- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
- Name
- 9,10-Anthracenedione, 1-amino-2-methyl-
- InChI
- InChI=1S/C15H11NO2/c1-8-6-7-11-12(13(8)16)15(18)10-5-3-2-4-9(10)14(11)17/h2-7H,16H2,1H3
- InChI Key
- ZLCUIOWQYBYEBG-UHFFFAOYSA-N
- Formula
- C15H11NO2
- SMILES
- Cc1ccc2c(c1N)C(=O)c1ccccc1C2=O
- Mol. Weight (g/mol)
- 237.25
- CAS
- 82-28-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Binary diffusion coefficient, m2/s [ref]
Operational condition: Mole fraction = 0 (Fluid (supercritical or subcritical phases))
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Binary diffusion coefficient, m2/s - Fluid (supercritical or subcritical phases) |
| 308.20 | 21300.00 | 0.0000 |
| 308.20 | 23000.00 | 0.0000 |
| 308.20 | 24300.00 | 0.0000 |
| 308.20 | 24300.00 | 0.0000 |
| 308.20 | 25000.00 | 0.0000 |
| 308.20 | 25000.00 | 0.0000 |
| 308.20 | 26000.00 | 0.0000 |
| 308.20 | 29000.00 | 0.0000 |
| 308.20 | 29000.00 | 0.0000 |
| 308.20 | 29000.00 | 0.0000 |
| 308.20 | 29000.00 | 0.0000 |
| 308.20 | 30400.00 | 0.0000 |
| 308.20 | 32000.00 | 0.0000 |
| 308.20 | 32000.00 | 0.0000 |
| 308.20 | 32000.00 | 0.0000 |
| 313.20 | 20000.00 | 0.0000 |
| 313.20 | 21300.00 | 0.0000 |
| 313.20 | 21300.00 | 0.0000 |
| 313.20 | 21300.00 | 0.0000 |
| 313.20 | 23000.00 | 0.0000 |
| 313.20 | 23000.00 | 0.0000 |
| 313.20 | 23000.00 | 0.0000 |
| 313.20 | 23000.00 | 0.0000 |
| 313.20 | 24300.00 | 0.0000 |
| 313.20 | 25000.00 | 0.0000 |
| 313.20 | 25000.00 | 0.0000 |
| 313.20 | 26000.00 | 0.0000 |
| 313.20 | 26000.00 | 0.0000 |
| 313.20 | 26000.00 | 0.0000 |
| 313.20 | 27400.00 | 0.0000 |
| 313.20 | 29000.00 | 0.0000 |
| 313.20 | 29000.00 | 0.0000 |
| 313.20 | 29000.00 | 0.0000 |
| 313.20 | 30400.00 | 0.0000 |
| 313.20 | 32000.00 | 0.0000 |
| 313.20 | 33400.00 | 0.0000 |
| 313.20 | 35500.00 | 0.0000 |
| 313.20 | 40000.00 | 0.0000 |
| 318.20 | 20000.00 | 0.0000 |
| 318.20 | 21300.00 | 0.0000 |
| 318.20 | 23000.00 | 0.0000 |
| 318.20 | 23000.00 | 0.0000 |
| 318.20 | 24300.00 | 0.0000 |
| 318.20 | 24300.00 | 0.0000 |
| 318.20 | 24300.00 | 0.0000 |
| 318.20 | 25000.00 | 0.0000 |
| 318.20 | 26000.00 | 0.0000 |
| 318.20 | 27400.00 | 0.0000 |
| 318.20 | 29000.00 | 0.0000 |
| 318.20 | 30400.00 | 0.0000 |
| 318.20 | 30400.00 | 0.0000 |
| 318.20 | 32000.00 | 0.0000 |
| 318.20 | 33400.00 | 0.0000 |
| 328.20 | 23000.00 | 0.0000 |
| 328.20 | 24300.00 | 0.0000 |
| 328.20 | 24700.00 | 0.0000 |
| 328.20 | 25000.00 | 0.0000 |
| 328.20 | 25000.00 | 0.0000 |
