- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
- Name
- 1-Nitroanthraquinone
- InChI
- InChI=1S/C14H7NO4/c16-13-8-4-1-2-5-9(8)14(17)12-10(13)6-3-7-11(12)15(18)19/h1-7H
- InChI Key
- YCANAXVBJKNANM-UHFFFAOYSA-N
- Formula
- C14H7NO4
- SMILES
-
O=C1c2ccccc2C(=O)c2c1cccc2[N+]
(=O)[O-] - Mol. Weight (g/mol)
- 253.21
- CAS
- 82-34-8
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of 1-Nitroanthraquinone (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of 1-Nitroanthraquinone (2) - Fluid (supercritical or subcritical phases) |
| 323.15 | 12500.00 | 3.0900e-06 |
| 323.15 | 15000.00 | 4.6600e-06 |
| 323.15 | 17500.00 | 5.9900e-06 |
| 323.15 | 20000.00 | 6.9900e-06 |
| 323.15 | 22500.00 | 8.8400e-06 |
| 323.15 | 25000.00 | 0.0000 |
| 353.15 | 12500.00 | 9.8000e-07 |
| 353.15 | 15000.00 | 2.0300e-06 |
| 353.15 | 17500.00 | 4.2600e-06 |
| 353.15 | 20000.00 | 6.8300e-06 |
| 353.15 | 22500.00 | 0.0000 |
| 353.15 | 25000.00 | 0.0000 |
| 383.15 | 12500.00 | 1.5500e-06 |
| 383.15 | 15000.00 | 2.6900e-06 |
| 383.15 | 17500.00 | 5.1100e-06 |
| 383.15 | 20000.00 | 0.0000 |
| 383.15 | 22500.00 | 0.0000 |
| 383.15 | 25000.00 | 0.0000 |
Mole fraction of 1-Nitroanthraquinone (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of 1-Nitroanthraquinone (2) - Fluid (supercritical or subcritical phases) |
| 323.15 | 12500.00 | 3.0900e-06 |
| 323.15 | 15000.00 | 4.6600e-06 |
| 323.15 | 17500.00 | 5.9900e-06 |
| 323.15 | 20000.00 | 6.9900e-06 |
| 323.15 | 22500.00 | 8.8400e-06 |
| 323.15 | 25000.00 | 0.0000 |
| 353.15 | 12500.00 | 9.8000e-07 |
| 353.15 | 15000.00 | 2.0300e-06 |
| 353.15 | 17500.00 | 4.2600e-06 |
| 353.15 | 20000.00 | 6.8300e-06 |
| 353.15 | 22500.00 | 0.0000 |
| 353.15 | 25000.00 | 0.0000 |
| 383.15 | 12500.00 | 1.5500e-06 |
| 383.15 | 15000.00 | 2.6900e-06 |
| 383.15 | 17500.00 | 5.1100e-06 |
| 383.15 | 20000.00 | 0.0000 |
| 383.15 | 22500.00 | 0.0000 |
| 383.15 | 25000.00 | 0.0000 |