- Name
- Monoethanolamine
- InChI
- InChI=1S/C2H7NO/c3-1-2-4/h4H,1-3H2
- InChI Key
- HZAXFHJVJLSVMW-UHFFFAOYSA-N
- Formula
- C2H7NO
- SMILES
- NCCO
- Mol. Weight (g/mol)
- 61.08
- CAS
- 141-43-5
- Name
- Methyltriphenylphosphonium bromide
- InChI
- InChI=1S/C19H18BrP/c1-21(20,17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19/h2-16H,1H3
- InChI Key
- BKRKYEFQSANYGA-UHFFFAOYSA-N
- Formula
- C19H18BrP
- SMILES
-
CP(Br)(c1ccccc1)(c1ccccc1)c1cc
ccc1 - Mol. Weight (g/mol)
- 357.22
- CAS
- 1779-49-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- γ - Surface tension liquid-gas, N/m (2)
- Tfus - Solid-liquid equilibrium temperature, K (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Methyltriphenylphosphonium bromide (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.1600 | 0.1289 |
| 298.15 | 0.1400 | 0.0355 |
| 298.15 | 0.1300 | 0.0280 |
| 298.15 | 0.1100 | 0.0277 |
| 308.15 | 0.1600 | 0.0849 |
| 308.15 | 0.1400 | 0.0207 |
| 308.15 | 0.1300 | 0.0200 |
| 308.15 | 0.1100 | 0.0200 |
| 318.15 | 0.1600 | 0.0379 |
| 318.15 | 0.1400 | 0.0136 |
| 318.15 | 0.1300 | 0.0131 |
| 318.15 | 0.1100 | 0.0136 |
| 328.15 | 0.1600 | 0.0254 |
| 328.15 | 0.1400 | 0.0100 |
| 328.15 | 0.1300 | 0.0091 |
| 328.15 | 0.1100 | 0.0095 |
| 338.15 | 0.1600 | 0.0156 |
| 338.15 | 0.1400 | 0.0075 |
| 338.15 | 0.1300 | 0.0069 |
| 338.15 | 0.1100 | 0.0070 |
| 348.15 | 0.1600 | 0.0107 |
| 348.15 | 0.1400 | 0.0056 |
| 348.15 | 0.1300 | 0.0054 |
| 348.15 | 0.1100 | 0.0054 |
| 358.15 | 0.1600 | 0.0091 |
| 358.15 | 0.1400 | 0.0049 |
| 358.15 | 0.1300 | 0.0048 |
| 358.15 | 0.1100 | 0.0047 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Methyltriphenylphosphonium bromide (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.1600 | 0.1289 |
| 298.15 | 0.1400 | 0.0355 |
| 298.15 | 0.1300 | 0.0280 |
| 298.15 | 0.1100 | 0.0277 |
| 308.15 | 0.1600 | 0.0849 |
| 308.15 | 0.1400 | 0.0207 |
| 308.15 | 0.1300 | 0.0200 |
| 308.15 | 0.1100 | 0.0200 |
| 318.15 | 0.1600 | 0.0379 |
| 318.15 | 0.1400 | 0.0136 |
| 318.15 | 0.1300 | 0.0131 |
| 318.15 | 0.1100 | 0.0136 |
| 328.15 | 0.1600 | 0.0254 |
| 328.15 | 0.1400 | 0.0100 |
| 328.15 | 0.1300 | 0.0091 |
| 328.15 | 0.1100 | 0.0095 |
| 338.15 | 0.1600 | 0.0156 |
| 338.15 | 0.1400 | 0.0075 |
| 338.15 | 0.1300 | 0.0069 |
| 338.15 | 0.1100 | 0.0070 |
| 348.15 | 0.1600 | 0.0107 |
| 348.15 | 0.1400 | 0.0056 |
| 348.15 | 0.1300 | 0.0054 |
| 348.15 | 0.1100 | 0.0054 |
| 358.15 | 0.1600 | 0.0091 |
| 358.15 | 0.1400 | 0.0049 |
| 358.15 | 0.1300 | 0.0048 |
| 358.15 | 0.1100 | 0.0047 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Methyltriphenylphosphonium bromide (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.1600 | 1.5664 |
| 298.15 | 0.1400 | 1.5119 |
| 298.15 | 0.1300 | 1.5059 |
| 298.15 | 0.1100 | 1.5027 |
| 308.15 | 0.1600 | 1.5625 |
| 308.15 | 0.1400 | 1.5079 |
| 308.15 | 0.1300 | 1.5022 |
