- Name
- Isopropyl Alcohol
- InChI
- InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3
- InChI Key
- KFZMGEQAYNKOFK-UHFFFAOYSA-N
- Formula
- C3H8O
- SMILES
- CC(C)O
- Mol. Weight (g/mol)
- 60.09
- CAS
- 67-63-0
- Name
- Acetic acid, sodium salt
- InChI
- InChI=1S/C2H4O2.Na/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1
- InChI Key
- VMHLLURERBWHNL-UHFFFAOYSA-M
- Formula
- C2H3NaO2
- SMILES
- CC(=O)O[Na]
- Mol. Weight (g/mol)
- 82.03
- CAS
- 127-09-3
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mass fraction (4)
- σcond - Electrical conductivity, S/m (2)
- Tboil - Boiling temperature at pressure P, K (2)
Mass fraction of Acetic acid, sodium salt (2) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid mixture 1)
- Temperature, K = 297.15 (Liquid mixture 1)
| Mass fraction of Isopropyl Alcohol (1) - Liquid mixture 1 | Mass fraction of Acetic acid, sodium salt (2) - Liquid mixture 1 |
|---|---|
| 0.8714 | 0.0396 |
| 0.8640 | 0.0401 |
| 0.8322 | 0.0436 |
| 0.7941 | 0.0496 |
| 0.7897 | 0.0528 |
| 0.7679 | 0.0555 |
| 0.6433 | 0.0792 |
| 0.4988 | 0.1197 |
| 0.4439 | 0.1381 |
| 0.2938 | 0.1958 |
| 0.2290 | 0.2290 |
| 0.1910 | 0.2503 |
| 0.1794 | 0.2584 |
| 0.1664 | 0.2659 |
| 0.1442 | 0.2825 |
Mass fraction [ref]
Operational conditions:
- Temperature, K = 297.15 (Liquid mixture 2)
- Pressure, kPa = 101 (Liquid mixture 2)
| Fixed | Measured | ||
|---|---|---|---|
| Mass fraction of Isopropyl Alcohol (1) - Liquid mixture 2 | Mass fraction of Acetic acid, sodium salt (2) - Liquid mixture 2 | Mass fraction of Acetic acid, sodium salt (2) - Liquid mixture 1 | Mass fraction of Isopropyl Alcohol (1) - Liquid mixture 1 |
| 0.1910 | 0.2503 | 0.0555 | 0.7679 |
| 0.1794 | 0.2584 | 0.0528 | 0.7897 |
| 0.1664 | 0.2659 | 0.0436 | 0.8322 |
| 0.1442 | 0.2825 | 0.0401 | 0.8640 |
Mass fraction of Acetic acid, sodium salt (2) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid mixture 1)
- Temperature, K = 297.15 (Liquid mixture 1)
| Mass fraction of Isopropyl Alcohol (1) - Liquid mixture 1 | Mass fraction of Acetic acid, sodium salt (2) - Liquid mixture 1 |
|---|---|
| 0.8714 | 0.0396 |
| 0.8640 | 0.0401 |
| 0.8322 | 0.0436 |
| 0.7941 | 0.0496 |
| 0.7897 | 0.0528 |
| 0.7679 | 0.0555 |
| 0.6433 | 0.0792 |
| 0.4988 | 0.1197 |
| 0.4439 | 0.1381 |
| 0.2938 | 0.1958 |
| 0.2290 | 0.2290 |
| 0.1910 | 0.2503 |
| 0.1794 | 0.2584 |
| 0.1664 | 0.2659 |
| 0.1442 | 0.2825 |
Mass fraction [ref]
Operational conditions:
