- Name
- Benzene, nitro-
- InChI
- InChI=1S/C6H5NO2/c8-7(9)6-4-2-1-3-5-6/h1-5H
- InChI Key
- LQNUZADURLCDLV-UHFFFAOYSA-N
- Formula
- C6H5NO2
- SMILES
- O=[N+]([O-])c1ccccc1
- Mol. Weight (g/mol)
- 123.11
- CAS
- 98-95-3
- Name
- Pentane, 2-methyl-
- InChI
- InChI=1S/C6H14/c1-4-5-6(2)3/h6H,4-5H2,1-3H3
- InChI Key
- AFABGHUZZDYHJO-UHFFFAOYSA-N
- Formula
- C6H14
- SMILES
- CCCC(C)C
- Mol. Weight (g/mol)
- 86.18
- CAS
- 107-83-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Benzene, nitro- (1) [ref]
Operational condition: Pressure, kPa = 85 (Liquid mixture 2)
| Temperature, K - Liquid mixture 1 | Mole fraction of Benzene, nitro- (1) - Liquid mixture 1 |
|---|---|
| 298.26 | 0.4160 |
| 298.25 | 0.4030 |
| 298.18 | 0.3790 |
| 298.14 | 0.3720 |
| 298.13 | 0.3700 |
| 298.11 | 0.3660 |
| 298.08 | 0.3630 |
| 297.94 | 0.3510 |
| 297.85 | 0.3430 |
| 297.67 | 0.3310 |
| 297.34 | 0.3160 |
| 296.74 | 0.2950 |
| 296.47 | 0.2900 |
| 295.23 | 0.2610 |
| 294.26 | 0.2440 |
| 293.17 | 0.2290 |
| 292.41 | 0.2190 |
| 291.64 | 0.2100 |
| 290.64 | 0.1970 |
| 289.73 | 0.1910 |
| 288.29 | 0.1790 |
| 287.54 | 0.1730 |
Mole fraction of Benzene, nitro- (1) [ref]
Operational condition: Pressure, kPa = 85 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mole fraction of Benzene, nitro- (1) - Liquid mixture 2 |
|---|---|
| 298.26 | 0.4510 |
| 298.25 | 0.4620 |
| 298.18 | 0.4820 |
| 298.14 | 0.4910 |
| 298.13 | 0.4930 |
| 298.11 | 0.4970 |
| 298.08 | 0.5000 |
| 297.94 | 0.5130 |
| 297.85 | 0.5190 |
| 297.67 | 0.5320 |
| 297.34 | 0.5520 |
| 296.74 | 0.5770 |
| 296.47 | 0.5890 |
| 295.23 | 0.6040 |
| 294.26 | 0.6210 |
| 293.17 | 0.6370 |
| 292.41 | 0.6570 |
| 291.64 | 0.6650 |
| 290.64 | 0.6740 |
| 289.73 | 0.6780 |
| 288.29 | 0.6880 |
| 287.54 | 0.6940 |
Mole fraction of Benzene, nitro- (1) [ref]
Operational condition: Pressure, kPa = 85 (Liquid mixture 2)
| Temperature, K - Liquid mixture 1 | Mole fraction of Benzene, nitro- (1) - Liquid mixture 1 |
|---|---|
| 298.26 | 0.4160 |
| 298.25 | 0.4030 |
| 298.18 | 0.3790 |
| 298.14 | 0.3720 |
| 298.13 | 0.3700 |
| 298.11 | 0.3660 |
| 298.08 | 0.3630 |
| 297.94 | 0.3510 |
| 297.85 | 0.3430 |
| 297.67 | 0.3310 |
| 297.34 | 0.3160 |
| 296.74 | 0.2950 |
| 296.47 | 0.2900 |
| 295.23 | 0.2610 |
| 294.26 | 0.2440 |
| 293.17 | 0.2290 |
| 292.41 | 0.2190 |
| 291.64 | 0.2100 |
| 290.64 | 0.1970 |
| 289.73 | 0.1910 |
| 288.29 | 0.1790 |
| 287.54 | 0.1730 |
Mole fraction of Benzene, nitro- (1) [ref]
Operational condition: Pressure, kPa = 85 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mole fraction of Benzene, nitro- (1) - Liquid mixture 2 |
|---|---|
| 298.26 | 0.4510 |
| 298.25 | 0.4620 |
