- Name
- Ethanol, 2-butoxy-
- InChI
- InChI=1S/C6H14O2/c1-2-3-5-8-6-4-7/h7H,2-6H2,1H3
- InChI Key
- POAOYUHQDCAZBD-UHFFFAOYSA-N
- Formula
- C6H14O2
- SMILES
- CCCCOCCO
- Mol. Weight (g/mol)
- 118.17
- CAS
- 111-76-2
- Name
- D-Leucine
- InChI
- InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1
- InChI Key
- ROHFNLRQFUQHCH-YFKPBYRVSA-N
- Formula
- C6H13NO2
- SMILES
- CC(C)CC(N)C(=O)O
- Mol. Weight (g/mol)
- 131.17
- CAS
- 328-38-1
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Mass fraction = 0.05 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Amount concentration (molarity), mol/dm3 of Ethanol, 2-butoxy- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 283.15 | 0.0000 | 998.344 |
| 283.15 | 0.0098 | 998.6 |
| 283.15 | 0.0246 | 998.986 |
| 283.15 | 0.0394 | 999.37 |
| 283.15 | 0.0738 | 1000.256 |
| 283.15 | 0.0984 | 1000.884 |
| 283.15 | 0.1181 | 1001.384 |
| 293.15 | 0.0000 | 995.517 |
| 293.15 | 0.0098 | 995.769 |
| 293.15 | 0.0246 | 996.148 |
| 293.15 | 0.0394 | 996.525 |
| 293.15 | 0.0738 | 997.394 |
| 293.15 | 0.0984 | 998.01 |
| 293.15 | 0.1181 | 998.498 |
| 303.15 | 0.0000 | 991.663 |
| 303.15 | 0.0098 | 991.907 |
| 303.15 | 0.0246 | 992.275 |
| 303.15 | 0.0394 | 992.64 |
| 303.15 | 0.0738 | 993.482 |
| 303.15 | 0.0984 | 994.078 |
| 303.15 | 0.1181 | 994.551 |
| 313.15 | 0.0000 | 987.019 |
| 313.15 | 0.0098 | 987.258 |
| 313.15 | 0.0246 | 987.618 |
| 313.15 | 0.0394 | 987.976 |
| 313.15 | 0.0738 | 988.799 |
| 313.15 | 0.0984 | 989.382 |
| 313.15 | 0.1181 | 989.844 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Solvent: Mass fraction = 0.05 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Amount concentration (molarity), mol/dm3 of Ethanol, 2-butoxy- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 283.15 | 0.0000 | 998.344 |
| 283.15 | 0.0098 | 998.6 |
| 283.15 | 0.0246 | 998.986 |
| 283.15 | 0.0394 | 999.37 |
| 283.15 | 0.0738 | 1000.256 |
| 283.15 | 0.0984 | 1000.884 |
| 283.15 | 0.1181 | 1001.384 |
| 293.15 | 0.0000 | 995.517 |
| 293.15 | 0.0098 | 995.769 |
| 293.15 | 0.0246 | 996.148 |
| 293.15 | 0.0394 | 996.525 |
| 293.15 | 0.0738 | 997.394 |
| 293.15 | 0.0984 | 998.01 |
| 293.15 | 0.1181 | 998.498 |
| 303.15 | 0.0000 | 991.663 |
| 303.15 | 0.0098 | 991.907 |
| 303.15 | 0.0246 | 992.275 |
| 303.15 | 0.0394 | 992.64 |
| 303.15 | 0.0738 | 993.482 |
| 303.15 | 0.0984 | 994.078 |
| 303.15 | 0.1181 | 994.551 |
| 313.15 | 0.0000 | 987.019 |
| 313.15 | 0.0098 | 987.258 |
| 313.15 | 0.0246 | 987.618 |
| 313.15 | 0.0394 | 987.976 |
| 313.15 | 0.0738 | 988.799 |
| 313.15 | 0.0984 | 989.382 |
| 313.15 | 0.1181 | 989.844 |