| 328.20 | 26000.00 | 0.0000 |
| 328.20 | 27400.00 | 0.0000 |
| 328.20 | 29000.00 | 0.0000 |
| 328.20 | 30400.00 | 0.0000 |
| 328.20 | 32000.00 | 0.0000 |
| 328.20 | 33400.00 | 0.0000 |
| 328.20 | 35500.00 | 0.0000 |
Binary diffusion coefficient, m2/s [ref]
Operational condition: Mole fraction = 0 (Fluid (supercritical or subcritical phases))
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Binary diffusion coefficient, m2/s - Fluid (supercritical or subcritical phases) |
| 308.20 | 21300.00 | 0.0000 |
| 308.20 | 23000.00 | 0.0000 |
| 308.20 | 24300.00 | 0.0000 |
| 308.20 | 24300.00 | 0.0000 |
| 308.20 | 25000.00 | 0.0000 |
| 308.20 | 25000.00 | 0.0000 |
| 308.20 | 26000.00 | 0.0000 |
| 308.20 | 29000.00 | 0.0000 |
| 308.20 | 29000.00 | 0.0000 |
| 308.20 | 29000.00 | 0.0000 |
| 308.20 | 29000.00 | 0.0000 |
| 308.20 | 30400.00 | 0.0000 |
| 308.20 | 32000.00 | 0.0000 |
| 308.20 | 32000.00 | 0.0000 |
| 308.20 | 32000.00 | 0.0000 |
| 313.20 | 20000.00 | 0.0000 |
| 313.20 | 21300.00 | 0.0000 |
| 313.20 | 21300.00 | 0.0000 |
| 313.20 | 21300.00 | 0.0000 |
| 313.20 | 23000.00 | 0.0000 |
| 313.20 | 23000.00 | 0.0000 |
| 313.20 | 23000.00 | 0.0000 |
| 313.20 | 23000.00 | 0.0000 |
| 313.20 | 24300.00 | 0.0000 |
| 313.20 | 25000.00 | 0.0000 |
| 313.20 | 25000.00 | 0.0000 |
| 313.20 | 26000.00 | 0.0000 |
| 313.20 | 26000.00 | 0.0000 |
| 313.20 | 26000.00 | 0.0000 |
| 313.20 | 27400.00 | 0.0000 |
| 313.20 | 29000.00 | 0.0000 |
| 313.20 | 29000.00 | 0.0000 |
| 313.20 | 29000.00 | 0.0000 |
| 313.20 | 30400.00 | 0.0000 |
| 313.20 | 32000.00 | 0.0000 |
| 313.20 | 33400.00 | 0.0000 |
| 313.20 | 35500.00 | 0.0000 |
| 313.20 | 40000.00 | 0.0000 |
| 318.20 | 20000.00 | 0.0000 |
| 318.20 | 21300.00 | 0.0000 |
| 318.20 | 23000.00 | 0.0000 |
| 318.20 | 23000.00 | 0.0000 |
| 318.20 | 24300.00 | 0.0000 |
| 318.20 | 24300.00 | 0.0000 |
| 318.20 | 24300.00 | 0.0000 |
| 318.20 | 25000.00 | 0.0000 |
| 318.20 | 26000.00 | 0.0000 |
| 318.20 | 27400.00 | 0.0000 |
| 318.20 | 29000.00 | 0.0000 |
| 318.20 | 30400.00 | 0.0000 |
| 318.20 | 30400.00 | 0.0000 |
| 318.20 | 32000.00 | 0.0000 |
| 318.20 | 33400.00 | 0.0000 |
| 328.20 | 23000.00 | 0.0000 |
| 328.20 | 24300.00 | 0.0000 |
| 328.20 | 24700.00 | 0.0000 |
| 328.20 | 25000.00 | 0.0000 |
| 328.20 | 25000.00 | 0.0000 |
| 328.20 | 26000.00 | 0.0000 |
| 328.20 | 27400.00 | 0.0000 |
| 328.20 | 29000.00 | 0.0000 |
| 328.20 | 30400.00 | 0.0000 |
| 328.20 | 32000.00 | 0.0000 |
| 328.20 | 33400.00 | 0.0000 |
| 328.20 | 35500.00 | 0.0000 |