 323.15 | 0.0537 | 1598.0 |
| 323.15 | 0.0898 | 1601.0 |
| 323.15 | 0.1264 | 1604.2 |
| 323.15 | 0.1630 | 1607.4 |
| 323.15 | 0.1814 | 1610.6 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Amount concentration (molarity), mol/dm3 = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-Valine (2) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1562.0 |
| 298.15 | 0.0178 | 1565.0 |
| 298.15 | 0.0357 | 1568.0 |
| 298.15 | 0.0537 | 1571.2 |
| 298.15 | 0.0898 | 1574.4 |
| 298.15 | 0.1264 | 1577.4 |
| 298.15 | 0.1630 | 1580.6 |
| 298.15 | 0.1814 | 1583.4 |
| 303.15 | 0.0000 | 1569.4 |
| 303.15 | 0.0178 | 1572.6 |
| 303.15 | 0.0357 | 1575.8 |
| 303.15 | 0.0537 | 1578.8 |
| 303.15 | 0.0898 | 1582.0 |
| 303.15 | 0.1264 | 1585.0 |
| 303.15 | 0.1630 | 1588.2 |
| 303.15 | 0.1814 | 1591.4 |
| 308.15 | 0.0000 | 1575.0 |
| 308.15 | 0.0178 | 1578.0 |
| 308.15 | 0.0357 | 1581.2 |
| 308.15 | 0.0537 | 1584.2 |
| 308.15 | 0.0898 | 1587.2 |
| 308.15 | 0.1264 | 1590.4 |
| 308.15 | 0.1630 | 1593.6 |
| 308.15 | 0.1814 | 1596.6 |
| 313.15 | 0.0000 | 1580.0 |
| 313.15 | 0.0178 | 1583.0 |
| 313.15 | 0.0357 | 1586.2 |
| 313.15 | 0.0537 | 1589.4 |
| 313.15 | 0.0898 | 1592.6 |
| 313.15 | 0.1264 | 1595.8 |
| 313.15 | 0.1630 | 1599.0 |
| 313.15 | 0.1814 | 1602.0 |
| 318.15 | 0.0000 | 1584.5 |
| 318.15 | 0.0178 | 1587.5 |
| 318.15 | 0.0357 | 1590.5 |
| 318.15 | 0.0537 | 1593.8 |
| 318.15 | 0.0898 | 1597.0 |
| 318.15 | 0.1264 | 1600.0 |
| 318.15 | 0.1630 | 1603.2 |
| 318.15 | 0.1814 | 1606.4 |
| 323.15 | 0.0000 | 1588.8 |
| 323.15 | 0.0178 | 1592.0 |
| 323.15 | 0.0357 | 1595.0 |
| 323.15 | 0.0537 | 1598.0 |
| 323.15 | 0.0898 | 1601.0 |
| 323.15 | 0.1264 | 1604.2 |
| 323.15 | 0.1630 | 1607.4 |
| 323.15 | 0.1814 | 1610.6 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Amount concentration (molarity), mol/dm3 = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-Valine (2) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1562.0 |
| 298.15 | 0.0178 | 1565.0 |
| 298.15 | 0.0357 | 1568.0 |
| 298.15 | 0.0537 | 1571.2 |
| 298.15 | 0.0898 | 1574.4 |
| 298.15 | 0.1264 | 1577.4 |
| 298.15 | 0.1630 | 1580.6 |
| 298.15 | 0.1814 | 1583.4 |
| 303.15 | 0.0000 | 1569.4 |
| 303.15 | 0.0178 | 1572.6 |
| 303.15 | 0.0357 | 1575.8 |
| 303.15 | 0.0537 | 1578.8 |
| 303.15 | 0.0898 | 1582.0 |
| 303.15 | 0.1264 | 1585.0 |
| 303.15 | 0.1630 | 1588.2 |
| 303.15 | 0.1814 | 1591.4 |
| 308.15 | 0.0000 | 1575.0 |
| 308.15 | 0.0178 | 1578.0 |
| 308.15 | 0.0357 | 1581.2 |
| 308.15 | 0.0537 | 1584.2 |
| 308.15 | 0.0898 | 1587.2 |
| 308.15 | 0.1264 | 1590.4 |
| 308.15 | 0.1630 | 1593.6 |
| 308.15 | 0.1814 | 1596.6 |
| 313.15 | 0.0000 | 1580.0 |
| 313.15 | 0.0178 | 1583.0 |
| 313.15 | 0.0357 | 1586.2 |