- Temperature, K = 297.15 (Liquid mixture 2)
- Pressure, kPa = 101 (Liquid mixture 2)
| Fixed | Measured | ||
|---|---|---|---|
| Mass fraction of Isopropyl Alcohol (1) - Liquid mixture 2 | Mass fraction of Acetic acid, sodium salt (2) - Liquid mixture 2 | Mass fraction of Acetic acid, sodium salt (2) - Liquid mixture 1 | Mass fraction of Isopropyl Alcohol (1) - Liquid mixture 1 |
| 0.1910 | 0.2503 | 0.0555 | 0.7679 |
| 0.1794 | 0.2584 | 0.0528 | 0.7897 |
| 0.1664 | 0.2659 | 0.0436 | 0.8322 |
| 0.1442 | 0.2825 | 0.0401 | 0.8640 |
Electrical conductivity, S/m [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Temperature, K = 297.15 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mass fraction of Isopropyl Alcohol (1) - Liquid | Mass fraction of Acetic acid, sodium salt (2) - Liquid | Electrical conductivity, S/m - Liquid |
| 0.0000 | 0.0470 | 0.0441 |
| 0.0100 | 0.0400 | 0.0372 |
| 0.0200 | 0.3500 | 0.0331 |
| 0.0300 | 0.3000 | 0.0289 |
| 0.0400 | 0.2500 | 0.0242 |
| 0.0500 | 0.2000 | 0.0190 |
| 0.0600 | 0.1500 | 0.0144 |
| 0.0700 | 0.1000 | 0.0096 |
| 0.0800 | 0.0500 | 0.0053 |
| 0.0970 | 0.0000 | 0.0001 |
Electrical conductivity, S/m [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Temperature, K = 297.15 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mass fraction of Isopropyl Alcohol (1) - Liquid | Mass fraction of Acetic acid, sodium salt (2) - Liquid | Electrical conductivity, S/m - Liquid |
| 0.0000 | 0.0470 | 0.0441 |
| 0.0100 | 0.0400 | 0.0372 |
| 0.0200 | 0.3500 | 0.0331 |
| 0.0300 | 0.3000 | 0.0289 |
| 0.0400 | 0.2500 | 0.0242 |
| 0.0500 | 0.2000 | 0.0190 |
| 0.0600 | 0.1500 | 0.0144 |
| 0.0700 | 0.1000 | 0.0096 |
| 0.0800 | 0.0500 | 0.0053 |
| 0.0970 | 0.0000 | 0.0001 |
Boiling temperature at pressure P, K [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Pressure, kPa - Liquid | Mole fraction of Acetic acid, sodium salt (2) - Liquid | Mole fraction of Isopropyl Alcohol (1) - Liquid | Boiling temperature at pressure P, K - Liquid |
| 407.00 | 0.0807 | 0.0105 | 405.76 |
| 408.00 | 0.0474 | 0.0500 | 396.31 |
| 418.00 | 0.0815 | 0.0161 | 405.82 |
| 430.00 | 0.0497 | 0.0041 | 415.54 |
| 433.00 | 0.0491 | 0.0161 | 405.74 |
| 434.00 | 0.0815 | 0.0000 | 425.37 |
| 437.00 | 0.0499 | 0.0000 | 420.49 |
| 438.00 | 0.0808 | 0.0042 | 415.56 |
| 447.00 | 0.0807 | 0.0105 | 410.65 |
| 461.00 | 0.0501 | 0.0224 | 405.82 |
| 463.00 | 0.0474 | 0.0500 | 400.99 |
| 473.00 | 0.0815 | 0.0161 | 410.75 |
