- Name
- Acetonitrile
- InChI
- InChI=1S/C2H3N/c1-2-3/h1H3
- InChI Key
- WEVYAHXRMPXWCK-UHFFFAOYSA-N
- Formula
- C2H3N
- SMILES
- CC#N
- Mol. Weight (g/mol)
- 41.05
- CAS
- 75-05-8
- Name
- 2-Mercaptobenzothiazole
- InChI
- InChI=1S/C7H5NS2/c9-7-8-5-3-1-2-4-6(5)10-7/h1-4H,(H,8,9)
- InChI Key
- YXIWHUQXZSMYRE-UHFFFAOYSA-N
- Formula
- C7H5NS2
- SMILES
- Sc1nc2ccccc2s1
- Mol. Weight (g/mol)
- 167.25
- CAS
- 149-30-4
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of 2-Mercaptobenzothiazole (2) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Temperature, K - Liquid | Mole fraction of 2-Mercaptobenzothiazole (2) - Liquid |
|---|---|
| 273.15 | 0.0043 |
| 275.65 | 0.0047 |
| 278.15 | 0.0051 |
| 280.65 | 0.0055 |
| 283.15 | 0.0060 |
| 285.65 | 0.0065 |
| 288.15 | 0.0070 |
| 290.65 | 0.0076 |
| 293.15 | 0.0082 |
| 295.65 | 0.0088 |
| 298.15 | 0.0096 |
| 300.65 | 0.0102 |
| 303.15 | 0.0110 |
| 305.65 | 0.0118 |
| 308.15 | 0.0127 |
| 310.65 | 0.0137 |
| 313.15 | 0.0146 |
| 315.65 | 0.0155 |
| 318.15 | 0.0167 |
Mole fraction of 2-Mercaptobenzothiazole (2) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Temperature, K - Liquid | Mole fraction of 2-Mercaptobenzothiazole (2) - Liquid |
|---|---|
| 273.15 | 0.0043 |
| 275.65 | 0.0047 |
| 278.15 | 0.0051 |
| 280.65 | 0.0055 |
| 283.15 | 0.0060 |
| 285.65 | 0.0065 |
| 288.15 | 0.0070 |
| 290.65 | 0.0076 |
| 293.15 | 0.0082 |
| 295.65 | 0.0088 |
| 298.15 | 0.0096 |
| 300.65 | 0.0102 |
| 303.15 | 0.0110 |
| 305.65 | 0.0118 |
| 308.15 | 0.0127 |
| 310.65 | 0.0137 |
| 313.15 | 0.0146 |
| 315.65 | 0.0155 |
| 318.15 | 0.0167 |