- Name
- Benzoic acid
- InChI
- InChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)
- InChI Key
- WPYMKLBDIGXBTP-UHFFFAOYSA-N
- Formula
- C7H6O2
- SMILES
- O=C(O)c1ccccc1
- Mol. Weight (g/mol)
- 122.12
- CAS
- 65-85-0
- Name
- Benzaldehyde
- InChI
- InChI=1S/C7H6O/c8-6-7-4-2-1-3-5-7/h1-6H
- InChI Key
- HUMNYLRZRPPJDN-UHFFFAOYSA-N
- Formula
- C7H6O
- SMILES
- O=Cc1ccccc1
- Mol. Weight (g/mol)
- 106.12
- CAS
- 100-52-7
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass ratio of solute to solvent of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mass ratio of solute to solvent of Benzoic acid (1) - Liquid |
|---|---|
| 307.45 | 0.0564 |
| 310.95 | 0.0739 |
| 315.05 | 0.0999 |
| 319.35 | 0.1321 |
| 322.95 | 0.1709 |
| 327.05 | 0.2195 |
| 331.65 | 0.2763 |
| 334.95 | 0.3397 |
| 339.55 | 0.4127 |
| 343.35 | 0.4916 |
| 347.35 | 0.5791 |
| 350.55 | 0.6741 |
Mass ratio of solute to solvent of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mass ratio of solute to solvent of Benzoic acid (1) - Liquid |
|---|---|
| 307.45 | 0.0564 |
| 310.95 | 0.0739 |
| 315.05 | 0.0999 |
| 319.35 | 0.1321 |
| 322.95 | 0.1709 |
| 327.05 | 0.2195 |
| 331.65 | 0.2763 |
| 334.95 | 0.3397 |
| 339.55 | 0.4127 |
| 343.35 | 0.4916 |
| 347.35 | 0.5791 |
| 350.55 | 0.6741 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mass ratio of solute to solvent of Benzoic acid (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0564 | 304.45 |
| 0.0742 | 308.95 |
| 0.1002 | 313.75 |
| 0.1334 | 318.95 |
| 0.1728 | 323.25 |
| 0.2235 | 329.05 |
| 0.2813 | 332.85 |
| 0.3460 | 336.55 |
| 0.4191 | 340.65 |
| 0.4980 | 344.35 |
| 0.5855 | 347.45 |
| 0.6805 | 350.55 |
| 0.7854 | 353.35 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mass ratio of solute to solvent of Benzoic acid (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0564 | 304.45 |
| 0.0742 | 308.95 |
| 0.1002 | 313.75 |
| 0.1334 | 318.95 |
| 0.1728 | 323.25 |
| 0.2235 | 329.05 |
| 0.2813 | 332.85 |
| 0.3460 | 336.55 |
| 0.4191 | 340.65 |
| 0.4980 | 344.35 |
| 0.5855 | 347.45 |
| 0.6805 | 350.55 |
| 0.7854 | 353.35 |