| 480.00 | 0.0497 | 0.0041 | 420.41 |
| 483.00 | 0.0808 | 0.0042 | 420.41 |
| 488.00 | 0.0491 | 0.0161 | 410.65 |
| 489.00 | 0.0815 | 0.0000 | 430.22 |
| 492.00 | 0.0499 | 0.0000 | 425.34 |
| 512.00 | 0.0807 | 0.0105 | 415.54 |
| 516.00 | 0.0501 | 0.0224 | 410.65 |
| 528.00 | 0.0474 | 0.0500 | 405.87 |
| 533.00 | 0.0815 | 0.0161 | 415.56 |
| 545.00 | 0.0497 | 0.0041 | 425.26 |
| 548.00 | 0.0491 | 0.0161 | 415.51 |
| 549.00 | 0.0815 | 0.0000 | 435.09 |
| 552.00 | 0.0499 | 0.0000 | 430.17 |
| 553.00 | 0.0808 | 0.0042 | 425.31 |
| 562.00 | 0.0807 | 0.0105 | 420.41 |
| 581.00 | 0.0501 | 0.0224 | 415.56 |
| 603.00 | 0.0474 | 0.0500 | 410.75 |
| 608.00 | 0.0815 | 0.0161 | 420.41 |
| 610.00 | 0.0497 | 0.0041 | 430.14 |
| 613.00 | 0.0808 | 0.0042 | 430.17 |
| 617.00 | 0.0499 | 0.0000 | 435.01 |
| 623.00 | 0.0491 | 0.0161 | 420.41 |
| 624.00 | 0.0815 | 0.0000 | 439.94 |
| 627.00 | 0.0807 | 0.0105 | 425.29 |
| 656.00 | 0.0501 | 0.0224 | 420.49 |
| 678.00 | 0.0808 | 0.0042 | 435.01 |
| 680.00 | 0.0497 | 0.0041 | 435.04 |
| 683.00 | 0.0474 | 0.0500 | 415.59 |
| 683.00 | 0.0815 | 0.0161 | 425.23 |
| 687.00 | 0.0499 | 0.0000 | 439.94 |
| 693.00 | 0.0491 | 0.0161 | 425.31 |
| 699.00 | 0.0815 | 0.0000 | 444.87 |
| 707.00 | 0.0807 | 0.0105 | 430.14 |
| 741.00 | 0.0501 | 0.0224 | 425.34 |
| 758.00 | 0.0808 | 0.0042 | 439.88 |
| 763.00 | 0.0815 | 0.0161 | 430.17 |
| 768.00 | 0.0474 | 0.0500 | 420.46 |
| 770.00 | 0.0497 | 0.0041 | 439.94 |
| 772.00 | 0.0499 | 0.0000 | 444.85 |
| 777.00 | 0.0491 | 0.0161 | 430.20 |
| 779.00 | 0.0815 | 0.0000 | 449.71 |
| 782.00 | 0.0807 | 0.0105 | 434.98 |
| 831.00 | 0.0501 | 0.0224 | 430.22 |
| 838.00 | 0.0808 | 0.0042 | 444.82 |
| 858.00 | 0.0815 | 0.0161 | 435.01 |
| 860.00 | 0.0497 | 0.0041 | 444.82 |
| 862.00 | 0.0499 | 0.0000 | 449.79 |
| 867.00 | 0.0491 | 0.0161 | 435.09 |
| 868.00 | 0.0474 | 0.0500 | 425.34 |
| 872.00 | 0.0807 | 0.0105 | 439.91 |
| 874.00 | 0.0815 | 0.0000 | 454.58 |
| 931.00 | 0.0501 | 0.0224 | 435.12 |
| 933.00 | 0.0808 | 0.0042 | 449.68 |
| 955.00 | 0.0497 | 0.0041 | 449.71 |
| 957.00 | 0.0499 | 0.0000 | 454.66 |
| 958.00 | 0.0815 | 0.0161 | 439.83 |
| 962.00 | 0.0807 | 0.0105 | 444.74 |
| 967.00 | 0.0491 | 0.0161 | 439.99 |
| 973.00 | 0.0474 | 0.0500 | 430.25 |
| 974.00 | 0.0815 | 0.0000 | 459.43 |
| 1036.00 | 0.0501 | 0.0224 | 440.02 |
| 1037.00 | 0.0808 | 0.0042 | 454.52 |
| 1063.00 | 0.0815 | 0.0161 | 444.74 |
| 1065.00 | 0.0497 | 0.0041 | 454.63 |
| 1067.00 | 0.0499 | 0.0000 | 459.51 |
