- Name
- 1-Octen-3-ol
- InChI
- InChI=1S/C8H16O/c1-3-5-6-7-8(9)4-2/h4,8-9H,2-3,5-7H2,1H3
- InChI Key
- VSMOENVRRABVKN-UHFFFAOYSA-N
- Formula
- C8H16O
- SMILES
- C=CC(O)CCCCC
- Mol. Weight (g/mol)
- 128.21
- CAS
- 3391-86-4
- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of 1-Octen-3-ol (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of 1-Octen-3-ol (1) - Fluid (supercritical or subcritical phases) |
| 318.15 | 8000.00 | 0.0011 |
| 318.15 | 8500.00 | 0.0014 |
| 318.15 | 9000.00 | 0.0029 |
| 318.15 | 9500.00 | 0.0042 |
| 318.15 | 10000.00 | 0.0062 |
| 328.15 | 8000.00 | 0.0009 |
| 328.15 | 8500.00 | 0.0011 |
| 328.15 | 9000.00 | 0.0018 |
| 328.15 | 9500.00 | 0.0021 |
| 328.15 | 10000.00 | 0.0032 |
| 328.15 | 10500.00 | 0.0075 |
| 338.15 | 8000.00 | 0.0007 |
| 338.15 | 9000.00 | 0.0014 |
| 338.15 | 9500.00 | 0.0020 |
| 338.15 | 10000.00 | 0.0024 |
| 338.15 | 10500.00 | 0.0035 |
| 338.15 | 11000.00 | 0.0078 |
Mole fraction of 1-Octen-3-ol (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of 1-Octen-3-ol (1) - Fluid (supercritical or subcritical phases) |
| 318.15 | 8000.00 | 0.0011 |
| 318.15 | 8500.00 | 0.0014 |
| 318.15 | 9000.00 | 0.0029 |
| 318.15 | 9500.00 | 0.0042 |
| 318.15 | 10000.00 | 0.0062 |
| 328.15 | 8000.00 | 0.0009 |
| 328.15 | 8500.00 | 0.0011 |
| 328.15 | 9000.00 | 0.0018 |
| 328.15 | 9500.00 | 0.0021 |
| 328.15 | 10000.00 | 0.0032 |
| 328.15 | 10500.00 | 0.0075 |
| 338.15 | 8000.00 | 0.0007 |
| 338.15 | 9000.00 | 0.0014 |
| 338.15 | 9500.00 | 0.0020 |
| 338.15 | 10000.00 | 0.0024 |
| 338.15 | 10500.00 | 0.0035 |
| 338.15 | 11000.00 | 0.0078 |