| 313.15 | 0.0537 | 1589.4 |
| 313.15 | 0.0898 | 1592.6 |
| 313.15 | 0.1264 | 1595.8 |
| 313.15 | 0.1630 | 1599.0 |
| 313.15 | 0.1814 | 1602.0 |
| 318.15 | 0.0000 | 1584.5 |
| 318.15 | 0.0178 | 1587.5 |
| 318.15 | 0.0357 | 1590.5 |
| 318.15 | 0.0537 | 1593.8 |
| 318.15 | 0.0898 | 1597.0 |
| 318.15 | 0.1264 | 1600.0 |
| 318.15 | 0.1630 | 1603.2 |
| 318.15 | 0.1814 | 1606.4 |
| 323.15 | 0.0000 | 1588.8 |
| 323.15 | 0.0178 | 1592.0 |
| 323.15 | 0.0357 | 1595.0 |
| 323.15 | 0.0537 | 1598.0 |
| 323.15 | 0.0898 | 1601.0 |
| 323.15 | 0.1264 | 1604.2 |
| 323.15 | 0.1630 | 1607.4 |
| 323.15 | 0.1814 | 1610.6 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Amount concentration (molarity), mol/dm3 = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of D-Valine (2) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0000 | 1562.0 |
| 298.15 | 0.0178 | 1565.0 |
| 298.15 | 0.0357 | 1568.0 |
| 298.15 | 0.0537 | 1571.2 |
| 298.15 | 0.0898 | 1574.4 |
| 298.15 | 0.1264 | 1577.4 |
| 298.15 | 0.1630 | 1580.6 |
| 298.15 | 0.1814 | 1583.4 |
| 303.15 | 0.0000 | 1569.4 |
| 303.15 | 0.0178 | 1572.6 |
| 303.15 | 0.0357 | 1575.8 |
| 303.15 | 0.0537 | 1578.8 |
| 303.15 | 0.0898 | 1582.0 |
| 303.15 | 0.1264 | 1585.0 |
| 303.15 | 0.1630 | 1588.2 |
| 303.15 | 0.1814 | 1591.4 |
| 308.15 | 0.0000 | 1575.0 |
| 308.15 | 0.0178 | 1578.0 |
| 308.15 | 0.0357 | 1581.2 |
| 308.15 | 0.0537 | 1584.2 |
| 308.15 | 0.0898 | 1587.2 |
| 308.15 | 0.1264 | 1590.4 |
| 308.15 | 0.1630 | 1593.6 |
| 308.15 | 0.1814 | 1596.6 |
| 313.15 | 0.0000 | 1580.0 |
| 313.15 | 0.0178 | 1583.0 |
| 313.15 | 0.0357 | 1586.2 |
| 313.15 | 0.0537 | 1589.4 |
| 313.15 | 0.0898 | 1592.6 |
| 313.15 | 0.1264 | 1595.8 |
| 313.15 | 0.1630 | 1599.0 |
| 313.15 | 0.1814 | 1602.0 |
| 318.15 | 0.0000 | 1584.5 |
| 318.15 | 0.0178 | 1587.5 |
| 318.15 | 0.0357 | 1590.5 |
| 318.15 | 0.0537 | 1593.8 |
| 318.15 | 0.0898 | 1597.0 |
| 318.15 | 0.1264 | 1600.0 |
| 318.15 | 0.1630 | 1603.2 |
| 318.15 | 0.1814 | 1606.4 |
| 323.15 | 0.0000 | 1588.8 |
| 323.15 | 0.0178 | 1592.0 |
| 323.15 | 0.0357 | 1595.0 |
| 323.15 | 0.0537 | 1598.0 |
| 323.15 | 0.0898 | 1601.0 |
| 323.15 | 0.1264 | 1604.2 |
| 323.15 | 0.1630 | 1607.4 |
| 323.15 | 0.1814 | 1610.6 |
Sources
- Effect of KCl and KNO3 on Partial Molal Volumes and Partial Molal Compressibilities of Some Amino Acids at Different Temperatures
- Viscosity studies of (L-alanine-, L-proline, L-valine, L-leucine + aqueous KCl/KNO3) solutions at different temperatures
- Measuring and modeling aqueous electrolyte/amino-acid solutions with ePC-SAFT
- Interactions in l-alanine /l-proline /l-valine /l-leucine aqueous KCl/KNO3 systems at different temperatures: An isentropic compressibility study