- Name
- 1,2-Benzenediol
- InChI
- InChI=1S/C6H6O2/c7-5-3-1-2-4-6(5)8/h1-4,7-8H
- InChI Key
- YCIMNLLNPGFGHC-UHFFFAOYSA-N
- Formula
- C6H6O2
- SMILES
- Oc1ccccc1O
- Mol. Weight (g/mol)
- 110.11
- CAS
- 120-80-9
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of 1,2-Benzenediol (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of 1,2-Benzenediol (1) - Liquid |
| 298.15 | 101.00 | 0.1230 |
Mole fraction of Water (2) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Water (2) - Liquid |
|---|---|
| 293.15 | 0.9058 |
| 298.15 | 0.8771 |
| 303.15 | 0.8432 |
| 308.15 | 0.8077 |
| 313.15 | 0.7523 |
| 318.15 | 0.7108 |
| 323.15 | 0.6550 |
Mass fraction of 1,2-Benzenediol (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mass fraction of 1,2-Benzenediol (1) - Liquid |
|---|---|
| 303.15 | 0.4850 |
| 328.15 | 0.7635 |
Mole fraction of 1,2-Benzenediol (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of 1,2-Benzenediol (1) - Liquid |
| 298.15 | 101.00 | 0.1230 |
Mole fraction of Water (2) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Water (2) - Liquid |
|---|---|
| 293.15 | 0.9058 |
| 298.15 | 0.8771 |
| 303.15 | 0.8432 |
| 308.15 | 0.8077 |
| 313.15 | 0.7523 |
| 318.15 | 0.7108 |
| 323.15 | 0.6550 |
Mass fraction of 1,2-Benzenediol (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mass fraction of 1,2-Benzenediol (1) - Liquid |
|---|---|
| 303.15 | 0.4850 |
| 328.15 | 0.7635 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Amount concentration (molarity), mol/dm3 of 1,2-Benzenediol (1) - Liquid | Mass density, kg/m3 - Liquid |
| 283.15 | 0.0000 | 999.749 |
| 283.15 | 0.0354 | 1000.623 |
| 283.15 | 0.1697 | 1003.897 |
| 283.15 | 0.3460 | 1008.132 |
| 283.15 | 0.4721 | 1011.093 |
| 283.15 | 0.5008 | 1011.777 |
| 283.15 | 0.6589 | 1015.399 |
| 283.15 | 0.7524 | 1017.526 |
| 293.15 | 0.0000 | 998.252 |
| 293.15 | 0.0354 | 999.093 |
| 293.15 | 0.1697 | 1002.239 |
| 293.15 | 0.3460 | 1006.299 |
| 293.15 | 0.4721 | 1009.136 |
| 293.15 | 0.5008 | 1009.794 |
| 293.15 | 0.6589 | 1013.259 |
| 293.15 | 0.7524 | 1015.295 |
| 298.15 | 0.0000 | 997.093 |
| 298.15 | 0.0354 | 997.92 |
| 298.15 | 0.1697 | 1001.009 |
| 298.15 | 0.3460 | 1004.993 |
| 298.15 | 0.4721 | 1007.776 |
| 298.15 | 0.5008 | 1008.417 |
| 298.15 | 0.6589 | 1011.815 |
| 298.15 | 0.7524 | 1013.811 |
| 303.15 | 0.0000 | 995.699 |
| 303.15 | 0.0354 | 996.509 |
| 303.15 | 0.1697 | 999.543 |
| 303.15 | 0.3460 | 1003.456 |
| 303.15 | 0.4721 | 1006.187 |
| 303.15 | 0.5008 | 1006.818 |