| 1072.00 | 0.0807 | 0.0105 | 449.57 |
| 1082.00 | 0.0491 | 0.0161 | 444.85 |
| 1093.00 | 0.0474 | 0.0500 | 435.12 |
| 1137.00 | 0.0808 | 0.0042 | 459.43 |
| 1146.00 | 0.0501 | 0.0224 | 444.76 |
| 1178.00 | 0.0815 | 0.0161 | 449.65 |
| 1180.00 | 0.0497 | 0.0041 | 459.51 |
| 1182.00 | 0.0807 | 0.0105 | 454.47 |
| 1187.00 | 0.0491 | 0.0161 | 449.68 |
| 1213.00 | 0.0474 | 0.0500 | 439.96 |
| 1281.00 | 0.0501 | 0.0224 | 449.71 |
| 1307.00 | 0.0807 | 0.0105 | 459.51 |
| 1308.00 | 0.0815 | 0.0161 | 454.58 |
| 1322.00 | 0.0491 | 0.0161 | 454.52 |
| 1348.00 | 0.0474 | 0.0500 | 444.82 |
| 1416.00 | 0.0501 | 0.0224 | 454.60 |
| 1443.00 | 0.0815 | 0.0161 | 459.45 |
| 1462.00 | 0.0491 | 0.0161 | 459.40 |
| 1498.00 | 0.0474 | 0.0500 | 449.71 |
| 1561.00 | 0.0501 | 0.0224 | 459.53 |
| 1653.00 | 0.0474 | 0.0500 | 454.60 |
| 1828.00 | 0.0474 | 0.0500 | 459.48 |
Boiling temperature at pressure P, K [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Pressure, kPa - Liquid | Mole fraction of Acetic acid, sodium salt (2) - Liquid | Mole fraction of Isopropyl Alcohol (1) - Liquid | Boiling temperature at pressure P, K - Liquid |
| 407.00 | 0.0807 | 0.0105 | 405.76 |
| 408.00 | 0.0474 | 0.0500 | 396.31 |
| 418.00 | 0.0815 | 0.0161 | 405.82 |
| 430.00 | 0.0497 | 0.0041 | 415.54 |
| 433.00 | 0.0491 | 0.0161 | 405.74 |
| 434.00 | 0.0815 | 0.0000 | 425.37 |
| 437.00 | 0.0499 | 0.0000 | 420.49 |
| 438.00 | 0.0808 | 0.0042 | 415.56 |
| 447.00 | 0.0807 | 0.0105 | 410.65 |
| 461.00 | 0.0501 | 0.0224 | 405.82 |
| 463.00 | 0.0474 | 0.0500 | 400.99 |
| 473.00 | 0.0815 | 0.0161 | 410.75 |
| 480.00 | 0.0497 | 0.0041 | 420.41 |
| 483.00 | 0.0808 | 0.0042 | 420.41 |
| 488.00 | 0.0491 | 0.0161 | 410.65 |
| 489.00 | 0.0815 | 0.0000 | 430.22 |
| 492.00 | 0.0499 | 0.0000 | 425.34 |
| 512.00 | 0.0807 | 0.0105 | 415.54 |
| 516.00 | 0.0501 | 0.0224 | 410.65 |
| 528.00 | 0.0474 | 0.0500 | 405.87 |
| 533.00 | 0.0815 | 0.0161 | 415.56 |
| 545.00 | 0.0497 | 0.0041 | 425.26 |
| 548.00 | 0.0491 | 0.0161 | 415.51 |
| 549.00 | 0.0815 | 0.0000 | 435.09 |
| 552.00 | 0.0499 | 0.0000 | 430.17 |
| 553.00 | 0.0808 | 0.0042 | 425.31 |
| 562.00 | 0.0807 | 0.0105 | 420.41 |
| 581.00 | 0.0501 | 0.0224 | 415.56 |
| 603.00 | 0.0474 | 0.0500 | 410.75 |
| 608.00 | 0.0815 | 0.0161 | 420.41 |
| 610.00 | 0.0497 | 0.0041 | 430.14 |
| 613.00 | 0.0808 | 0.0042 | 430.17 |
| 617.00 | 0.0499 | 0.0000 | 435.01 |
| 623.00 | 0.0491 | 0.0161 | 420.41 |
| 624.00 | 0.0815 | 0.0000 | 439.94 |
