- Name
- p-Xylene
- InChI
- InChI=1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3
- InChI Key
- URLKBWYHVLBVBO-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1ccc(C)cc1
- Mol. Weight (g/mol)
- 106.17
- CAS
- 106-42-3
- Name
- Pentane, 2,2,4-trimethyl-
- InChI
- InChI=1S/C8H18/c1-7(2)6-8(3,4)5/h7H,6H2,1-5H3
- InChI Key
- NHTMVDHEPJAVLT-UHFFFAOYSA-N
- Formula
- C8H18
- SMILES
- CC(C)CC(C)(C)C
- Mol. Weight (g/mol)
- 114.23
- CAS
- 540-84-1
- Name
- Pyrene
- InChI
- InChI=1S/C16H10/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h1-10H
- InChI Key
- BBEAQIROQSPTKN-UHFFFAOYSA-N
- Formula
- C16H10
- SMILES
- c1cc2ccc3cccc4ccc(c1)c2c34
- Mol. Weight (g/mol)
- 202.25
- CAS
- 129-00-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Pyrene (3) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Volume fraction of p-Xylene (1) - Liquid | Mole fraction of Pyrene (3) - Liquid |
| 293.00 | 0.0000 | 0.0073 |
| 293.00 | 0.1000 | 0.0111 |
| 293.00 | 0.2000 | 0.0158 |
| 293.00 | 0.3000 | 0.0225 |
| 293.00 | 0.4000 | 0.0262 |
| 293.00 | 0.5000 | 0.0335 |
| 293.00 | 0.6000 | 0.0382 |
| 293.00 | 0.7000 | 0.0438 |
| 293.00 | 0.8000 | 0.0506 |
| 293.00 | 0.9000 | 0.0591 |
| 293.00 | 1.0000 | 0.0777 |
| 298.00 | 0.0000 | 0.0086 |
| 298.00 | 0.1000 | 0.0135 |
| 298.00 | 0.2000 | 0.0191 |
| 298.00 | 0.3000 | 0.0244 |
| 298.00 | 0.4000 | 0.0311 |
| 298.00 | 0.5000 | 0.0356 |
| 298.00 | 0.6000 | 0.0448 |
| 298.00 | 0.7000 | 0.0487 |
| 298.00 | 0.8000 | 0.0575 |
| 298.00 | 0.9000 | 0.0649 |
| 298.00 | 1.0000 | 0.0863 |
| 303.00 | 0.0000 | 0.0104 |
| 303.00 | 0.1000 | 0.0155 |
| 303.00 | 0.2000 | 0.0206 |
| 303.00 | 0.3000 | 0.0278 |
| 303.00 | 0.4000 | 0.0346 |
| 303.00 | 0.5000 | 0.0443 |
| 303.00 | 0.6000 | 0.0509 |
| 303.00 | 0.7000 | 0.0571 |
| 303.00 | 0.8000 | 0.0670 |
| 303.00 | 0.9000 | 0.0759 |
| 303.00 | 1.0000 | 0.0976 |
| 308.00 | 0.0000 | 0.0120 |
| 308.00 | 0.1000 | 0.0190 |
| 308.00 | 0.2000 | 0.0242 |
| 308.00 | 0.3000 | 0.0318 |
| 308.00 | 0.4000 | 0.0388 |
| 308.00 | 0.5000 | 0.0500 |
| 308.00 | 0.6000 | 0.0552 |
| 308.00 | 0.7000 | 0.0633 |
| 308.00 | 0.8000 | 0.0732 |
| 308.00 | 0.9000 | 0.0832 |
| 308.00 | 1.0000 | 0.1093 |
| 313.00 | 0.0000 | 0.0135 |
| 313.00 | 0.1000 | 0.0228 |
| 313.00 | 0.2000 | 0.0299 |
| 313.00 | 0.3000 | 0.0389 |
| 313.00 | 0.4000 | 0.0484 |
| 313.00 | 0.5000 | 0.0555 |
| 313.00 | 0.6000 | 0.0654 |
| 313.00 | 0.7000 | 0.0747 |
| 313.00 | 0.8000 | 0.0817 |
