- Name
- Monoethanolamine
- InChI
- InChI=1S/C2H7NO/c3-1-2-4/h4H,1-3H2
- InChI Key
- HZAXFHJVJLSVMW-UHFFFAOYSA-N
- Formula
- C2H7NO
- SMILES
- NCCO
- Mol. Weight (g/mol)
- 61.08
- CAS
- 141-43-5
- Name
- Tetra-N-butylammonium bromide
- InChI
- InChI=1S/C16H36N.BrH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p-1
- InChI Key
- JRMUNVKIHCOMHV-UHFFFAOYSA-M
- Formula
- C16H36BrN
- SMILES
- CCCC[N+](CCCC)(CCCC)CCCC.[Br-]
- Mol. Weight (g/mol)
- 322.37
- CAS
- 1643-19-2
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- γ - Surface tension liquid-gas, N/m (2)
- Tfus - Solid-liquid equilibrium temperature, K (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium bromide (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.2500 | 0.1068 |
| 298.15 | 0.2000 | 0.0802 |
| 298.15 | 0.1600 | 0.0529 |
| 298.15 | 0.1400 | 0.0220 |
| 308.15 | 0.2500 | 0.0770 |
| 308.15 | 0.2000 | 0.0547 |
| 308.15 | 0.1600 | 0.0310 |
| 308.15 | 0.1400 | 0.0155 |
| 318.15 | 0.2500 | 0.0536 |
| 318.15 | 0.2000 | 0.0382 |
| 318.15 | 0.1600 | 0.0211 |
| 318.15 | 0.1400 | 0.0120 |
| 328.15 | 0.2500 | 0.0353 |
| 328.15 | 0.2000 | 0.0201 |
| 328.15 | 0.1600 | 0.0144 |
| 328.15 | 0.1400 | 0.0090 |
| 338.15 | 0.2500 | 0.0186 |
| 338.15 | 0.2000 | 0.0134 |
| 338.15 | 0.1600 | 0.0090 |
| 338.15 | 0.1400 | 0.0068 |
| 348.15 | 0.2500 | 0.0138 |
| 348.15 | 0.2000 | 0.0105 |
| 348.15 | 0.1600 | 0.0075 |
| 348.15 | 0.1400 | 0.0057 |
| 358.15 | 0.2500 | 0.0102 |
| 358.15 | 0.2000 | 0.0080 |
| 358.15 | 0.1600 | 0.0052 |
| 358.15 | 0.1400 | 0.0052 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium bromide (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.2500 | 0.1068 |
| 298.15 | 0.2000 | 0.0802 |
| 298.15 | 0.1600 | 0.0529 |
| 298.15 | 0.1400 | 0.0220 |
| 308.15 | 0.2500 | 0.0770 |
| 308.15 | 0.2000 | 0.0547 |
| 308.15 | 0.1600 | 0.0310 |
| 308.15 | 0.1400 | 0.0155 |
| 318.15 | 0.2500 | 0.0536 |
| 318.15 | 0.2000 | 0.0382 |
| 318.15 | 0.1600 | 0.0211 |
| 318.15 | 0.1400 | 0.0120 |
| 328.15 | 0.2500 | 0.0353 |
| 328.15 | 0.2000 | 0.0201 |
| 328.15 | 0.1600 | 0.0144 |
| 328.15 | 0.1400 | 0.0090 |
| 338.15 | 0.2500 | 0.0186 |
| 338.15 | 0.2000 | 0.0134 |
| 338.15 | 0.1600 | 0.0090 |
| 338.15 | 0.1400 | 0.0068 |
| 348.15 | 0.2500 | 0.0138 |
| 348.15 | 0.2000 | 0.0105 |
| 348.15 | 0.1600 | 0.0075 |
| 348.15 | 0.1400 | 0.0057 |
| 358.15 | 0.2500 | 0.0102 |
| 358.15 | 0.2000 | 0.0080 |
| 358.15 | 0.1600 | 0.0052 |
| 358.15 | 0.1400 | 0.0052 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium bromide (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.2500 | 1.4923 |
| 298.15 | 0.2000 | 1.4881 |
| 298.15 | 0.1600 | 1.4877 |
| 298.15 | 0.1400 | 1.4838 |
| 308.15 | 0.2500 | 1.4888 |
| 308.15 | 0.2000 | 1.4846 |
| 308.15 | 0.1600 | 1.4842 |
| 308.15 | 0.1400 | 1.4803 |
| 318.15 | 0.2500 | 1.4855 |
