- Name
- Propanoic acid, 2-methyl-
- InChI
- InChI=1S/C4H8O2/c1-3(2)4(5)6/h3H,1-2H3,(H,5,6)
- InChI Key
- KQNPFQTWMSNSAP-UHFFFAOYSA-N
- Formula
- C4H8O2
- SMILES
- CC(C)C(=O)O
- Mol. Weight (g/mol)
- 88.11
- CAS
- 79-31-2
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Viscosity, Pa*s [ref]
Operational conditions:
- Mole fraction = 0.38 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 300.25 | 0.0022 |
| 300.33 | 0.0022 |
| 300.36 | 0.0022 |
| 300.49 | 0.0022 |
| 300.61 | 0.0022 |
| 300.66 | 0.0022 |
| 300.76 | 0.0022 |
| 300.87 | 0.0022 |
| 300.96 | 0.0022 |
| 301.09 | 0.0022 |
| 301.16 | 0.0022 |
| 301.26 | 0.0022 |
| 301.36 | 0.0021 |
| 301.49 | 0.0021 |
| 301.56 | 0.0021 |
| 301.85 | 0.0021 |
| 302.16 | 0.0021 |
| 302.46 | 0.0021 |
Viscosity, Pa*s [ref]
Operational conditions:
- Mole fraction = 0.38 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 300.25 | 0.0022 |
| 300.33 | 0.0022 |
| 300.36 | 0.0022 |
| 300.49 | 0.0022 |
| 300.61 | 0.0022 |
| 300.66 | 0.0022 |
| 300.76 | 0.0022 |
| 300.87 | 0.0022 |
| 300.96 | 0.0022 |
| 301.09 | 0.0022 |
| 301.16 | 0.0022 |
| 301.26 | 0.0022 |
| 301.36 | 0.0021 |
| 301.49 | 0.0021 |
| 301.56 | 0.0021 |
| 301.85 | 0.0021 |
| 302.16 | 0.0021 |
| 302.46 | 0.0021 |