- Name
- Propane, 1-nitro-
- InChI
- InChI=1S/C3H7NO2/c1-2-3-4(5)6/h2-3H2,1H3
- InChI Key
- JSZOAYXJRCEYSX-UHFFFAOYSA-N
- Formula
- C3H7NO2
- SMILES
- CCC[N+](=O)[O-]
- Mol. Weight (g/mol)
- 89.09
- CAS
- 108-03-2
- Name
- Tetradecane
- InChI
- InChI=1S/C14H30/c1-3-5-7-9-11-13-14-12-10-8-6-4-2/h3-14H2,1-2H3
- InChI Key
- BGHCVCJVXZWKCC-UHFFFAOYSA-N
- Formula
- C14H30
- SMILES
- CCCCCCCCCCCCCC
- Mol. Weight (g/mol)
- 198.39
- CAS
- 629-59-4
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Excess molar enthalpy (molar enthalpy (2)
- Liquid-liquid equilibrium temperature, K (2)
- Excess molar volume, m3/mol (2)
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 308.15 (Liquid)
| Mole fraction of Propane, 1-nitro- (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.6886 | 1.83 |
| 0.6918 | 1.831 |
| 0.6924 | 1.831 |
| 0.7024 | 1.806 |
| 0.7032 | 1.814 |
| 0.7058 | 1.787 |
| 0.7083 | 1.778 |
| 0.7117 | 1.762 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 308.15 (Liquid)
| Mole fraction of Propane, 1-nitro- (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.6886 | 1.83 |
| 0.6918 | 1.831 |
| 0.6924 | 1.831 |
| 0.7024 | 1.806 |
| 0.7032 | 1.814 |
| 0.7058 | 1.787 |
| 0.7083 | 1.778 |
| 0.7117 | 1.762 |
Liquid-liquid equilibrium temperature, K [ref]
Operational condition: Mole fraction = 0.7 (Liquid mixture 1)
| Pressure, kPa - Liquid mixture 1 | Liquid-liquid equilibrium temperature, K - Liquid mixture 1 |
|---|---|
| 485.00 | 300.81 |
| 831.00 | 300.86 |
| 1157.00 | 300.90 |
| 1552.00 | 300.96 |
| 2151.00 | 301.04 |
| 2513.00 | 301.09 |
| 3929.00 | 301.28 |
| 4677.00 | 301.38 |
Liquid-liquid equilibrium temperature, K [ref]
Operational condition: Mole fraction = 0.7 (Liquid mixture 1)
| Pressure, kPa - Liquid mixture 1 | Liquid-liquid equilibrium temperature, K - Liquid mixture 1 |
|---|---|
| 485.00 | 300.81 |
| 831.00 | 300.86 |
| 1157.00 | 300.90 |
| 1552.00 | 300.96 |
| 2151.00 | 301.04 |
| 2513.00 | 301.09 |
| 3929.00 | 301.28 |
| 4677.00 | 301.38 |
Excess molar volume, m3/mol [ref]
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Propane, 1-nitro- (1) - Liquid | Pressure, kPa - Liquid | Excess molar volume, m3/mol - Liquid |
| 0.7089 | 101.00 | 7.7300e-07 |
Excess molar volume, m3/mol [ref]
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Propane, 1-nitro- (1) - Liquid | Pressure, kPa - Liquid | Excess molar volume, m3/mol - Liquid |
| 0.7089 | 101.00 | 7.7300e-07 |