| 308.15 | 0.1100 | 1.4991 |
| 318.15 | 0.1600 | 1.5585 |
| 318.15 | 0.1400 | 1.505 |
| 318.15 | 0.1300 | 1.4993 |
| 318.15 | 0.1100 | 1.4955 |
| 328.15 | 0.1600 | 1.5552 |
| 328.15 | 0.1400 | 1.5007 |
| 328.15 | 0.1300 | 1.4952 |
| 328.15 | 0.1100 | 1.4922 |
| 338.15 | 0.1600 | 1.5516 |
| 338.15 | 0.1400 | 1.4973 |
| 338.15 | 0.1300 | 1.4906 |
| 338.15 | 0.1100 | 1.488 |
| 348.15 | 0.1600 | 1.547 |
| 348.15 | 0.1400 | 1.4934 |
| 348.15 | 0.1300 | 1.4863 |
| 348.15 | 0.1100 | 1.4841 |
| 358.15 | 0.1600 | 1.5429 |
| 358.15 | 0.1400 | 1.4903 |
| 358.15 | 0.1300 | 1.4822 |
| 358.15 | 0.1100 | 1.4799 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Methyltriphenylphosphonium bromide (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.1600 | 1.5664 |
| 298.15 | 0.1400 | 1.5119 |
| 298.15 | 0.1300 | 1.5059 |
| 298.15 | 0.1100 | 1.5027 |
| 308.15 | 0.1600 | 1.5625 |
| 308.15 | 0.1400 | 1.5079 |
| 308.15 | 0.1300 | 1.5022 |
| 308.15 | 0.1100 | 1.4991 |
| 318.15 | 0.1600 | 1.5585 |
| 318.15 | 0.1400 | 1.505 |
| 318.15 | 0.1300 | 1.4993 |
| 318.15 | 0.1100 | 1.4955 |
| 328.15 | 0.1600 | 1.5552 |
| 328.15 | 0.1400 | 1.5007 |
| 328.15 | 0.1300 | 1.4952 |
| 328.15 | 0.1100 | 1.4922 |
| 338.15 | 0.1600 | 1.5516 |
| 338.15 | 0.1400 | 1.4973 |
| 338.15 | 0.1300 | 1.4906 |
| 338.15 | 0.1100 | 1.488 |
| 348.15 | 0.1600 | 1.547 |
| 348.15 | 0.1400 | 1.4934 |
| 348.15 | 0.1300 | 1.4863 |
| 348.15 | 0.1100 | 1.4841 |
| 358.15 | 0.1600 | 1.5429 |
| 358.15 | 0.1400 | 1.4903 |
| 358.15 | 0.1300 | 1.4822 |
| 358.15 | 0.1100 | 1.4799 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Methyltriphenylphosphonium bromide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.1600 | 1195.8 |
| 298.15 | 0.1400 | 1107.4 |
| 298.15 | 0.1300 | 1099.8 |
| 298.15 | 0.1100 | 1092.9 |
| 308.15 | 0.1600 | 1187.9 |
| 308.15 | 0.1400 | 1100.0 |
| 308.15 | 0.1300 | 1091.9 |
| 308.15 | 0.1100 | 1085.0 |
| 318.15 | 0.1600 | 1180.1 |
| 318.15 | 0.1400 | 1092.2 |
| 318.15 | 0.1300 | 1083.8 |
| 318.15 | 0.1100 | 1077.1 |
| 328.15 | 0.1600 | 1172.3 |
| 328.15 | 0.1400 | 1084.2 |
| 328.15 | 0.1300 | 1075.8 |
| 328.15 | 0.1100 | 1068.9 |
| 338.15 | 0.1600 | 1164.5 |
| 338.15 | 0.1400 | 1076.1 |
| 338.15 | 0.1300 | 1067.6 |
| 338.15 | 0.1100 | 1060.8 |
| 348.15 | 0.1600 | 1156.6 |
| 348.15 | 0.1400 | 1068.0 |
| 348.15 | 0.1300 | 1059.4 |
| 348.15 | 0.1100 | 1052.7 |
| 358.15 | 0.1600 | 1148.8 |
| 358.15 | 0.1400 | 1059.8 |
| 358.15 | 0.1300 | 1051.1 |
| 358.15 | 0.1100 | 1044.7 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Methyltriphenylphosphonium bromide (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.1600 | 1195.8 |
| 298.15 | 0.1400 | 1107.4 |
| 298.15 | 0.1300 | 1099.8 |
| 298.15 | 0.1100 | 1092.9 |
| 308.15 | 0.1600 | 1187.9 |
| 308.15 | 0.1400 | 1100.0 |
| 308.15 | 0.1300 | 1091.9 |
| 308.15 | 0.1100 | 1085.0 |
| 318.15 | 0.1600 | 1180.1 |
