- Name
- Benzene, 1-chloro-4-methyl-
- InChI
- InChI=1S/C7H7Cl/c1-6-2-4-7(8)5-3-6/h2-5H,1H3
- InChI Key
- NPDACUSDTOMAMK-UHFFFAOYSA-N
- Formula
- C7H7Cl
- SMILES
- Cc1ccc(Cl)cc1
- Mol. Weight (g/mol)
- 126.58
- CAS
- 106-43-4
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass fraction of Benzene, 1-chloro-4-methyl- (1) [ref]
Operational condition: Pressure, kPa = 5000 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass fraction of Benzene, 1-chloro-4-methyl- (1) - Liquid mixture 1 |
|---|---|
| 535.45 | 0.0311 |
| 537.65 | 0.0345 |
| 542.75 | 0.0414 |
| 544.85 | 0.0446 |
| 548.45 | 0.0533 |
| 550.35 | 0.0553 |
| 552.35 | 0.0615 |
| 554.95 | 0.0681 |
| 557.85 | 0.0730 |
| 558.75 | 0.0773 |
| 560.75 | 0.0780 |
| 563.85 | 0.0821 |
| 566.65 | 0.0869 |
| 566.95 | 0.0876 |
Henry's Law constant (molality scale), kPa*kg/mol of Benzene, 1-chloro-4-methyl- (1) [ref]
Operational condition: Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Henry's Law constant (molality scale), kPa*kg/mol of Benzene, 1-chloro-4-methyl- (1) - Liquid |
|---|---|
| 274.15 | 85.5559 |
| 294.65 | 239.576 |
| 294.65 | 217.429 |
| 296.15 | 231.59 |
| 310.15 | 224.028 |
| 313.15 | 591.1 |
| 326.15 | 1241.1 |
| 331.15 | 887.7 |
Mass fraction of Benzene, 1-chloro-4-methyl- (1) [ref]
Operational condition: Pressure, kPa = 5000 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass fraction of Benzene, 1-chloro-4-methyl- (1) - Liquid mixture 1 |
|---|---|
| 535.45 | 0.0311 |
| 537.65 | 0.0345 |
| 542.75 | 0.0414 |
| 544.85 | 0.0446 |
| 548.45 | 0.0533 |
| 550.35 | 0.0553 |
| 552.35 | 0.0615 |
| 554.95 | 0.0681 |
| 557.85 | 0.0730 |
| 558.75 | 0.0773 |
| 560.75 | 0.0780 |
| 563.85 | 0.0821 |
| 566.65 | 0.0869 |
| 566.95 | 0.0876 |
Henry's Law constant (molality scale), kPa*kg/mol of Benzene, 1-chloro-4-methyl- (1) [ref]
Operational condition: Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Henry's Law constant (molality scale), kPa*kg/mol of Benzene, 1-chloro-4-methyl- (1) - Liquid |
|---|---|
| 274.15 | 85.5559 |
| 294.65 | 239.576 |
| 294.65 | 217.429 |
| 296.15 | 231.59 |
| 310.15 | 224.028 |
| 313.15 | 591.1 |
| 326.15 | 1241.1 |
| 331.15 | 887.7 |