- Name
- 2-Butanone
- InChI
- InChI=1S/C4H8O/c1-3-4(2)5/h3H2,1-2H3
- InChI Key
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N
- Formula
- C4H8O
- SMILES
- CCC(C)=O
- Mol. Weight (g/mol)
- 72.11
- CAS
- 78-93-3
- Name
- sodium chloride
- InChI
- InChI=1S/ClH.Na/h1H;/q;+1/p-1
- InChI Key
- FAPWRFPIFSIZLT-UHFFFAOYSA-M
- Formula
- ClNa
- SMILES
- [Cl-].[Na+]
- Mol. Weight (g/mol)
- 58.44
- CAS
- 7647-14-5
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Molality, mol/kg of 2-Butanone (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Solvent: Molality, mol/kg of sodium chloride (2) - Liquid mixture 1 | Molality, mol/kg of 2-Butanone (1) - Liquid mixture 1 |
| 283.15 | 0.0000 | 4.811 |
| 288.15 | 0.0000 | 4.354 |
| 293.15 | 0.0000 | 3.785 |
| 298.15 | 0.0000 | 3.12 |
| 303.15 | 0.0000 | 2.385 |
| 283.15 | 0.1711 | 4.659 |
| 288.15 | 0.1711 | 3.813 |
| 293.15 | 0.1711 | 3.425 |
| 298.15 | 0.1711 | 2.759 |
| 303.15 | 0.1711 | 2.177 |
| 283.15 | 0.3422 | 3.979 |
| 288.15 | 0.3422 | 3.633 |
| 293.15 | 0.3422 | 3.037 |
| 298.15 | 0.3422 | 2.51 |
| 303.15 | 0.3422 | 2.08 |
| 283.15 | 0.5818 | 3.55 |
| 288.15 | 0.5818 | 3.12 |
| 293.15 | 0.5818 | 2.731 |
| 298.15 | 0.5818 | 2.163 |
| 303.15 | 0.5818 | 1.65 |
Henry's Law constant (mole fraction scale), kPa of 2-Butanone (1) [ref]
Operational condition: Mole fraction = 0 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Molality, mol/kg of sodium chloride (2) - Liquid | Henry's Law constant (mole fraction scale), kPa of 2-Butanone (1) - Liquid |
| 313.00 | 0.0000 | 721.0 |
| 313.00 | 0.2000 | 767.0 |
| 313.00 | 0.4000 | 794.0 |
| 313.00 | 0.6000 | 842.0 |
| 313.00 | 0.8000 | 883.0 |
| 313.00 | 1.0000 | 940.0 |
| 313.00 | 1.2 | 1006.0 |
| 323.00 | 0.0000 | 1167.0 |
| 323.00 | 0.2000 | 1301.0 |
| 323.00 | 0.4000 | 1252.0 |
| 323.00 | 0.6000 | 1362.0 |
| 323.00 | 0.8000 | 1436.0 |
| 323.00 | 1.0000 | 1520.0 |
| 323.00 | 1.2 | 1614.0 |
| 333.00 | 0.0000 | 1775.0 |
| 333.00 | 0.2000 | 1982.0 |
| 333.00 | 0.4000 | 1906.0 |
| 333.00 | 0.6000 | 1965.0 |
| 333.00 | 0.8000 | 2114.0 |
| 333.00 | 1.0000 | 2359.0 |
| 333.00 | 1.2 | 2480.0 |
| 343.00 | 0.0000 | 2670.0 |
| 343.00 | 0.2000 | 2740.0 |
| 343.00 | 0.4000 | 2920.0 |
| 343.00 | 0.6000 | 3010.0 |
| 343.00 | 0.8000 | 3170.0 |
| 343.00 | 1.0000 | 3510.0 |
| 343.00 | 1.2 | 3660.0 |
| 353.00 | 0.0000 | 3733.0 |
| 353.00 | 0.2000 | 3906.0 |
| 353.00 | 0.4000 | 4120.0 |
| 353.00 | 0.6000 | 4400.0 |
| 353.00 | 0.8000 | 4590.0 |
| 353.00 | 1.0000 | 4910.0 |