| 318.15 | 0.1400 | 1092.2 |
| 318.15 | 0.1300 | 1083.8 |
| 318.15 | 0.1100 | 1077.1 |
| 328.15 | 0.1600 | 1172.3 |
| 328.15 | 0.1400 | 1084.2 |
| 328.15 | 0.1300 | 1075.8 |
| 328.15 | 0.1100 | 1068.9 |
| 338.15 | 0.1600 | 1164.5 |
| 338.15 | 0.1400 | 1076.1 |
| 338.15 | 0.1300 | 1067.6 |
| 338.15 | 0.1100 | 1060.8 |
| 348.15 | 0.1600 | 1156.6 |
| 348.15 | 0.1400 | 1068.0 |
| 348.15 | 0.1300 | 1059.4 |
| 348.15 | 0.1100 | 1052.7 |
| 358.15 | 0.1600 | 1148.8 |
| 358.15 | 0.1400 | 1059.8 |
| 358.15 | 0.1300 | 1051.1 |
| 358.15 | 0.1100 | 1044.7 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Methyltriphenylphosphonium bromide (2) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 298.15 | 0.1600 | 0.0489 |
| 298.15 | 0.1400 | 0.0493 |
| 298.15 | 0.1300 | 0.0502 |
| 298.15 | 0.1100 | 0.0503 |
| 308.15 | 0.1600 | 0.0480 |
| 308.15 | 0.1400 | 0.0484 |
| 308.15 | 0.1300 | 0.0493 |
| 308.15 | 0.1100 | 0.0495 |
| 318.15 | 0.1600 | 0.0472 |
| 318.15 | 0.1400 | 0.0476 |
| 318.15 | 0.1300 | 0.0482 |
| 318.15 | 0.1100 | 0.0486 |
| 328.15 | 0.1600 | 0.0464 |
| 328.15 | 0.1400 | 0.0467 |
| 328.15 | 0.1300 | 0.0472 |
| 328.15 | 0.1100 | 0.0478 |
| 338.15 | 0.1600 | 0.0456 |
| 338.15 | 0.1400 | 0.0459 |
| 338.15 | 0.1300 | 0.0463 |
| 338.15 | 0.1100 | 0.0469 |
| 348.15 | 0.1600 | 0.0448 |
| 348.15 | 0.1400 | 0.0449 |
| 348.15 | 0.1300 | 0.0453 |
| 348.15 | 0.1100 | 0.0462 |
| 358.15 | 0.1600 | 0.0440 |
| 358.15 | 0.1400 | 0.0442 |
| 358.15 | 0.1300 | 0.0444 |
| 358.15 | 0.1100 | 0.0453 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Methyltriphenylphosphonium bromide (2) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 298.15 | 0.1600 | 0.0489 |
| 298.15 | 0.1400 | 0.0493 |
| 298.15 | 0.1300 | 0.0502 |
| 298.15 | 0.1100 | 0.0503 |
| 308.15 | 0.1600 | 0.0480 |
| 308.15 | 0.1400 | 0.0484 |
| 308.15 | 0.1300 | 0.0493 |
| 308.15 | 0.1100 | 0.0495 |
| 318.15 | 0.1600 | 0.0472 |
| 318.15 | 0.1400 | 0.0476 |
| 318.15 | 0.1300 | 0.0482 |
| 318.15 | 0.1100 | 0.0486 |
| 328.15 | 0.1600 | 0.0464 |
| 328.15 | 0.1400 | 0.0467 |
| 328.15 | 0.1300 | 0.0472 |
| 328.15 | 0.1100 | 0.0478 |
| 338.15 | 0.1600 | 0.0456 |
| 338.15 | 0.1400 | 0.0459 |
| 338.15 | 0.1300 | 0.0463 |
| 338.15 | 0.1100 | 0.0469 |
| 348.15 | 0.1600 | 0.0448 |
| 348.15 | 0.1400 | 0.0449 |
| 348.15 | 0.1300 | 0.0453 |
| 348.15 | 0.1100 | 0.0462 |
| 358.15 | 0.1600 | 0.0440 |
| 358.15 | 0.1400 | 0.0442 |
| 358.15 | 0.1300 | 0.0444 |
| 358.15 | 0.1100 | 0.0453 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Amount ratio of solute to solvent of Monoethanolamine (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 6.0 | 277.67 |
| 7.0 | 272.81 |
| 8.0 | 272.21 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Amount ratio of solute to solvent of Monoethanolamine (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 6.0 | 277.67 |
| 7.0 | 272.81 |
| 8.0 | 272.21 |