- Name
- p-Xylene
- InChI
- InChI=1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3
- InChI Key
- URLKBWYHVLBVBO-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1ccc(C)cc1
- Mol. Weight (g/mol)
- 106.17
- CAS
- 106-42-3
- Name
- Octane
- InChI
- InChI=1S/C8H18/c1-3-5-7-8-6-4-2/h3-8H2,1-2H3
- InChI Key
- TVMXDCGIABBOFY-UHFFFAOYSA-N
- Formula
- C8H18
- SMILES
- CCCCCCCC
- Mol. Weight (g/mol)
- 114.23
- CAS
- 111-65-9
- Name
- Pyrene
- InChI
- InChI=1S/C16H10/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h1-10H
- InChI Key
- BBEAQIROQSPTKN-UHFFFAOYSA-N
- Formula
- C16H10
- SMILES
- c1cc2ccc3cccc4ccc(c1)c2c34
- Mol. Weight (g/mol)
- 202.25
- CAS
- 129-00-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Pyrene (3) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Volume fraction of p-Xylene (1) - Liquid | Mole fraction of Pyrene (3) - Liquid |
| 293.00 | 0.0000 | 0.0156 |
| 293.00 | 0.1000 | 0.0179 |
| 293.00 | 0.2000 | 0.0234 |
| 293.00 | 0.3000 | 0.0270 |
| 293.00 | 0.4000 | 0.0321 |
| 293.00 | 0.5000 | 0.0373 |
| 293.00 | 0.6000 | 0.0416 |
| 293.00 | 0.7000 | 0.0486 |
| 293.00 | 0.8000 | 0.0535 |
| 293.00 | 0.9000 | 0.0638 |
| 293.00 | 1.0000 | 0.0777 |
| 298.00 | 0.0000 | 0.0169 |
| 298.00 | 0.1000 | 0.0194 |
| 298.00 | 0.2000 | 0.0242 |
| 298.00 | 0.3000 | 0.0306 |
| 298.00 | 0.4000 | 0.0376 |
| 298.00 | 0.5000 | 0.0418 |
| 298.00 | 0.6000 | 0.0453 |
| 298.00 | 0.7000 | 0.0563 |
| 298.00 | 0.8000 | 0.0642 |
| 298.00 | 0.9000 | 0.0761 |
| 298.00 | 1.0000 | 0.0863 |
| 303.00 | 0.0000 | 0.0195 |
| 303.00 | 0.1000 | 0.0227 |
| 303.00 | 0.2000 | 0.0296 |
| 303.00 | 0.3000 | 0.0349 |
| 303.00 | 0.4000 | 0.0408 |
| 303.00 | 0.5000 | 0.0494 |
| 303.00 | 0.6000 | 0.0551 |
| 303.00 | 0.7000 | 0.0629 |
| 303.00 | 0.8000 | 0.0729 |
| 303.00 | 0.9000 | 0.0839 |
| 303.00 | 1.0000 | 0.0976 |
| 308.00 | 0.0000 | 0.0219 |
| 308.00 | 0.1000 | 0.0261 |
| 308.00 | 0.2000 | 0.0329 |
| 308.00 | 0.3000 | 0.0390 |
| 308.00 | 0.4000 | 0.0469 |
| 308.00 | 0.5000 | 0.0540 |
| 308.00 | 0.6000 | 0.0607 |
| 308.00 | 0.7000 | 0.0727 |
| 308.00 | 0.8000 | 0.0841 |
| 308.00 | 0.9000 | 0.0982 |
| 308.00 | 1.0000 | 0.1093 |
| 313.00 | 0.0000 | 0.0259 |
| 313.00 | 0.1000 | 0.0296 |
| 313.00 | 0.2000 | 0.0377 |
| 313.00 | 0.3000 | 0.0466 |
| 313.00 | 0.4000 | 0.0497 |
| 313.00 | 0.5000 | 0.0606 |
| 313.00 | 0.6000 | 0.0671 |
| 313.00 | 0.7000 | 0.0847 |
| 313.00 | 0.8000 | 0.0952 |
| 313.00 | 0.9000 | 0.1088 |