| 353.00 | 1.2 | 5250.0 |
| 363.00 | 0.0000 | 4960.0 |
| 363.00 | 0.2000 | 5030.0 |
| 363.00 | 0.4000 | 5300.0 |
| 363.00 | 0.6000 | 5640.0 |
| 363.00 | 0.8000 | 5820.0 |
| 363.00 | 1.0000 | 6410.0 |
| 363.00 | 1.2 | 6800.0 |
Molality, mol/kg of 2-Butanone (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Solvent: Molality, mol/kg of sodium chloride (2) - Liquid mixture 1 | Molality, mol/kg of 2-Butanone (1) - Liquid mixture 1 |
| 283.15 | 0.0000 | 4.811 |
| 288.15 | 0.0000 | 4.354 |
| 293.15 | 0.0000 | 3.785 |
| 298.15 | 0.0000 | 3.12 |
| 303.15 | 0.0000 | 2.385 |
| 283.15 | 0.1711 | 4.659 |
| 288.15 | 0.1711 | 3.813 |
| 293.15 | 0.1711 | 3.425 |
| 298.15 | 0.1711 | 2.759 |
| 303.15 | 0.1711 | 2.177 |
| 283.15 | 0.3422 | 3.979 |
| 288.15 | 0.3422 | 3.633 |
| 293.15 | 0.3422 | 3.037 |
| 298.15 | 0.3422 | 2.51 |
| 303.15 | 0.3422 | 2.08 |
| 283.15 | 0.5818 | 3.55 |
| 288.15 | 0.5818 | 3.12 |
| 293.15 | 0.5818 | 2.731 |
| 298.15 | 0.5818 | 2.163 |
| 303.15 | 0.5818 | 1.65 |
Henry's Law constant (mole fraction scale), kPa of 2-Butanone (1) [ref]
Operational condition: Mole fraction = 0 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Solvent: Molality, mol/kg of sodium chloride (2) - Liquid | Henry's Law constant (mole fraction scale), kPa of 2-Butanone (1) - Liquid |
| 313.00 | 0.0000 | 721.0 |
| 313.00 | 0.2000 | 767.0 |
| 313.00 | 0.4000 | 794.0 |
| 313.00 | 0.6000 | 842.0 |
| 313.00 | 0.8000 | 883.0 |
| 313.00 | 1.0000 | 940.0 |
| 313.00 | 1.2 | 1006.0 |
| 323.00 | 0.0000 | 1167.0 |
| 323.00 | 0.2000 | 1301.0 |
| 323.00 | 0.4000 | 1252.0 |
| 323.00 | 0.6000 | 1362.0 |
| 323.00 | 0.8000 | 1436.0 |
| 323.00 | 1.0000 | 1520.0 |
| 323.00 | 1.2 | 1614.0 |
| 333.00 | 0.0000 | 1775.0 |
| 333.00 | 0.2000 | 1982.0 |
| 333.00 | 0.4000 | 1906.0 |
| 333.00 | 0.6000 | 1965.0 |
| 333.00 | 0.8000 | 2114.0 |
| 333.00 | 1.0000 | 2359.0 |
| 333.00 | 1.2 | 2480.0 |
| 343.00 | 0.0000 | 2670.0 |
| 343.00 | 0.2000 | 2740.0 |
| 343.00 | 0.4000 | 2920.0 |
| 343.00 | 0.6000 | 3010.0 |
| 343.00 | 0.8000 | 3170.0 |
| 343.00 | 1.0000 | 3510.0 |
| 343.00 | 1.2 | 3660.0 |
| 353.00 | 0.0000 | 3733.0 |
| 353.00 | 0.2000 | 3906.0 |
| 353.00 | 0.4000 | 4120.0 |
| 353.00 | 0.6000 | 4400.0 |
| 353.00 | 0.8000 | 4590.0 |
| 353.00 | 1.0000 | 4910.0 |
| 353.00 | 1.2 | 5250.0 |
| 363.00 | 0.0000 | 4960.0 |
| 363.00 | 0.2000 | 5030.0 |
| 363.00 | 0.4000 | 5300.0 |
| 363.00 | 0.6000 | 5640.0 |
| 363.00 | 0.8000 | 5820.0 |
| 363.00 | 1.0000 | 6410.0 |
| 363.00 | 1.2 | 6800.0 |