- Name
- 1,4-Cyclohexanedione
- InChI
- InChI=1S/C6H8O2/c7-5-1-2-6(8)4-3-5/h1-4H2
- InChI Key
- DCZFGQYXRKMVFG-UHFFFAOYSA-N
- Formula
- C6H8O2
- SMILES
- O=C1CCC(=O)CC1
- Mol. Weight (g/mol)
- 112.13
- CAS
- 637-88-7
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Partial molar volume, m3/mol of 1,4-Cyclohexanedione (1) [ref]
Operational condition: Mole fraction = 0 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Partial molar volume, m3/mol of 1,4-Cyclohexanedione (1) - Liquid |
| 298.17 | 15050.00 | 0.0001 |
| 298.17 | 30010.00 | 0.0001 |
| 318.14 | 15050.00 | 0.0001 |
| 318.14 | 30020.00 | 0.0001 |
| 338.18 | 15050.00 | 0.0001 |
| 338.18 | 30080.00 | 0.0001 |
| 358.14 | 15040.00 | 0.0001 |
| 358.14 | 30020.00 | 0.0001 |
| 373.17 | 15030.00 | 0.0001 |
| 373.17 | 30030.00 | 0.0001 |
| 398.17 | 1980.00 | 0.0001 |
| 398.17 | 15050.00 | 0.0001 |
| 398.17 | 30020.00 | 0.0001 |
| 423.18 | 1980.00 | 0.0001 |
| 423.18 | 15040.00 | 0.0001 |
| 423.18 | 30020.00 | 0.0001 |
| 448.15 | 1990.00 | 0.0001 |
| 448.15 | 15050.00 | 0.0001 |
| 448.15 | 30030.00 | 0.0001 |
| 473.16 | 1970.00 | 0.0001 |
| 473.16 | 15020.00 | 0.0001 |
| 473.16 | 30050.00 | 0.0001 |
| 498.14 | 30000.00 | 0.0001 |
| 498.15 | 2940.00 | 0.0001 |
| 498.16 | 15050.00 | 0.0001 |
| 523.15 | 5120.00 | 0.0001 |
| 523.16 | 15070.00 | 0.0001 |
| 523.17 | 30200.00 | 0.0001 |
| 548.24 | 30340.00 | 0.0001 |
| 548.25 | 15200.00 | 0.0001 |
| 548.26 | 7170.00 | 0.0001 |
| 573.16 | 9970.00 | 0.0001 |
| 573.16 | 30110.00 | 0.0001 |
| 573.17 | 15170.00 | 0.0001 |
Partial molar volume, m3/mol of 1,4-Cyclohexanedione (1) [ref]
Operational condition: Mole fraction = 0 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Partial molar volume, m3/mol of 1,4-Cyclohexanedione (1) - Liquid |
| 298.17 | 15050.00 | 0.0001 |
| 298.17 | 30010.00 | 0.0001 |
| 318.14 | 15050.00 | 0.0001 |
| 318.14 | 30020.00 | 0.0001 |
| 338.18 | 15050.00 | 0.0001 |
| 338.18 | 30080.00 | 0.0001 |
| 358.14 | 15040.00 | 0.0001 |
| 358.14 | 30020.00 | 0.0001 |
| 373.17 | 15030.00 | 0.0001 |
| 373.17 | 30030.00 | 0.0001 |
| 398.17 | 1980.00 | 0.0001 |
| 398.17 | 15050.00 | 0.0001 |
| 398.17 | 30020.00 | 0.0001 |
| 423.18 | 1980.00 | 0.0001 |
| 423.18 | 15040.00 | 0.0001 |
| 423.18 | 30020.00 | 0.0001 |
| 448.15 | 1990.00 | 0.0001 |
| 448.15 | 15050.00 | 0.0001 |
| 448.15 | 30030.00 | 0.0001 |
| 473.16 | 1970.00 | 0.0001 |
| 473.16 | 15020.00 | 0.0001 |
| 473.16 | 30050.00 | 0.0001 |
| 498.14 | 30000.00 | 0.0001 |
| 498.15 | 2940.00 | 0.0001 |
| 498.16 | 15050.00 | 0.0001 |
| 523.15 | 5120.00 | 0.0001 |
| 523.16 | 15070.00 | 0.0001 |
| 523.17 | 30200.00 | 0.0001 |
| 548.24 | 30340.00 | 0.0001 |
| 548.25 | 15200.00 | 0.0001 |
| 548.26 | 7170.00 | 0.0001 |
| 573.16 | 9970.00 | 0.0001 |
| 573.16 | 30110.00 | 0.0001 |
| 573.17 | 15170.00 | 0.0001 |