| 303.15 | 0.6589 | 1010.151 |
| 303.15 | 0.7524 | 1012.109 |
| 313.15 | 0.0000 | 992.273 |
| 313.15 | 0.0354 | 993.058 |
| 313.15 | 0.1697 | 995.992 |
| 313.15 | 0.3460 | 999.774 |
| 313.15 | 0.4721 | 1002.408 |
| 313.15 | 0.5008 | 1003.02 |
| 313.15 | 0.6589 | 1006.232 |
| 313.15 | 0.7524 | 1008.122 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Amount concentration (molarity), mol/dm3 of 1,2-Benzenediol (1) - Liquid | Mass density, kg/m3 - Liquid |
| 283.15 | 0.0000 | 999.749 |
| 283.15 | 0.0354 | 1000.623 |
| 283.15 | 0.1697 | 1003.897 |
| 283.15 | 0.3460 | 1008.132 |
| 283.15 | 0.4721 | 1011.093 |
| 283.15 | 0.5008 | 1011.777 |
| 283.15 | 0.6589 | 1015.399 |
| 283.15 | 0.7524 | 1017.526 |
| 293.15 | 0.0000 | 998.252 |
| 293.15 | 0.0354 | 999.093 |
| 293.15 | 0.1697 | 1002.239 |
| 293.15 | 0.3460 | 1006.299 |
| 293.15 | 0.4721 | 1009.136 |
| 293.15 | 0.5008 | 1009.794 |
| 293.15 | 0.6589 | 1013.259 |
| 293.15 | 0.7524 | 1015.295 |
| 298.15 | 0.0000 | 997.093 |
| 298.15 | 0.0354 | 997.92 |
| 298.15 | 0.1697 | 1001.009 |
| 298.15 | 0.3460 | 1004.993 |
| 298.15 | 0.4721 | 1007.776 |
| 298.15 | 0.5008 | 1008.417 |
| 298.15 | 0.6589 | 1011.815 |
| 298.15 | 0.7524 | 1013.811 |
| 303.15 | 0.0000 | 995.699 |
| 303.15 | 0.0354 | 996.509 |
| 303.15 | 0.1697 | 999.543 |
| 303.15 | 0.3460 | 1003.456 |
| 303.15 | 0.4721 | 1006.187 |
| 303.15 | 0.5008 | 1006.818 |
| 303.15 | 0.6589 | 1010.151 |
| 303.15 | 0.7524 | 1012.109 |
| 313.15 | 0.0000 | 992.273 |
| 313.15 | 0.0354 | 993.058 |
| 313.15 | 0.1697 | 995.992 |
| 313.15 | 0.3460 | 999.774 |
| 313.15 | 0.4721 | 1002.408 |
| 313.15 | 0.5008 | 1003.02 |
| 313.15 | 0.6589 | 1006.232 |
| 313.15 | 0.7524 | 1008.122 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Amount concentration (molarity), mol/dm3 of 1,2-Benzenediol (1) - Liquid | Speed of sound, m/s - Liquid |
| 283.15 | 0.0000 | 1447.74 |
| 283.15 | 0.0354 | 1449.93 |
| 283.15 | 0.1697 | 1457.86 |
| 283.15 | 0.3460 | 1467.86 |
| 283.15 | 0.4721 | 1474.5 |
| 283.15 | 0.5008 | 1476.53 |
| 283.15 | 0.6589 | 1483.97 |
| 283.15 | 0.7524 | 1488.49 |
| 293.15 | 0.0000 | 1482.32 |
| 293.15 | 0.0354 | 1484.09 |
| 293.15 | 0.1697 | 1490.57 |
| 293.15 | 0.3460 | 1498.73 |
| 293.15 | 0.4721 | 1504.14 |
| 293.15 | 0.5008 | 1505.37 |
| 293.15 | 0.6589 | 1511.8 |
| 293.15 | 0.7524 | 1515.42 |
| 298.15 | 0.0000 | 1496.63 |
| 298.15 | 0.0354 | 1498.2 |
| 298.15 | 0.1697 | 1504.04 |
| 298.15 | 0.3460 | 1511.36 |
| 298.15 | 0.4721 | 1516.2 |