| 313.00 | 0.9000 | 0.0949 |
| 313.00 | 1.0000 | 0.1236 |
| 318.00 | 0.0000 | 0.0146 |
| 318.00 | 0.1000 | 0.0248 |
| 318.00 | 0.2000 | 0.0339 |
| 318.00 | 0.3000 | 0.0444 |
| 318.00 | 0.4000 | 0.0517 |
| 318.00 | 0.5000 | 0.0584 |
| 318.00 | 0.6000 | 0.0692 |
| 318.00 | 0.7000 | 0.0787 |
| 318.00 | 0.8000 | 0.0918 |
| 318.00 | 0.9000 | 0.1069 |
| 318.00 | 1.0000 | 0.1367 |
Mole fraction of Pyrene (3) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Volume fraction of p-Xylene (1) - Liquid | Mole fraction of Pyrene (3) - Liquid |
| 293.00 | 0.0000 | 0.0073 |
| 293.00 | 0.1000 | 0.0111 |
| 293.00 | 0.2000 | 0.0158 |
| 293.00 | 0.3000 | 0.0225 |
| 293.00 | 0.4000 | 0.0262 |
| 293.00 | 0.5000 | 0.0335 |
| 293.00 | 0.6000 | 0.0382 |
| 293.00 | 0.7000 | 0.0438 |
| 293.00 | 0.8000 | 0.0506 |
| 293.00 | 0.9000 | 0.0591 |
| 293.00 | 1.0000 | 0.0777 |
| 298.00 | 0.0000 | 0.0086 |
| 298.00 | 0.1000 | 0.0135 |
| 298.00 | 0.2000 | 0.0191 |
| 298.00 | 0.3000 | 0.0244 |
| 298.00 | 0.4000 | 0.0311 |
| 298.00 | 0.5000 | 0.0356 |
| 298.00 | 0.6000 | 0.0448 |
| 298.00 | 0.7000 | 0.0487 |
| 298.00 | 0.8000 | 0.0575 |
| 298.00 | 0.9000 | 0.0649 |
| 298.00 | 1.0000 | 0.0863 |
| 303.00 | 0.0000 | 0.0104 |
| 303.00 | 0.1000 | 0.0155 |
| 303.00 | 0.2000 | 0.0206 |
| 303.00 | 0.3000 | 0.0278 |
| 303.00 | 0.4000 | 0.0346 |
| 303.00 | 0.5000 | 0.0443 |
| 303.00 | 0.6000 | 0.0509 |
| 303.00 | 0.7000 | 0.0571 |
| 303.00 | 0.8000 | 0.0670 |
| 303.00 | 0.9000 | 0.0759 |
| 303.00 | 1.0000 | 0.0976 |
| 308.00 | 0.0000 | 0.0120 |
| 308.00 | 0.1000 | 0.0190 |
| 308.00 | 0.2000 | 0.0242 |
| 308.00 | 0.3000 | 0.0318 |
| 308.00 | 0.4000 | 0.0388 |
| 308.00 | 0.5000 | 0.0500 |
| 308.00 | 0.6000 | 0.0552 |
| 308.00 | 0.7000 | 0.0633 |
| 308.00 | 0.8000 | 0.0732 |
| 308.00 | 0.9000 | 0.0832 |
| 308.00 | 1.0000 | 0.1093 |
| 313.00 | 0.0000 | 0.0135 |
| 313.00 | 0.1000 | 0.0228 |
| 313.00 | 0.2000 | 0.0299 |
| 313.00 | 0.3000 | 0.0389 |
| 313.00 | 0.4000 | 0.0484 |
| 313.00 | 0.5000 | 0.0555 |
| 313.00 | 0.6000 | 0.0654 |
| 313.00 | 0.7000 | 0.0747 |
| 313.00 | 0.8000 | 0.0817 |
| 313.00 | 0.9000 | 0.0949 |
| 313.00 | 1.0000 | 0.1236 |
| 318.00 | 0.0000 | 0.0146 |
| 318.00 | 0.1000 | 0.0248 |
| 318.00 | 0.2000 | 0.0339 |
| 318.00 | 0.3000 | 0.0444 |
| 318.00 | 0.4000 | 0.0517 |
| 318.00 | 0.5000 | 0.0584 |
| 318.00 | 0.6000 | 0.0692 |
| 318.00 | 0.7000 | 0.0787 |
| 318.00 | 0.8000 | 0.0918 |
| 318.00 | 0.9000 | 0.1069 |
| 318.00 | 1.0000 | 0.1367 |