- Name
- Octane
- InChI
- InChI=1S/C8H18/c1-3-5-7-8-6-4-2/h3-8H2,1-2H3
- InChI Key
- TVMXDCGIABBOFY-UHFFFAOYSA-N
- Formula
- C8H18
- SMILES
- CCCCCCCC
- Mol. Weight (g/mol)
- 114.23
- CAS
- 111-65-9
- Name
- Pentane, 2,2,4-trimethyl-
- InChI
- InChI=1S/C8H18/c1-7(2)6-8(3,4)5/h7H,6H2,1-5H3
- InChI Key
- NHTMVDHEPJAVLT-UHFFFAOYSA-N
- Formula
- C8H18
- SMILES
- CC(C)CC(C)(C)C
- Mol. Weight (g/mol)
- 114.23
- CAS
- 540-84-1
- Name
- Pyrene
- InChI
- InChI=1S/C16H10/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h1-10H
- InChI Key
- BBEAQIROQSPTKN-UHFFFAOYSA-N
- Formula
- C16H10
- SMILES
- c1cc2ccc3cccc4ccc(c1)c2c34
- Mol. Weight (g/mol)
- 202.25
- CAS
- 129-00-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Pyrene (3) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Volume fraction of Octane (1) - Liquid | Mole fraction of Pyrene (3) - Liquid |
| 293.00 | 0.0000 | 0.0073 |
| 293.00 | 0.1000 | 0.0086 |
| 293.00 | 0.2000 | 0.0087 |
| 293.00 | 0.3000 | 0.0091 |
| 293.00 | 0.4000 | 0.0095 |
| 293.00 | 0.5000 | 0.0100 |
| 293.00 | 0.6000 | 0.0119 |
| 293.00 | 0.7000 | 0.0129 |
| 293.00 | 0.8000 | 0.0139 |
| 293.00 | 0.9000 | 0.0148 |
| 293.00 | 1.0000 | 0.0156 |
| 298.00 | 0.0000 | 0.0086 |
| 298.00 | 0.1000 | 0.0099 |
| 298.00 | 0.2000 | 0.0102 |
| 298.00 | 0.3000 | 0.0105 |
| 298.00 | 0.4000 | 0.0108 |
| 298.00 | 0.5000 | 0.0111 |
| 298.00 | 0.6000 | 0.0135 |
| 298.00 | 0.7000 | 0.0141 |
| 298.00 | 0.8000 | 0.0151 |
| 298.00 | 0.9000 | 0.0156 |
| 298.00 | 1.0000 | 0.0169 |
| 303.00 | 0.0000 | 0.0104 |
| 303.00 | 0.1000 | 0.0116 |
| 303.00 | 0.2000 | 0.0119 |
| 303.00 | 0.3000 | 0.0120 |
| 303.00 | 0.4000 | 0.0122 |
| 303.00 | 0.5000 | 0.0135 |
| 303.00 | 0.6000 | 0.0144 |
| 303.00 | 0.7000 | 0.0152 |
| 303.00 | 0.8000 | 0.0161 |
| 303.00 | 0.9000 | 0.0168 |
| 303.00 | 1.0000 | 0.0195 |
| 308.00 | 0.0000 | 0.0120 |
| 308.00 | 0.1000 | 0.0143 |
| 308.00 | 0.2000 | 0.0145 |
| 308.00 | 0.3000 | 0.0159 |
| 308.00 | 0.4000 | 0.0163 |
| 308.00 | 0.5000 | 0.0167 |
| 308.00 | 0.6000 | 0.0168 |
| 308.00 | 0.7000 | 0.0172 |
| 308.00 | 0.8000 | 0.0179 |
| 308.00 | 0.9000 | 0.0189 |
| 308.00 | 1.0000 | 0.0219 |
| 313.00 | 0.0000 | 0.0135 |
| 313.00 | 0.1000 | 0.0148 |
| 313.00 | 0.2000 | 0.0149 |
| 313.00 | 0.3000 | 0.0162 |
| 313.00 | 0.4000 | 0.0169 |
| 313.00 | 0.5000 | 0.0172 |
| 313.00 | 0.6000 | 0.0173 |
| 313.00 | 0.7000 | 0.0196 |
| 313.00 | 0.8000 | 0.0200 |
| 313.00 | 0.9000 | 0.0207 |