| 298.18 | 0.4820 |
| 298.14 | 0.4910 |
| 298.13 | 0.4930 |
| 298.11 | 0.4970 |
| 298.08 | 0.5000 |
| 297.94 | 0.5130 |
| 297.85 | 0.5190 |
| 297.67 | 0.5320 |
| 297.34 | 0.5520 |
| 296.74 | 0.5770 |
| 296.47 | 0.5890 |
| 295.23 | 0.6040 |
| 294.26 | 0.6210 |
| 293.17 | 0.6370 |
| 292.41 | 0.6570 |
| 291.64 | 0.6650 |
| 290.64 | 0.6740 |
| 289.73 | 0.6780 |
| 288.29 | 0.6880 |
| 287.54 | 0.6940 |
Refractive index (other wavelength) [ref]
Operational conditions:
- Pressure, kPa = 85 (Liquid mixture 1)
- Wavelength, nm = 632.8 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Refractive index (other wavelength) - Liquid mixture 1 |
|---|---|
| 298.26 | 1.4348 |
| 298.25 | 1.4326 |
| 298.18 | 1.4285 |
| 298.14 | 1.4274 |
| 298.13 | 1.4271 |
| 298.11 | 1.4264 |
| 298.08 | 1.4258 |
| 297.94 | 1.4239 |
| 297.85 | 1.4227 |
| 297.67 | 1.4207 |
| 297.34 | 1.4184 |
| 296.74 | 1.4153 |
| 296.47 | 1.4145 |
| 295.23 | 1.4105 |
| 294.26 | 1.4084 |
| 293.17 | 1.4065 |
| 292.41 | 1.4054 |
| 291.64 | 1.4044 |
| 290.64 | 1.4029 |
| 289.73 | 1.4025 |
| 288.29 | 1.4014 |
| 287.54 | 1.4009 |
Refractive index (other wavelength) [ref]
Operational conditions:
- Pressure, kPa = 85 (Liquid mixture 2)
- Wavelength, nm = 632.8 (Liquid mixture 2)
| Temperature, K - Liquid mixture 2 | Refractive index (other wavelength) - Liquid mixture 2 |
|---|---|
| 298.26 | 1.441 |
| 298.25 | 1.443 |
| 298.18 | 1.4465 |
| 298.14 | 1.4482 |
| 298.13 | 1.4485 |
| 298.11 | 1.4492 |
| 298.08 | 1.4498 |
| 297.94 | 1.4522 |
| 297.85 | 1.4534 |
| 297.67 | 1.4559 |
| 297.34 | 1.4597 |
| 296.74 | 1.4646 |
| 296.47 | 1.467 |
| 295.23 | 1.4704 |
| 294.26 | 1.4742 |
| 293.17 | 1.4777 |
| 292.41 | 1.4819 |
| 291.64 | 1.4838 |
| 290.64 | 1.4861 |
| 289.73 | 1.4873 |
| 288.29 | 1.49 |
| 287.54 | 1.4915 |
Refractive index (other wavelength) [ref]
Operational conditions:
- Pressure, kPa = 85 (Liquid)
- Wavelength, nm = 632.8 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Benzene, nitro- (1) - Liquid | Temperature, K - Liquid | Refractive index (other wavelength) - Liquid |
| 0.0000 | 291.27 | 1.372 |
| 0.0000 | 292.60 | 1.3713 |
| 0.0000 | 293.24 | 1.3708 |
| 0.0000 | 293.18 | 1.3709 |
| 0.0000 | 294.36 | 1.3702 |
| 0.0000 | 295.16 | 1.3697 |
| 0.0000 | 295.98 | 1.3693 |
| 0.0000 | 296.50 | 1.369 |
| 0.0000 | 297.08 | 1.3686 |
| 0.0000 | 297.99 | 1.3681 |
| 0.1020 | 294.46 | 1.3859 |
| 0.1020 | 295.14 | 1.3855 |
| 0.1020 | 296.69 | 1.3846 |
| 0.1020 | 297.37 | 1.3842 |
| 0.1020 | 298.53 | 1.3835 |
| 0.1020 | 299.41 | 1.383 |
| 0.1840 | 295.31 | 1.3982 |
| 0.1840 | 296.48 | 1.3975 |
| 0.1840 | 297.12 | 1.3971 |
| 0.1840 | 298.65 | 1.3963 |
| 0.1840 | 299.18 | 1.396 |