| 318.15 | 0.2000 | 1.4817 |
| 318.15 | 0.1600 | 1.4811 |
| 318.15 | 0.1400 | 1.477 |
| 328.15 | 0.2500 | 1.4824 |
| 328.15 | 0.2000 | 1.4785 |
| 328.15 | 0.1600 | 1.4778 |
| 328.15 | 0.1400 | 1.4735 |
| 338.15 | 0.2500 | 1.4797 |
| 338.15 | 0.2000 | 1.4754 |
| 338.15 | 0.1600 | 1.4739 |
| 338.15 | 0.1400 | 1.4699 |
| 348.15 | 0.2500 | 1.4765 |
| 348.15 | 0.2000 | 1.4716 |
| 348.15 | 0.1600 | 1.4699 |
| 348.15 | 0.1400 | 1.466 |
| 358.15 | 0.2500 | 1.473 |
| 358.15 | 0.2000 | 1.469 |
| 358.15 | 0.1600 | 1.4663 |
| 358.15 | 0.1400 | 1.4623 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium bromide (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.2500 | 1.4923 |
| 298.15 | 0.2000 | 1.4881 |
| 298.15 | 0.1600 | 1.4877 |
| 298.15 | 0.1400 | 1.4838 |
| 308.15 | 0.2500 | 1.4888 |
| 308.15 | 0.2000 | 1.4846 |
| 308.15 | 0.1600 | 1.4842 |
| 308.15 | 0.1400 | 1.4803 |
| 318.15 | 0.2500 | 1.4855 |
| 318.15 | 0.2000 | 1.4817 |
| 318.15 | 0.1600 | 1.4811 |
| 318.15 | 0.1400 | 1.477 |
| 328.15 | 0.2500 | 1.4824 |
| 328.15 | 0.2000 | 1.4785 |
| 328.15 | 0.1600 | 1.4778 |
| 328.15 | 0.1400 | 1.4735 |
| 338.15 | 0.2500 | 1.4797 |
| 338.15 | 0.2000 | 1.4754 |
| 338.15 | 0.1600 | 1.4739 |
| 338.15 | 0.1400 | 1.4699 |
| 348.15 | 0.2500 | 1.4765 |
| 348.15 | 0.2000 | 1.4716 |
| 348.15 | 0.1600 | 1.4699 |
| 348.15 | 0.1400 | 1.466 |
| 358.15 | 0.2500 | 1.473 |
| 358.15 | 0.2000 | 1.469 |
| 358.15 | 0.1600 | 1.4663 |
| 358.15 | 0.1400 | 1.4623 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium bromide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.2500 | 1061.6 |
| 298.15 | 0.2000 | 1060.9 |
| 298.15 | 0.1600 | 1056.6 |
| 298.15 | 0.1400 | 1048.1 |
| 308.15 | 0.2500 | 1054.5 |
| 308.15 | 0.2000 | 1053.6 |
| 308.15 | 0.1600 | 1048.0 |
| 308.15 | 0.1400 | 1038.7 |
| 318.15 | 0.2500 | 1047.3 |
| 318.15 | 0.2000 | 1046.4 |
| 318.15 | 0.1600 | 1041.5 |
| 318.15 | 0.1400 | 1028.9 |
| 328.15 | 0.2500 | 1040.2 |
| 328.15 | 0.2000 | 1039.2 |
| 328.15 | 0.1600 | 1034.1 |
| 328.15 | 0.1400 | 1018.5 |
| 338.15 | 0.2500 | 1033.1 |
| 338.15 | 0.2000 | 1032.0 |
| 338.15 | 0.1600 | 1026.7 |
| 338.15 | 0.1400 | 1010.2 |
| 348.15 | 0.2500 | 1026.1 |
| 348.15 | 0.2000 | 1024.7 |
| 348.15 | 0.1600 | 1019.3 |
| 348.15 | 0.1400 | 1001.1 |
| 358.15 | 0.2500 | 1019.0 |
| 358.15 | 0.2000 | 1017.4 |
| 358.15 | 0.1600 | 1012.0 |
| 358.15 | 0.1400 | 992.1 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium bromide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.2500 | 1061.6 |
| 298.15 | 0.2000 | 1060.9 |
| 298.15 | 0.1600 | 1056.6 |
| 298.15 | 0.1400 | 1048.1 |
| 308.15 | 0.2500 | 1054.5 |
| 308.15 | 0.2000 | 1053.6 |
| 308.15 | 0.1600 | 1048.0 |
| 308.15 | 0.1400 | 1038.7 |
| 318.15 | 0.2500 | 1047.3 |
| 318.15 | 0.2000 | 1046.4 |
| 318.15 | 0.1600 | 1041.5 |
