- Name
- 2-Mercaptobenzothiazole
- InChI
- InChI=1S/C7H5NS2/c9-7-8-5-3-1-2-4-6(5)10-7/h1-4H,(H,8,9)
- InChI Key
- YXIWHUQXZSMYRE-UHFFFAOYSA-N
- Formula
- C7H5NS2
- SMILES
- Sc1nc2ccccc2s1
- Mol. Weight (g/mol)
- 167.25
- CAS
- 149-30-4
- Name
- Ethyl Acetate
- InChI
- InChI=1S/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3
- InChI Key
- XEKOWRVHYACXOJ-UHFFFAOYSA-N
- Formula
- C4H8O2
- SMILES
- CCOC(C)=O
- Mol. Weight (g/mol)
- 88.11
- CAS
- 141-78-6
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of 2-Mercaptobenzothiazole (1) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Temperature, K - Liquid | Mole fraction of 2-Mercaptobenzothiazole (1) - Liquid |
|---|---|
| 273.15 | 0.0274 |
| 275.65 | 0.0286 |
| 278.15 | 0.0297 |
| 280.65 | 0.0309 |
| 283.15 | 0.0323 |
| 285.65 | 0.0336 |
| 288.15 | 0.0348 |
| 290.65 | 0.0361 |
| 293.15 | 0.0374 |
| 295.65 | 0.0389 |
| 298.15 | 0.0403 |
| 300.65 | 0.0419 |
| 303.15 | 0.0434 |
| 305.65 | 0.0448 |
| 308.15 | 0.0465 |
| 310.65 | 0.0482 |
| 313.15 | 0.0499 |
| 315.65 | 0.0513 |
| 318.15 | 0.0532 |
Mole fraction of 2-Mercaptobenzothiazole (1) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Temperature, K - Liquid | Mole fraction of 2-Mercaptobenzothiazole (1) - Liquid |
|---|---|
| 273.15 | 0.0274 |
| 275.65 | 0.0286 |
| 278.15 | 0.0297 |
| 280.65 | 0.0309 |
| 283.15 | 0.0323 |
| 285.65 | 0.0336 |
| 288.15 | 0.0348 |
| 290.65 | 0.0361 |
| 293.15 | 0.0374 |
| 295.65 | 0.0389 |
| 298.15 | 0.0403 |
| 300.65 | 0.0419 |
| 303.15 | 0.0434 |
| 305.65 | 0.0448 |
| 308.15 | 0.0465 |
| 310.65 | 0.0482 |
| 313.15 | 0.0499 |
| 315.65 | 0.0513 |
| 318.15 | 0.0532 |