- Name
- Acetic acid, hydroxy-
- InChI
- InChI=1S/C2H4O3/c3-1-2(4)5/h3H,1H2,(H,4,5)
- InChI Key
- AEMRFAOFKBGASW-UHFFFAOYSA-N
- Formula
- C2H4O3
- SMILES
- O=C(O)CO
- Mol. Weight (g/mol)
- 76.05
- CAS
- 79-14-1
- Name
- Choline chloride
- InChI
- InChI=1S/C5H14NO.ClH/c1-6(2,3)4-5-7;/h7H,4-5H2,1-3H3;1H/q+1;/p-1
- InChI Key
- SGMZJAMFUVOLNK-UHFFFAOYSA-M
- Formula
- C5H14ClNO
- SMILES
- C[N+](C)(C)CCO.[Cl-]
- Mol. Weight (g/mol)
- 139.62
- CAS
- 67-48-1
- Name
- Isopropyl Alcohol
- InChI
- InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3
- InChI Key
- KFZMGEQAYNKOFK-UHFFFAOYSA-N
- Formula
- C3H8O
- SMILES
- CC(C)O
- Mol. Weight (g/mol)
- 60.09
- CAS
- 67-63-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Boiling temperature at pressure P, K [ref]
Operational condition: Solvent: Mole fraction = 0.25 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Isopropyl Alcohol (3) - Liquid | Pressure, kPa - Liquid | Boiling temperature at pressure P, K - Liquid |
| 0.9500 | 10.00 | 307.20 |
| 0.9500 | 15.00 | 314.40 |
| 0.9500 | 20.00 | 319.90 |
| 0.9500 | 25.00 | 324.20 |
| 0.9500 | 30.00 | 327.80 |
| 0.9500 | 40.00 | 333.80 |
| 0.9500 | 50.00 | 338.70 |
| 0.9500 | 60.00 | 342.80 |
| 0.9500 | 70.00 | 346.30 |
| 0.9500 | 80.00 | 349.50 |
| 0.9500 | 89.90 | 352.30 |
| 0.9500 | 101.20 | 355.30 |
| 0.9000 | 10.00 | 306.80 |
| 0.9000 | 15.00 | 314.00 |
| 0.9000 | 20.00 | 318.90 |
| 0.9000 | 30.00 | 326.80 |
| 0.9000 | 40.00 | 332.30 |
| 0.9000 | 50.00 | 337.60 |
| 0.9000 | 60.00 | 341.80 |
| 0.9000 | 69.90 | 345.50 |
| 0.9000 | 80.00 | 348.60 |
| 0.9000 | 90.00 | 351.40 |
| 0.9000 | 101.30 | 354.30 |
| 0.9500 | 100.00 | 355.20 |
| 0.9000 | 100.00 | 354.30 |
Boiling temperature at pressure P, K [ref]
Operational condition: Solvent: Mole fraction = 0.25 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Isopropyl Alcohol (3) - Liquid | Pressure, kPa - Liquid | Boiling temperature at pressure P, K - Liquid |
| 0.9500 | 10.00 | 307.20 |
| 0.9500 | 15.00 | 314.40 |
| 0.9500 | 20.00 | 319.90 |
| 0.9500 | 25.00 | 324.20 |
| 0.9500 | 30.00 | 327.80 |
| 0.9500 | 40.00 | 333.80 |
| 0.9500 | 50.00 | 338.70 |
| 0.9500 | 60.00 | 342.80 |
| 0.9500 | 70.00 | 346.30 |
| 0.9500 | 80.00 | 349.50 |
| 0.9500 | 89.90 | 352.30 |
| 0.9500 | 101.20 | 355.30 |
| 0.9000 | 10.00 | 306.80 |
| 0.9000 | 15.00 | 314.00 |
| 0.9000 | 20.00 | 318.90 |
| 0.9000 | 30.00 | 326.80 |
| 0.9000 | 40.00 | 332.30 |
| 0.9000 | 50.00 | 337.60 |
| 0.9000 | 60.00 | 341.80 |
| 0.9000 | 69.90 | 345.50 |
| 0.9000 | 80.00 | 348.60 |
| 0.9000 | 90.00 | 351.40 |
| 0.9000 | 101.30 | 354.30 |
| 0.9500 | 100.00 | 355.20 |
| 0.9000 | 100.00 | 354.30 |