| 313.00 | 1.0000 | 0.0259 |
| 318.00 | 0.0000 | 0.0146 |
| 318.00 | 0.1000 | 0.0151 |
| 318.00 | 0.2000 | 0.0164 |
| 318.00 | 0.3000 | 0.0186 |
| 318.00 | 0.4000 | 0.0188 |
| 318.00 | 0.5000 | 0.0189 |
| 318.00 | 0.6000 | 0.0197 |
| 318.00 | 0.7000 | 0.0209 |
| 318.00 | 0.8000 | 0.0227 |
| 318.00 | 0.9000 | 0.0238 |
| 318.00 | 1.0000 | 0.0290 |
Mole fraction of Pyrene (3) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Volume fraction of Octane (1) - Liquid | Mole fraction of Pyrene (3) - Liquid |
| 293.00 | 0.0000 | 0.0073 |
| 293.00 | 0.1000 | 0.0086 |
| 293.00 | 0.2000 | 0.0087 |
| 293.00 | 0.3000 | 0.0091 |
| 293.00 | 0.4000 | 0.0095 |
| 293.00 | 0.5000 | 0.0100 |
| 293.00 | 0.6000 | 0.0119 |
| 293.00 | 0.7000 | 0.0129 |
| 293.00 | 0.8000 | 0.0139 |
| 293.00 | 0.9000 | 0.0148 |
| 293.00 | 1.0000 | 0.0156 |
| 298.00 | 0.0000 | 0.0086 |
| 298.00 | 0.1000 | 0.0099 |
| 298.00 | 0.2000 | 0.0102 |
| 298.00 | 0.3000 | 0.0105 |
| 298.00 | 0.4000 | 0.0108 |
| 298.00 | 0.5000 | 0.0111 |
| 298.00 | 0.6000 | 0.0135 |
| 298.00 | 0.7000 | 0.0141 |
| 298.00 | 0.8000 | 0.0151 |
| 298.00 | 0.9000 | 0.0156 |
| 298.00 | 1.0000 | 0.0169 |
| 303.00 | 0.0000 | 0.0104 |
| 303.00 | 0.1000 | 0.0116 |
| 303.00 | 0.2000 | 0.0119 |
| 303.00 | 0.3000 | 0.0120 |
| 303.00 | 0.4000 | 0.0122 |
| 303.00 | 0.5000 | 0.0135 |
| 303.00 | 0.6000 | 0.0144 |
| 303.00 | 0.7000 | 0.0152 |
| 303.00 | 0.8000 | 0.0161 |
| 303.00 | 0.9000 | 0.0168 |
| 303.00 | 1.0000 | 0.0195 |
| 308.00 | 0.0000 | 0.0120 |
| 308.00 | 0.1000 | 0.0143 |
| 308.00 | 0.2000 | 0.0145 |
| 308.00 | 0.3000 | 0.0159 |
| 308.00 | 0.4000 | 0.0163 |
| 308.00 | 0.5000 | 0.0167 |
| 308.00 | 0.6000 | 0.0168 |
| 308.00 | 0.7000 | 0.0172 |
| 308.00 | 0.8000 | 0.0179 |
| 308.00 | 0.9000 | 0.0189 |
| 308.00 | 1.0000 | 0.0219 |
| 313.00 | 0.0000 | 0.0135 |
| 313.00 | 0.1000 | 0.0148 |
| 313.00 | 0.2000 | 0.0149 |
| 313.00 | 0.3000 | 0.0162 |
| 313.00 | 0.4000 | 0.0169 |
| 313.00 | 0.5000 | 0.0172 |
| 313.00 | 0.6000 | 0.0173 |
| 313.00 | 0.7000 | 0.0196 |
| 313.00 | 0.8000 | 0.0200 |
| 313.00 | 0.9000 | 0.0207 |
| 313.00 | 1.0000 | 0.0259 |
| 318.00 | 0.0000 | 0.0146 |
| 318.00 | 0.1000 | 0.0151 |
| 318.00 | 0.2000 | 0.0164 |
| 318.00 | 0.3000 | 0.0186 |
| 318.00 | 0.4000 | 0.0188 |
| 318.00 | 0.5000 | 0.0189 |
| 318.00 | 0.6000 | 0.0197 |
| 318.00 | 0.7000 | 0.0209 |
| 318.00 | 0.8000 | 0.0227 |
| 318.00 | 0.9000 | 0.0238 |
| 318.00 | 1.0000 | 0.0290 |