| 0.2670 | 296.79 | 1.4105 |
| 0.2670 | 297.86 | 1.4098 |
| 0.2670 | 299.56 | 1.409 |
| 0.2670 | 301.44 | 1.4081 |
| 0.2670 | 302.17 | 1.4076 |
| 0.3690 | 298.20 | 1.4269 |
| 0.3690 | 298.78 | 1.4265 |
| 0.3690 | 299.36 | 1.4262 |
| 0.3690 | 300.11 | 1.4259 |
| 0.3690 | 301.21 | 1.4253 |
| 0.4660 | 298.79 | 1.4432 |
| 0.4660 | 299.74 | 1.4426 |
| 0.4660 | 300.50 | 1.4422 |
| 0.4660 | 301.08 | 1.4419 |
| 0.5670 | 298.23 | 1.4619 |
| 0.5670 | 298.92 | 1.4616 |
| 0.5670 | 299.80 | 1.4611 |
| 0.5670 | 301.13 | 1.4604 |
| 0.5670 | 302.22 | 1.4599 |
| 0.6580 | 294.01 | 1.4812 |
| 0.6580 | 296.43 | 1.4799 |
| 0.6580 | 297.16 | 1.4795 |
| 0.6580 | 298.24 | 1.479 |
| 0.6580 | 299.30 | 1.4784 |
| 0.6580 | 299.86 | 1.4781 |
| 0.6580 | 300.74 | 1.4776 |
| 0.7580 | 296.17 | 1.4994 |
| 0.7580 | 296.99 | 1.4991 |
| 0.7580 | 297.67 | 1.4986 |
| 0.7580 | 298.29 | 1.4984 |
| 0.7580 | 298.93 | 1.498 |
| 0.8710 | 296.85 | 1.5209 |
| 0.8710 | 297.40 | 1.5205 |
| 0.8710 | 297.98 | 1.5201 |
| 0.8710 | 298.91 | 1.5196 |
| 0.8710 | 300.05 | 1.519 |
| 1.0000 | 293.55 | 1.5476 |
| 1.0000 | 293.93 | 1.5474 |
| 1.0000 | 293.55 | 1.5477 |
| 1.0000 | 294.72 | 1.547 |
| 1.0000 | 295.47 | 1.5467 |
| 1.0000 | 296.50 | 1.5462 |
| 1.0000 | 298.00 | 1.5454 |
| 1.0000 | 299.01 | 1.5447 |
| 1.0000 | 300.93 | 1.5438 |
| 1.0000 | 302.42 | 1.5431 |
| 1.0000 | 303.97 | 1.5424 |
| 1.0000 | 305.26 | 1.5418 |
Refractive index (other wavelength) [ref]
Operational conditions:
- Pressure, kPa = 85 (Liquid mixture 1)
- Wavelength, nm = 632.8 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Refractive index (other wavelength) - Liquid mixture 1 |
|---|---|
| 298.26 | 1.4348 |
| 298.25 | 1.4326 |
| 298.18 | 1.4285 |
| 298.14 | 1.4274 |
| 298.13 | 1.4271 |
| 298.11 | 1.4264 |
| 298.08 | 1.4258 |
| 297.94 | 1.4239 |
| 297.85 | 1.4227 |
| 297.67 | 1.4207 |
| 297.34 | 1.4184 |
| 296.74 | 1.4153 |
| 296.47 | 1.4145 |
| 295.23 | 1.4105 |
| 294.26 | 1.4084 |
| 293.17 | 1.4065 |
| 292.41 | 1.4054 |
| 291.64 | 1.4044 |
| 290.64 | 1.4029 |
| 289.73 | 1.4025 |
| 288.29 | 1.4014 |
| 287.54 | 1.4009 |
Refractive index (other wavelength) [ref]
Operational conditions:
- Pressure, kPa = 85 (Liquid mixture 2)
- Wavelength, nm = 632.8 (Liquid mixture 2)
| Temperature, K - Liquid mixture 2 | Refractive index (other wavelength) - Liquid mixture 2 |
|---|---|
| 298.26 | 1.441 |
| 298.25 | 1.443 |
| 298.18 | 1.4465 |
| 298.14 | 1.4482 |
| 298.13 | 1.4485 |
| 298.11 | 1.4492 |
| 298.08 | 1.4498 |
| 297.94 | 1.4522 |
| 297.85 | 1.4534 |
| 297.67 | 1.4559 |
| 297.34 | 1.4597 |
| 296.74 | 1.4646 |
| 296.47 | 1.467 |
| 295.23 | 1.4704 |
| 294.26 | 1.4742 |
| 293.17 | 1.4777 |
| 292.41 | 1.4819 |