| 318.15 | 0.1400 | 1028.9 |
| 328.15 | 0.2500 | 1040.2 |
| 328.15 | 0.2000 | 1039.2 |
| 328.15 | 0.1600 | 1034.1 |
| 328.15 | 0.1400 | 1018.5 |
| 338.15 | 0.2500 | 1033.1 |
| 338.15 | 0.2000 | 1032.0 |
| 338.15 | 0.1600 | 1026.7 |
| 338.15 | 0.1400 | 1010.2 |
| 348.15 | 0.2500 | 1026.1 |
| 348.15 | 0.2000 | 1024.7 |
| 348.15 | 0.1600 | 1019.3 |
| 348.15 | 0.1400 | 1001.1 |
| 358.15 | 0.2500 | 1019.0 |
| 358.15 | 0.2000 | 1017.4 |
| 358.15 | 0.1600 | 1012.0 |
| 358.15 | 0.1400 | 992.1 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium bromide (2) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 298.15 | 0.2500 | 0.0357 |
| 298.15 | 0.2000 | 0.0358 |
| 298.15 | 0.1600 | 0.0360 |
| 298.15 | 0.1400 | 0.0361 |
| 308.15 | 0.2500 | 0.0353 |
| 308.15 | 0.2000 | 0.0354 |
| 308.15 | 0.1600 | 0.0356 |
| 308.15 | 0.1400 | 0.0357 |
| 318.15 | 0.2500 | 0.0348 |
| 318.15 | 0.2000 | 0.0350 |
| 318.15 | 0.1600 | 0.0352 |
| 318.15 | 0.1400 | 0.0354 |
| 328.15 | 0.2500 | 0.0345 |
| 328.15 | 0.2000 | 0.0346 |
| 328.15 | 0.1600 | 0.0349 |
| 328.15 | 0.1400 | 0.0351 |
| 338.15 | 0.2500 | 0.0340 |
| 338.15 | 0.2000 | 0.0343 |
| 338.15 | 0.1600 | 0.0346 |
| 338.15 | 0.1400 | 0.0347 |
| 348.15 | 0.2500 | 0.0336 |
| 348.15 | 0.2000 | 0.0339 |
| 348.15 | 0.1600 | 0.0342 |
| 348.15 | 0.1400 | 0.0344 |
| 358.15 | 0.2500 | 0.0332 |
| 358.15 | 0.2000 | 0.0335 |
| 358.15 | 0.1600 | 0.0339 |
| 358.15 | 0.1400 | 0.0341 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tetra-N-butylammonium bromide (2) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 298.15 | 0.2500 | 0.0357 |
| 298.15 | 0.2000 | 0.0358 |
| 298.15 | 0.1600 | 0.0360 |
| 298.15 | 0.1400 | 0.0361 |
| 308.15 | 0.2500 | 0.0353 |
| 308.15 | 0.2000 | 0.0354 |
| 308.15 | 0.1600 | 0.0356 |
| 308.15 | 0.1400 | 0.0357 |
| 318.15 | 0.2500 | 0.0348 |
| 318.15 | 0.2000 | 0.0350 |
| 318.15 | 0.1600 | 0.0352 |
| 318.15 | 0.1400 | 0.0354 |
| 328.15 | 0.2500 | 0.0345 |
| 328.15 | 0.2000 | 0.0346 |
| 328.15 | 0.1600 | 0.0349 |
| 328.15 | 0.1400 | 0.0351 |
| 338.15 | 0.2500 | 0.0340 |
| 338.15 | 0.2000 | 0.0343 |
| 338.15 | 0.1600 | 0.0346 |
| 338.15 | 0.1400 | 0.0347 |
| 348.15 | 0.2500 | 0.0336 |
| 348.15 | 0.2000 | 0.0339 |
| 348.15 | 0.1600 | 0.0342 |
| 348.15 | 0.1400 | 0.0344 |
| 358.15 | 0.2500 | 0.0332 |
| 358.15 | 0.2000 | 0.0335 |
| 358.15 | 0.1600 | 0.0339 |
| 358.15 | 0.1400 | 0.0341 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Amount ratio of solute to solvent of Monoethanolamine (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 3.0 | 265.15 |
| 4.0 | 255.45 |
| 5.0 | 257.60 |
| 6.0 | 258.19 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Amount ratio of solute to solvent of Monoethanolamine (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 3.0 | 265.15 |
| 4.0 | 255.45 |
| 5.0 | 257.60 |
| 6.0 | 258.19 |