- Name
- Pentanoic acid, 4-oxo-
- InChI
- InChI=1S/C5H8O3/c1-4(6)2-3-5(7)8/h2-3H2,1H3,(H,7,8)
- InChI Key
- JOOXCMJARBKPKM-UHFFFAOYSA-N
- Formula
- C5H8O3
- SMILES
- CC(=O)CCC(=O)O
- Mol. Weight (g/mol)
- 116.12
- CAS
- 123-76-2
- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
- Name
- Tetraethylammonium bromide
- InChI
- InChI=1S/C8H20N.BrH/c1-5-9(6-2,7-3)8-4;/h5-8H2,1-4H3;1H/q+1;/p-1
- InChI Key
- HWCKGOZZJDHMNC-UHFFFAOYSA-M
- Formula
- C8H20BrN
- SMILES
- CC[N+](CC)(CC)CC.[Br-]
- Mol. Weight (g/mol)
- 210.16
- CAS
- 71-91-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Molality, mol/kg of Carbon dioxide (2) [ref]
Operational condition: Solvent: Mole fraction = 0.75 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa of Carbon dioxide (2) - Gas | Molality, mol/kg of Carbon dioxide (2) - Liquid |
| 303.15 | 68.70 | 0.0291 |
| 303.15 | 122.40 | 0.0525 |
| 303.15 | 210.30 | 0.0888 |
| 303.15 | 305.10 | 0.1294 |
| 303.15 | 402.40 | 0.1702 |
| 303.15 | 500.50 | 0.2124 |
| 303.15 | 564.40 | 0.2402 |
| 313.15 | 84.20 | 0.0330 |
| 313.15 | 139.10 | 0.0516 |
| 313.15 | 230.10 | 0.0829 |
| 313.15 | 329.10 | 0.1170 |
| 313.15 | 428.90 | 0.1511 |
| 313.15 | 525.90 | 0.1838 |
| 313.15 | 587.70 | 0.2057 |
| 323.15 | 83.10 | 0.0240 |
| 323.15 | 138.50 | 0.0396 |
| 323.15 | 236.20 | 0.0677 |
| 323.15 | 323.80 | 0.0936 |
| 323.15 | 423.90 | 0.1233 |
| 323.15 | 528.30 | 0.1525 |
| 323.15 | 578.80 | 0.1684 |
| 333.15 | 81.80 | 0.0214 |
| 333.15 | 141.00 | 0.0366 |
| 333.15 | 233.40 | 0.0598 |
| 333.15 | 327.90 | 0.0827 |
| 333.15 | 429.60 | 0.1095 |
| 333.15 | 529.40 | 0.1349 |
| 333.15 | 587.80 | 0.1485 |
Molality, mol/kg of Carbon dioxide (2) [ref]
Operational condition: Solvent: Mole fraction = 0.75 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa of Carbon dioxide (2) - Gas | Molality, mol/kg of Carbon dioxide (2) - Liquid |
| 303.15 | 68.70 | 0.0291 |
| 303.15 | 122.40 | 0.0525 |
| 303.15 | 210.30 | 0.0888 |
| 303.15 | 305.10 | 0.1294 |
| 303.15 | 402.40 | 0.1702 |
| 303.15 | 500.50 | 0.2124 |
| 303.15 | 564.40 | 0.2402 |
| 313.15 | 84.20 | 0.0330 |
| 313.15 | 139.10 | 0.0516 |
| 313.15 | 230.10 | 0.0829 |
| 313.15 | 329.10 | 0.1170 |
| 313.15 | 428.90 | 0.1511 |
| 313.15 | 525.90 | 0.1838 |
| 313.15 | 587.70 | 0.2057 |
| 323.15 | 83.10 | 0.0240 |
| 323.15 | 138.50 | 0.0396 |
| 323.15 | 236.20 | 0.0677 |
| 323.15 | 323.80 | 0.0936 |
| 323.15 | 423.90 | 0.1233 |
| 323.15 | 528.30 | 0.1525 |
| 323.15 | 578.80 | 0.1684 |
| 333.15 | 81.80 | 0.0214 |
| 333.15 | 141.00 | 0.0366 |
| 333.15 | 233.40 | 0.0598 |
| 333.15 | 327.90 | 0.0827 |
| 333.15 | 429.60 | 0.1095 |
| 333.15 | 529.40 | 0.1349 |
| 333.15 | 587.80 | 0.1485 |