| 291.64 | 1.4838 |
| 290.64 | 1.4861 |
| 289.73 | 1.4873 |
| 288.29 | 1.49 |
| 287.54 | 1.4915 |
Refractive index (other wavelength) [ref]
Operational conditions:
- Pressure, kPa = 85 (Liquid)
- Wavelength, nm = 632.8 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Benzene, nitro- (1) - Liquid | Temperature, K - Liquid | Refractive index (other wavelength) - Liquid |
| 0.0000 | 291.27 | 1.372 |
| 0.0000 | 292.60 | 1.3713 |
| 0.0000 | 293.24 | 1.3708 |
| 0.0000 | 293.18 | 1.3709 |
| 0.0000 | 294.36 | 1.3702 |
| 0.0000 | 295.16 | 1.3697 |
| 0.0000 | 295.98 | 1.3693 |
| 0.0000 | 296.50 | 1.369 |
| 0.0000 | 297.08 | 1.3686 |
| 0.0000 | 297.99 | 1.3681 |
| 0.1020 | 294.46 | 1.3859 |
| 0.1020 | 295.14 | 1.3855 |
| 0.1020 | 296.69 | 1.3846 |
| 0.1020 | 297.37 | 1.3842 |
| 0.1020 | 298.53 | 1.3835 |
| 0.1020 | 299.41 | 1.383 |
| 0.1840 | 295.31 | 1.3982 |
| 0.1840 | 296.48 | 1.3975 |
| 0.1840 | 297.12 | 1.3971 |
| 0.1840 | 298.65 | 1.3963 |
| 0.1840 | 299.18 | 1.396 |
| 0.2670 | 296.79 | 1.4105 |
| 0.2670 | 297.86 | 1.4098 |
| 0.2670 | 299.56 | 1.409 |
| 0.2670 | 301.44 | 1.4081 |
| 0.2670 | 302.17 | 1.4076 |
| 0.3690 | 298.20 | 1.4269 |
| 0.3690 | 298.78 | 1.4265 |
| 0.3690 | 299.36 | 1.4262 |
| 0.3690 | 300.11 | 1.4259 |
| 0.3690 | 301.21 | 1.4253 |
| 0.4660 | 298.79 | 1.4432 |
| 0.4660 | 299.74 | 1.4426 |
| 0.4660 | 300.50 | 1.4422 |
| 0.4660 | 301.08 | 1.4419 |
| 0.5670 | 298.23 | 1.4619 |
| 0.5670 | 298.92 | 1.4616 |
| 0.5670 | 299.80 | 1.4611 |
| 0.5670 | 301.13 | 1.4604 |
| 0.5670 | 302.22 | 1.4599 |
| 0.6580 | 294.01 | 1.4812 |
| 0.6580 | 296.43 | 1.4799 |
| 0.6580 | 297.16 | 1.4795 |
| 0.6580 | 298.24 | 1.479 |
| 0.6580 | 299.30 | 1.4784 |
| 0.6580 | 299.86 | 1.4781 |
| 0.6580 | 300.74 | 1.4776 |
| 0.7580 | 296.17 | 1.4994 |
| 0.7580 | 296.99 | 1.4991 |
| 0.7580 | 297.67 | 1.4986 |
| 0.7580 | 298.29 | 1.4984 |
| 0.7580 | 298.93 | 1.498 |
| 0.8710 | 296.85 | 1.5209 |
| 0.8710 | 297.40 | 1.5205 |
| 0.8710 | 297.98 | 1.5201 |
| 0.8710 | 298.91 | 1.5196 |
| 0.8710 | 300.05 | 1.519 |
| 1.0000 | 293.55 | 1.5476 |
| 1.0000 | 293.93 | 1.5474 |
| 1.0000 | 293.55 | 1.5477 |
| 1.0000 | 294.72 | 1.547 |
| 1.0000 | 295.47 | 1.5467 |
| 1.0000 | 296.50 | 1.5462 |
| 1.0000 | 298.00 | 1.5454 |
| 1.0000 | 299.01 | 1.5447 |
| 1.0000 | 300.93 | 1.5438 |
| 1.0000 | 302.42 | 1.5431 |
| 1.0000 | 303.97 | 1.5424 |
| 1.0000 | 305.26 | 1.5418 |
Critical temperature, K [ref]
| Mole fraction of Benzene, nitro- (1) - Liquid | Critical temperature, K - Liquid |
|---|---|
| 0.4330 | 298.30 |
Critical temperature, K [ref]
| Mole fraction of Benzene, nitro- (1) - Liquid | Critical temperature, K - Liquid |
|---|---|
| 0.4330 | 298.30 |