- Name
- 1-Butanol
- InChI
- InChI=1S/C4H10O/c1-2-3-4-5/h5H,2-4H2,1H3
- InChI Key
- LRHPLDYGYMQRHN-UHFFFAOYSA-N
- Formula
- C4H10O
- SMILES
- CCCCO
- Mol. Weight (g/mol)
- 74.12
- CAS
- 71-36-3
- Name
- Acetone
- InChI
- InChI=1S/C3H6O/c1-3(2)4/h1-2H3
- InChI Key
- CSCPPACGZOOCGX-UHFFFAOYSA-N
- Formula
- C3H6O
- SMILES
- CC(C)=O
- Mol. Weight (g/mol)
- 58.08
- CAS
- 67-64-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (2)
- Binary diffusion coefficient, m2/s (4)
- Vapor Liquid Equilibrium at Constant Pressure (2)
- Vapor Liquid Equilibrium at Constant Temperature
Mole fraction of Acetone (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetone (2) - Liquid | Mole fraction of Acetone (2) - Gas |
| 283.20 | 0.0120 | 0.6450 |
| 283.20 | 0.0370 | 0.8430 |
| 283.20 | 0.0870 | 0.9210 |
| 283.20 | 0.2910 | 0.9690 |
| 283.20 | 0.5520 | 0.9860 |
| 283.20 | 0.8260 | 0.9970 |
| 295.20 | 0.0120 | 0.4990 |
| 295.20 | 0.0370 | 0.7650 |
| 295.20 | 0.0870 | 0.8680 |
| 295.20 | 0.2910 | 0.9480 |
| 295.20 | 0.5520 | 0.9760 |
| 295.20 | 0.8260 | 0.9910 |
| 308.20 | 0.0120 | 0.4020 |
| 308.20 | 0.0370 | 0.6660 |
| 308.20 | 0.0870 | 0.8180 |
| 308.20 | 0.2910 | 0.9240 |
| 308.20 | 0.5520 | 0.9740 |
| 308.20 | 0.8260 | 0.9880 |
| 324.20 | 0.0120 | 0.2600 |
| 324.20 | 0.0370 | 0.5220 |
| 324.20 | 0.0870 | 0.7070 |
| 324.20 | 0.2910 | 0.8920 |
| 324.20 | 0.5520 | 0.9500 |
| 324.20 | 0.8260 | 0.9850 |
Mole fraction of Acetone (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetone (2) - Liquid | Mole fraction of Acetone (2) - Gas |
| 283.20 | 0.0120 | 0.6450 |
| 283.20 | 0.0370 | 0.8430 |
| 283.20 | 0.0870 | 0.9210 |
| 283.20 | 0.2910 | 0.9690 |
| 283.20 | 0.5520 | 0.9860 |
| 283.20 | 0.8260 | 0.9970 |
| 295.20 | 0.0120 | 0.4990 |
| 295.20 | 0.0370 | 0.7650 |
| 295.20 | 0.0870 | 0.8680 |
| 295.20 | 0.2910 | 0.9480 |
| 295.20 | 0.5520 | 0.9760 |
| 295.20 | 0.8260 | 0.9910 |
| 308.20 | 0.0120 | 0.4020 |
| 308.20 | 0.0370 | 0.6660 |
| 308.20 | 0.0870 | 0.8180 |
| 308.20 | 0.2910 | 0.9240 |
| 308.20 | 0.5520 | 0.9740 |
| 308.20 | 0.8260 | 0.9880 |
| 324.20 | 0.0120 | 0.2600 |
| 324.20 | 0.0370 | 0.5220 |
| 324.20 | 0.0870 | 0.7070 |
| 324.20 | 0.2910 | 0.8920 |
| 324.20 | 0.5520 | 0.9500 |
| 324.20 | 0.8260 | 0.9850 |
Binary diffusion coefficient, m2/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of Acetone (2) - Liquid | Binary diffusion coefficient, m2/s - Liquid |
|---|---|
| 0.0125 | 0.0000 |
| 0.1000 | 0.0000 |
| 0.2000 | 0.0000 |
| 0.3000 | 0.0000 |
| 0.4000 | 0.0000 |
| 0.5000 | 0.0000 |
| 0.6000 | 0.0000 |
| 0.7000 | 0.0000 |
| 0.8000 | 0.0000 |
| 0.9000 | 0.0000 |
| 0.9915 | 0.0000 |
| 0.9925 | 0.0000 |
