- Name
- Adenosine
- InChI
- InChI=1S/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13)
- InChI Key
- OIRDTQYFTABQOQ-UHFFFAOYSA-N
- Formula
- C10H13N5O4
- SMILES
- Nc1ncnc2c1ncn2C1OC(CO)C(O)C1O
- Mol. Weight (g/mol)
- 267.24
- CAS
- 58-61-7
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (2)
- Apparent molar heat capacity, J/K/mol (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (4)
Mole fraction of Adenosine (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Adenosine (1) - Liquid |
|---|---|
| 278.15 | 0.0002 |
| 283.15 | 0.0002 |
| 288.15 | 0.0003 |
| 293.15 | 0.0004 |
| 298.15 | 0.0004 |
| 303.15 | 0.0005 |
| 308.15 | 0.0006 |
| 313.15 | 0.0007 |
| 318.15 | 0.0009 |
| 323.15 | 0.0010 |
Mole fraction of Adenosine (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Adenosine (1) - Liquid |
|---|---|
| 278.15 | 0.0002 |
| 283.15 | 0.0002 |
| 288.15 | 0.0003 |
| 293.15 | 0.0004 |
| 298.15 | 0.0004 |
| 303.15 | 0.0005 |
| 308.15 | 0.0006 |
| 313.15 | 0.0007 |
| 318.15 | 0.0009 |
| 323.15 | 0.0010 |
Apparent molar heat capacity, J/K/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Molality, mol/kg of Adenosine (1) - Liquid | Apparent molar heat capacity, J/K/mol - Liquid |
|---|---|
| 0.0160 | 483.2 |
| 0.0170 | 488.0 |
| 0.0180 | 487.4 |
| 0.0190 | 491.7 |
| 0.0194 | 486.7 |
| 0.0200 | 489.8 |
| 0.0210 | 488.4 |
| 0.0217 | 489.9 |
| 0.0220 | 487.5 |
Apparent molar heat capacity, J/K/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Molality, mol/kg of Adenosine (1) - Liquid | Apparent molar heat capacity, J/K/mol - Liquid |
|---|---|
| 0.0160 | 483.2 |
| 0.0170 | 488.0 |
| 0.0180 | 487.4 |
| 0.0190 | 491.7 |
| 0.0194 | 486.7 |
| 0.0200 | 489.8 |
| 0.0210 | 488.4 |
| 0.0217 | 489.9 |
| 0.0220 | 487.5 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Adenosine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0133 | 1000.402 |
| 288.15 | 0.0140 | 1000.468 |
| 288.15 | 0.0149 | 1000.561 |
| 288.15 | 0.0161 | 1000.682 |
| 288.15 | 0.0171 | 1000.774 |
| 288.15 | 0.0180 | 1000.857 |
| 288.15 | 0.0188 | 1000.936 |
| 288.15 | 0.0189 | 1000.951 |
| 288.15 | 0.0194 | 1000.997 |
| 298.15 | 0.0150 | 998.486 |
| 298.15 | 0.0160 | 998.58 |
| 298.15 | 0.0170 | 998.686 |
| 298.15 | 0.0180 | 998.767 |
| 298.15 | 0.0190 | 998.864 |
| 298.15 | 0.0194 | 998.902 |
| 298.15 | 0.0200 | 998.965 |
| 298.15 | 0.0210 | 999.055 |
| 298.15 | 0.0217 | 999.129 |
| 298.15 | 0.0220 | 999.151 |
| 303.15 | 0.0133 | 996.913 |
| 303.15 | 0.0140 | 996.975 |
| 303.15 | 0.0150 | 997.076 |
| 303.15 | 0.0155 | 997.117 |
| 303.15 | 0.0161 | 997.185 |
| 303.15 | 0.0171 | 997.271 |
| 303.15 | 0.0180 | 997.354 |
| 303.15 | 0.0189 | 997.445 |
| 303.15 | 0.0190 | 997.455 |
| 303.15 | 0.0194 | 997.495 |
| 313.15 | 0.0130 | 993.43 |
| 313.15 | 0.0135 | 993.47 |
| 313.15 | 0.0140 | 993.522 |
| 313.15 | 0.0150 | 993.616 |
| 313.15 | 0.0160 | 993.707 |
| 313.15 | 0.0170 | 993.802 |
| 313.15 | 0.0180 | 993.896 |
| 313.15 | 0.0188 | 993.976 |
