- Name
- Choline chloride
- InChI
- InChI=1S/C5H14NO.ClH/c1-6(2,3)4-5-7;/h7H,4-5H2,1-3H3;1H/q+1;/p-1
- InChI Key
- SGMZJAMFUVOLNK-UHFFFAOYSA-M
- Formula
- C5H14ClNO
- SMILES
- C[N+](C)(C)CCO.[Cl-]
- Mol. Weight (g/mol)
- 139.62
- CAS
- 67-48-1
- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
- Name
- Glycerin
- InChI
- InChI=1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2
- InChI Key
- PEDCQBHIVMGVHV-UHFFFAOYSA-N
- Formula
- C3H8O3
- SMILES
- OCC(O)CO
- Mol. Weight (g/mol)
- 92.09
- CAS
- 56-81-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Molality, mol/kg of Carbon dioxide (2) [ref]
Operational condition: Solvent: Mole fraction = 0.333 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Gas | Pressure, kPa - Gas | Molality, mol/kg of Carbon dioxide (2) - Gas |
| 303.15 | 187.00 | 0.1449 |
| 303.15 | 616.00 | 0.4678 |
| 303.15 | 1222.00 | 0.9037 |
| 303.15 | 1995.00 | 1.4308 |
| 303.15 | 2976.00 | 2.0893 |
| 303.15 | 3977.00 | 2.7619 |
| 303.15 | 4963.00 | 3.2909 |
| 303.15 | 5863.00 | 3.6929 |
| 313.15 | 191.00 | 0.1103 |
| 313.15 | 622.00 | 0.3614 |
| 313.15 | 1239.00 | 0.7149 |
| 313.15 | 2012.00 | 1.1604 |
| 313.15 | 2978.00 | 1.6209 |
| 313.15 | 4002.00 | 2.198 |
| 313.15 | 5040.00 | 2.7251 |
| 313.15 | 5991.00 | 3.0718 |
| 323.15 | 196.00 | 0.0888 |
| 323.15 | 626.00 | 0.2778 |
| 323.15 | 1271.00 | 0.5560 |
| 323.15 | 2071.00 | 0.9068 |
| 323.15 | 3018.00 | 1.3235 |
| 323.15 | 4034.00 | 1.7528 |
| 323.15 | 5151.00 | 2.2747 |
| 323.15 | 6170.00 | 2.6508 |
| 333.15 | 201.00 | 0.0717 |
| 333.15 | 636.00 | 0.2143 |
| 333.15 | 1307.00 | 0.4443 |
| 333.15 | 2131.00 | 0.7249 |
| 333.15 | 3102.00 | 1.0545 |
| 333.15 | 4070.00 | 1.3811 |
| 333.15 | 5286.00 | 1.7926 |
| 333.15 | 6265.00 | 2.1243 |
| 343.15 | 203.00 | 0.0538 |
| 343.15 | 649.00 | 0.1721 |
| 343.15 | 1338.00 | 0.3605 |
| 343.15 | 2171.00 | 0.5765 |
| 343.15 | 3164.00 | 0.8314 |
| 343.15 | 4197.00 | 1.0946 |
| 343.15 | 5308.00 | 1.3721 |
| 343.15 | 6347.00 | 1.601 |
Molality, mol/kg of Carbon dioxide (2) [ref]
Operational condition: Solvent: Mole fraction = 0.333 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Gas | Pressure, kPa - Gas | Molality, mol/kg of Carbon dioxide (2) - Gas |
| 303.15 | 187.00 | 0.1449 |
| 303.15 | 616.00 | 0.4678 |
| 303.15 | 1222.00 | 0.9037 |
| 303.15 | 1995.00 | 1.4308 |
| 303.15 | 2976.00 | 2.0893 |
| 303.15 | 3977.00 | 2.7619 |
| 303.15 | 4963.00 | 3.2909 |
| 303.15 | 5863.00 | 3.6929 |
| 313.15 | 191.00 | 0.1103 |
| 313.15 | 622.00 | 0.3614 |
| 313.15 | 1239.00 | 0.7149 |
| 313.15 | 2012.00 | 1.1604 |
| 313.15 | 2978.00 | 1.6209 |
| 313.15 | 4002.00 | 2.198 |
| 313.15 | 5040.00 | 2.7251 |
| 313.15 | 5991.00 | 3.0718 |
| 323.15 | 196.00 | 0.0888 |
| 323.15 | 626.00 | 0.2778 |
| 323.15 | 1271.00 | 0.5560 |
| 323.15 | 2071.00 | 0.9068 |
| 323.15 | 3018.00 | 1.3235 |
| 323.15 | 4034.00 | 1.7528 |
| 323.15 | 5151.00 | 2.2747 |
| 323.15 | 6170.00 | 2.6508 |
| 333.15 | 201.00 | 0.0717 |
| 333.15 | 636.00 | 0.2143 |
| 333.15 | 1307.00 | 0.4443 |
| 333.15 | 2131.00 | 0.7249 |
| 333.15 | 3102.00 | 1.0545 |
| 333.15 | 4070.00 | 1.3811 |
| 333.15 | 5286.00 | 1.7926 |
| 333.15 | 6265.00 | 2.1243 |
| 343.15 | 203.00 | 0.0538 |
| 343.15 | 649.00 | 0.1721 |
| 343.15 | 1338.00 | 0.3605 |
| 343.15 | 2171.00 | 0.5765 |
| 343.15 | 3164.00 | 0.8314 |
| 343.15 | 4197.00 | 1.0946 |
| 343.15 | 5308.00 | 1.3721 |
| 343.15 | 6347.00 | 1.601 |