| 313.00 | 1.0000 | 0.1236 |
| 318.00 | 0.0000 | 0.0290 |
| 318.00 | 0.1000 | 0.0348 |
| 318.00 | 0.2000 | 0.0424 |
| 318.00 | 0.3000 | 0.0553 |
| 318.00 | 0.4000 | 0.0602 |
| 318.00 | 0.5000 | 0.0703 |
| 318.00 | 0.6000 | 0.0769 |
| 318.00 | 0.7000 | 0.0978 |
| 318.00 | 0.8000 | 0.1094 |
| 318.00 | 0.9000 | 0.1179 |
| 318.00 | 1.0000 | 0.1367 |
Mole fraction of Pyrene (3) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Volume fraction of p-Xylene (1) - Liquid | Mole fraction of Pyrene (3) - Liquid |
| 293.00 | 0.0000 | 0.0156 |
| 293.00 | 0.1000 | 0.0179 |
| 293.00 | 0.2000 | 0.0234 |
| 293.00 | 0.3000 | 0.0270 |
| 293.00 | 0.4000 | 0.0321 |
| 293.00 | 0.5000 | 0.0373 |
| 293.00 | 0.6000 | 0.0416 |
| 293.00 | 0.7000 | 0.0486 |
| 293.00 | 0.8000 | 0.0535 |
| 293.00 | 0.9000 | 0.0638 |
| 293.00 | 1.0000 | 0.0777 |
| 298.00 | 0.0000 | 0.0169 |
| 298.00 | 0.1000 | 0.0194 |
| 298.00 | 0.2000 | 0.0242 |
| 298.00 | 0.3000 | 0.0306 |
| 298.00 | 0.4000 | 0.0376 |
| 298.00 | 0.5000 | 0.0418 |
| 298.00 | 0.6000 | 0.0453 |
| 298.00 | 0.7000 | 0.0563 |
| 298.00 | 0.8000 | 0.0642 |
| 298.00 | 0.9000 | 0.0761 |
| 298.00 | 1.0000 | 0.0863 |
| 303.00 | 0.0000 | 0.0195 |
| 303.00 | 0.1000 | 0.0227 |
| 303.00 | 0.2000 | 0.0296 |
| 303.00 | 0.3000 | 0.0349 |
| 303.00 | 0.4000 | 0.0408 |
| 303.00 | 0.5000 | 0.0494 |
| 303.00 | 0.6000 | 0.0551 |
| 303.00 | 0.7000 | 0.0629 |
| 303.00 | 0.8000 | 0.0729 |
| 303.00 | 0.9000 | 0.0839 |
| 303.00 | 1.0000 | 0.0976 |
| 308.00 | 0.0000 | 0.0219 |
| 308.00 | 0.1000 | 0.0261 |
| 308.00 | 0.2000 | 0.0329 |
| 308.00 | 0.3000 | 0.0390 |
| 308.00 | 0.4000 | 0.0469 |
| 308.00 | 0.5000 | 0.0540 |
| 308.00 | 0.6000 | 0.0607 |
| 308.00 | 0.7000 | 0.0727 |
| 308.00 | 0.8000 | 0.0841 |
| 308.00 | 0.9000 | 0.0982 |
| 308.00 | 1.0000 | 0.1093 |
| 313.00 | 0.0000 | 0.0259 |
| 313.00 | 0.1000 | 0.0296 |
| 313.00 | 0.2000 | 0.0377 |
| 313.00 | 0.3000 | 0.0466 |
| 313.00 | 0.4000 | 0.0497 |
| 313.00 | 0.5000 | 0.0606 |
| 313.00 | 0.6000 | 0.0671 |
| 313.00 | 0.7000 | 0.0847 |
| 313.00 | 0.8000 | 0.0952 |
| 313.00 | 0.9000 | 0.1088 |
| 313.00 | 1.0000 | 0.1236 |
| 318.00 | 0.0000 | 0.0290 |
| 318.00 | 0.1000 | 0.0348 |
| 318.00 | 0.2000 | 0.0424 |
| 318.00 | 0.3000 | 0.0553 |
| 318.00 | 0.4000 | 0.0602 |
| 318.00 | 0.5000 | 0.0703 |
| 318.00 | 0.6000 | 0.0769 |
| 318.00 | 0.7000 | 0.0978 |
| 318.00 | 0.8000 | 0.1094 |
| 318.00 | 0.9000 | 0.1179 |
| 318.00 | 1.0000 | 0.1367 |