| 313.15 | 0.0200 | 994.077 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Adenosine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0133 | 1000.402 |
| 288.15 | 0.0140 | 1000.468 |
| 288.15 | 0.0149 | 1000.561 |
| 288.15 | 0.0161 | 1000.682 |
| 288.15 | 0.0171 | 1000.774 |
| 288.15 | 0.0180 | 1000.857 |
| 288.15 | 0.0188 | 1000.936 |
| 288.15 | 0.0189 | 1000.951 |
| 288.15 | 0.0194 | 1000.997 |
| 298.15 | 0.0150 | 998.486 |
| 298.15 | 0.0160 | 998.58 |
| 298.15 | 0.0170 | 998.686 |
| 298.15 | 0.0180 | 998.767 |
| 298.15 | 0.0190 | 998.864 |
| 298.15 | 0.0194 | 998.902 |
| 298.15 | 0.0200 | 998.965 |
| 298.15 | 0.0210 | 999.055 |
| 298.15 | 0.0217 | 999.129 |
| 298.15 | 0.0220 | 999.151 |
| 303.15 | 0.0133 | 996.913 |
| 303.15 | 0.0140 | 996.975 |
| 303.15 | 0.0150 | 997.076 |
| 303.15 | 0.0155 | 997.117 |
| 303.15 | 0.0161 | 997.185 |
| 303.15 | 0.0171 | 997.271 |
| 303.15 | 0.0180 | 997.354 |
| 303.15 | 0.0189 | 997.445 |
| 303.15 | 0.0190 | 997.455 |
| 303.15 | 0.0194 | 997.495 |
| 313.15 | 0.0130 | 993.43 |
| 313.15 | 0.0135 | 993.47 |
| 313.15 | 0.0140 | 993.522 |
| 313.15 | 0.0150 | 993.616 |
| 313.15 | 0.0160 | 993.707 |
| 313.15 | 0.0170 | 993.802 |
| 313.15 | 0.0180 | 993.896 |
| 313.15 | 0.0188 | 993.976 |
| 313.15 | 0.0200 | 994.077 |
Speed of sound, m/s [ref]
Operational condition: Temperature, K = 298.15 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Molality, mol/kg of Adenosine (1) - Liquid | Speed of sound, m/s - Liquid |
| 10000.00 | 0.0201 | 1514.61 |
| 10000.00 | 0.0196 | 1514.58 |
| 10000.00 | 0.0193 | 1514.6 |
| 10000.00 | 0.0191 | 1514.54 |
| 10000.00 | 0.0188 | 1514.54 |
| 10000.00 | 0.0184 | 1514.53 |
| 10000.00 | 0.0178 | 1514.45 |
| 20000.00 | 0.0201 | 1531.39 |
| 20000.00 | 0.0196 | 1531.38 |
| 20000.00 | 0.0193 | 1531.36 |
| 20000.00 | 0.0191 | 1531.34 |
| 20000.00 | 0.0188 | 1531.31 |
| 20000.00 | 0.0184 | 1531.29 |
| 20000.00 | 0.0178 | 1531.26 |
| 40000.00 | 0.0201 | 1564.96 |
| 40000.00 | 0.0196 | 1564.96 |
| 40000.00 | 0.0193 | 1564.97 |
| 40000.00 | 0.0191 | 1564.9 |
| 40000.00 | 0.0188 | 1564.91 |
| 40000.00 | 0.0184 | 1564.89 |
| 40000.00 | 0.0178 | 1564.83 |
| 60000.00 | 0.0201 | 1598.46 |
| 60000.00 | 0.0196 | 1598.46 |
| 60000.00 | 0.0193 | 1598.42 |
| 60000.00 | 0.0191 | 1598.42 |
| 60000.00 | 0.0188 | 1598.41 |
| 60000.00 | 0.0184 | 1598.39 |
| 60000.00 | 0.0178 | 1598.33 |
| 80000.00 | 0.0201 | 1631.79 |
| 80000.00 | 0.0196 | 1631.83 |
| 80000.00 | 0.0193 | 1631.79 |
| 80000.00 | 0.0191 | 1631.78 |
| 80000.00 | 0.0188 | 1631.75 |
| 80000.00 | 0.0184 | 1631.72 |
| 80000.00 | 0.0178 | 1631.66 |
| 100000.00 | 0.0201 | 1664.99 |
| 100000.00 | 0.0196 | 1664.98 |
| 100000.00 | 0.0193 | 1664.95 |
| 100000.00 | 0.0191 | 1664.94 |
| 100000.00 | 0.0188 | 1664.93 |
| 100000.00 | 0.0184 | 1664.92 |
| 100000.00 | 0.0178 | 1664.85 |
| 120000.00 | 0.0201 | 1697.82 |
| 120000.00 | 0.0196 | 1697.81 |
| 120000.00 | 0.0193 | 1697.77 |
| 120000.00 | 0.0191 | 1697.76 |
| 120000.00 | 0.0188 | 1697.74 |
| 120000.00 | 0.0184 | 1697.72 |
