- Name
- Tetra-N-butylammonium chloride
- InChI
- InChI=1S/C16H36N.ClH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p-1
- InChI Key
- NHGXDBSUJJNIRV-UHFFFAOYSA-M
- Formula
- C16H36ClN
- SMILES
- CCCC[N+](CCCC)(CCCC)CCCC.[Cl-]
- Mol. Weight (g/mol)
- 277.92
- CAS
- 1112-67-0
- Name
- Pentanoic acid, 4-oxo-
- InChI
- InChI=1S/C5H8O3/c1-4(6)2-3-5(7)8/h2-3H2,1H3,(H,7,8)
- InChI Key
- JOOXCMJARBKPKM-UHFFFAOYSA-N
- Formula
- C5H8O3
- SMILES
- CC(=O)CCC(=O)O
- Mol. Weight (g/mol)
- 116.12
- CAS
- 123-76-2
- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Molality, mol/kg of Carbon dioxide (3) [ref]
Operational condition: Solvent: Mole fraction = 0.75 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa of Carbon dioxide (3) - Gas | Molality, mol/kg of Carbon dioxide (3) - Liquid |
| 303.15 | 63.20 | 0.0339 |
| 303.15 | 118.80 | 0.0640 |
| 303.15 | 200.60 | 0.1059 |
| 303.15 | 293.00 | 0.1571 |
| 303.15 | 389.80 | 0.2098 |
| 303.15 | 494.30 | 0.2671 |
| 303.15 | 559.10 | 0.3027 |
| 313.15 | 69.70 | 0.0380 |
| 313.15 | 127.30 | 0.0648 |
| 313.15 | 210.90 | 0.1011 |
| 313.15 | 310.00 | 0.1435 |
| 313.15 | 409.10 | 0.1895 |
| 313.15 | 509.60 | 0.2349 |
| 313.15 | 578.60 | 0.2682 |
| 323.15 | 79.10 | 0.0294 |
| 323.15 | 131.60 | 0.0479 |
| 323.15 | 229.60 | 0.0839 |
| 323.15 | 323.40 | 0.1200 |
| 323.15 | 424.20 | 0.1578 |
| 323.15 | 524.40 | 0.1955 |
| 323.15 | 591.60 | 0.2210 |
| 333.15 | 85.00 | 0.0255 |
| 333.15 | 144.50 | 0.0442 |
| 333.15 | 236.50 | 0.0726 |
| 333.15 | 335.50 | 0.1024 |
| 333.15 | 431.70 | 0.1328 |
| 333.15 | 533.00 | 0.1676 |
| 333.15 | 589.80 | 0.1859 |
Molality, mol/kg of Carbon dioxide (3) [ref]
Operational condition: Solvent: Mole fraction = 0.75 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa of Carbon dioxide (3) - Gas | Molality, mol/kg of Carbon dioxide (3) - Liquid |
| 303.15 | 63.20 | 0.0339 |
| 303.15 | 118.80 | 0.0640 |
| 303.15 | 200.60 | 0.1059 |
| 303.15 | 293.00 | 0.1571 |
| 303.15 | 389.80 | 0.2098 |
| 303.15 | 494.30 | 0.2671 |
| 303.15 | 559.10 | 0.3027 |
| 313.15 | 69.70 | 0.0380 |
| 313.15 | 127.30 | 0.0648 |
| 313.15 | 210.90 | 0.1011 |
| 313.15 | 310.00 | 0.1435 |
| 313.15 | 409.10 | 0.1895 |
| 313.15 | 509.60 | 0.2349 |
| 313.15 | 578.60 | 0.2682 |
| 323.15 | 79.10 | 0.0294 |
| 323.15 | 131.60 | 0.0479 |
| 323.15 | 229.60 | 0.0839 |
| 323.15 | 323.40 | 0.1200 |
| 323.15 | 424.20 | 0.1578 |
| 323.15 | 524.40 | 0.1955 |
| 323.15 | 591.60 | 0.2210 |
| 333.15 | 85.00 | 0.0255 |
| 333.15 | 144.50 | 0.0442 |
| 333.15 | 236.50 | 0.0726 |
| 333.15 | 335.50 | 0.1024 |
| 333.15 | 431.70 | 0.1328 |
| 333.15 | 533.00 | 0.1676 |
| 333.15 | 589.80 | 0.1859 |