- Name
- Benzoic acid, 4-methyl-
- InChI
- InChI=1S/C8H8O2/c1-6-2-4-7(5-3-6)8(9)10/h2-5H,1H3,(H,9,10)
- InChI Key
- LPNBBFKOUUSUDB-UHFFFAOYSA-N
- Formula
- C8H8O2
- SMILES
- Cc1ccc(C(=O)O)cc1
- Mol. Weight (g/mol)
- 136.15
- CAS
- 99-94-5
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Datasets
Mole fraction of Benzoic acid, 4-methyl- (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid, 4-methyl- (1) - Liquid |
|---|---|
| 413.15 | 0.0112 |
| 403.15 | 0.0071 |
| 393.15 | 0.0046 |
| 383.15 | 0.0028 |
| 373.15 | 0.0018 |
| 363.15 | 0.0007 |
| 353.15 | 0.0005 |
| 343.15 | 0.0004 |
| 333.15 | 0.0002 |
| 323.15 | 0.0001 |
| 313.15 | 0.0001 |
| 303.15 | 0.0001 |
| 298.15 | 0.0001 |
| 423.15 | 0.0135 |
Mole fraction of Benzoic acid, 4-methyl- (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mole fraction of Benzoic acid, 4-methyl- (1) - Liquid mixture 1 |
|---|---|
| 443.15 | 0.0489 |
| 433.15 | 0.0398 |
Mole fraction of Benzoic acid, 4-methyl- (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid, 4-methyl- (1) - Liquid |
|---|---|
| 303.20 | 0.0001 |
| 308.20 | 0.0001 |
| 313.20 | 0.0001 |
| 318.20 | 0.0001 |
| 323.20 | 0.0001 |
| 328.20 | 0.0001 |
| 333.20 | 0.0002 |
| 338.20 | 0.0002 |
| 343.20 | 0.0003 |
| 348.20 | 0.0003 |
| 353.20 | 0.0003 |
Mole fraction of Benzoic acid, 4-methyl- (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid, 4-methyl- (1) - Liquid |
|---|---|
| 293.15 | 0.0000 |
| 303.15 | 0.0001 |
| 313.15 | 0.0001 |
| 323.15 | 0.0001 |
| 333.15 | 0.0002 |
| 343.15 | 0.0002 |
Mole fraction of Benzoic acid, 4-methyl- (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid, 4-methyl- (1) - Liquid |
|---|---|
| 413.15 | 0.0112 |
| 403.15 | 0.0071 |
| 393.15 | 0.0046 |
| 383.15 | 0.0028 |
| 373.15 | 0.0018 |
| 363.15 | 0.0007 |
| 353.15 | 0.0005 |
| 343.15 | 0.0004 |
| 333.15 | 0.0002 |
| 323.15 | 0.0001 |
| 313.15 | 0.0001 |
| 303.15 | 0.0001 |
| 298.15 | 0.0001 |
| 423.15 | 0.0135 |
Mole fraction of Benzoic acid, 4-methyl- (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mole fraction of Benzoic acid, 4-methyl- (1) - Liquid mixture 1 |
|---|---|
| 443.15 | 0.0489 |
| 433.15 | 0.0398 |
Mole fraction of Benzoic acid, 4-methyl- (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid, 4-methyl- (1) - Liquid |
|---|---|
| 303.20 | 0.0001 |
| 308.20 | 0.0001 |
| 313.20 | 0.0001 |
| 318.20 | 0.0001 |
| 323.20 | 0.0001 |
| 328.20 | 0.0001 |
| 333.20 | 0.0002 |
| 338.20 | 0.0002 |
| 343.20 | 0.0003 |
| 348.20 | 0.0003 |
| 353.20 | 0.0003 |
Mole fraction of Benzoic acid, 4-methyl- (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid, 4-methyl- (1) - Liquid |
|---|---|
| 293.15 | 0.0000 |
| 303.15 | 0.0001 |
| 313.15 | 0.0001 |
| 323.15 | 0.0001 |
| 333.15 | 0.0002 |
| 343.15 | 0.0002 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Mole fraction of Benzoic acid, 4-methyl- (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0000 | 304.00 |
| 0.0000 | 305.10 |
| 0.0000 | 306.30 |
| 0.0001 | 308.15 |
| 0.0001 | 309.15 |
| 0.0001 | 309.85 |
| 0.0001 | 310.35 |
| 0.0001 | 314.85 |
| 0.0001 | 317.85 |
| 0.0001 | 320.35 |
| 0.0001 | 323.25 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Mole fraction of Benzoic acid, 4-methyl- (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0000 | 290.25 |
| 0.0000 | 299.55 |
| 0.0000 | 301.35 |
| 0.0001 | 311.25 |
| 0.0001 | 317.25 |
| 0.0001 | 320.05 |
| 0.0001 | 327.75 |
| 0.0001 | 335.35 |
| 0.0002 | 339.85 |
| 0.0002 | 344.95 |
| 0.0002 | 348.35 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Mole fraction of Benzoic acid, 4-methyl- (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0000 | 304.00 |
| 0.0000 | 305.10 |
| 0.0000 | 306.30 |
| 0.0001 | 308.15 |
| 0.0001 | 309.15 |
| 0.0001 | 309.85 |
| 0.0001 | 310.35 |
| 0.0001 | 314.85 |
| 0.0001 | 317.85 |
| 0.0001 | 320.35 |
| 0.0001 | 323.25 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Mole fraction of Benzoic acid, 4-methyl- (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0000 | 290.25 |
| 0.0000 | 299.55 |
| 0.0000 | 301.35 |
| 0.0001 | 311.25 |
| 0.0001 | 317.25 |
| 0.0001 | 320.05 |
| 0.0001 | 327.75 |
| 0.0001 | 335.35 |
| 0.0002 | 339.85 |
| 0.0002 | 344.95 |
| 0.0002 | 348.35 |
Sources
- The effect of temperature on the solubility of benzoic acid derivatives in water
- Determination and modeling of aqueous solubility of 4-position substituted benzoic acid compounds in a high-temperature solution
- Solubility and partition coefficient of p-toluic acid in p-xylene and water
- Measurement and Correlation of the Solubility for Camptothecine in Different Organic Solvents
- Solid-Liquid Equilibria of Several Systems Containing Acetic Acid