| 120000.00 | 0.0178 | 1697.67 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Molality, mol/kg of Adenosine (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0170 | 1497.775 |
| 0.0174 | 1497.796 |
| 0.0180 | 1497.835 |
| 0.0185 | 1497.868 |
| 0.0191 | 1497.903 |
| 0.0195 | 1497.934 |
| 0.0200 | 1497.965 |
| 0.0205 | 1497.996 |
Speed of sound, m/s [ref]
Operational condition: Temperature, K = 298.15 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Molality, mol/kg of Adenosine (1) - Liquid | Speed of sound, m/s - Liquid |
| 10000.00 | 0.0201 | 1514.61 |
| 10000.00 | 0.0196 | 1514.58 |
| 10000.00 | 0.0193 | 1514.6 |
| 10000.00 | 0.0191 | 1514.54 |
| 10000.00 | 0.0188 | 1514.54 |
| 10000.00 | 0.0184 | 1514.53 |
| 10000.00 | 0.0178 | 1514.45 |
| 20000.00 | 0.0201 | 1531.39 |
| 20000.00 | 0.0196 | 1531.38 |
| 20000.00 | 0.0193 | 1531.36 |
| 20000.00 | 0.0191 | 1531.34 |
| 20000.00 | 0.0188 | 1531.31 |
| 20000.00 | 0.0184 | 1531.29 |
| 20000.00 | 0.0178 | 1531.26 |
| 40000.00 | 0.0201 | 1564.96 |
| 40000.00 | 0.0196 | 1564.96 |
| 40000.00 | 0.0193 | 1564.97 |
| 40000.00 | 0.0191 | 1564.9 |
| 40000.00 | 0.0188 | 1564.91 |
| 40000.00 | 0.0184 | 1564.89 |
| 40000.00 | 0.0178 | 1564.83 |
| 60000.00 | 0.0201 | 1598.46 |
| 60000.00 | 0.0196 | 1598.46 |
| 60000.00 | 0.0193 | 1598.42 |
| 60000.00 | 0.0191 | 1598.42 |
| 60000.00 | 0.0188 | 1598.41 |
| 60000.00 | 0.0184 | 1598.39 |
| 60000.00 | 0.0178 | 1598.33 |
| 80000.00 | 0.0201 | 1631.79 |
| 80000.00 | 0.0196 | 1631.83 |
| 80000.00 | 0.0193 | 1631.79 |
| 80000.00 | 0.0191 | 1631.78 |
| 80000.00 | 0.0188 | 1631.75 |
| 80000.00 | 0.0184 | 1631.72 |
| 80000.00 | 0.0178 | 1631.66 |
| 100000.00 | 0.0201 | 1664.99 |
| 100000.00 | 0.0196 | 1664.98 |
| 100000.00 | 0.0193 | 1664.95 |
| 100000.00 | 0.0191 | 1664.94 |
| 100000.00 | 0.0188 | 1664.93 |
| 100000.00 | 0.0184 | 1664.92 |
| 100000.00 | 0.0178 | 1664.85 |
| 120000.00 | 0.0201 | 1697.82 |
| 120000.00 | 0.0196 | 1697.81 |
| 120000.00 | 0.0193 | 1697.77 |
| 120000.00 | 0.0191 | 1697.76 |
| 120000.00 | 0.0188 | 1697.74 |
| 120000.00 | 0.0184 | 1697.72 |
| 120000.00 | 0.0178 | 1697.67 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Molality, mol/kg of Adenosine (1) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0170 | 1497.775 |
| 0.0174 | 1497.796 |
| 0.0180 | 1497.835 |
| 0.0185 | 1497.868 |
| 0.0191 | 1497.903 |
| 0.0195 | 1497.934 |
| 0.0200 | 1497.965 |
| 0.0205 | 1497.996 |
Sources
- The partial molar volumes at T = (288.15 to 313.15) K, and the partial molar heat capacities and expansions at T = 298.15 K of cytidine, uridine, and adenosine in aqueous solution
- Volumetric properties of the nucleosides adenosine, cytidine, and uridine in aqueous solution at T=298.15K and P=(10 to120)MPa
- Equilibrium solubility, dissolution thermodynamics and preferential solvation of adenosine in aqueous solutions of N,N-dimethylformamide, N-methyl-2-pyrrolidone, dimethylsulfoxide and propylene glycol
- Partial Molar Isentropic and Isothermal Compressions of the Nucleosides Adenosine, Cytidine, and Uridine in Aqueous Solution at 298.15 K