Binary diffusion coefficient, m2/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of Acetone (2) - Liquid | Binary diffusion coefficient, m2/s - Liquid |
|---|---|
| 0.0125 | 0.0000 |
| 0.1000 | 0.0000 |
| 0.2000 | 0.0000 |
| 0.3000 | 0.0000 |
| 0.4000 | 0.0000 |
| 0.5000 | 0.0000 |
| 0.6000 | 0.0000 |
| 0.7000 | 0.0000 |
| 0.8000 | 0.0000 |
| 0.9000 | 0.0000 |
| 0.9915 | 0.0000 |
| 0.9925 | 0.0000 |
Binary diffusion coefficient, m2/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of Acetone (2) - Liquid | Binary diffusion coefficient, m2/s - Liquid |
|---|---|
| 0.0125 | 0.0000 |
| 0.1000 | 0.0000 |
| 0.2000 | 0.0000 |
| 0.3000 | 0.0000 |
| 0.4000 | 0.0000 |
| 0.5000 | 0.0000 |
| 0.6000 | 0.0000 |
| 0.7000 | 0.0000 |
| 0.8000 | 0.0000 |
| 0.9000 | 0.0000 |
| 0.9915 | 0.0000 |
| 0.9925 | 0.0000 |
Binary diffusion coefficient, m2/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of Acetone (2) - Liquid | Binary diffusion coefficient, m2/s - Liquid |
|---|---|
| 0.0125 | 0.0000 |
| 0.1000 | 0.0000 |
| 0.2000 | 0.0000 |
| 0.3000 | 0.0000 |
| 0.4000 | 0.0000 |
| 0.5000 | 0.0000 |
| 0.6000 | 0.0000 |
| 0.7000 | 0.0000 |
| 0.8000 | 0.0000 |
| 0.9000 | 0.0000 |
| 0.9915 | 0.0000 |
| 0.9925 | 0.0000 |
Vapor Liquid Equilibrium at Constant Pressure [ref]
Operational condition: Pressure, kPa = 99.46 (VLE)
| Fixed | Measured | |
|---|---|---|
| T [K] - VLE | x1[mol/mol] of Acetone (2) - Liquid | y1[mol/mol] of Acetone (2) - Vapour |
| 388.15 | 0.0100 | 0.1050 |
| 385.15 | 0.0250 | 0.2250 |
| 380.25 | 0.0500 | 0.4050 |
| 376.95 | 0.0700 | 0.4720 |
| 364.85 | 0.1540 | 0.6980 |
| 360.05 | 0.1980 | 0.7500 |
| 358.55 | 0.2150 | 0.7730 |
| 354.85 | 0.2650 | 0.8090 |
| 351.95 | 0.3120 | 0.8370 |
| 341.75 | 0.5350 | 0.9300 |
| 339.35 | 0.6070 | 0.9430 |
| 337.65 | 0.6590 | 0.9510 |
| 334.75 | 0.7630 | 0.9720 |
| 333.15 | 0.8190 | 0.9780 |
| 331.25 | 0.8970 | 0.9880 |
Vapor Liquid Equilibrium at Constant Pressure [ref]
Operational condition: Pressure, kPa = 101.33 (VLE)
| T [K] - VLE | x1[mol/mol] of Acetone (2) - Liquid |
|---|---|
| 374.5 | 0.1240 |
| 361.64 | 0.2420 |
| 353.15 | 0.3540 |
| 347.36 | 0.4600 |
| 343.18 | 0.5610 |
| 339.49 | 0.6570 |
| 336.47 | 0.7490 |
| 334.05 | 0.8360 |
| 331.83 | 0.9200 |
Vapor Liquid Equilibrium at Constant Temperature [ref]
Operational condition: Temperature, K = 298.15 (VLE)
| Fixed | Measured | |
|---|---|---|
| P [kPa] - VLE | x1[mol/mol] of Acetone (2) - Liquid | y1[mol/mol] of Acetone (2) - Vapour |
| 9.733 | 0.1600 | 0.9140 |
| 15.465 | 0.4350 | 0.9610 |
| 19.865 | 0.6500 | 0.9750 |
| 21.865 | 0.7900 | 0.9840 |
| 24.265 | 0.9050 | 0.9890 |
| 25.331 | 0.9510 | 0.9910 |