| 627.00 | 0.0807 | 0.0105 | 425.29 |
| 656.00 | 0.0501 | 0.0224 | 420.49 |
| 678.00 | 0.0808 | 0.0042 | 435.01 |
| 680.00 | 0.0497 | 0.0041 | 435.04 |
| 683.00 | 0.0474 | 0.0500 | 415.59 |
| 683.00 | 0.0815 | 0.0161 | 425.23 |
| 687.00 | 0.0499 | 0.0000 | 439.94 |
| 693.00 | 0.0491 | 0.0161 | 425.31 |
| 699.00 | 0.0815 | 0.0000 | 444.87 |
| 707.00 | 0.0807 | 0.0105 | 430.14 |
| 741.00 | 0.0501 | 0.0224 | 425.34 |
| 758.00 | 0.0808 | 0.0042 | 439.88 |
| 763.00 | 0.0815 | 0.0161 | 430.17 |
| 768.00 | 0.0474 | 0.0500 | 420.46 |
| 770.00 | 0.0497 | 0.0041 | 439.94 |
| 772.00 | 0.0499 | 0.0000 | 444.85 |
| 777.00 | 0.0491 | 0.0161 | 430.20 |
| 779.00 | 0.0815 | 0.0000 | 449.71 |
| 782.00 | 0.0807 | 0.0105 | 434.98 |
| 831.00 | 0.0501 | 0.0224 | 430.22 |
| 838.00 | 0.0808 | 0.0042 | 444.82 |
| 858.00 | 0.0815 | 0.0161 | 435.01 |
| 860.00 | 0.0497 | 0.0041 | 444.82 |
| 862.00 | 0.0499 | 0.0000 | 449.79 |
| 867.00 | 0.0491 | 0.0161 | 435.09 |
| 868.00 | 0.0474 | 0.0500 | 425.34 |
| 872.00 | 0.0807 | 0.0105 | 439.91 |
| 874.00 | 0.0815 | 0.0000 | 454.58 |
| 931.00 | 0.0501 | 0.0224 | 435.12 |
| 933.00 | 0.0808 | 0.0042 | 449.68 |
| 955.00 | 0.0497 | 0.0041 | 449.71 |
| 957.00 | 0.0499 | 0.0000 | 454.66 |
| 958.00 | 0.0815 | 0.0161 | 439.83 |
| 962.00 | 0.0807 | 0.0105 | 444.74 |
| 967.00 | 0.0491 | 0.0161 | 439.99 |
| 973.00 | 0.0474 | 0.0500 | 430.25 |
| 974.00 | 0.0815 | 0.0000 | 459.43 |
| 1036.00 | 0.0501 | 0.0224 | 440.02 |
| 1037.00 | 0.0808 | 0.0042 | 454.52 |
| 1063.00 | 0.0815 | 0.0161 | 444.74 |
| 1065.00 | 0.0497 | 0.0041 | 454.63 |
| 1067.00 | 0.0499 | 0.0000 | 459.51 |
| 1072.00 | 0.0807 | 0.0105 | 449.57 |
| 1082.00 | 0.0491 | 0.0161 | 444.85 |
| 1093.00 | 0.0474 | 0.0500 | 435.12 |
| 1137.00 | 0.0808 | 0.0042 | 459.43 |
| 1146.00 | 0.0501 | 0.0224 | 444.76 |
| 1178.00 | 0.0815 | 0.0161 | 449.65 |
| 1180.00 | 0.0497 | 0.0041 | 459.51 |
| 1182.00 | 0.0807 | 0.0105 | 454.47 |
| 1187.00 | 0.0491 | 0.0161 | 449.68 |
| 1213.00 | 0.0474 | 0.0500 | 439.96 |
| 1281.00 | 0.0501 | 0.0224 | 449.71 |
| 1307.00 | 0.0807 | 0.0105 | 459.51 |
| 1308.00 | 0.0815 | 0.0161 | 454.58 |
| 1322.00 | 0.0491 | 0.0161 | 454.52 |
| 1348.00 | 0.0474 | 0.0500 | 444.82 |
| 1416.00 | 0.0501 | 0.0224 | 454.60 |
| 1443.00 | 0.0815 | 0.0161 | 459.45 |
| 1462.00 | 0.0491 | 0.0161 | 459.40 |
| 1498.00 | 0.0474 | 0.0500 | 449.71 |
| 1561.00 | 0.0501 | 0.0224 | 459.53 |
| 1653.00 | 0.0474 | 0.0500 | 454.60 |
| 1828.00 | 0.0474 | 0.0500 | 459.48 |