| 298.15 | 0.5008 | 1517.3 |
| 298.15 | 0.6589 | 1523.05 |
| 298.15 | 0.7524 | 1526.28 |
| 303.15 | 0.0000 | 1509.05 |
| 303.15 | 0.0354 | 1510.46 |
| 303.15 | 0.1697 | 1515.69 |
| 303.15 | 0.3460 | 1522.24 |
| 303.15 | 0.4721 | 1526.57 |
| 303.15 | 0.5008 | 1527.55 |
| 303.15 | 0.6589 | 1532.66 |
| 303.15 | 0.7524 | 1535.53 |
| 313.15 | 0.0000 | 1528.81 |
| 313.15 | 0.0354 | 1529.93 |
| 313.15 | 0.1697 | 1534.07 |
| 313.15 | 0.3460 | 1539.22 |
| 313.15 | 0.4721 | 1542.6 |
| 313.15 | 0.5008 | 1543.36 |
| 313.15 | 0.6589 | 1547.32 |
| 313.15 | 0.7524 | 1549.53 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Amount concentration (molarity), mol/dm3 of 1,2-Benzenediol (1) - Liquid | Speed of sound, m/s - Liquid |
| 283.15 | 0.0000 | 1447.74 |
| 283.15 | 0.0354 | 1449.93 |
| 283.15 | 0.1697 | 1457.86 |
| 283.15 | 0.3460 | 1467.86 |
| 283.15 | 0.4721 | 1474.5 |
| 283.15 | 0.5008 | 1476.53 |
| 283.15 | 0.6589 | 1483.97 |
| 283.15 | 0.7524 | 1488.49 |
| 293.15 | 0.0000 | 1482.32 |
| 293.15 | 0.0354 | 1484.09 |
| 293.15 | 0.1697 | 1490.57 |
| 293.15 | 0.3460 | 1498.73 |
| 293.15 | 0.4721 | 1504.14 |
| 293.15 | 0.5008 | 1505.37 |
| 293.15 | 0.6589 | 1511.8 |
| 293.15 | 0.7524 | 1515.42 |
| 298.15 | 0.0000 | 1496.63 |
| 298.15 | 0.0354 | 1498.2 |
| 298.15 | 0.1697 | 1504.04 |
| 298.15 | 0.3460 | 1511.36 |
| 298.15 | 0.4721 | 1516.2 |
| 298.15 | 0.5008 | 1517.3 |
| 298.15 | 0.6589 | 1523.05 |
| 298.15 | 0.7524 | 1526.28 |
| 303.15 | 0.0000 | 1509.05 |
| 303.15 | 0.0354 | 1510.46 |
| 303.15 | 0.1697 | 1515.69 |
| 303.15 | 0.3460 | 1522.24 |
| 303.15 | 0.4721 | 1526.57 |
| 303.15 | 0.5008 | 1527.55 |
| 303.15 | 0.6589 | 1532.66 |
| 303.15 | 0.7524 | 1535.53 |
| 313.15 | 0.0000 | 1528.81 |
| 313.15 | 0.0354 | 1529.93 |
| 313.15 | 0.1697 | 1534.07 |
| 313.15 | 0.3460 | 1539.22 |
| 313.15 | 0.4721 | 1542.6 |
| 313.15 | 0.5008 | 1543.36 |
| 313.15 | 0.6589 | 1547.32 |
| 313.15 | 0.7524 | 1549.53 |
Sources
- Extraction of phenolic compounds from aqueous solution using choline bis(trifluoromethylsulfonyl)imide
- Phase equilibria of phenolic compounds in water or ethanol
- Effects of structural isomerism on solution behaviour of solutes: Apparent molar volumes and isentropic compression of catechol, resorcinal, and hydroquinone in aqueous solution at T = (283.15, 293.15, 298.15, 303.15, and 313.15) K
- Liquid-Liquid Equilibrium of Water + 2-Methoxyphenol + Methyl Isobutyl Ketone and Water + 1,2-Benzenediol + Methyl Isobutyl Ketone at 303.15 K and 328.15 K